Squashed 'third_party/nixpkgs/' changes from 23e89b7da85c..d0797a04b81c
d0797a04b81c jq-lsp: 0.1.4 -> 0.1.9 (#362009) 95c18ad139ab materialize: fix on darwin + various improvements (#361500) 59e0687dfe83 hyprlauncher: 0.2.2 -> 0.2.7 (#360940) 26de4d48a61b msgraph-cli: init a 1.9.0 (#314619) 28aad698f32c nodePackages.insect: drop (#361287) 99cdff3ff691 cargo-sort: revert to 1.0.9 (from 1.1.0) (#361624) b0302a578d50 angular-language-server: 18.2.0 -> 19.0.3 (#360805) d532c25ad274 jay: remove `/usr` prefix from installed files (#361928) 897a55c324ae hyprlauncher: 0.2.2 -> 0.2.7 57efa159d816 jq-lsp: 0.1.4 -> 0.1.9 c87fec8a4f94 nodePackages.insect: drop 47b5e2e54c47 urh: 2.9.6 -> 2.9.8; install desktop file (#357930) d53fb123cded nodePackages.webpack-cli: drop; webpack-cli: init at 5.1.4 (#361616) 69c07a15906d treewide: adopt/co-maintain some packages (#355700) a7564f0a210e spot: 0.4.1 -> 0.5.0 (#361676) 902c823aa294 rustfinity: init at 0.2.13 (#360239) 302d3d791cb6 nixos/unl0kr: add a `package` option (#361865) fb86ba65c72e zydis: propagate zycore dependency (#348099) 742fc1bf919b zed-editor: 0.163.3 -> 0.164.2 (#361929) f85d75627e39 traccar: init at 6.5 (#354732) 54f3a0cc7ff7 tiddit: init at 3.6.1 (#312995) 833953e74105 tiny-cuda-nn: fix a couple of build issues (#359664) 8436552a2be5 typstyle: 0.12.6 -> 0.12.7 (#361917) 9bd047ed25e4 php82Packages.phing: 3.0.0 -> 3.0.1 (#361941) e1ad70fd4b76 nodePackages.meshcommander: drop (#361294) 5f9f57a3eeb2 zapret: 67 -> 69.5 (#361681) 13c5025b170a plasticity: 24.2.4 -> 24.2.6 (#357411) 4cbe7614cc8f nodePackages.stackdriver-statsd-backend: drop (#361304) 07dc9fe48bb8 trufflehog: 3.84.1 -> 3.84.2 (#361777) e606b0fca612 trivy: 0.57.1 -> 0.58.0 (#361775) ac4c14ba5023 python312Packages.mypy-boto3-*: updates (#361771) 2b20c9cb537d python312Packages.git-filter-repo: 2.45.0 -> 2.47.0 (#361770) bd9ff2cb051b python312Packages.tesla-fleet-api: 0.8.4 -> 0.8.5 (#361957) a772498086ea obs-studio-plugins.obs-ndi: fix deprecation errors (#361864) 929116e31606 expr: update repository owner (#361963) 6157749ca6f2 bitbox: init at 4.46.3 (#267064) 1d0e98f2f997 ndcurves: init at 1.4.1 (#347703) 8d02c5670fe0 dotnet: improve buildDotnetGlobalTool (#361464) c434c9198d11 expr: update repository owner 9a78c7a9ee05 peertube: Document current lack of darwin support in meta (#361492) 774f4235ccff digikam: add conditional cmake flag for cudaSupport (#356596) ef4cc9cc7825 ironbar: 0.16.0 -> 0.16.1 (#361476) e23bacc84412 nexttrace: build with go 1.22 to fix darwin build (#352581) 49c1d7a3df02 python312Packages.tesla-fleet-api: 0.8.4 -> 0.8.5 7e3022163e2a mainsail: 2.12.0 -> 2.13.0 (#361933) fbafd4f6751c handheld-daemon-ui: 3.2.3 -> 3.3.0 (#361609) 0b6cd9d50849 python312Packages.grad-cam: 1.5.3 -> 1.5.4 (#361497) f7cd26554941 python312Packages.streamdeck: 0.9.5 -> 0.9.6 (#361569) e05e6c3fcd63 lms: 3.60.0 -> 3.61.0 (#360624) c78ef18e9c2a rosa: 1.2.46 -> 1.2.48 (#359440) b800933dced9 python312Packages.toggl-cli: 2.4.4 -> 3.0.2 (#361814) 5cc92d98c7b7 koboldcpp: 1.78 -> 1.79.1 (#361463) f3874d9c40b2 sslscan: 2.1.5 -> 2.1.6 (#361926) c9b86e5cdfcc blendfarm: update to net8, apply upstream fixes (#359357) a0f7ed7d6512 wgsl-analyzer: init at 0.8.1 (#361578) 140a1efbe3fa upscaler: 1.4.0 -> 1.4.1 (#361670) cf68d0d3a5b8 prometheus-libvirt-exporter: init at 2.3.3 and add the prometheus module (#283985) 46dcfefc46ed photoqt: 4.6 -> 4.7 (#361171) 731d106d2dc8 utm: 4.5.4 -> 4.6.2 (#361170) ad884b3b0232 php82Packages.phing: 3.0.0 -> 3.0.1 7cd591618e08 stm32cubemx: Pass arguments to Java jar (#361745) c90c3ba41f59 xeus-cling: use locally available logos to remove fragile wikimedia dep (#361730) e0cde54d9227 python312Packages.blis: 1.0.1 -> 1.0.2 (#361924) 69f9ca4bc010 enkei: init at 0.9.3 (#233095) 8e4cf35970d6 nodePackages.ganache: drop (#361285) 6f8001faa372 mainsail: 2.12.0 -> 2.13.0 64131d53638f zed-editor: 0.163.3 -> 0.164.2 f262c160d2d3 libdeltachat: 1.151.2 -> 1.151.4 (#361551) bfab36ca339c bitwarden-cli: 2024.11.0 -> 2024.11.1 (#360659) 63721dc5cf4d jay: remove `/usr` prefix from installed files fafd0c1fb285 sslscan: 2.1.5 -> 2.1.6 a2d8aeae5a80 python312Packages.types-aiobotocore: 2.15.2 -> 2.15.2.post3 (#361801) 9854b54a19e2 tgt: 1.0.93 -> 1.0.94 (#361810) f20506e35a24 hck: 0.10.1 -> 0.11.0 (#361869) 3efe7fea4e13 python312Packages.reproject: 0.14.0 -> 0.14.1 (#361873) a173356b3c76 highfive-mpi: 2.10.0 -> 2.10.1 (#361885) f2f1fd10b944 python312Packages.pyathena: 3.9.0 -> 3.10.0 (#361896) 5afac31ed606 kuttl: 0.19.0 -> 0.20.0 (#361906) 50b84071ccee kdePackages.qtutilities: 6.14.3 -> 6.14.4 (#361911) b5ef4ed35c56 python312Packages.blis: 1.0.1 -> 1.0.2 ee0f7a0458cc forgejo.updateScript: fix the regex escape (#361871) c378f493f381 terraform: 1.10.0 -> 1.10.1 895a4c771462 otb: 9.0.0 -> 9.1.0 (#361648) 61edc1b4e370 typstyle: 0.12.6 -> 0.12.7 b50c35ad798c git-lfs: fix build on darwin (#361797) 017d36cb17ff materialize: add nix-update-script fcf5d17df5f5 materialize: add versionCheckHook 560b52ac96c8 materialize: drop useless libclang 85bd7b3bce73 materialize: fix build on darwin 17358c6418d3 materialize: switch to fetchCargoVendor c5184c7481b9 materialize: clean 0809ab66023a materialize: move to by-name 162733d9a274 materialize: format d203c28b8ada neovim-node-client: minor fixes (#361905) 20486ea5b866 ripasso-cursive: cosmetic changes (#361736) 6541fe7311f3 nixos/installer: Allow setting a password on cmdline for pxe boot (#358722) bf3c05abb19a kdePackages.qtutilities: 6.14.3 -> 6.14.4 f3be6634ab1c neovim-node-client: minor fixes a8f2acee56f2 kuttl: 0.19.0 -> 0.20.0 34ac189bedc9 treewide: expose pname and version in some more packages (#361250) c40884ebadbe matrix-alertmanager: 0.7.2 -> 0.8.0 (#356211) 67a56f27f2ac doc/build-helpers/testers: Fix command renamed to script (#352713) 140ab9e66d38 python312Packages.pyathena: 3.9.0 -> 3.10.0 685845f024b0 python312Packages.comicon: 1.2.0 -> 1.2.1 (#361860) 7690facc5b91 nixfmt-rfc-style: 2024-11-26 -> 2024-12-04 (#361875) 9ac06f06a66d gnomeExtensions.argos: Update to more recent revision for GNOME 47 (#360723) 628a575fdaed warp-terminal: 0.2024.11.19.08.02.stable_01 -> 0.2024.11.19.08.02.stable_03 (#359940) 77d3b11d0da7 canon-cups-ufr2: fix color printing issues (#332213) 6993346aba04 cyme: 1.8.4 -> 1.8.5 (#356234) f1e22e5f42c5 anki-bin: 24.06.3 -> 24.11 (#360722) f85c510c8782 python311Packages.fslpy: init at 3.21.0 (#329952) b3052439dcbd nb: 7.14.4 -> 7.14.6 (#356336) ccf9d87fe681 nixos/cinnamon: Switch notExcluded to disablePackageByName 162f4339ef33 nixos/gnome: Switch notExcluded to disablePackageByName c4ed78b5a097 nixos/pantheon: Switch notExcluded to disablePackageByName e221971ee79c nixos/budgie: Switch notExcluded to disablePackageByName 8fe87559a904 nixos/lib: Add disablePackageByName 909473552e52 wpaperd: 1.0.1 -> 1.1.1 (#361478) c1cdedbf69c5 prometheus-nats-exporter: add updateScript and testVersion (#336946) dcf8bcf0b5c8 nixos/espanso: remove unused wayland option (#339541) cb3de3579d9b nixfmt-rfc-style: 2024-11-26 -> 2024-12-04 cdb52454aad5 benzene: init at 0-unstable-2022-12-18 (#341090) 9018c7b154ab google-chat-linux: init at 5.29.23-1 (#346729) 6db3c2f63358 forgejo.updateScript: fix the regex escape cc5d4970cf07 {sogo,sope}: 5.11.0 -> 5.11.2 (#349490) c6da44da083a python312Packages.torchsnapshot: skip failing test and enable on python 3.12 (#361813) 0d7ab66420cd gopass: 1.15.14 -> 1.15.15 with added updateScript (#360950) b9829aec83ea highfive-mpi: 2.10.0 -> 2.10.1 3a8de63ff58c unnamed-sdvx-clone: init at 0.6.0 (#345325) 35b5046fd6c8 .github/ISSUE_TEMPLATE: Add an issue template for tracking (#316129) eacb516f052a python312Packages.osmnx: 1.9.3 → 2.0.0 (#360529) 05130d5666f8 hck: 0.10.1 -> 0.11.0 20d4eb3bc605 python312Packages.reproject: 0.14.0 -> 0.14.1 1330ae4275a0 appimageTools: add libmpg123 to the environment (#347824) 50422cdcc3f4 lazygit: use go1.22 (#361125) 3081a84e634b python3Packages.pynput: 1.7.6 → 1.7.7 (#324879) 4ce3d6e4a503 detect-it-easy: add aarch64-linux (#361857) 0b7ca90aa9f8 python3Packages.pynput: 1.7.6 → 1.7.7 13594e1d9c91 python312Packages.notobuilder: 0-unstable-2024-08-03 -> 0-unstable-2024-09-25 (#361608) 1538a54cb06a obs-studio-plugins.obs-ndi: fix deprecation errors 971dce8f77f8 mollysocket: 1.5.3 -> 1.5.4 (#361610) 52643c64cdce nixos/unl0kr: add a `package` option c561fb91a7c6 detect-it-easy: add aarch64-linux 4bdc7d1d4503 doc: lib.types.attrsWith init documentation (#361358) 093a8945a9cd python312Packages.comicon: 1.2.0 -> 1.2.1 5adee31c1187 lib/types: init {types.attrsWith} (#361391) 02484b3d4d93 python312Packages.dbt-bigquery: 1.8.2 -> 1.8.3 (#360438) 3b28974728e2 python3Packages.django_5: 5.1.3 -> 5.1.4 (#361835) fab3778dd1e8 workflows/check-nix-format: Improve error message (#337577) 6eac218f2d3d Count hard links separately when sizing virtual disks (#330055) 93ef5416570a ci: init get-merge-commit workflow (#361494) 52b4f50573c5 nixos/zeronet: fix settings option (#128976) 874d76b78b19 vimPlugins.tiny-devicons-auto-colors-nvim: init at 2024-08-23 (#360919) 52acf63da445 ci/nixpkgs-vet: use the get-merge-commit workflow 5ddb63fe13c2 ci/eval: use the get-merge-commit workflow b5a6aeb5df0e ci: init get-merge-commit workflow dfc9f7232969 nixos/transmission: improvements (#350085) 8254cef69de8 python310Packages.onlykey-solo-python: fix compatibility with fido2 1.1.3 (#354382) ca5f6df0c2c2 nixos/pam: replace apparmor warnings with assertions (#332119) b188947db956 mixxx: fix source hash (#361718) 1f3f155e96f3 nixos/exwm: fix services.xserver.windowManager.exwm.enable option (#361714) 2a2e1d2a2bf3 nixos-facter: 0.2.0 -> 0.3.0 (#361564) be7d22f6be72 supergfxctl-plasmoid: 2.0.0 -> 2.1.1 (#361664) c82bf9527438 nixos/exwm: remove option enableDefaultConfig 5185052ee02d nixos/aesmd: fix incorrect `mkRemovedOptionModule` option path (#361812) d637b85e2589 treewide: replace `--enable-wayland-ime` with `--enable-wayland-ime=true` for the arguments to properly work (#361341) 00bcf5cb4573 python3Packages.django_5: 5.1.3 -> 5.1.4 f1a18363305d python3Packages.pywikibot: init at 9.5.0 (#333068) bc56516e889c sane-airscan: 0.99.29 -> 0.99.30 (#361188) f86653579079 python312Packages.pulsectl: 24.8.0 -> 24.11.0 (#361816) 446d4901fab0 sage: 10.5.rc0 -> 10.5 (#361803) 2b6766253ec6 mpvScripts.modernz: init at 0.2.1 (#360681) 8fb6a2e74df3 python312Packages.pulsectl: 24.8.0 -> 24.11.0 8439c49361f4 sage: 10.5.rc0 -> 10.5 ad02718eab7c python312Packages.torchsnapshot: skip failing test and enable on python 3.12 2f9d395f057a lib.packagesFromDirectoryRecursive: Improved documentation (#359898) 3c8a1553fb53 tgt: 1.0.93 -> 1.0.94 797444df0ffc nixos/aesmd: fix incorrect `mkRemovedOptionModule` option path cc006aed5e75 git-lfs: disable network tests on darwin c37067f877b2 nixos/netboot: Fix netbootRamdisk build (#331220) 4847bcf397de plasticity: format eb7910a7e7e8 python312Packages.types-aiobotocore: 2.15.2 -> 2.15.2.post3 09f7986029c0 plasticity: 24.2.4 -> 24.2.6 a574f2b68d3e nixos/uptime-kuma: Add additional lockdown settings to systemd unit (#361452) f23331e55db5 python312Packages.vt-py: 0.18.4 -> 0.19.0 (#361772) 9dc5544dea0d python312Packages.billiard: disable time sensitive tests (#357595) ee243557c747 dbip-{country,city,asn}-lite: 2024-11 -> 2024-12 (#360890) caf15f88bf66 various packages: use new darwin sdk pattern (#358263) 8b3da597e9c7 philipstv: init at 2.1.1 (#359886) 032239c962b5 julia.withPackages: add juliaCpuTarget option (#361655) 039ae5db9164 flottbot: 0.13.1 -> 0.14.0 (#360712) bf52f47f1d69 python313: 3.13.0 -> 3.13.1 (#361632) 719b30aeb3c0 git-lfs: minor improvements 169896f4fef2 clusternet: 0.17.1 -> 0.17.2 (#361747) 381e652552f5 git-lfs: move to by-name 91beb6b324f5 python312Packages.heudiconv: 1.2.0 -> 1.3.2 (#361756) cbbe6c945cf6 python312Packages.oauthenticator: 17.1.0 -> 17.2.0 (#361760) 1b330e362fa0 checkov: 3.2.327 -> 3.2.328, python312Packages.bc-detect-secrets: 1.5.28 -> 1.5.32 (#361766) 966ee2be2f10 git-lfs: format e8e4b1ecb207 python312Packages.types-awscrt: 0.23.1 -> 0.23.3 (#361773) b66069df877c nixos/invoiceplane: fix sites option description (#316699) ee819cdce913 python312Packages.gehomesdk: 0.5.29 -> 0.5.30 (#361583) 03bf8f84c282 cnspec: 11.32.0 -> 11.33.0 (#361584) f85ff70f0a56 trufflehog: migrate to versionCheckHook 73877ce1aac3 trufflehog: 3.84.1 -> 3.84.2 bfa57fa30068 kanidm: add support for multiple versions (#357734) 494d0e74c6ef python312Packages.textblob: 0.18.0 -> 0.18.0.post0 (#361489) 79a1daab1471 trivy: 0.57.1 -> 0.58.0 178f5f70becc ripasso-cursive: skip failing test on darwin c0cb2ee77a60 qt6Packages.qtspell: init at 1.0.1 (#258143) efbff5300ae7 python312Packages.pgspecial: 2.1.2 -> 2.1.3 (#361653) 443c03154fca python312Packages.vt-py: 0.18.4 -> 0.19.0 95f9644af62d blendfarm: update to net8, apply upstream fixes e51dba85caef python312Packages.types-awscrt: 0.23.1 -> 0.23.3 11e7173ccafb oauth2l: 1.3.0 -> 1.3.1 (#361620) 001201bf5d70 repren: init at 1.0.1 (#361562) 24158f698007 python312Packages.publicsuffixlist: 1.0.2.20241130 -> 1.0.2.20241203 (#361577) bc658fa64e2f linuxPackages.vmm_clock: 0.2.0 -> 0.2.1 (#361631) 4ad556b0cecc python312Packages.mailchecker: 6.0.11 -> 6.0.13 (#361546) c11aa15420ae python312Packages.jsonargparse: 4.34.0 -> 4.34.1 (#361547) 82bbde758e4a python312Packages.mypy-boto3-s3: 1.35.72 -> 1.35.74 af78af7b5532 python312Packages.mypy-boto3-redshift-serverless: 1.35.52 -> 1.35.74 38d9aee2a55c python312Packages.mypy-boto3-redshift: 1.35.61 -> 1.35.74 32326673bd9f python312Packages.mypy-boto3-quicksight: 1.35.68 -> 1.35.74 44eec4746ce7 python312Packages.mypy-boto3-lakeformation: 1.35.55 -> 1.35.74 dcec285c9094 python312Packages.librouteros: 3.3.0 -> 3.3.1 (#361580) 89c43e9a6b3a python312Packages.mypy-boto3-glue: 1.35.65 -> 1.35.74 b705d6209c89 python312Packages.aiohomeconnect: 0.6.0 -> 0.6.2 (#361637) 804c5eff20bf python312Packages.mypy-boto3-dynamodb: 1.35.60 -> 1.35.74 f1b481d54671 python312Packages.mypy-boto3-cloudwatch: 1.35.63 -> 1.35.74 d1ce1b77200b python312Packages.mypy-boto3-athena: 1.35.44 -> 1.35.74 125ab784d678 aldente: 1.28.6 -> 1.29 (#361638) 2179c422dc30 python312Packages.git-filter-repo: 2.45.0 -> 2.47.0 d1d84c06853c python312Packages.bc-detect-secrets: 1.5.28 -> 1.5.32 b0ee9e616d8f zapret: 67 -> 69.5 dd9c90a7305e checkov: 3.2.327 -> 3.2.328 c702d50a632d minecraft-server: 1.21.3 -> 1.21.4 (#361640) 62ecaec63a3e coqPackages.mathcomp-analysis: 1.5.0 -> 1.7.0 (#361371) 0f64286316d4 nixos/exwm: rename emacsWithPackages dd801acc4541 nexusmods-app: 0.6.3 -> 0.7.0 (#360174) 161a56994bef python312Packages.toggl-cli: 2.4.4 -> 3.0.2 cf49f728a07c python312Packages.oauthenticator: 17.1.0 -> 17.2.0 efab2bbe79c1 kandim: fix update script and limit to main package 90840cdb052d nixos/kanidm: set default package version based on stateVersion dda17ad20cc3 kanidm: support multiple versions, 1.4 and 1.3 a9f8a663fb62 mate.mate-applets: 1.28.0 -> 1.28.1 (#361113) ffc48e4c5186 python312Packages.heudiconv: 1.2.0 -> 1.3.2 58f1b636d3b3 python312Packages.argos-translate-files: 1.1.4 -> 1.2.0 (#361677) 68fe64e2ada1 mise: 2024.10.8 -> 2024.11.37 (#354312) 91f31e3ccdf6 python312Packages.mtcnn: 0.1.1 -> 1.0.0; fix build (#361156) f994212f930e python312Packages.timm: 1.0.11 -> 1.0.12 (#361593) 8aeb7378b98c icloudpd: 1.24.4 -> 1.25.0 (#361517) d55ce387db52 nixos/samba, kdePackages.kdenetwork-filesharing: wire up usershares (#355031) 0d3aa7f623fc python312Packages.beancount-plugin-utils: init at 0.0.4 (#325902) d6263281b5aa kdePackages.kdenetwork-filesharing: hardcode runtime Samba dependencies, add NixOS specific hint dfe286ae4b79 gpu-viewer: 3.08 -> 3.10 (#361594) d93a3e8531f0 python312Packages.ray: 2.39.0 -> 2.40.0 (#361743) 592aa95398ed mise: 2024.10.8 -> 2024.11.37 cc67534b921a python312Packages.retinaface: fix build 62478f38fd57 python312Packages.mtcnn: 0.1.1 -> 1.0.0 7e54c6620ec9 ogen: init at 1.4.1 (#335762) bba37efe584e ripasso-cursive: add update script 32d974860262 ripasso-cursive: cosmetic changes e6eb28e69fdd zepp-simulator: init at 2.0.2 (#346379) 03d828a1fb02 cldr-annotations: fix hash (#361442) 351f10f88d73 gpu-viewer: 3.08 -> 3.10 3e1260861f43 clusternet: 0.17.1 -> 0.17.2 947675545b81 python312Packages.cyipopt: add numpy to build-system (#361738) a6225bbc173a stm32cubemx: Pass arguments to Java jar cf6c2d61741d python312Packages.ray: 2.39.0 -> 2.40.0 09824817661d nixos/samba: add convenient option to enable usershares 14ff5ebae0b8 slimserver: 8.5.2 -> 9.0.0 (#361093) a4c0407f24c2 python312Packages.cyipopt: add numpy to build-system ae92b4b92eaf python312Packages.lottie: 0.7.0 -> 0.7.1 (#361686) 55f0da4eaae7 Add adafruit board toolkit (#353849) f83811b938cd python312Packages.jupyterlab-server: remove jupyterlab_server.pytest_plugin from import checks (#360165) f0fa6364de59 python3Packages.adafruit-board-toolkit: init at 1.1.1 9cdb9a699879 python312Packages.beancount-plugin-utils: init at 0.0.4 65b194bc4098 python312Packages.recipe-scrapers: 15.2.1 -> 15.3.2 (#361399) 5e4c353d890b xeus-cling: use locally available logos to remove fragile wikimedia dependency 4c0bd04c5dff ironbar: 0.16.0 -> 0.16.1 1a2282008d5a ripasso-cursive: remove unneeded clang dependency 7376feb6bb23 ripasso-cursive: move to by-name 15562307c850 ripasso-cursive: format 182c37fcc4de linuxKernel.kernels.linux_zen: 6.11.5-zen1 -> v6.12.1-zen1; linuxKernel.kernels.linux_lqx: 6.11.5-lqx1 -> v6.12.1-lqx1 (#361041) 7fdd4bbc9e97 lxqt.lxqt-notificationd: 2.1.0 -> 2.1.1 (#361231) c926b194348d lxqt.lxqt-panel: 2.1.2 -> 2.1.3 (#361230) e324d4e013ca python312Packages.latex2pydata: 0.4.0 -> 0.4.1 (#360946) ea21931656b0 lxqt.lxqt-wayland-session: 0.1.0 -> 0.1.1 (#359238) a128993b4373 ocamlformat_0_27_0: init 5edb3e77f426 chromium,chromedriver: 131.0.6778.85 -> 131.0.6778.108 (#361530) 861edbc3ba8b to-html: 0.1.4 -> 0.1.6 (#360178) da8a7c69e70f seatd: 0.8.0 -> 0.9.1 (#361026) 6791b9d24963 zepp-simulator: init at 2.0.2 9293bc7d55ae traccar: init at 6.5 2a3d58a2adbf highs: 1.8.0 -> 1.8.1 (#360451) 83ef7bfcbb50 nixos-rebuild-ng: implement the remaining missing features (#360215) b6bd36b868d1 zotero: 7.0.8 → 7.0.10 (#359851) 33be238a788f strawberry: 1.1.3 -> 1.2.2 (#358024) 3e7643aad5fe authentik: flag with `knownVulnerabilities` (#361567) 740d2fb5ada2 wgsl-analyzer: init at 0.8.1 c3c2032ecb57 pkgs/README.md: minor refactor to patch section to improve readability (#361688) be1689accecf cldr-annotations: fix hash 0d5a61037cf4 uhubctl: fix darwin build (#361491) e2bf75c862be wl-clicker: init at v0.3.1 (#330684) cbba67d30943 bombsquad: use the wayback machine for stable links 56d2a40058d6 dmd: patch test needspkgmod.d (#351090) f04f58809dab python312Packages.lottie: 0.7.0 -> 0.7.1 87c4f4d7ba9e silx: 2.1.1 -> 2.1.2 (#361612) 36a29f37f265 python312Packages.argos-translate-files: 1.1.4 -> 1.2.0 d18ef8212246 brave: fix darwin build (#361504) 6f9368f591c6 python312Packages.voip-utils: 0.2.0 -> 0.2.1 (#340250) 2e40d6ddeb7d spot: 0.4.1 -> 0.5.0 73ba95d2d7c5 kubernetes-kcp.tests: fix the eval (#361669) 848552e1191c kaput-cli: init at 2.5.0 (#361343) c2e85f96e629 kubernetes-kcp.tests: fix the eval 8539595cbed3 upscaler: 1.4.0 -> 1.4.1 66056e11e31e nixos/doc/rl-2505: document retroarch refactoring changes (#361421) 1e536d5ebeac linuxPackages_latest.broadcom_sta: add patch to compile on Kernel 6.12 (#359484) 0a828d4e8fb2 supergfxctl-plasmoid: 2.0.0 -> 2.1.1 b69b526e6df0 julia.withPackages: add juliaCpuTarget option ed6c067f2560 doc/tauri: use tauri 2.0 dependencies & new darwin SDK pattern in example (#357148) 180472d36d7d ollama: 0.4.5 -> 0.4.7 (#361646) b40ee6832e76 python312Packages.pgspecial: 2.1.2 -> 2.1.3 c51787c99c19 flutter: Pass flutter_tools package_config.json to Dart runtime (#354174) 944bdae3a1cc tinymist: 0.12.4 -> 0.12.8 (#361429) 74454e41a555 nixos/filesystems: don't silently ignore label when device is set (#361418) fa3126fe26df otb: 9.0.0 -> 9.1.0 9c43f010c727 cables: 0.3.2 -> 0.4.4 (#360921) 5e0dd6992eea Cinnamon 6.4 (#359855) 192e92d56844 ollama: 0.4.5 -> 0.4.7 820af6cb1986 aldente: 1.28.6 -> 1.29 0fe1d02f6037 minecraft-server: 1.21.3 -> 1.21.4 b54f0f97eb2f python312Packages.aiohomeconnect: 0.6.0 -> 0.6.2 7422541d0c4c kustomize-sops: rename exec plugin to ksops (#175539) 1ec7e4eb52f0 python313: 3.13.0 -> 3.13.1 2cb893adf677 dash-mpd-cli: init at 0.2.23 (#355105) fc229237a6ec clusternet: init at 0.17.1 (#357644) 7d5b0de30302 jhentai: init at 8.0.5 (#360288) 0b8bf84eeb58 linuxPackages.vmm_clock: 0.2.0 -> 0.2.1 a5c3dcc7605b cargo-sort: revert to 1.0.9 (from 1.1.0) ee5452c3969b python312Packages.aiosomecomfort: 0.0.25 -> 0.0.26 (#359499) b6c8e333a5ad oauth2l: 1.3.0 -> 1.3.1 986e0e650391 nodePackages.meshcommander: drop 1c662d56df24 nodePackages.stackdriver-statsd-backend: drop b6047c81a60f python312Packages.voip-utils: run tests c3cc4cc013ec gopass: 1.15.14 -> 1.15.15 29ba792f88bc silx: 2.1.1 -> 2.1.2 1da2983cbd4b gopass: add passthru.tests.version 8780e5fb89ad gopass: add updateScript 47c8b8a8a4f1 gopass: format with nixfmt-rfc-style 81c4870a68b7 cyme: 1.8.4 -> 1.8.5 463a8461b544 nb: prefer `hash` rather than `sha256` in fetchFromGitHub 006cc2991878 nb: 7.14.4 -> 7.14.6 5cfe3df29c23 python312Packages.fastjet: 3.4.2 -> 3.4.3 b9be34f7cd79 handheld-daemon-ui: 3.2.3 -> 3.3.0 739502db6500 python312Packages.notobuilder: 0-unstable-2024-08-03 -> 0-unstable-2024-09-25 be7c21ed1b85 mollysocket: 1.5.3 -> 1.5.4 cb35b9803fab grim: khaneliman adopt package (#361124) b09a4627a216 vimPlugins: update on 2024-12-03 (#361493) 2f17e933b4e3 ugrep: 7.1.0 -> 7.1.1 (#360373) e39392ea2ce1 nodePackages.webpack-cli: make alias to pkgs.webpack-cli a2283c7a2e28 python312Packages.readchar: 4.2.0 -> 4.2.1 (#356823) 78550eef9418 webpack-cli: init at 5.1.4 9daaf476b92e python312Packages.timm: 1.0.11 -> 1.0.12 929a9fd3dc4b Linux kernels 2024-12-02 (including 6.13-rc1) (#361159) 310e4de59f68 yt-dlp: 2024.11.18 -> 2024.12.3 (#361557) cd8b3d654d3f nexusmods-app: 0.6.3 -> 0.7.0 36e98fc54360 maintainers: fix typo in my username (#361585) 4aacc1cb8af4 maintainers: fix typo 957dcdf48627 cnspec: 11.32.0 -> 11.33.0 b4837eea02e0 nixos/nbd: remove `with lib;` (#343506) e7099625a328 python312Packages.gehomesdk: 0.5.29 -> 0.5.30 cec1aec3946e python312Packages.librouteros: 3.3.0 -> 3.3.1 6964ded47bac rustcat: refactor (#361401) 45e946176867 wafw00f: refactor (#361433) 9bde0b12bb3f rates: refactor (#361423) a8e7c2e8d609 nbtscanner: refactor (#361407) aedc37d8a86d slowlorust: refactor (#361412) d19a9bebc1ec websocat: add versionCheckHook (#361419) 35cb7af6cba8 gotestwaf: migrate to versionCheckHook (#361415) 9c2aa69c93a1 python312Packages.thinqconnect: 1.0.1 -> 1.0.2 (#361413) e7de500b02c2 coinlive: refactor (#361398) fa6228744096 python312Packages.mailchecker: 6.0.11 -> 6.0.13 dfb1b885fd94 python312Packages.jsonargparse: 4.34.0 -> 4.34.1 65c5afda0ac6 python312Packages.publicsuffixlist: 1.0.2.20241130 -> 1.0.2.20241203 32e51a5303e2 nuclear: 0.6.39 -> 0.6.40 (#361370) 18e5cdf666bf kubelogin: 0.1.4 -> 0.1.5 (#361236) 53ef48c774f6 open-webui: add missing dependencies (#361572) b3945f2f37fe 1password-gui: 8.10.48 -> 8.10.54, 1password-gui-beta: 8.10.50-8.BETA -> 8.10.56-1.BETA (#361520) 617c502f9804 angular-language-server: 18.2.0 -> 19.0.3 0dedae51b975 nbtscanner: move to pkgs/by-name 1930a6cb529d open-webui: add missing dependencies 53886667eef4 Merge GNOME updates 2024-12-01 (#360787) 384f6f592b99 authentik: flag with `knownVulnerabilities` 641d29d17269 python312Packages.streamdeck: 0.9.5 -> 0.9.6 7dc4b25deaa5 ocamlPackages.ca-certs-nss: 3.103 -> 3.107 (#360669) 7e56b2d0b413 git-lfs: 3.5.1 -> 3.6.0 (#357914) 2813a19a27bf nixos-facter: 0.2.0 -> 0.3.0 58e0732fb33c hwinfo: split lib from bin output 16873e4e8bdb svgbob: 0.7.2 -> 0.7.4 (#361031) e94bbdd99340 nixos/gitlab-runner: let script options accept scripts as strings (#344644) 59af35ec5462 python3Packages.pyalsaaudio: init at 0.11.0 (#351536) ec1676e3cc19 repren: init at 1.0.1 229da450d6f6 nix-plugin-pijul: 0.1.5 -> 0.1.6 (#360578) 6f846cd1ebf8 sccmhunter: Init at 1.0.6-unstable-2024-10-30 (#353121) 776885fdf5b0 starpls: 0.1.15 -> 0.1.17 (#360344) 6c4abe533672 haproxy: 3.0.5 -> 3.1.0 (#361300) 52570bc80fcb cargo-lock: 9.0.0 -> 10.0.1 (#361126) 689a9ea7c635 catppuccin-kvantum: 0-unstable-2024-10-10 -> 0-unstable-2024-10-25 (#360555) f108f55499e5 static-web-server: 2.33.0 -> 2.33.1 (#353280) 9133ab1d0777 sdrangel: 7.22.2 -> 7.22.4 (#357768) 2f2926f59389 dmd: patch test needspkgmod.d 96a1839b9b04 yt-dlp: 2024.11.18 -> 2024.12.3 6bd90758e1fd blender: use numpy 1.x (#358375) 8e7548ae09a2 otpauth: 0.5.2 -> 0.5.3 (#361092) 0fe78ee9eb14 armadillo: 14.0.3 -> 14.2.1 (#360416) 2187a09269bb nbtscanner: add versionCheckHook efa0a14b3b28 nbtscanner: format with nixfmt d1100914878d nbtscanner: refactor 3112671af2b6 mediamtx: 1.9.2 -> 1.9.3 (#352624) f9f7d7b58c06 nixos/networkd: use upstream wait-online@ unit (#360319) 53b8f92efde9 janus-gateway: 1.2.4 -> 1.3.0 (#360881) 374899ba3f00 nixos/loki: fix eval after ccaf4694 (#361543) d47140b9bd2e nixos/loki: fix eval after ccaf4694 d6f851c76e78 aws-sam-cli: 1.127.0 -> 1.131.0 (#323090) ccaf4694a0ea nixos/loki: Start Loki after the network comes online (#311991) 0f009407d9d3 various: remove syslog.target unit dependency (#154633) b9867333b633 nixos/fireqos: fix service not being enabled (#361402) 8d3033ab45ee ocamlformat: Build on OCaml 4.14 (#361404) 2cbf9757ccaf python312Packages.mypy-boto3-*: updates (#361038) 79abb3b1378c darwin.iproute2mac: 1.4.1 -> 1.5.4 (#361283) 2a0676973f91 libdeltachat: 1.151.2 -> 1.151.4 9dd73db76f3a librist: remove sebtm as maintainer (#361525) 5daef4514010 swayrbar: remove sebtm as maintainer (#361526) 342e17ceb385 tp-auto-kbbl: remove sebtm as maintainer (#361527) 3049b97c6e38 wlprop: remove sebtm as maintainer (#361528) 1904047ff063 python3Packages.pyhepmc: 2.13.4 -> 2.14.0 (#360461) fbb7dcdbe040 hepmc3: fix HepMC3-config on darwin (#360478) b256a82610f3 mastodon: 4.3.1 -> 4.3.2 (#361487) 5752069431c3 stdenv.mkDerivation: support structuredAttrs in inputDerivation (#361233) aa05b55564c5 eza: use new darwin sdk pattern f5a35dd142da cargo-unfmt: use new darwin sdk pattern 7bc42ab29b9a cargo-feature: use new darwin sdk pattern cf34f2300ceb cargo-fuzz: use new darwin sdk pattern 9ae65801e4a0 cargo-limit: use new darwin sdk pattern 9ef707ba9522 reindeer: use new darwin sdk pattern 14aee1533f32 ostree-rs-ext: use new darwin sdk pattern fa0ec055fb3b sequoia-chameleon-gnupg: use new darwin sdk pattern 6b7f41b40356 openpgp-card-tools: use new darwin sdk pattern bbdbf9c935b4 python312Packages.cryptg: use new darwin sdk pattern 4d74c042ba2a garage: use new darwin sdk pattern fc0a7fe9c075 cplay-ng: 5.2.0 -> 5.3.1 (#357093) eb48ff562196 chromium,chromedriver: 131.0.6778.85 -> 131.0.6778.108 f1804e27b73e wlprop: remove sebtm as maintainer 7bff69e5e23e tp-auto-kbbl: remove sebtm as maintainer 0eb05d90f123 swayrbar: remove sebtm as maintainer 99a6022ebfbd librist: remove sebtm as maintainer 7cc48215b1c3 ton: fix build on Darwin (#361514) 3ebf7def3f13 python312Packages.moderngl-window: 3.0.2 -> 3.0.3 (#361427) 285daaec0ddf 1password-gui: 8.10.48 -> 8.10.54, 1password-gui-beta: 8.10.50-8.BETA -> 8.10.56-1.BETA 83ae8e7fc75d python3Packages.magic: expose version and pname 56dcfcd9b4f2 gepetto-gui: expose version and pname fc34c16e9f1d python3Packages.dscribe: use pname instead of name da1f92145527 python3Packages.molbar: use pname instead of name d8af5c5da225 x16.run: set pname and version 0eae5911560d xmoji: use pname 2f46896cb8fd xonotic: set pname and version 57a7c3206589 icloudpd: 1.24.4 -> 1.25.0 f1f074f2132a deconz: 2.28.0 -> 2.28.1 34ba4e87ce08 lftp: 4.9.2 -> 4.9.3 256e947ef141 chrpath: 0.17 -> 0.18 fdaa8cadd543 jhentai: init at 8.0.5 1cfd028b3e5d cyclonedx-cli: 0.25.1 -> 0.27.2 (#359842) 3b9f3b0d0518 exo: 0-unstable-2024-11-14 -> 0-unstable-2024-11-30 (#361154) 12b8432cbbd6 ankama-launcher: init at 3.12.24 (#337438) 0208ae4ad3cc ntpd-rs: 1.3.0 -> 1.3.1 (#361213) 117601c9a0b8 exo: 0-unstable-2024-11-14 -> 0-unstable-2024-11-30 ae09090884b5 python312Packages.moderngl-window: 3.0.2 -> 3.0.3 5f708cb9c039 rcodesign: 0.27.0 -> 0.28.0 (#356104) c1081926c8c6 gerrit: 3.10.3 -> 3.11.0 (#361332) d2e1795c0ac8 python312Packages.pytorch-pfn-extras: 0.7.7 -> 0.8.1; fix build (#361147) b27ac6e75fe3 ton: fix build on Darwin 0cd49dc34d26 meow: 2.1.3 -> 2.1.4 (#360381) 23ed6b684404 roon-server: 2.0-1470 -> 2.0-1483 (#360395) 9e7ccb4d80ef brave: fix darwin build 206cc199fcc1 pcloud: 1.14.7 -> 1.14.8 (#356202) ee4033bb4076 matrix-synapse: 1.120.0 -> 1.120.2 (#361495) 52b6a6cd9621 python312Packages.pytorch-pfn-extras: 0.7.7 -> 0.8.1 4e258ac67f5d python312Packages.grad-cam: 1.5.3 -> 1.5.4 6648c58eae48 stdenv.mkDerivation: support structuredAttrs in inputDerivation 77b951f36369 ks: 0.4.0 -> 0.4.2 (#360515) 93e8ab64beb9 linuxPackages.drbd: 9.2.8 -> 9.2.12 (#360238) 6869d3315cb0 vimPlugins.blink-cmp: 0.6.2 -> 0.7.1 fdcd79a3c3fe papers: 46.2 -> 47.0 (#353971) b222156aea90 venera: init at 1.0.8 (#359919) ab2d31a4d4f9 matrix-synapse: 1.120.0 -> 1.120.2 995adf49fe65 vimPlugins.nvim-treesitter: update grammars fd0e09c3f180 vimPlugins: resolve github repository redirects 695f21d26dda vimPlugins: update on 2024-12-03 f46d51206908 peertube: Document current lack of darwin support in meta 142346385c5b qt6Packages.qtspell: init at 1.0.1 c49649056159 uhubctl: fix darwin build df96e51f3cd1 venera: init at 1.0.8 946dbfcfa44e dart.sqlite3_flutter_libs: init 6a8468119797 python312Packages.textblob: 0.18.0 -> 0.18.0.post0 a248a23589b5 mastodon: 4.3.1 -> 4.3.2 4c9ca5389065 portfolio: 0.71.2 -> 0.72.2 (#360387) b4c7dcc1b689 slurm: 24.05.4.1 -> 24.11.0.1 (#361321) 629bf81b6706 nixos/k3s: refactor k3s multi node test (#355230) 923776226764 wpaperd: 1.0.1 -> 1.1.1 0c19c97a6423 tinymist: 0.12.4 -> 0.12.8 abf020202da3 fastfetch: 2.30.1 -> 2.31.0 (#361379) 7461c476f3d8 plocate: 1.1.22 -> 1.1.23 (#361140) 638568b3852e nixos/frr: make runtime directory world-readable (#358930) 98e9372c1c7f nixos-rebuild: refactor if-else in match 7ce5501df046 cyclonedx-cli: add team cyberus to maintainers 11ad6d0722a5 cyclonedx-cli: 0.25.1 -> 0.27.2 1c26355e02ea tree: 2.1.3 -> 2.2.1 (#361302) d910dbe90b66 papers: 46.2 -> 47.0 4c34d7381aed python312Packages.types-psycopg2: 2.9.21.20240819 -> 2.9.21.20241019 (#361186) 2a0efa8d9eaf wgo: 0.5.6d -> 0.5.7 (#361208) 033cfb36247a mandown: 0.1.4 -> 0.1.5 (#361291) 76e3007fffe8 websurfx: 1.20.7 -> 1.20.13 (#361315) bffe07243bd2 libgbinder: 1.1.40 -> 1.1.41 (#361317) 397d6eb8c68e dotnet-outdated: don't build for EOL sdks (#361048) 8e497c4232fd upgrade-assistant: 0.5.820 -> 0.5.829 a6a87f182150 pbm: 1.3.2 -> 1.4.3 4cd88e9f5635 python312Packages.mitogen: 0.3.18 -> 0.3.19 (#361414) b24da7230fd3 viceroy: 0.12.1 -> 0.12.2 (#361416) f6c726b55e76 python312Packages.playwrightcapture: 1.27.3 -> 1.27.4 (#361420) f5a34c7cb659 alembic: 1.8.7 -> 1.8.8 (#361428) 5ba0168d3dcb kanidm: 1.4.3 -> 1.4.4 (#361445) 142d4941196a qgroundcontrol: 4.4.2 -> 4.4.3 (#360956) 7f2dd6859283 hunspellDicts.uk-ua: 4.6.3 -> 6.5.3 (#360747) 2025cfa2979a unifi-controller: use hash and remove blank knownVulnerabilities (#356993) f58592aed5d2 bpftrace: Source from "bpftrace" instead of "iovisor" (#333030) 66f69bdbdec6 godot_4: compile with BuildID (#351246) fb426e653dda fable: 4.20.0 -> 4.24.0 f355a9b9d75a csharpier: 0.29.1 -> 0.30.2 79e336184f5c fable: add version test 04f1c8b4eab2 buildDotnetGlobalTool: add default updateScript c763d1885e79 datafusion-cli: 42.0.0 -> 43.0.0 (#361359) 322f2e45a597 git-codereview: 1.12.0 -> 1.13.0 (#361366) 19e3a49d7dcf python3Packages.pytouchlinesl: 0.2.0 -> 0.3.0 (#361417) 21af7052b442 python312Packages.nettigo-air-monitor: 3.3.0 -> 4.0.0 (#361377) 0237ad1db31d cfspeedtest: 1.2.6 -> 1.3.0 (#361382) 07a92bc00666 buildDotnetGlobalTools: add finalAttrs support 3463d22cd84e buildDotnetGlobalTool: format with nixfmt ef9c78f9e031 libjwt: 1.17.2 -> 1.18.1 (#361383) 005ccd987665 nuclei: 3.3.6 -> 3.3.7 (#361385) ec852ae44e0a python312Packages.gto: 1.7.1 -> 1.7.2 (#361386) eebd8dae17d5 python312Packages.avwx-engine: 1.9.1 -> 1.9.2 (#361387) 027054d5aa41 python312Packages.bloodyad: 2.0.8 -> 2.1.1 (#361389) 82abeb488023 checkov: 3.2.324 -> 3.2.327 (#361390) a89ee7773aa2 python312Packages.renault-api: 0.2.7 -> 0.2.8 (#361393) e26688a63305 openfga-cli: 0.6.1 -> 0.6.2 (#361394) 557349cd5ac5 pantheon.elementary-screenshot: 8.0.0 -> 8.0.1 (#361456) 4252509dc3b8 buildkite-agent-metrics: 5.9.9 -> 5.9.10 (#361395) 3461cf6aed7e python312Packages.pysmlight: 0.1.3 -> 0.1.4 (#361397) f649117a9cdb cargo-cyclonedx: 0.5.5 -> 0.5.6 (#361335) 7f8d6e4a2449 python312Packages.xlsx2csv: 0.8.3 -> 0.8.4 (#361350) 029dea9aaacf kronosnet: 1.29 -> 1.30 (#361292) 50bb98b52163 python312Packages.pycrdt: 0.10.6 -> 0.10.7 (#361426) fa530e029f1a pantheon.elementary-screenshot: 8.0.0 -> 8.0.1 584bee16c00e python312Packages.django-axes: 7.0.0 -> 7.0.1 (#361301) bf9afe0e85aa koboldcpp: 1.78 -> 1.79.1 055d17f425f8 python312Packages.pueblo: 0.0.9 -> 0.0.10 (#361440) 0a39f398dff7 giza: 1.4.1 -> 1.4.2 (#361086) 4a661643978d nixos/uptime-kuma: Add additional lockdown settings to systemd unit 8207bfe50a8f nixos/uptime-kuma: Order lockdown settings lexicographically ff04c2da50e5 froide: init at 0-unstable-2024-11-22 (#355835) 655aa02cc95c eintopf: 0.14.1 -> 0.14.2; eintopf.frontend: 0.14.1 -> 0.14.2 (#353955) 006b124d5c6f python312Packages.unifi-ap: 0.0.1 -> 0.0.2 (#361306) 03f67dc9bee8 kubeseal: 0.27.1 -> 0.27.2 (#361312) 758ceddbe44d kanidm: 1.4.3 -> 1.4.4 d4b904d30d32 hyfetch: include pciutils as a dependency (#361261) 8569c2ec4505 swayrbar: 0.4.0 -> 0.4.2 (#358643) c6e9bd02ca11 nixos-rebuild-ng: add test to `nixos-rebuild build` b2b15dbc81ef nixos/doc/rl-2505: Mention Cinnamon 6.4 d3b00bb894e5 nixos/cinnamon: Remove polkit_gnome e83ca8870e31 nixos/cinnamon: Enable power-profiles-daemon 8c9f81eb53c7 nemo-python: 6.2.0 -> 6.4.0 f5571c171f34 nemo-fileroller: 6.2.0 -> 6.4.0 c2cbfebd9243 nemo-emblems: 6.2.1 -> 6.4.0 d3d93401373f nemo: 6.2.8 -> 6.4.2 df5743d61dbc snowflake: 2.9.2 -> 2.10.1 (#360210) d62cd526c846 muffin: 6.2.0 -> 6.4.1 6b1ff5c7e366 cjs: 6.2.0 -> 6.4.0 e1e722bc5bd3 cinnamon-translations: 6.2.2 -> 6.4.0 465940ad05b3 cinnamon-settings-daemon: 6.2.0 -> 6.4.1 e2163b4a7b7e cinnamon-session: 6.2.1 -> 6.4.0 52e2bbc30ca0 cinnamon-screensaver: 6.2.1 -> 6.4.0 c6e2429cbe9e cinnamon-menus: 6.2.0 -> 6.4.0 cf5392204689 cinnamon-desktop: 6.2.0 -> 6.4.1 8c1957866a00 cinnamon-control-center: 6.2.0 -> 6.4.0 32adb65c08c2 dotnet: fixes (#360923) 42ad9d42a422 python312Packages.pueblo: 0.0.9 -> 0.0.10 89fdabb36a6a xdg-desktop-portal-shana: 0.3.12 -> 0.3.13 (#361392) 3dc0617163df mydumper: 0.14.1-1 -> 0.16.9-1 (#325566) 7392ad0ac211 cinnamon-common: 6.2.9 -> 6.4.1 566e53c2ad75 nixos/knot: add missing CLIs to wrapper (#361139) 5eac24c0c5e9 lcrq: 0.2.1 -> 0.2.3 (#361307) 38ebec462382 librecast: 0.8.0 -> 0.9.1 (#361120) 510184797b26 netcdf: fix and enable strictDeps = true (#360690) 4a736ec26a1b tree-sitter: fix two grammar pnames (#360388) 4c2ae8c54738 ciscoPacketTracer7: fix fhsenv version (#360887) 143952b7d307 hyfetch: include pciutils as a dependency f97c2cfddf2d wafw00f: refactor debea81ba7f3 nixos-rebuild-ng: don't try to register the profile when doing build or test 609b25dfa683 linux/hardened/patches/6.6: v6.6.62-hardened1 -> v6.6.63-hardened1 08cf416d5f79 linux/hardened/patches/6.11: v6.11.9-hardened1 -> v6.11.10-hardened1 b5964b825f0e linux/hardened/patches/6.1: v6.1.118-hardened1 -> v6.1.119-hardened1 adb7bd4be87f linux-rt_6_6: 6.6.58-rt45 -> 6.6.63-rt46 ee127a0590af linux-rt_6_1: 6.1.112-rt43 -> 6.1.119-rt45 6431119ca4bd linux-rt_5_4: 5.4.278-rt91 -> 5.4.285-rt93 9f80d0187283 linux-rt_5_10: 5.10.225-rt117 -> 5.10.229-rt121 8d3349cda370 linux_testing: 6.12-rc7 -> 6.13-rc1 dd33e87ac65e silx: init at 2.1.1, fabio: init at 24.4.0 (#340000) 122ab4117f3f deepin: do not install infrequently used apps by default (#361425) 442b6ae19d90 fdroidserver: 2.3a2 -> 2.3.0 (#359351) d6d092f87d95 {buildRustPackage,fetchCargoTarball,fetchCargoVendor}: respect cargoRoot (#350541) 9f664fb68b3a fdroidserver: 2.3a2 -> 2.3.0 2bedc788d7c8 nixos/ananicy: fix eval when hardened kernel is used with ananicy-cpp (#361172) 6990eac8e820 deepin: do not install infrequently used apps by default f49f947ec4a6 check-jsonschema: 0.29.2 -> 0.29.4 (#360020) a75d28a5b0c6 visual-hexdiff: init at 0.0.53 (#327172) 930a52aacc76 scala-cli: 1.5.1 -> 1.5.4 (#361225) 25bdcd51e86e lib.packagesFromDirectoryRecursive: Split and explain examples, warn about scope limitation bd1bc9d56b82 unison-ucm: 0.5.28 -> 0.5.29 (#361221) 781b44b39d17 lib.packagesFromDirectoryRecursive: document inputs better f574b37ee4ef tkrzw: 1.0.31 -> 1.0.32 5061e5448d55 rates: move to pkgs/by-name 51adde8e757d rates: add versionCheckHook a72e7d1cd29b rates:format with nixfmt 9226d4e9ee55 nixos/filesystems: don't silently ignore label when device is set ece89eabe57c rates: refactor 48011bb5515d nixos/doc/rl-2505: document retroarch refactoring changes 1d957b2e3acf websocat: move to pkgs/by-name 0fbfd6ff1a42 python3Packages.pytouchlinesl: 0.2.0 -> 0.3.0 f1e02d7a44f7 websocat: add versionCheckHook e331bd9a9200 websocat: format with nixfmt dc28b5b21f65 gotestwaf: move to pkgs/by-name 0a4c5699f340 gotestwaf: migrate to versionCheckHook d956846ddc51 python312Packages.playwrightcapture: 1.27.3 -> 1.27.4 47bb8b2150a7 python312Packages.thinqconnect: 1.0.1 -> 1.0.2 fe5fb91889ea slowlorust: move to pkgs/by-name 2e387e6c5927 viceroy: 0.12.1 -> 0.12.2 29657fce4b05 slowlorust: add versionCheckHook f46d02e1dab2 python312Packages.mitogen: 0.3.18 -> 0.3.19 c91e47f589d0 nixos/fireqos: modernize ab73ad0d48f2 slowlorust: format with nixfmt 58c4fb6e110f slowlorust: refactor 185997b78980 alembic: 1.8.7 -> 1.8.8 b26fe7212385 python312Packages.pycrdt: 0.10.6 -> 0.10.7 6d8ddd87dc09 wireshark: 4.2.6 -> 4.4.2 (#344914) def6c2f79ecc vimPlugins.blink-cmp: add updateScript (#358078) 15ca3525fe63 python312packages.latex2pydata: format with nixfmt 69b1c90060b2 python312Packages.latex2pydata: 0.4.0 -> 0.4.1 c2e4f3c99f4c rustcat: move to pkgs/by-name 6342e63fa80d rustcat: refactor c8ecb7f23376 python312Packages.voip-utils: 0.2.0 -> 0.2.1 7ed1bb9467ff nixos/fireqos: fix service not being enabled 36f08301c23d coinlive: move to pkgs/by-name ea3e278f5bda python312Packages.recipe-scrapers: 15.2.1 -> 15.3.2 c1ad9fc2f62e coinlive: add versionCheckHook bdfcdf2dce20 coinlive: refactor e3ca8012e951 python3Packages.dbus-next: disable (flaky) tests, remove myself as maintainer (#360361) e57052ce763d python312Packages.pysmlight: 0.1.3 -> 0.1.4 370d17dee343 python312Packages.policy-sentry: 0.13.1 -> 0.13.2 (#360818) a59bc27c4ddb Revert "workflows/eval: Add the eval summary as a comment" (#361388) 49eaa25bc6f4 python312Packages.nettigo-air-monitor: update disabled cda5f0c30c26 buildkite-agent-metrics: 5.9.9 -> 5.9.10 732ec1a9eaae dvc: 3.57.0 -> 3.58.0 (#361027) ad12d9d40789 python312Packages.bc-detect-secrets: 1.5.27 -> 1.5.28 (#361029) 9eec026830ef mediawriter: 5.2.0 -> 5.2.2 (#361033) 5389ec5e9cac python312Packages.tencentcloud-sdk-python: 3.0.1274 -> 3.0.1275 (#361037) d5088bef28d0 python312Packages.boto3-stubs: 1.35.71 -> 1.35.72, python312Packages.botocore-stubs: 1.35.71 -> 1.35.72 (#361028) 73e858617d13 python312Packages.aiortm: 0.9.37 -> 0.9.38 (#361030) 428d38a47e13 openfga-cli: 0.6.1 -> 0.6.2 23dafd20736c python312Packages.mypy-boto3-builder: 7.26.1 -> 8.5.0 (#360587) 2c3931076062 python312Packages.pytado: remove (#355347) ce8f304bb68f lib.types.attrsWith: remove failing test 664ee243c4a7 python312Packages.mypy-boto3-s3control: 1.35.72 -> 1.35.73 58c115499f8c lib.types: improve performance on attrsWith e60e2e6916b5 lib/types: standardise attrsOf functor.wrapped warning and add a test dbb085549e19 lib/modules: Minor performance optimisation e438d6b08d46 lib/types: Add deprecation to attrsWith bd353d322c6f lib/types: Test attrsWith type merging 5b7a21358d67 lib/types: init {types.attrsWith} 0590b490691e python312Packages.mypy-boto3-vpc-lattice: 1.35.0 -> 1.35.72 26a0fda80545 python312Packages.mypy-boto3-transfer: 1.35.40 -> 1.35.72 341999702e4a python312Packages.mypy-boto3-securityhub: 1.35.29 -> 1.35.72 5cd6895dfd8f python312Packages.mypy-boto3-s3control: 1.35.55 -> 1.35.72 fb385d1026ea python312Packages.mypy-boto3-s3: 1.35.69 -> 1.35.72 caabacb4e3b9 python312Packages.mypy-boto3-rds: 1.35.66 -> 1.35.72 233d542a8876 python312Packages.mypy-boto3-organizations: 1.35.60 -> 1.35.72 e82dab120b68 python312Packages.mypy-boto3-opensearch: 1.35.58 -> 1.35.72 6d1157d2b6a3 python312Packages.mypy-boto3-memorydb: 1.35.36 -> 1.35.72 d45bbb9acf91 python312Packages.mypy-boto3-logs: 1.35.67 -> 1.35.72 5bc58463af76 python312Packages.mypy-boto3-imagebuilder: 1.35.46 -> 1.35.72 4c1cc4fa8042 python312Packages.mypy-boto3-guardduty: 1.35.55 -> 1.35.72 01488e368c32 python312Packages.mypy-boto3-fsx: 1.35.71 -> 1.35.72 29ca3b74a010 python312Packages.mypy-boto3-events: 1.35.0 -> 1.35.72 0f397666a8a2 python312Packages.mypy-boto3-eks: 1.35.57 -> 1.35.72 9d38b489d444 python312Packages.mypy-boto3-ecs: 1.35.66 -> 1.35.72 9b7b02ca174c python312Packages.mypy-boto3-ec2: 1.35.70 -> 1.35.72 69ae8e7712b9 python312Packages.mypy-boto3-customer-profiles: 1.35.64 -> 1.35.72 66d42b0305cd python312Packages.mypy-boto3-connect: 1.35.70 -> 1.35.72 44471d01edbf python312Packages.mypy-boto3-cleanrooms: 1.35.56 -> 1.35.72 5668a8986c7d python312Packages.mypy-boto3-chime-sdk-voice: 1.35.16 -> 1.35.72 8cc108b78d78 python312Packages.gto: 1.7.1 -> 1.7.2 ae52e560c05a Revert "workflows/eval: Add the eval summary as a comment" 3b6172a23431 hunspellDicts.id_ID: init at 24.8.0.2 (#331917) d3e6e586cb28 python312Packages.avwx-engine: 1.9.1 -> 1.9.2 18383a0c0127 python312Packages.bloodyad: 2.0.8 -> 2.1.1 94fd8f102e86 checkov: 3.2.324 -> 3.2.327 809122258965 python312Packages.renault-api: 0.2.7 -> 0.2.8 8ab1eab9bad6 xdg-desktop-portal-shana: 0.3.12 -> 0.3.13 bcccfc987c33 nuclei: 3.3.6 -> 3.3.7 4631f6f83108 python312Packages.aioopenexchangerates: 0.6.16 -> 0.6.17 (#361032) b12aaee23f31 python312Packages.holidays: 0.61 -> 0.62 (#361260) ebf9c03bce74 python312Packages.netdata: 1.2.0 -> 1.3.0 (#361262) 46b38c718346 python312Packages.pyezviz: 0.2.2.4 -> 0.2.2.4a (#361258) f655752053af kubescape: 3.0.19 -> 3.0.21 (#361254) 2342f92e45be dnsx: refactor (#361248) 38ef70613c75 nuclei: add versionCheckHook (#361228) 3192488230aa uncover: refactor (#361247) 5105fe52b3c4 httpx: add versionCheckHook (#361246) 5c3b9b9ca6b8 naabu: 2.3.2 -> 2.3.3 (#361214) 9f1b4aa1f514 wapiti: 3.2.1 -> 3.2.2 (#361194) 47901f7bd919 python312Packages.pyexploitdb: 0.2.56 -> 0.2.57 (#361193) 5f392740e1d8 fastfetch: 2.30.1 -> 2.31.0 0c053dfc7c53 peertube: 6.0.4 -> 6.3.3 (#358194) b152af30422d cfspeedtest: 1.2.6 -> 1.3.0 ca55ed167478 filesender: FIX: missing format definition. (#316885) 90c73340a667 conda: fix fhsenv version (#360889) ef371ce38808 libjwt: 1.17.2 -> 1.18.1 233b1ae0491c nixos/localtimed: fix 'geoclue2Package' doc (#360733) 9216cf4e0957 busybox-sandbox-shell: fix eval for musl (#361265) fab6e8c185ae python312Packages.nettigo-air-monitor: 3.3.0 -> 4.0.0 fd305d09150f survex: 1.4.11 -> 1.4.13 (#361342) 89f30442238e nuclear: 0.6.39 -> 0.6.40 1f3aeb467dbe ankama-launcher: init at 3.12.24 accd0c74031f maintainers: add harbiinger 55d15ad12a74 nixos/gitwatch: fix module accounting (#361346) 2ac43e7049e5 git-codereview: 1.12.0 -> 1.13.0 3fab98acb1b1 grpcurl: 1.9.1 -> 1.9.2 (#360026) d78b02f3126c handheld-daemon: 3.4.1 -> 3.6.1 (#359282) e94d44a63dcd kaput-cli: init at 2.5.0 f2d4dc7a32bf doc: lib.types.attrsWith init documentation 071feeb78a37 zed-editor: 0.163.2 -> 0.163.3 (#361235) 76fa07d7bfc1 mujoco: 3.2.5 -> 3.2.6 (#361252) afc317801f6d datafusion-cli: 42.0.0 -> 43.0.0 ab08766aa52a pinentry-qt: fix caps lock warning (#355267) 267748eb9827 virt-manager: Add back gstreamer plugins (#361351) 77a1d17b4146 bdf2psf: 1.230 -> 1.232 (#361325) cce4fd54d92d open-webui: add missing `emoji` dependency (#361347) e314747e0949 dotnet-outdated: don't build for EOL sdks b76c888fe834 osm2pgsql: 2.0.0 → 2.0.1 (#361187) c3f812e2a675 pizauth: 1.0.5 -> 1.0.6 (#361348) fa6edb453d0c virt-manager: Add back gstreamer plugins bc678b289269 nixos/gitwatch: fix module accounting e6559ed59868 python312Packages.xlsx2csv: 0.8.3 -> 0.8.4 78c8bf61e0eb open-webui: add missing `emoji` dependency c21cb5620e24 pizauth: 1.0.5 -> 1.0.6 81662274a0a6 ci/eval: test aliases (#360242) 8f72df359887 nodePackages.kaput-cli: drop 260aa262b884 workflows/eval: Add the eval summary as a comment (#361061) 335671e9f17f survex: 1.4.11 -> 1.4.13 dc19a018eecd Run GitHub Actions on automatic backport PRs (#360260) 60bbd7983cef notepadqq: fix build (#359865) fcc6fd8761d9 Revert "lib/types: init {types.attrsWith}" (#361334) 907cb3d253e2 Revert "lib/types: init {types.attrsWith}" 1c30b56d1eaa cargo-cyclonedx: 0.5.5 -> 0.5.6 afd9ca8bf0e0 cargo-spellcheck: move to pkgs/by-name (#356513) ac708d05d291 gerrit: 3.10.3 -> 3.11.0 b3e823fc968c vscode-extensions.sas.sas-lsp: 1.11.0 -> 1.12.0 (#361217) 2dcaea7a2d3a typstyle: 0.12.5 -> 0.12.6 (#361253) 499361c88b5c nixos/gnupg: fix typo (#361074) a29b36945dad notepadqq: fix build 586f6130349d lib/licenses: fix lens license URL (#360654) be8d39928e3c libevdevc: fix cross compilation, format with nixfmt (#360169) f3853c6f26d2 gamescope: fix cross compilation (#360164) c97d21dd36bb sums: 0.11 -> 0.13 (#361107) fd2ce8263139 bdf2psf: 1.230 -> 1.232 7e8382eeb162 zoom-us: 6.2.10 -> 6.2.11 (#361097) 6c5e69236202 slurm: 24.05.4.1 -> 24.11.0.1 fed5bcc9eb60 nodejs: fix build on 32 bit platforms (#354842) d38d4226c648 vscode: fix fhsenv version (#360888) 9bbe6cf2f157 libgbinder: 1.1.40 -> 1.1.41 1553e309e56b websurfx: 1.20.7 -> 1.20.13 37166ee32164 shairport-sync-airplay2: 4.3.4 -> 4.3.5 (#361119) 3d2f6c05c9f9 kubeseal: 0.27.1 -> 0.27.2 c823bfba6168 lcrq: 0.2.1 -> 0.2.3 d6d4c8516e0c python312Packages.unifi-ap: 0.0.1 -> 0.0.2 d00977e384dc tree: 2.1.3 -> 2.2.1 3da53a0ecfe3 python312Packages.django-axes: 7.0.0 -> 7.0.1 49d98edb5114 haproxy: 3.0.5 -> 3.1.0 ae077ea2483d kronosnet: 1.29 -> 1.30 90c4ec91e35d credslayer: mark as broken b19d2f5ac24c mandown: 0.1.4 -> 0.1.5 4bc254a73082 darwin.iproute2mac: 1.4.1 -> 1.5.4 bcda866739d2 darwin.iproute2mac: refactor 178b701ef353 darwin.iproute2mac: format with nixfmt 7589c944d958 python312Packages.flask-allowed-hosts: 1.1.2 -> 1.2.0 (#361132) 1760e04382ff python312Packages.aioopenexchangerates: 0.6.16 -> 0.6.17 d758f880e617 python312Packages.mypy-boto3-builder: 7.26.1 -> 8.5.0 89f4dd9602ba busybox-sandbox-shell: fix eval for musl 9cbf98a99831 python312Packages.netdata: 1.2.0 -> 1.3.0 6369dcd1327a python312Packages.yoda: 2.0.1 -> 2.0.2 c409cc2c79a2 python312Packages.pyezviz: 0.2.2.4 -> 0.2.2.4a cf88793e3e52 python312Packages.aiostreammagic: 2.8.4 -> 2.8.5 (#355514) f18e00076ee0 mint-y-icons: 1.7.8 -> 1.7.9 (#361135) 80d3661cbb15 python312Packages.holidays: 0.61 -> 0.62 7e0671b79ab9 python312Packages.aioacaia: 0.1.9 -> 0.1.10 (#360144) f832f404a50c python312Packages.plugwise: 1.5.2 -> 1.6.1 (#360582) 422630eaa330 python312Packages.policy-sentry: update disabled ee64502f2131 kubescape: 3.0.19 -> 3.0.21 5f4e098fbdc5 typstyle: 0.12.5 -> 0.12.6 d87278c8e119 mujoco: 3.2.5 -> 3.2.6 25df979ed010 kubescape: migrate to versionCheckHook a70b0958b948 vimPlugins.blink-cmp: add updateScript 6af89f26532b dbgate: add desktop entries (#359534) 6013083e7588 dnsx: add versionCheckHook 2ae24b12461e nixos/gnupg: fix typo 11d2c2f009a6 dnsx: refactor f5308303dd77 python312Packages.uproot: 5.5.0 -> 5.5.1; fix build (#357938) 928163d8c55b dnsx: format with nixfmt 5b5043eaa798 uncover: add versionCheckHook 9006a164116e uncover: refactor 896d058ebcf5 mediamtx: 1.9.2 -> 1.9.3 de9af45125b6 uncover: format with nixfmt 7c2b2e383520 tlsx: format with nixfmt 58c00ebdac71 python312Packages.pythonnet: use correct dotnet sdk in fetch-deps 41c32298f90f python312Packages.clr-loader: use correct dotnet sdk in fetch-deps e3b71cc6e1c2 dotnet-{sdk,runtime,aspnetcore}_9: add as top-level packages 3709deefc668 httpx: add versionCheckHook 9888edd1e785 buildGraalvm: fix build on x86_64-darwin (#360254) 7257077fe55f zathura: expose version 8f6c2ad7d12b zitadel: use pname ffd47e132bb1 zod-engine: expose pname 1663ca3de8d1 forgejo-runner: 4.0.1 -> 5.0.3, various quality-of-life improvements (#360535) 89bea7b45200 xeus-cling: fix improper linking with LLVM (#351130) 89a3c7e9f02a nixos/prometheus: add fallback_scrape_protocol and scrape_protocols options (#361223) fe3a65826f5a kubelogin: 0.1.4 -> 0.1.5 c9f879c11437 zed-editor: 0.163.2 -> 0.163.3 53f3c92b4d1f spl: 0.4.1 -> 0.4.2 (#361226) efbd47f639b7 lxqt.lxqt-notificationd: 2.1.0 -> 2.1.1 debf187c9a08 lxqt.lxqt-panel: 2.1.2 -> 2.1.3 aef0614650a9 update supported platforms 9af0d6388273 staging-next 2024-11-30 (#360437) 813a35d37f7a nuclei: add versionCheckHook 518dec21c06c aider-chat: 0.65.0 -> 0.66.0 (#360917) 32b68749d21d scala-cli: 1.5.1 -> 1.5.4 1649adc155e8 nixos/prometheus: add fallback_scrape_protocol and scrape_protocols options 6a4a92acc16c spl: 0.4.1 -> 0.4.2 16c8216a6621 envision-unwrapped: 0-unstable-2024-10-20 -> 1.1.1 (#360652) e395e33b0576 unison-ucm: 0.5.28 -> 0.5.29 674c82128b22 asnmap: format with nixfmt ffcd04865fbd en-croissant: use fetchCargoVendor da6ec030c5f7 mouse-actions-gui: use buildRustPackage 16f30cf21083 {buildRustPackage,fetchCargoTarball,fetchCargoVendor}: respect cargoRoot 0c492272828b ci: Update pinned Nixpkgs (#361165) 6e3ba153f2cc vscode-extensions.sas.sas-lsp: 1.11.0 -> 1.12.0 c163cc5f87e1 bitwuzla: 0.6.0 -> 0.6.1 (#360966) cc423c28a04f ci/eval: Also count added packages as rebuilds (#361206) b43da9aef563 buildFHSEnv: fix cross compilation (#361195) 48c57334ef26 naabu: add versionCheckHook 56340f00bdc0 Reduce warning spam from `nix search` (#355271) f835ff5a2a97 ntpd-rs: 1.3.0 -> 1.3.1 f7727d11336a python312Packages.enlighten: 1.12.4 -> 1.13.0 ab143f4a0a62 pythia: 8.311 -> 8.312 108b6b7dfe36 citrix-workspace: 24.5.0.76 -> 24.8.0.98 (#360106) d1ed012f737f otb: init at 9.0.0 (#325630) 86d6b891af56 metasploit: bump dependencies, add versionTest (#359998) 5186d9edba70 wgo: 0.5.6d -> 0.5.7 5ef3bc8da428 naabu: 2.3.2 -> 2.3.3 449314825e46 ci/eval: Also count added packages as rebuilds 2e0989bc2542 decasify: init at 0.8.0 (#355894) 399699f33586 librepcb: 1.1.0 -> 1.2.0 a20b194e4f78 graalvmCEPackages.graaljs: 24.0.1 -> 24.1.1 (#358485) caa73d0e0201 wapiti: 3.2.1 -> 3.2.2 338849ddd69c qgroundcontrol: 4.4.2 -> 4.4.3 e2f38cddadff python312Packages.pyexploitdb: 0.2.56 -> 0.2.57 3b932c5d6fd8 python312Packages.usb-monitor: 1.21 -> 1.23 (#361020) 63a869db05ca texlivePackages: add homepage (#321744) 6ff1f11bfdf9 raffi: 0.5.1 -> 0.6.0 (#360317) 66d58959130e buildFHSEnv: fix cross compilation 887f2e1219d1 vscode-extensions.streetsidesoftware.code-spell-checker: 4.0.16 -> 4.0.21 (#361001) b911b0cff7e9 symfony-cli: 5.10.4 -> 5.10.5 (#361002) 701c67100c3a python312Packages.uxsim: 1.7.0 -> 1.7.1 (#360168) 8f1d4f699a1b python312Packages.pytado: remove 71af5cf7214c envision-unwrapped: 0-unstable-2024-10-20 -> 1.1.1 299dc0eb68d1 osm2pgsql: 2.0.0 → 2.0.1 75fd236586f2 sane-airscan: 0.99.29 -> 0.99.30 cba792e13db4 poac: 0.5.1 -> 0.10.1 (#342790) 66d1ea290e4f zram-generator: 1.1.2 -> 1.2.1 (#359850) f2558b134bd4 python312Packages.types-psycopg2: 2.9.21.20240819 -> 2.9.21.20241019 88814f34997f nixos/keycloak: Enable Dual-Stack by default. (#360845) ca6e9b7b31d0 Remove myself from maintainers. (#361175) 419307c424a4 coroot: 1.5.11 -> 1.6.3 (#360372) 049271b4a27a archivebox: fix build and add singlefile (#358588) 31c82483626a julia.withPackages: Darwin support (#360353) b696e6361516 kubernetes-controller-tools: 0.16.4 -> 0.16.5 (#360127) 2460a210041d phrase-cli: 2.33.1 -> 2.34.1 (#360129) 45ff3869fb63 opensearch: 2.17.1 -> 2.18.0 (#360597) c62f9b26b01b treewide: lib.warn -> lib.warnOnInstantiate cf9805af62a0 lib.derivations: add warnOnInstantiate 3329cb495ad4 stylelint: 16.9.0 -> 16.11.0 (#360524) dcef80db233d python312Packages.dicomweb-client: 0.59.1 -> 0.59.3 (#360701) fda2bd1711ec kclvm_cli: 0.10.3 -> 0.10.8 (#360590) c05a3209ed64 dpp: 10.0.32 -> 10.0.35 (#360612) 5a3e06e720bd halo: 2.20.5 -> 2.20.10 (#360610) daf57bbf5dd1 markuplinkchecker: 0.18.0 -> 0.19.0 (#360490) 8f828a3c50a3 mpremote: 1.24.0 -> 1.24.1 (#360655) 51c05b0861f9 sbt: 1.10.2 -> 1.10.6 (#360688) 9298849129eb diswall: 0.6.0 -> 0.6.1 (#360855) 6a7837bb958d python312Packages.dicomweb-client: 0.59.1 -> 0.59.3 cbefb908e709 python312Packages.dicomweb-client: minor refactor (#360852) 2ddef00e8837 klog-time-tracker: 6.4 -> 6.5 (#359861) 62f13368e68f python312Packages.zcbor: 0.9.0 -> 0.9.1 (#360983) e63a85ca23f3 moonfire-nvr: 0.7.7 -> 0.7.17 (#360015) 83e6c35cbd44 otus-lisp: 2.5 -> 2.6 (#360898) e2a45abe9422 infisical: 0.31.8 -> 0.32.0 (#360944) 175066b7e550 pcsx2: 2.1.127 -> 2.3.39 (#360237) 476e0b59aa5f Remove myself from maintainers. 6f99314d0c38 python312Packages.niaclass: 0.2.0 -> 0.2.1 (#359876) 0f4b675d2fc7 pipeline: 2.0.2 -> 2.0.3 (#360967) a86b5873b6e3 nixos/ananicy: fix eval when hardened kernel is used with ananicy-cpp 35776e11a56a gitopper: 0.0.16 -> 0.0.20 (#360975) 250ff660022a python312Packages.pyvo: 1.5.3 -> 1.6 (#360261) 5b7b4996e2aa x42-plugins: 20230315 -> 20240611 (#360268) ae5d6bcc8e54 mixxx: 2.4.1 -> 2.4.2 (#360507) dbf753c54491 tandoor-recipes: drop maintainership (#359603) 187df981b7ff photoqt: 4.6 -> 4.7 d448e0395714 utm: 4.5.4 -> 4.6.2 355bd474d73a unison-ucm: 0.5.27 -> 0.5.28, add native aarch64-darwin support (#360905) ebca0a6b9a39 nerd-fonts: improve error message for old package (#360914) b64d706fa435 comet-gog: 0.1.2 -> 0.2.0 (#359481) 44b831c0b166 Merge master into staging-next c9bbb9962cf7 ci: Update pinned Nixpkgs cd519af995cc Added `boot.modprobeConfig.useUbuntuModuleBlacklist`. (#290330) 3b082a594cbc netlify-cli: 17.37.1 -> 17.37.2 (#360743) 21ced09826a7 organicmaps: 2024.09.08-7 -> 2024.11.12-7 (#358209) 3d3a119dce9a vacuum-go: 0.14.1 -> 0.14.3 (#360802) 898a5023f39d nixos/boot: merge to maintain commit signatures 548eb2776de0 nixos/boot: remove lib.mdDoc from boot.modprobeConfig.useUbuntuModuleBlacklist 93dcf8df4c2c philipstv: init at 2.1.1 9763b802cea9 php.extensions.uuid: init at v1.2.1 (#360352) b9e553d8c083 tinycompress: 1.2.11 -> 1.2.13 (#361148) 41a0a66be21c python312Packages.tensordict: disable flaky test_map_iter_interrupt_early on all platforms (#361008) 1e416e4414da wireplumber: 0.5.6 -> 0.5.7 (#361142) d57718d1b344 citrix-workspace: 24.5.0.76 -> 24.8.0.98 3be76dae000a etlegacy-unwrapped: fix Darwin build (#361063) 2227975f9d04 citrix-workspace: add flacks af24e6840b89 wireplumber: 0.5.6 -> 0.5.7 e6b09cd21bba utm: format with nixfmt 62b5e44e1298 tinycompress: 1.2.11 -> 1.2.13 d2f5c28d0dfc containerd: 1.7.23 -> 2.0.0 (#356618) 708c16b14f1c plocate: 1.1.22 -> 1.1.23 46402be06066 nixos/knot: add missing CLIs to wrapper 58dfbf4032ab librenms: 24.10.1 -> 24.11.0 (#359456) 94d17479d4d3 nixos/searxng: limiter.toml reference moved (#348761) 9c3a8465ed36 mint-y-icons: 1.7.8 -> 1.7.9 b59849582809 jetbrains.rider: use dotnet sdk 8 as sdk 7 has been marked insecure (#360383) 2596f0e21c13 python312Packages.flask-allowed-hosts: 1.1.2 -> 1.2.0 2aed365b52a9 python312Packages.uproot: 5.5.0 -> 5.5.1 4feb3eeff3bc python312Packages.scikit-hep-testdata: 0.4.48 -> 0.5.0 23a7a7d8b430 lib/types: init {types.attrsWith} (#354738) a5291b34f8b5 lazygit: remove with lib 82ba3fec8d0d python312Packages.boost-histogram: skip failing test on aarch64-darwin (#360813) f690eab6e252 python3Packages.cyipopt: init at 1.5.0 (#349036) 37ab9f72863b python312Packages.pytensor: disable failing tests on darwin (#360745) 399e582e18d5 lib.types: improve performance on attrsWith a2f0b1adc78b python3Packages.eth-typing: 4.0.0 -> 5.0.1 (#360667) 400af872cec4 networkd-dispatcher: don't patch conf file path, add extraArgs option (#265348) 0186d2908260 cargo-lock: 9.0.0 -> 10.0.1 bb6be59fc340 gg-jj: init at 0.23.0 (#360354) 8f5afb644388 grim: khaneliman adopt package 88196cc0760e python3Packages.sopel: add missing packaging dependency and mainProgram (#342045) d5eccbbbae7b lib/types: standardise attrsOf functor.wrapped warning and add a test e6944db042eb vscode-extensions: make `pname` optional (#361052) fc7422af7186 xlogo: 1.0.6 -> 1.0.7 (#361104) 845b25f26b1a geoserver: 2.26.0 -> 2.26.1 (#360880) 15042902eab7 vim-utils.nix: format (#360892) d02a05e5ac10 librecast: 0.8.0 -> 0.9.1 c3f3e5492d3c librime-lua: 0-unstable-2024-08-19 -> 0-unstable-2024-11-02 (#360780) 818c30aed4bd python312Packages.refoss-ha: 1.2.4 -> 1.2.5 (#361115) 2f6cdb78610c shairport-sync-airplay2: 4.3.4 -> 4.3.5 14f4431d123b lib/modules: Minor performance optimisation 8622e1001983 python312Packages.refoss-ha: 1.2.4 -> 1.2.5 e193a72e6032 sums: 0.11 -> 0.13 2cf7ed414543 mate.mate-applets: 1.28.0 -> 1.28.1 bd9f8a28f786 checkov: 3.2.322 -> 3.2.324 (#361034) 39929efeb334 python312Packages.hstspreload: 2024.11.1 -> 2024.12.1 (#361040) a4dba94bfdf1 linuxPackages_latest.prl-tools: 20.1.1-55740 -> 20.1.2-55742 (#360709) a145c8690642 xlogo: 1.0.6 -> 1.0.7 8c4d52786dfb feishin: 0.11.1 -> 0.12.1 (#359962) 5b1ae7b5fa40 exprtk: 0.0.2 -> 0.0.3 (#361003) aeccc55bcb45 zoom-us: 6.2.10 -> 6.2.11 1294e798cbc1 nixos/signald: automatically migrate db (#202923) 26a0b5a37c2c python312Packages.pycomposefile: 0.0.31 -> 0.0.32 (#361011) 6bafa30f8d8c kdePackages.fcitx5-qt: 5.1.7 -> 5.1.8 (#361013) 3cfd18967c12 openvswitch: 3.4.0 -> 3.4.1 (#345621) fcabe28cf022 python312Packages.wtf-peewee: 3.0.5 -> 3.0.6 (#361014) f9a3f5e53b1d python312Packages.pydrawise: 2024.9.0 -> 2024.12.0 (#360949) e76eb1bf76fe python312Packages.spotifyaio: 0.8.10 -> 0.8.11 (#360951) b834a52cc3f8 slimserver: 8.5.2 -> 9.0.0 2e00fd6d072f Drop nix 2.18 (#359215) 23c2d03311a1 otpauth: 0.5.2 -> 0.5.3 539999c8c08e perlPackages.AudioScan: 1.05 -> 1.10 df0a5e3f01e2 quba: 1.4.0 -> 1.4.2 (#360955) 67d5898578da notify: 1.0.6 -> 1.0.7 (#360959) 9cddc5d8426e yaml2json: 1.3.3 -> 1.3.4 (#360961) a73ceafa18d3 cargo-rdme: 1.4.5 -> 1.4.8 (#360972) 925d0865fce6 nf-test: 0.9.1 -> 0.9.2 (#360973) d355a72b4bb2 pyrosimple: 2.14.0 -> 2.14.1 (#360912) efd422dd7e9a nixos-bgrt-plymouth: 0-unstable-2023-03-10 -> 0-unstable-2024-10-25 (#360927) 06af2cf911c7 python312Packages.es-client: 8.15.1 -> 8.15.2 (#360932) 81ef4cc75fb9 protolint: 0.50.5 -> 0.51.0 (#360938) fb31bce4f9a8 python312Packages.pydrive2: 1.20.0 -> 1.21.3 (#360943) a117e75daaf4 python312Packages.garth: 0.4.46 -> 0.4.47 (#360945) 8341a07bf55e giza: 1.4.1 -> 1.4.2 3828bc6e1102 nixos/kea: fix settings example (#361068) fc3ca3479a7d obs-studio-plugins.input-overlay: 5.0.5 -> 5.0.6 (#359973) 6b75fd71bd34 bfs: 4.0.3 -> 4.0.4 (#360868) 804b2e10ec90 python312Packages.torchrl: skip flaky tests dcffa1246c7e python3Packages.netbox-plugin-prometheus-sd: specify source hash (#361069) fe45c942b475 mint-themes: 2.1.9 -> 2.2.0 (#361071) 59a78fb6055d etlegacy-unwrapped: autoformat nixfmt b7e33cda3254 etlegacy-unwrapped: add more compilation flags 96aa751629d6 etlegacy-unwrapped: fix Darwin build 187deac429b5 python3Packages.netbox-plugin-prometheus-sd: specify source hash d3da67a1ac0e invidious: fix playback for proxied video streaming (#360926) baad7715eab2 mint-themes: 2.1.9 -> 2.2.0 ad36bd5cf047 python312Packages.jupyter-docprovider: 1.0.0 -> 1.0.1 (#361062) 201b0b054e8d python3Packages.cyipopt: init at 1.5.0 1e0c4e50b0bf network: Fix cycle dependency causing race of netdev and address configuration (#352523) 488df6fd9275 monkeysAudio: 10.76 -> 10.81 (#360264) ac86a85402b5 Merge master into staging-next 9a0ae3a604a5 tandoor-recipes: drop maintainership 6785af4d505f turn-rs: 3.1.0 -> 3.2.0 (#360784) bf293b13cd6b grafana-alloy: 1.4.3 -> 1.5.0 (#360902) 798c3d20d385 nixos/kea: fix settings example 65350680a0b8 gg-jj: init at 0.23.0 38003ce53b48 workflows/eval: Add the eval summary as a comment 8c819ae53d1f simplotask: 1.16.0 -> 1.16.1 (#360970) e5e661b30ab5 ocamlPackages.ca-certs-nss: 3.103 -> 3.107 d36948193492 python312Packages.jupyter-docprovider: 1.0.0 -> 1.0.1 741c4b449088 python312Packages.napari-nifti: init at 0.0.17 (#334471) 61e061ef6618 terraform-compliance: 1.3.48 -> 1.3.49 (#360676) 7fe2c827fc96 shotcut: fix reference to ffmpeg in patch (#354862) f5e0837efc36 proton-ge-bin: Automate switching to new GE-Proton version after update (#355066) bb6efb84a3dc bitmask-vpn: fix calyx build (#348299) 025394c3f67c shotcut: fix reference to ffmpeg in patch d4f2666ce0d9 trojan-rs: init at 0.16.0-unstable-2024-11-21 (#295234) 12c4224d83da nixos/shairport-sync: restart the systemd service on failure (#357253) cd6311621925 labwc-tweaks-gtk: 0-unstable-2024-10-20 -> 0-unstable-2024-11-25 (#360794) 09801c985b44 vscode-extensions: make `pname` optional a68a09ea6e4a xtf: 0-unstable-2024-09-13 -> 0-unstable-2024-11-01 (#360673) 35838a8a4d7b python312Packages.aiohttp-fast-zlib: 0.1.1 -> 0.2.0 (#359786) 042600690d4e mame: 0.270 -> 0.272 (#360815) 8f1d83efeb0f python312Packages.hstspreload: 2024.11.1 -> 2024.12.1 5c00b1e11ebc fna3d: 24.11 -> 24.12 (#360928) c1d0a025aab8 linuxKernel.kernels.linux_lqx: 6.11.5-lqx1 -> v6.12.1-lqx1 4fef32823db6 linuxKernel.kernels.linux_zen: 6.11.5-zen1 -> v6.12.1-zen1 dd9a2e26ac31 nixos/nat: Match iptables behavior with nftables, add externalIP check (#277016) 73fd950c8938 python312Packages.pipenv-poetry-migrate: 0.5.11 -> 0.5.12 (#360820) 120f127da4f0 dvc: 3.57.0 -> 3.58.0 a766b3c2165d python312Packages.botocore-stubs: 1.35.71 -> 1.35.72 eaf8bb7e7dc7 python312Packages.boto3-stubs: 1.35.71 -> 1.35.72 be6c902b8e21 python312Packages.bc-detect-secrets: 1.5.27 -> 1.5.28 4cf1c43a163b python312Packages.aiortm: 0.9.37 -> 0.9.38 b8d5143f7f67 svgbob: 0.7.2 -> 0.7.4 274a969f14e0 mediawriter: 5.2.0 -> 5.2.2 118b50cb23bf checkov: 3.2.322 -> 3.2.324 bd653298c22b python312Packages.tencentcloud-sdk-python: 3.0.1274 -> 3.0.1275 b9ffe0d2ef58 python312Packages.jupyter-server-ydoc: 1.0.0 -> 1.0.1 (#361025) ad8c9282b5b7 liana: 6.0 -> 8.0 (#343429) 9673dfc97702 seatd: 0.8.0 -> 0.9.1 7061537bb7c5 python312Packages.jupyter-server-ydoc: 1.0.0 -> 1.0.1 a9f1795e90f9 php.extensions.uuid: init at v1.2.1 61237cf74109 busybox-sandbox-shell: replace pkgsStatic with useMusl (#314845) 1af9e10973cb nixos/dockerTools: fixup proot/fakeroot code - exclude also dev (#308603) 8fc0ae40aa50 python312Packages.usb-monitor: 1.21 -> 1.23 dfc70891556b python312Packages.wtf-peewee: 3.0.5 -> 3.0.6 8ee13c3c6b63 python312Packages.notus-scanner: 22.6.4 -> 22.6.5 (#359608) cb1f5fbccf1b gitxray: 1.0.16 -> 1.0.16.4 (#360357) e105c62d1ebc python312Packages.publicsuffixlist: 1.0.2.20241129 -> 1.0.2.20241130 (#360401) 8a23a5eff85a python312Packages.signxml: 4.0.2 -> 4.0.3 (#360402) 82b685d683ea kdePackages.fcitx5-qt: 5.1.7 -> 5.1.8 8c66c2ecc7e9 prowler: 4.4.1 -> 4.6.1 (#360408) ed6cdbf5cc70 mdformat: 0.7.18 -> 0.7.19 (#360409) 730dc358d97a python312Packages.crontab: 0.23.0 -> 3.2.0 (#360418) d003febf8808 python312Packages.powerapi: init at 2.9.1 (#360441) ae9345434903 python312Packages.aioacaia: 0.1.9 -> 0.1.10 (#360446) ab5e510d610e python312Packages.denonavr: 1.0.0 -> 1.0.1 (#360447) 0ac057880479 python312Packages.reolink-aio: 0.11.3 -> 0.11.4 (#360448) a9f0bf6adbe8 python312Packages.pysuezv2: init at 1.3.2 (#360460) 64fb78fc130a python312Packages.aiohomeconnect: init at 0.6.0 (#360584) 79632371f69e python312Packages.pysigma: 0.11.17 -> 0.11.18, python312Packages.pysigma-backend-elasticsearch: 1.1.3 -> 1.1.5 (#360586) e53e9be8c516 python312Packages.tensordict: disable flaky test_map_iter_interrupt_early on all platforms 4e8f6593c0fe python312Packages.tensordict: enable now succeeding tests 254617cd4701 python312Packages.pycomposefile: 0.0.31 -> 0.0.32 ee236bddda75 podman-tui: 1.2.3 -> 1.3.0 (#360795) 161f4d4f4464 python312Packages.jupyter-collaboration-ui: 1.0.0 -> 1.0.1 (#360981) 89ea1d479f9b pinact: format and add updateScript (#353998) ba3bbb862c85 typos: 1.27.3 -> 1.28.1 (#360969) b48508f9ba23 symfony-cli: 5.10.4 -> 5.10.5 65e95fc72a44 git-pr: init at 0.0.2 (#330063) d1279767b764 nco: 5.2.8 -> 5.2.9 (#360520) 54377503a957 vimPlugins.snacks-nvim: 2024-11-26 -> 2024-12-01 (#360824) ddee4ec6db5a autosuspend: 7.0.2 -> 7.0.3 (#360963) a951f0810239 Merge master into staging-next 59837600cd88 exprtk: 0.0.2 -> 0.0.3 20b99a077254 vscode-extensions.streetsidesoftware.code-spell-checker: 4.0.16 -> 4.0.21 7746ea988939 Revert "lib.filesystem.packagesFromDirectoryRecursive: refactor" (#360996) 940db5766a96 Revert "lib.filesystem.packagesFromDirectoryRecursive: refactor (#359941)" f32579d1913e ruby_3_2: 3.2.5 -> 3.2.6 (#356446) 1bfa6721a3ab mercure: 0.16.3 -> 0.17.1 (#360752) 868ae9a62f97 lazygit: use go1.22 ccd6676357d3 ocaml: 5.2.0 → 5.2.1 2ebd6b68543d liana: migrate to new fetcher 415ef7a35579 dashy-ui: fix uncalled settings override phase (#360933) a9cc274baa92 edgedb: 5.5.2 -> 6.0.0 (#360143) 0e96b0026fe3 entt: 3.13.2 -> 3.14.0 (#360968) d2662f39f752 liana: 6.0 -> 8.0 159994ed8606 Merge master into staging-next 0b3b7f5650b5 gojq: 0.12.16 -> 0.12.17 (#360767) 5c6c7bd75944 Merge master into staging-next b112d6f62c5d python312Packages.zcbor: 0.9.0 -> 0.9.1 91071a2b278a poetryPlugins.poetry-plugin-up: 0.7.3 -> 0.8.0 (#360910) 70182baee7f9 python312Packages.jupyter-collaboration-ui: 1.0.0 -> 1.0.1 26a517c504b6 terraform-providers.equinix: 2.9.0 -> 2.11.0 aefb0ad14fff terraform-providers.spotinst: 1.195.0 -> 1.199.2 cb8087cfd588 terraform-providers.fastly: 5.14.0 -> 5.15.0 a2a56dac57f1 terraform-providers.akamai: 6.5.0 -> 6.6.0 49d24a52e42d terraform-providers.kubectl: 1.14.0 -> 1.16.0 871d435cd6d4 proj: 9.5.0 -> 9.5.1 5416c7b9a0d5 t-rex: broken with rust 1.80, won't be fixed upstream 637ede4d8184 gitopper: 0.0.16 -> 0.0.20 b3aee224608b nf-test: 0.9.1 -> 0.9.2 97ee54529254 cargo-rdme: 1.4.5 -> 1.4.8 f53eb6bded47 botan{2,3}: always set --cpu, fix cross compilation (#359883) b6d6c296a7eb btrfs-progs: 6.11 -> 6.12 (#360321) a214c2e6f24a typos: 1.27.3 -> 1.28.1 67c8eb58f530 simplotask: 1.16.0 -> 1.16.1 92374ea8a863 entt: 3.13.2 -> 3.14.0 d218593a80db pipeline: 2.0.2 -> 2.0.3 f9a383b08ebd bitwuzla: 0.6.0 -> 0.6.1 4741b83d0fdb fanbox-dl: 0.23.2 -> 0.27.1 (#360841) c6f7529b1e74 autosuspend: 7.0.2 -> 7.0.3 aa1ac1151da9 yaml2json: 1.3.3 -> 1.3.4 c8f68652d8ff notify: 1.0.6 -> 1.0.7 274e92547fb8 python312Packages.x-wr-timezone: 1.0.1 -> 2.0.0 (#359646) 9975be9696f7 python312Packages.pynecil: 0.2.1 -> 1.0.1 (#360217) 240c53b527ea treewide: remove unused clang from build closure (#360711) 3265888eb462 libdeltachat: 1.151.1 -> 1.151.2 (#360280) 8bda6ea01c1a tests: network: update `nixosTests.networking.scripted.virtual` to match correct behavior 9354d385e2c0 network: Fix cycle dependency causing race of netdev and address configuration cdd53bc4a8cb quba: 1.4.0 -> 1.4.2 5d776e2586ea jawiki-all-titles-in-ns0: 0-unstable-2024-10-01 -> 0-unstable-2024-12-01 (#360789) f779fbc72d4e jp-zip-codes: 0-unstable-2024-10-01 -> 0-unstable-2024-12-01 (#360790) b363ffa9a8df dash-mpd-cli: init at 0.2.23 3ea42f852aa9 latexminted: 0.3.0 -> 0.3.2 (#360021) 602364b9b207 python312Packages.spotifyaio: 0.8.10 -> 0.8.11 f7cf15307c3a python312Packages.pydrawise: 2024.9.0 -> 2024.12.0 3f8b8796f53e python312Packages.garth: 0.4.46 -> 0.4.47 7abb6b029fc4 bitwig-studio: add libnghttp2 library (#360748) 0cc514472fac invidious: fix playback for proxied video streaming 8801ef507afd infisical: 0.31.8 -> 0.32.0 434447f72429 folio: 24.13 -> 24.14 (#360931) dc858dbd6f5c python312Packages.pydrive2: 1.20.0 -> 1.21.3 50d473d6ff60 python312Packages.ihcsdk: 2.8.7 -> 2.8.9 (#360297) d306e5d016ac python312Packages.rmscene: 0.5.0 -> 0.6.0 (#360209) 758dfb6dcf42 svkbd: 0.4.1 -> 0.4.2 (#359414) 441d8461eb41 linuxPackages_latest.prl-tools: update maintainers as requested 354d805e270c protolint: 0.50.5 -> 0.51.0 32cbecb28fd8 home-assistant-custom-lovelace-modules.bubble-card: 2.2.4 -> 2.3.0 (#360930) 54d2d7637c7c python312Packages.es-client: 8.15.1 -> 8.15.2 7b4ff152a2fa folio: 24.13 -> 24.14 e1d3f4f13caf fna3d: 24.11 -> 24.12 deafd40c2560 nixos-bgrt-plymouth: 0-unstable-2023-03-10 -> 0-unstable-2024-10-25 7df32823cc8a buildFHSEnv: symlink libexec into the FHS tree (#328685) 8cb4eb65322e cables: 0.3.2 -> 0.4.4 82f83292640c aider-chat: 0.65.0 -> 0.66.0 d0dc7b771a82 vimPlugins.tiny-devicons-auto-colors-nvim: init at 2024-08-23 2468fe55609a nerd-fonts: improve error message for old package 238b952e9724 Merge master into staging-next c39723ebf53a pyrosimple: 2.14.0 -> 2.14.1 2c15aa59df00 hickory-dns: 0.25.0-alpha.3 -> 0.25.0-alpha.4 (#360696) 29d3e70e5399 poetryPlugins.poetry-plugin-up: 0.7.3 -> 0.8.0 f1ec9da98baa apko: 0.19.6 -> 0.20.1 (#359839) 74a070506d83 unison-ucm: 0.5.27 -> 0.5.28, add native aarch64-darwin support cdc518b50a85 Merge sublime-merge: set meta.mainProgram (#358726) e7447b790fd9 Merge libadwaita: 1.6.1 -> 1.6.2 (#358327) b17b5e480591 python312Packages.napari-nifti: init at 0.0.17 879717af9459 python312Packages.medvol: init at 0.0.15 222b59113bdc grafana-alloy: 1.4.3 -> 1.5.0 69614d6364a6 ntfy-alertmanager: 0.3.0 -> 0.4.0 (#360677) 3a3b818fe260 allure: 2.31.0 -> 2.32.0 (#360838) 9f7964d314f8 otus-lisp: 2.5 -> 2.6 8b125fe422e7 emacsPackages.isearch-plus: 3434-unstable-2023-09-27 -> 3434-unstable-2024-10-13 (#360657) 19453eac5c59 vim-utils.nix: format 12133f63ca52 apx: 2.4.3 -> 2.4.4 (#360705) b862d470f85e dbip-asn-lite: 2024-11 -> 2024-12 ac49fcf06804 dbip-city-lite: 2024-11 -> 2024-12 5789cc9dedc5 ciscoPacketTracer7: fix fhsenv version f44bae80ccb3 dbip-country-lite: 2024-11 -> 2024-12 4e87a01cd02a vscode: fix fhsenv version 81594eb1b181 ammonite: add ammonite for Scala 3.3 (#315872) afb7a68ef79c conda: fix fhsenv version e91f2ae0aa64 smartcat: 2.1.0 -> 2.2.0 (#360825) 5ce06a7a9657 metasploit: reformat a31a2b90ad17 janus-gateway: 1.2.4 -> 1.3.0 ac0619555532 rattler-build: 0.29.0 -> 0.31.1 (#360457) f31106aa861d geoserver: 2.26.0 -> 2.26.1 491c8c8e0a0f nixos/netbird: fix coturn configuration (#356267) 01271ee28160 vimPlugins.wezterm-nvim: init at 2024-09-26 (#360822) 53cf7d9cf210 gitlab-runner: Fix marshalling of TOML datetimes (#360860) 11472f0d1b10 busybox-sandbox-shell: replace pkgsStatic with useMusl 47dc5232ba7a python3Packages.netbox-plugin-prometheus-sd: init at 1.1.1 (#307786) 5b3042490fcb bfs: 4.0.3 -> 4.0.4 9d4a034350db kakoune-lsp: 18.0.2 -> 18.1.0 (#360504) 3ad0927f72a6 virt-manager: 4.1.0 -> 5.0.0 (#359479) 2681fd3f0945 python312Packages.py3status: Fix typelib (#359630) 8e55d5ddd923 winbox4: 4.0beta9 -> 4.0beta12 (#360821) d34056b2189d nixos-rebuild-ng: disable _NIXOS_REBUILD_REEXEC for now 0d9ffb008b4a sm64coopdx: 1.0.3 -> 1.0.4 (#359768) 8540239004a2 forgejo-runner: only run passthru tests on linux 0a7dc31a8581 gitlab-runner: Try fixing #356717 7d0c560559f3 omnisharp-roslyn: bump from .NET 6 to 8, add support for 9 (#360598) ed63d349082e diswall: 0.6.0 -> 0.6.1 512859412f26 ci: fix GHA's rebuild-xxx: 5001+ labels (#360754) ffa1a59452c2 python312Packages.dicomweb-client: minor refactor dcfddbffccc2 amazon-ssm-agent: 3.3.987.0 -> 3.3.1345.0 (#360658) 46e5286de0bb vimPlugins.snacks-nvim: 2024-11-26 -> 2024-12-01 818502bd0cc3 python312Packages.qcs-sdk-python: 0.20.1 -> 0.21.4 (#360294) 694bb7123358 pupdate: 3.19.0 -> 3.20.0 (#360343) 1bc96e16df64 calamares: escape unfree package selection text quote (#360808) dd5ac98f894b nixos/keycloak: Enable Dual-Stack by default. 6533ff0b7ce9 flix: 0.52.0 -> 0.54.0 (#360627) 24c46fb9da32 mountpoint-s3: 1.10.0 -> 1.12.0 (#360622) 7414afd89222 fanbox-dl: 0.23.2 -> 0.27.1 870d90e3985b allure: 2.31.0 -> 2.32.0 7fd3ecc74da8 nixos/strongswan: update start_action option (#360731) b47354725fb0 ci/eval: test aliases b817d8fdc1b6 deno: 2.1.1 -> 2.1.2 (#360138) 13b4c34d5f9a vimPlugins.wezterm-nvim: init at 2024-09-26 a62bfc822e9d smartcat: 2.1.0 -> 2.2.0 44a4f0b71551 winbox4: add savalet as a maintainer 525a6c278dc2 maintainers: add savalet c14612d5019c zigbee2mqtt: 1.41.0 -> 1.42.0 (#360816) 2a7353c2fb42 python312Packages.pyngo: 2.2.1 -> 2.3.0 (#360819) d25d4fbeac6c prometheus-knot-exporter: 3.4.1 -> 3.4.2 (#360720) d6bb88d9ad40 winbox4: 4.0beta9 -> 4.0beta12 dc4fcebafa4a Merge master into staging-next 4a936cc90477 esphome: 2024.11.1 -> 2024.11.2 (#359642) ddc4245c7f0f python312Packages.pipenv-poetry-migrate: 0.5.11 -> 0.5.12 a70038cf313d python312Packages.pyngo: 2.2.1 -> 2.3.0 d481e810eed9 python312Packages.policy-sentry: 0.13.1 -> 0.13.2 0b3416b40b3b wget: modernize and use PCRE2 instead of PCRE1 (#360567) 75f2138681a9 zigbee2mqtt: 1.41.0 -> 1.42.0 1b9db3aa1df7 python312Packages.boltztrap2: fix build (#359697) ca9881638e77 ios-deploy: rename from darwin.ios-deploy (#359888) 3c0a0eb7e5d3 python312Packages.bambi: disable crashing tests on aarch64-darwin d52e10c2d783 mame: 0.270 -> 0.272 d44c2904dc7b python312Packages.boost-histogram: skip crashing test on aarch64-darwin d2301bd7c29b vimPlugins: nvimRequireChecks and nvimSkipModules for new nvimRequireCheckHook (#360800) dad3f6cdb5f5 libphidget22: 0-unstable-2024-04-11 -> 1.20.20240909 (#348834) e003161eac36 python312Packages.libknot: 3.4.1 -> 3.4.2 148d7842b419 calamares: escape unfree package selection text quote 6af0ef23718e vimPlugins: replace nvim-web-devicons deps with nativeCheckInputs 1442b2604df4 vimPlugins.cmp-*: add nativeCheckInputs 398bc4a60e78 vimPlugins: add modules to skip 889493e93065 libphidget22extra: 0-unstable-2024-04-11 -> 1.20.20240909 4c6a1b09291f libphidget22: 0-unstable-2024-04-11 -> 1.20.20240909 d3ba34c9e44f plausible: 2.0.0 -> 2.1.4 (#356221) 65b24f11053b python312Packages.boost-histogram: modernize derivation; use fetchFromGitHub ff9420be0064 trojan-rs: init at 0.16.0-unstable-2024-11-21 4b0caba2c5d4 nixos/activation, switch-to-configuration-ng, doc: improve NIXOS_LUSTRATE installation experience (#349049) 0dda2b6db95f ts_query_ls: init at 1.0.1 (#350834) 551230b7a99d buildGraalvmNativeImage: fix build on darwin-x86_64 83b526817ad2 buildGraalvm: fix build on x86_64-darwin 36f2ee4d6f17 n8n: 1.65.1 -> 1.70.1 (#360685) c9a3c08a8a51 ts_query_ls: init at 1.0.1 b09c677babc4 homebox: 0.15.2 -> 0.16.0 c7a4e4c50320 sd-image: fix raspberry pi 0 boot (#355469) 79ebfff20418 trezor-suite: 24.8.3 -> 24.11.3, remove deprecated use of --replace (#360615) 35aafbc6526c root: 6.32.08 -> 6.34.00 (#342062) 49f57fdb25cc nixos/hostapd: allow octothorpe characters in SAE password (#356079) dff5a9370c71 nixos/prometheus-exporters/libvirt: init 15dcbec89e67 prometheus-libvirt-exporter: init at 2.3.3 b42fae534c70 vacuum-go: 0.14.1 -> 0.14.3 a3ddcf0fcdaa vimPlugins: add require checks a1ed41a11240 appimageTools: use version (#359930) eaae909d2bcc workflows/eval: add markdown of added, removed and changed (#360339) 71ec67dcc77b mac: drop same package as monkeysAudio ddeb99747d98 monkeysAudio: 10.76 -> 10.81 9fd3fbebd30d linuxPackages.drbd: 9.2.9 -> 9.2.12 35d4e5e11b67 linuxPackages.drbd: 9.2.8 -> 9.2.9 e961c1fb71a3 phel: 0.13.0 -> 0.16.0 (#314348) 65daaacd2f8b podman-tui: 1.2.3 -> 1.3.0 a33d5124aab9 labwc-tweaks-gtk: 0-unstable-2024-10-20 -> 0-unstable-2024-11-25 30a6639e1757 cxx-rs: 1.0.94 -> 1.0.131 (#360528) 8671210eac43 php84Extensions.vld: 0.18.0 -> 0.18.0-unstable-2024-08-22 (#360732) 4e7f5ed7d141 python312Packages.meilisearch: 0.31.6 -> 0.32.0 (#359974) 6084c6865757 gpu-viewer: 3.06 -> 3.08 (#360782) a627dd97513d phel: 0.13.0 -> 0.16.0 1660153b4ec5 home-manager: 0-unstable-2024-10-20 -> 0-unstable-2024-11-29 (#360686) eb578501ec94 gdal: 3.9.3 -> 3.10.0 (#355220) 2ca068d24b63 vimPlugins.remote-nvim-nvim: init at 2024-08-04 (#360621) e6bff4c8858b bats: 1.11.0 -> 1.11.1 (#360281) 1feb9c7f288e cargo-xwin: 0.17.3 -> 0.17.4 (#360431) 63d3f47de702 pyflyby: 1.9.6 -> 1.9.8 (#360453) cffe57e20e22 thrift-ls: 0.2.2 -> 0.2.5 (#360458) 0bc5ff73440e svdtools: 0.3.19 -> 0.3.20 (#360459) 47c3a3cc53e2 python312Packages.pyinstaller-hooks-contrib: 2024.9 -> 2024.10 (#360472) a594234fd246 python312Packages.array-api-strict: 2.0.1 -> 2.2 (#360474) eb7b180c8405 syncthingtray: 1.6.2 -> 1.6.3 (#360570) bfa35cd85b36 anvil-editor: init at 0.4 (#356629) dd0e4634bf70 python312Packages.microsoft-kiota-http: 1.3.3 -> 1.3.4 (#360479) 31d66ae40417 python312Packages.moderngl: 5.11.1 -> 5.12.0 (#360484) c8593a7ef577 python312Packages.aiohomekit: 3.2.6 -> 3.2.7 (#360485) 06f65c558d99 kubefetch: 0.7.2 -> 0.8.0 (#360487) 6676b60f3366 netscanner: 0.6.0 -> 0.6.1 (#360493) 41ef5ff5594a pet: 0.9.0 -> 1.0.0 (#360501) d835701e5430 Merge branch 'gnome-notExcluded' 5e8ba4b53b34 Merge: sudo: 1.9.16 -> 1.9.16p2 (#355672) 24404eb78bc5 ddns-go: 6.7.2 -> 6.7.6 (#360509) f1d4dc5a516a novops: 0.17.0 -> 0.18.0 (#360510) 1c2752a62e71 python312Packages.[tf-]keras: update; enable tests (#359590) a05c9eac61d0 go-minimock: 3.4.1 -> 3.4.3 (#360511) fb5178c3c512 nixos-rebuild-ng: set capture_output=True to cleanup_ssh d704aae2cff6 nixos-rebuild-ng: add logging for captured output values 752c092c47a8 nixos-rebuild-ng: use shlex.quote instead of join in run_wrapper c4902dad75f9 nixos-rebuild-ng: use raw NIX_SSHOPTS in copy_closure 1f25b0f96106 sig: 0.1.3 -> 0.1.4 (#360516) b815c8f7123e xv: 6.0.1 -> 6.0.2 (#360517) 16b8abe04153 tio: 3.7 -> 3.8 (#360518) efabf4c14514 jp-zip-codes: 0-unstable-2024-10-01 -> 0-unstable-2024-12-01 81289bba347d pulldown-cmark: 0.12.1 -> 0.12.2 (#360526) 5f28b534ef2d jawiki-all-titles-in-ns0: 0-unstable-2024-10-01 -> 0-unstable-2024-12-01 3b5e1da6b965 csound-qt: 1.1.2 -> 1.1.3 (#360533) 45d1c6ebd828 parlay: init at 0.6.0 (#324684) 26ef78a428a1 android-udev-rules: 20241019 -> 20241109 (#360558) d37e098e8dc8 Revert "gnome-maps: remove absolute path in desktop entry" 6299ef8e856e helmfile-wrapped: 0.169.0 -> 0.169.1 (#360563) a1654b1d693f obs-cmd: 0.17.9 -> 0.18.0 (#360564) 95c4829df89f turn-rs: 3.1.0 -> 3.2.0 948e8141d2bb step-cli: 0.28.0 -> 0.28.2 (#360565) 9a8d597d1097 python312Packages.pysigma-pipeline-crowdstrike: 2.0.0 -> 2.0.1 (#360577) 7ca6242d3a37 goperf: 0-unstable-2024-09-05 -> 0-unstable-2024-11-18 (#360724) 490f3c528689 gpu-viewer: 3.06 -> 3.08 b72e028debb1 python312Packages.django-modeltranslation: 0.19.10 -> 0.19.11 (#360583) d58544bdc9a2 spacectl: 1.6.0 -> 1.7.1 (#360585) b95275f4a508 altair: 8.0.0 -> 8.0.4 (#360589) ab9829406221 vals: 0.37.7 -> 0.37.8 (#360596) 8e9fe4f7fd08 litmusctl: 1.11.0 -> 1.12.0 (#360599) 8a27f7b74ba5 step-kms-plugin: 0.11.6 -> 0.11.7 (#360601) dc6f94d3cdf1 cargo-public-api: 0.40.0 -> 0.42.0 (#360604) 78aaa12b0dc5 parallel-hashmap: 1.4.0 -> 1.4.1 (#360606) 2a1bf498aa46 nixos/installation-cd-base: add git & rsync (#325511) f745fa9d7ebf misconfig-mapper: 1.10.0 -> 1.12.3 (#360608) fc46ecd8c9cd nixos/strongswan: update start_action option 07a96b24992c nixos/installation-device: make openssh settings a default (#339786) f608d1b3bc10 nixos/acme: fix cert ownership assert for string `SupplementaryGroups` (#356064) 48d2cad13d36 numix-icon-theme-square: 24.07.19 -> 24.10.22 (#360717) 0feb83efa1a9 transgui: 5.18.0-unstable-2024-02-26 -> 5.18.0-unstable-2024-10-03 (#360721) 674fcaeea113 poac: 0.5.1 -> 0.10.1 bd08b27cc7a3 wgcf: 2.2.22 -> 2.2.23 (#360739) b2f741341cf5 protonmail-bridge: 3.14.0 -> 3.15.0 (#359899) cb5a2eddcb70 librime-lua: 0-unstable-2024-08-19 -> 0-unstable-2024-11-02 6b595ed68f5f viu: 1.5.0 -> 1.5.1 (#360740) f81a6f40af2b thunderbird-bin-unwrapped: 128.4.3esr -> 128.5.0esr (#360736) 6d2861cd8e70 python312Packages.databricks-sql-connector: 3.4.0 -> 3.6.0 (#360683) b78d2682b57b cargo-expand: 1.0.91 -> 1.0.95 (#360689) 75af4073fbdf python312Packages.apycula: 0.14 -> 0.15 (#360691) b43a585a31e7 shopware-cli: 0.4.51 -> 0.4.60 (#360694) 7a3bde9f16eb roadrunner: 2024.1.2 -> 2024.2.1 (#360695) 5b5d6d061b20 libfmvoice: 0-unstable-2024-11-03 -> 0-unstable-2024-11-08 (#360698) cd9e72c5d784 python312Packages.pytest-celery: 1.1.1 -> 1.1.3 (#360702) 4c488edd7ad6 vte: 0.78.1 -> 0.78.2 (#358895) bf51e17ffd69 lc0: 0.31.1 -> 0.31.2 (#360707) f4bca8f86028 ibus-engines.m17n: 1.4.32 -> 1.4.34 (#360708) f6f3c22f0a1c xpipe: 12.0 -> 13.2 (#358493) 3fa7c515c101 pritunl-client: 1.3.4066.51 -> 1.3.4083.88 (#360542) 5569ed6c7912 opentofu: fix mkProvider (#360647) ae0558842c96 terraform-providers.namecheap: 2.1.2 -> 2.2.0 (#360656) c55ed74608a4 nwg-clipman: 0.2.3 -> 0.2.4 (#360670) e6b0419db851 capslock: 0.2.5 -> 0.2.6 (#360672) e366081cbe9e motoc: 0.3.3 -> 0.3.4 (#360675) d582e9d13daf zsh-wd: 0.9.1 -> 0.9.2 (#360613) f49841a05243 opengrok: 1.13.23 -> 1.13.24 (#360623) 14c54455ad8b prometheus-sql-exporter: 0.5.7 -> 0.5.8 (#360626) 1f8da346b95d eksctl: 0.193.0 -> 0.194.0 (#360629) 139f9542d3e6 kubedb-cli: 0.48.1 -> 0.49.0 (#360630) c4a05d95c81e orchard: 0.24.1 -> 0.25.2 (#360632) 13c6725c1912 prometheus-mongodb-exporter: 0.41.2 -> 0.42.0 (#360635) 1f72b75ff5a6 blackbox-terminal: Fix build with GCC 14 688f232b48bc buildkite-cli: 3.2.0 -> 3.3.1 (#360638) d1b6da9936d3 python312Packages.manga-ocr: 0.1.12 -> 0.1.13 (#360641) 8beb425a88c4 scaleway-cli: 2.34.0 -> 2.35.0 (#360149) 232e7a03996e got: 0.105 -> 0.106 (#360096) 344a8124c120 zrythm: 1.0.0-rc.2 -> 1.0.0 (#359953) fd335fa614cb tipp10: support running under wayland (#359049) 7a2f7cc8a8d1 python312Packages.moderngl-window: 3.0.0 -> 3.0.2 (#360534) 627fffc9ee83 logdy: 0.13.0 -> 0.13.1 (#357746) 1c498384db3d mini-calc: 3.2.0 -> 3.3.2 (#356679) f54975f3d3df jellyfin{,-web}: 10.10.1 → 10.10.2 → 10.10.3 (#356897) 8a493d4cacb3 streamlink: 6.11.0 -> 7.0.0 (#354037) b0ff56fd78e5 abctl: 0.13.1 -> 0.22.0 (#359267) 950e196baf78 meli: 0.8.8 -> 0.8.9 (#359656) b57786a8580b fheroes2: 1.1.3 -> 1.1.4 (#359742) 9f88d77c19c6 stackit-cli: 0.16.0 -> 0.17.0 (#359894) d022749e4d8a gojq: 0.12.16 -> 0.12.17 438451f1dbd3 gotemplate: 3.10.1 -> 3.11.0 (#359549) 68562c604685 rhythmbox: 3.4.7 → 3.4.8 f1136c5cb23a orca: 47.1 → 47.2 fb664c3bc713 libspelling: 0.4.4 → 0.4.5 f182cbffc24c gtksourceview5: 5.14.1 → 5.14.2 f01af5e44ba6 gnome-text-editor: 47.1 → 47.2 73e0a9773097 gnome-software: 47.1 → 47.2 649da5fca307 gnome-maps: 47.1 → 47.2 9f9b49e2aa86 ghex: 46.0 → 46.1 af6f153f5495 file-roller: 44.3 → 44.4 a06822cabfbc ci: fix GHA's rebuild-xxx: 5001+ labels e9bbe484dc3a evolution-ews: 3.54.1 → 3.54.2 0031ce04c1e2 evolution-data-server: 3.54.1 → 3.54.2 dceede073861 evolution: 3.54.1 → 3.54.2 3bc8b401c113 gnome.updateScript: Fetch cache.json from download.gnome.org/sources 403bcc3f2db9 mercure: 0.16.3 -> 0.17.1 ede548fffdfe Merge master into staging-next 444dd7202b73 mini-calc: 3.2.0 -> 3.3.2 ff094872130e bitwig-studio: add libnghttp2 library Needed to read certain vst plugins (e.g. decent-sampler) 886a96922f52 python312Packages.pytensor: disable failing tests on darwin d5d6ea030768 hunspellDicts.uk-ua: 4.6.3 -> 6.5.3 10f06c512e42 fetchurl: clean up KDE mirrors (#360523) 971dc5da77c4 netlify-cli: 17.37.1 -> 17.37.2 0d7e457b7e81 iio-oscilloscope: init at 0.17 (#280521) dccb1b6076b3 vokoscreen-ng: 4.0.0 -> 4.2.0 (#344495) 075c9e35fd9a ophis: 0-unstable-2019-04-13 -> 2.2-unstable-2024-07-28 (#343825) 7779a868360a Fix Codeql findings in update scripts (#342541) c38a936b5512 viu: 1.5.0 -> 1.5.1 aa3e60243159 orca-slicer: remove FLATPAK option (#360219) f54981897f29 frog-protocols: don't use pulled commit (#360609) 072543d64946 limine: 8.0.14 -> 8.4.0 (#358033) 9484135264f0 php84Extensions.vld: 0.18.0 -> 0.18.0-unstable-2024-08-22 b25149db7130 bitscope.*: fix fhsenv version (#359960) 6c45eb1f7153 wgcf: 2.2.22 -> 2.2.23 006691de3c82 github/workflows/eval: add nixos package search links and wrap sections in a summary list e10cdab135aa workflows/check-nix-format: reminder to rebase (#356813) 477c6ce18700 quilt: enable strictDeps (#359085) 35a2fc611783 nixos/aria2: allow fine tuning download file permissions (#359045) 6e14a2c1dee1 ariang: 1.3.7 -> 1.3.8 (#360719) 79b78a6f784f binwalk: fix `checkPhase` on Darwin (#360001) df363803eb8d thunderbird-bin-unwrapped: 128.4.3esr -> 128.5.0esr 35435a647a3b nixos/localtimed: fix 'geoclue2Package' doc e1481f5f7fe3 python312Packages.moderngl-window: 3.0.0 -> 3.0.1 6b7888bae78d rucola: init at 0.4.1 (#341286) 36fa40cdc1cd python312Packages.mhcflurry: fix tests 382846578cba kubernetes-kcp: init at 0.26.0 (#357444) 3e113faab78a weechat: 4.4.3 -> 4.4.4 (#360366) a94c29f62560 privatebin: fix description typo (#360424) 1c7406ae551f mqtt-exporter: init at 1.5.0 (#360486) 42366ec07ab8 codeium: various minor improvements (#360477) 58627b0c2930 openvswitch: 3.4.0 -> 3.4.1 ef1b6312b887 texlive.combine: fix requiredTexPackages (#356155) 0e6cb950cfb7 appimageTools: deprecate name & version 3029561a104b python312Packages.keras: enable tests cb2bc4fc7196 python312Packages.tf-keras: 2.17.0 -> 2.18.0 7289b48c67da python312Packages.keras: add GaetanLepage as maintainer 5272ff110fec python312Packages.keras: 3.6.0 -> 3.7.0 4454e70813bd python312Packages.tensorflow: rename generated wheel from tensorflow_cpu to tensorflow (#359605) f20dfdbabfb3 treewide: remove AndersonTorres from maintainers (#360292) 4ff9194fae15 soulseekqt: fix appimageTools version 9d4043d180a1 cables: fix appimageTools version 0c64b29d2ac3 deskreen: fix appimageTools version 8a59b79070d9 lib.filesystem.packagesFromDirectoryRecursive: refactor (#359941) 00b20dc6670c quba: fix appimageTools version 9f332351e6d2 saleae-logic-2: fix appimageTools version 17147067fce5 anki-bin: 24.06.3 -> 24.11 8b7ed6e105f3 github/workflows/eval: limit number of packages in markdown 93e3cd5520c3 goperf: 0-unstable-2024-09-05 -> 0-unstable-2024-11-18 3375bda5ead5 transgui: 5.18.0-unstable-2024-02-26 -> 5.18.0-unstable-2024-10-03 b803e1b03dc6 gnomeExtensions.argos: Update to more recent revision with support for GNOME 47 057669acd111 prometheus-knot-exporter: 3.4.1 -> 3.4.2 3ddb98b69057 ariang: 1.3.7 -> 1.3.8 c92368010fe7 numix-icon-theme-square: 24.07.19 -> 24.10.22 e30e3649008f open-webui: 0.4.6 -> 0.4.7 (#360713) 32ad523bd59f nixos/documentation: Link Devhelp files (#218123) ee0dd6764b71 open-webui: 0.4.6 -> 0.4.7 9312eba0833e helvum: remove unused clang from build closure ffdf195290cf niri: remove unused clang from build closure 414c15d91075 xen-guest-agent: remove unused clang from build closure 2f5cb5c197b5 youtrack: 2024.3.47197 -> 2024.3.52635 (#360645) 453e4c611a51 flottbot: 0.13.1 -> 0.14.0 6d99882452e9 bitwig-studio: 5.2.5 -> 5.2.7, fix Onset and Beat detection (#360198) 204e88479238 simdutf: 5.6.0 -> 5.6.3 (#360588) 12f09489008c nixos/tests/nat: Create more broad and detailed testing conditions 46b2df60a542 nixos/nat: Allow NAT to still function when a forward default DROP iptables rule is in effect. 622376ecb09f nixos/nat: Prevent NAT reflection on connections not coming from behind the NAT 6cb4e7d591c6 nixos/nat: Only connections made to the nat.externalIP will be port forwarded. 75df48d3885c maintainers: add tne 3b68a9b9f92d darklua: 0.13.1 -> 0.14.1 (#360704) 266a393643b9 linuxPackages_latest.prl-tools: 20.1.1-55740 -> 20.1.2-55742 7e4c94c50922 ibus-engines.m17n: 1.4.32 -> 1.4.34 139853e8e4a2 lc0: 0.31.1 -> 0.31.2 f14507be3dad nix-janitor: 0.3.1 -> 0.3.2 (#360440) e61a2da3885c nixos-rebuild: Fix ShellCheck issue 84d80cad3ec6 broot: 1.44.1 -> 1.44.2 (#360543) 6c6eb45a8de7 hardinfo2: init at 2.2.4 d00cccefdcb1 python312Packages.aiortm: 0.9.36 -> 0.9.37 (#360399) 7a98e5e041d6 python312Packages.cyclopts: 3.1.1 -> 3.1.2 (#360398) 7611bfff9ae4 python312Packages.msticpy: init at 2.14.0 (#360391) 554901018678 ggshield: 1.33.0 -> 1.34.0 (#360396) dfb444b1a350 python312Packages.meilisearch: update disabled 34712a63c5a3 darklua: 0.13.1 -> 0.14.1 23e0aee5ae04 apx: 2.4.3 -> 2.4.4 c5150dd981c6 firefly-iii: 6.1.21 -> 6.1.24, firefly-iii-data-importer: 1.5.6 -> 1.5.7 (#355838) 0a644d62935f libcpr: 1.11.0 -> 1.11.1 a4338f80baa2 python312Packages.pytest-celery: 1.1.1 -> 1.1.3 e1897c4c87c9 libfmvoice: 0-unstable-2024-11-03 -> 0-unstable-2024-11-08 767b0e3398fb influxdb-cxx: 0.7.2 -> 0.7.3 f5267ad9e8d6 hickory-dns: 0.25.0-alpha.3 -> 0.25.0-alpha.4 https://github.com/hickory-dns/hickory-dns/releases/tag/v0.25.0-alpha.4 f262d68de188 roadrunner: 2024.1.2 -> 2024.2.1 73ddd11c9511 shopware-cli: 0.4.51 -> 0.4.60 87be8f8134ea python312Packages.qdrant-client: 1.11.3 -> 1.12.1 (#360642) 7e90f2cfd599 netcdf: fix and enable strictDeps = true 907c7a1ad7b2 sbt: 1.10.2 -> 1.10.6 83ce73ddbc42 python312Packages.apycula: 0.14 -> 0.15 1d06cb097718 cargo-expand: 1.0.91 -> 1.0.95 f2bb2fbc4559 home-manager: 0-unstable-2024-10-20 -> 0-unstable-2024-11-29 4b82a20228f4 n8n: 1.65.1 -> 1.70.1 6b5cc43a5107 python312Packages.databricks-sql-connector: 3.4.0 -> 3.6.0 63300a194212 Merge master into staging-next d95509902600 aws-sam-cli: 1.127.0 -> 1.131.0 93f0b9a9d6e1 terraform-compliance: 1.3.48 -> 1.3.49 78a32d6e3856 ntfy-alertmanager: 0.3.0 -> 0.4.0 193bef538e7b ntfy-alertmanager: Add meta attributes and minor cleanup b9e5ebad8895 motoc: 0.3.3 -> 0.3.4 2a78dcfd9c29 python3Packages.eth-typing: 4.0.0 -> 5.0.1 252c782e2cdc xtf: 0-unstable-2024-09-13 -> 0-unstable-2024-11-01 1ad35c823844 capslock: 0.2.5 -> 0.2.6 065274f48e32 nwg-clipman: 0.2.3 -> 0.2.4 3c97a940e542 amazon-ssm-agent: 3.3.987.0 -> 3.3.1345.0 19c9d0707936 emacsPackages.isearch-plus: 3434-unstable-2023-09-27 -> 3434-unstable-2024-10-13 2c27ab2e6050 vimPlugins.nvim-dap-lldb: init at 2024-06-09 (#360625) 12a6792215c3 terraform-providers.namecheap: 2.1.2 -> 2.2.0 e923b84b0540 mpremote: 1.24.0 -> 1.24.1 96a405932dd2 lib/licenses: fix lens license URL 2edba0b22ea7 kdePackages.kirigami-addons: 1.5.0 -> 1.6.0 (#360539) 9eefd39583ab vimPlugins.dotnet-nvim: init at 2024-10-21 (#360614) e80fe3299c78 vimPlugins.remote-nvim-nvim: init at 2024-08-04 d4ce10e4738a vimPlugins.nvim-dap-lldb: init at 2024-06-09 f8d3b9a5cd1f opentofu: fix mkProvider b9d9802d721a youtrack: 2024.3.47197 -> 2024.3.52635 3634f1c1d83a python312Packages.manga-ocr: 0.1.12 -> 0.1.13 116a52786c27 python312Packages.qdrant-client: 1.11.3 -> 1.12.1 ef4c5d16542f buildkite-cli: 3.2.0 -> 3.3.1 2aa7ff538a56 prometheus-mongodb-exporter: 0.41.2 -> 0.42.0 ac35b104800b nixos/java: No bashisms in `environment.shellInit` script (#294121) c11605806eb3 orchard: 0.24.1 -> 0.25.2 46e556bdd55f kubedb-cli: 0.48.1 -> 0.49.0 f0a8e35f2f0f eksctl: 0.193.0 -> 0.194.0 d1bed296f1c6 flix: 0.52.0 -> 0.54.0 ae516d991573 prometheus-sql-exporter: 0.5.7 -> 0.5.8 bf89f433578a python312Packages.databricks-sdk: 0.35.0 -> 0.38.0 (#360415) 8b42515dfd58 lms: 3.60.0 -> 3.61.0 783fe2b679a8 opengrok: 1.13.23 -> 1.13.24 fb52a9d657a4 mountpoint-s3: 1.10.0 -> 1.12.0 37f4ddc209b0 vimPlugins.dotnet-nvim: init at 2024-10-21 22cbea2b0fc4 vimPlugins.csvview-nvim: init at 2024-11-18 (#360611) f66e21008624 Merge master into staging-next 107d49c46607 vimPlugins.csvview-nvim: init at 2024-11-18 b1820d232a4f zsh-wd: 0.9.1 -> 0.9.2 f0794eceb4e9 dpp: 10.0.32 -> 10.0.35 f86d5a84e025 frog-protocols: don't use pulled commit af3ca5f2b84b halo: 2.20.5 -> 2.20.10 ea5a824f194d php84Extensions.imagick: fix darwin build (#360575) b8dbeaff4dd7 etlegacy-unwrapped: 2.82.1 -> 2.83.1 (#360489) 59b3ef2d6eba misconfig-mapper: 1.10.0 -> 1.12.3 8ee37cc3dddd trezor-suite: Remove deprecated use of `--replace` bede1276da97 parallel-hashmap: 1.4.0 -> 1.4.1 bc367be6615f cargo-public-api: 0.40.0 -> 0.42.0 e5a78712600b sigma-cli: disable failing test aba30997f234 trezor-suite: 24.8.11 -> 24.11.3 f76363e91da8 omnisharp-roslyn: bump from .NET 6 to 8, add support for 9 37bd886b187d apt: 2.9.8 -> 2.9.16 (#360370) eecda1aa7042 Merge: runInLinuxVM: refactor structuredAttrs support, fix disko (#360413) 31ac3dd4d094 step-kms-plugin: 0.11.6 -> 0.11.7 a4b5e0bb8f30 readarr: 0.4.3.2665 -> 0.4.4.2686 (#359600) 8ee6aa113b7c litmusctl: 1.11.0 -> 1.12.0 86fcbea3f26c python312Packages.eq3btsmart: 1.2.0 -> 1.4.1 (#360594) 627eacfa75b6 opensearch: 2.17.1 -> 2.18.0 6cd7b58bc5ab vals: 0.37.7 -> 0.37.8 5731949899a1 python312Packages.eq3btsmart: 1.2.0 -> 1.4.1 58cc5cf62754 kclvm_cli: 0.10.3 -> 0.10.8 c37dd6b8bcf7 altair: 8.0.0 -> 8.0.4 6d67dc04b2cc python312Packages.pysigma-backend-elasticsearch: 1.1.3 -> 1.1.5 e1e83ecdadfb python312Packages.pysigma: 0.11.17 -> 0.11.18 337b082d286a emscripten: 3.1.64 -> 3.1.73 (#343743) 337540dd0518 python312Packages.aiohomeconnect: init at 0.6.0 2c1373ba934e simdutf: 5.6.0 -> 5.6.3 cfb090f14c79 wget: modernize and use PCRE2 instead of PCRE1 45d6c55e21ac spacectl: 1.6.0 -> 1.7.1 c80d5dad0cb9 python312Packages.django-modeltranslation: 0.19.10 -> 0.19.11 626f703319ef python312Packages.plugwise: 1.5.2 -> 1.6.1 6e826b78b0f9 php84Extensions.imagick: fix darwin build c3af24e559f5 python312Packages.pysigma-pipeline-crowdstrike: 2.0.0 -> 2.0.1 16c61703e3b3 komikku: 1.63.0 -> 1.64.0 (#359153) 5342960792e3 ox: 0.7.1 -> 0.7.2 (#359879) aa0caec6e9f8 syncthingtray: 1.6.2 -> 1.6.3 55dda6c193a4 python3Packages.rio-tiler: mark broken 39728bf9bddd nixos/tests/networking: fix GRE test (#360349) 918d17f0b523 step-cli: 0.28.0 -> 0.28.2 73c94b5962f6 obs-cmd: 0.17.9 -> 0.18.0 4976b4ef8b59 helmfile-wrapped: 0.169.0 -> 0.169.1 c20ccbbf9820 android-udev-rules: 20241019 -> 20241109 d95613b40e32 sile: remove unnecessary buildInputs, normalize source name and hash key d39e6db4924b git-warp-time: remove unnecessary buildInput, normalize source name and hash key 3111f846e9d1 decasify: init at 0.8.0 c500419053b9 catppuccin-kvantum: 0-unstable-2024-10-10 -> 0-unstable-2024-10-25 4b5fd880b517 rustfinity: init at 0.2.13 6ea9eae476d5 nixos-rebuild-ng: avoid usage of implementation details in LogFormatter c231b5367faa broot: 1.44.1 -> 1.44.2 0c7a4f8ad087 pritunl-client: 1.3.4066.51 -> 1.3.4083.88 33b9d57c656e incus: fix container tests from image rename (#360305) e6e8a6a05d78 mqtt-randompub: 0.2.2 -> 0.3.0 (#360420) 1e94a5328157 atop: fix cross-compilation (#360488) c670c0eedf26 opentabletdriver: 0.6.4.0 -> 0.6.4.0-unstable-2024-11-25 (#360389) 6e03fe786add forgejo-runner: add myself to maintainers 5054b0739dea glab: 1.49.0 -> 1.50.0 (#359935) ab91a69db187 forgejo-runner: use nix-update-script e41fbfb28030 forgejo-runner: use `versionCheckHook` for program version check 0b9965801d9f ophis: 0-unstable-2019-04-13 -> 2.2-unstable-2024-07-28 39878626c4ae ophis: remove AndersonTorres from maintainers ad8bd9ff48ed ophis: migrate to by-name 0396be8262c4 ophis: refactor 0d5bcfecb5f4 forgejo-runner: enable package tests 9a56705f9407 various: remove AndersonTorres from maintainers 4594b436018a kdePackages.kirigami-addons: 1.5.0 -> 1.6.0 feaad39ec715 forgejo-runner: 4.0.1 -> 5.0.3 ce60dba134bb portfolio: 0.71.2 -> 0.72.2 39d568fe874a csound-qt: 1.1.2 -> 1.1.3 020f9e10c3f6 python312Packages.osmnx: 1.9.3 → 2.0.0 55f5783b059e cxx-rs: 1.0.94 -> 1.0.131 e17f85767041 pulldown-cmark: 0.12.1 -> 0.12.2 07af3c176860 fetchurl: clean up KDE mirrors b0474962ea74 stylelint: 16.9.0 -> 16.11.0 06810f6b1faa nco: 5.2.8 -> 5.2.9 4bc3ac552d0d nixos-rebuild-ng: merge actions 3016300db436 haskellPackages: cherry picks from haskell-updates (#360499) 7794d8952b79 tio: 3.7 -> 3.8 a3c405013f22 xv: 6.0.1 -> 6.0.2 4431a47fcb4a nixos-rebuild-ng: add --build-host/--target-host to TEST/BUILD/DRY_BUILD/DRY_ACTIVATE bf967e6692ad sig: 0.1.3 -> 0.1.4 bac23e290d1d ks: 0.4.0 -> 0.4.2 130bb06af1b7 nixos/zapret: extra features (#356339) 046e35b6161a nchat: 5.2.11 -> 5.3.5 (#360432) 3dec3c32af5e Merge master into staging-next a61aede3688d nixos-rebuild-ng: make sure to copy the new closure when doing test or build a08fcec62f5a go-minimock: 3.4.1 -> 3.4.3 7f0ecceb2d61 novops: 0.17.0 -> 0.18.0 cab7882bf521 nixos-rebuild-ng: move check for missing action argument earlier b118371ebb1f nixos-rebuild-ng: add SSH_DEFAULT_OPTS to copy-closure c50144ab79b9 nixos-rebuild-ng: move reexec earlier f72572c14700 nixos-rebuild-ng: ignore non-directories in upgrade_channels cfe42fba1c5c nixos-rebuild-ng: do not fail if re-exec fails bebec2668b43 nixos-rebuild-ng: add missing flags from nixos-rebuild-ng 6c3ba91ce46f nixos-rebuild-ng: rename template file to not trigger CI fed6778da3a4 nixos-rebuild-ng: move temporary directory to process 776c21be0fc8 nixos-rebuild-ng: fix cleanup_ssh 3fd384af80c6 nixos-rebuild-ng: implement _NIXOS_REBUILD_REEXEC 3cadcd1653e4 nixos-rebuild-ng: make build functions more generic 359d34153590 nixos-rebuild-ng: add {BuildAttr,Flake}.to_attr() c859df048f77 nixos-rebuild-ng: refactor classic Nix to simplify logic 29e9b42022b6 nixos-rebuild-ng: fix --build-host and --target-host case 2ac1f78a1103 nixos-rebuild-ng: validate NIX_SSHOPTS only once 7d58c66881eb nixos-rebuild-ng: fix --build-host 34cda442082f nixos-rebuild-ng: use `nix build` for remote builds in Flakes, fix remote args 8a4105cfd7a6 nixos-rebuild-ng: update README.md f7266986d371 nixos-rebuild-ng: implement --build-host 02b943d57ff9 nixos-rebuild-ng: use find_file in edit 73567536e149 nixos-rebuild-ng: add from_host in nix.copy_closure 3a0c0975a8b6 nixos-rebuild-ng: remove unnecessary "from __future__ import annotations" 7a01349f7928 nixos-rebuild-ng: add TRY201 check for ruff 1e34a97f9f79 nixos-rebuild-ng: add message to help if the user forgot --ask-sudo-password 2db09d7f7730 nixos-rebuild-ng: configure logging 5cc71a346a16 nixos-rebuild-ng: Profile.from_name -> Profile.from_arg 0774b3654697 nixos-rebuild-ng: move default path logic to BuildAttr 88b4eb3aeb0f nixos-rebuild-ng: add repl d325edd6272a nixos-rebuild-ng: introduce models.BuildingAttr 9b3a550e96b9 gqrx: 2.17.5 -> 2.17.6 50773ef245d7 ddns-go: 6.7.2 -> 6.7.6 a3a9591051e5 evcc: 0.131.6 -> 0.131.8 (#360497) c600e806addb mullvad-vpn: format; move to by-name (#360494) a6a90a68cbe5 tbls: 1.78.0 -> 1.79.4 (#360337) a63d604647a8 rfc: 1.0.0 -> 1.0.1 (#360365) aaa6191e18b7 python312Packages.llama-cpp-python: init at 0.3.1 (#349657) 38caec4e585e vencord: 1.10.7 -> 1.10.8 (#360267) 4829779d1c6e mullvad-vpn: add versionCheckHook 331e7824ad3e goodvibes: 0.8.0 -> 0.8.1 (#354474) 3f694f33b04b kakoune-lsp: 18.0.2 -> 18.1.0 cc252426b0a0 updatecli: 0.82.0 -> 0.88.0 (#360016) 1fdd4348e466 openssh: add initrd-network-ssh nixos test to passthru.tests a4b9be1e7a8c pet: 0.9.0 -> 1.0.0 b8e5253e2739 evcc: 0.131.6 -> 0.131.8 d1a8edd37c4a bitwarden-cli: 2024.11.0 -> 2024.11.1 2b4d67b7e679 python312Packages.vobject: 0.9.7 -> 0.9.8 (#353145) 5289e5424d00 mullvad-vpn: move to by-name 649721fe54a6 haskell.packages.ghcHEAD: start compiler config for GHC 9.14 bde0bc80d642 haskell.compiler.ghcHEAD: bootstrap using GHC 9.10 e00faec99b05 radicale2: drop (#360284) c91c4a0f556c haskell.compiler.ghcHEAD: disable --hyperlinked-source on aarch64 d6ba42ff017e mullvad-vpn: format 5e1cc48cedc0 mullvad-vpn: 2024.6 -> 2024.7 (#356825) 4861b25042ee netscanner: 0.6.0 -> 0.6.1 0ce0839bc2f6 mullvad-vpn add darwin as badPlatform da14e45b25d5 etlegacy-unwrapped: 2.82.1 -> 2.83.1 f4a5f018f7f1 rustls-ffi: 0.13.0 -> 0.14.1 (#352584) 1a2fdaae29fe mqtt-exporter: init at 1.5.0 93db83885b18 markuplinkchecker: 0.18.0 -> 0.19.0 a6ee73b54347 atop: fix cross-compilation eb79afa5ff41 kubefetch: 0.7.2 -> 0.8.0 5aff2550eb7e haskellPackages.ghcide: apply patch for GHC 9.8.3 compat 73f95b45c3f2 haskellPackages.haskell-language-server: refactor override a0565521372a python312Packages.libcst: 1.5.0 -> 1.5.1 (#357874) 67276811c45f python312Packages.aiohomekit: 3.2.6 -> 3.2.7 e965f06941b5 python312Packages.moderngl: 5.11.1 -> 5.12.0 15c2105904e4 vimPlugins.codeium-nvim: minor checkPhase refactoring b7f742a5107b codeium: add versionCheckHook 76ba7a02ba23 codeium: correct meta.mainProgram 7fd4e5f7c309 parca-agent: init at 0.35.0 (#360132) 635d9c869215 codeium: format 2ed07b6ddd3c python312Packages.microsoft-kiota-http: 1.3.3 -> 1.3.4 31faab38bee3 python312Packages.array-api-strict: 2.0.1 -> 2.2 64ccdb8ac269 python312Packages.pyinstaller-hooks-contrib: 2024.9 -> 2024.10 60a1ffe606ad lact: mention NVIDIA (#360392) 1e0bb0270b19 python312Packages.notus-scanner: update disabled 30e8e79ac99f gerrit: 3.10.2 -> 3.10.3 (#359389) b99389f02dbd xautocfg: init at 1.2 (#335733) cbac36aa931e python312Packages.python-gvm: 24.8.0 -> 24.11.0 (#359884) 2e5767d6a577 python312Packages.pysuezv2: init at 1.3.2 5a7a68136d2f treewide: use rustPlatform.bindgenHook (#360427) e7b29dee169f svdtools: 0.3.19 -> 0.3.20 4e6986c433d4 thrift-ls: 0.2.2 -> 0.2.5 0f4c09857530 rattler-build: 0.29.0 -> 0.31.1 08061fddcc96 README: Update to 24.11 (#359945) 181981729889 Release 24.11 (#359948) f67fcd9a11c7 pyflyby: 1.9.6 -> 1.9.8 d431018bd4c2 python312Packages.aioacaia: 0.1.9 -> 0.1.10 c163ffa40390 python312Packages.denonavr: 1.0.0 -> 1.0.1 ed823e7bde0d python312Packages.reolink-aio: 0.11.3 -> 0.11.4 4761b61b1efd goodvibes: 0.8.0 -> 0.8.1 d772438febf0 gapless: 4.0 -> 4.2 (#360368) 399109c44de4 python312Packages.powerapi: init at 2.9.1 d043843aae60 nix-janitor: 0.3.1 -> 0.3.2 711fb0167d68 pragtical: 3.5.0 -> 3.5.1 (#360180) 3c352ba05186 scx.rustscheds: drop clang from nativeBuildInputs 23a60b0966dd neothesia: drop clang from nativeBuildInputs 1a827e70dc1b libkrun: drop clang from nativeBuildInputs f826c0aafaea fedimint: drop various darwin workarounds, use new sdk pattern 682cf788e1c7 scx.rustscheds: use rustPlatform.bindgenHook 52614866fd27 servo: use rustPlatform.bindgenHook bbd2561c7fe7 fedimint: use rustPlatform.bindgenHook f9b5b1f98c36 caligula: use new darwin sdk pattern b88f9fe29472 caligula: use rustPlatform.bindgenHook c56b3749469d libkrun: use rustPlatform.bindgenHook b20782310e89 neothesia: use rustPlatform.bindgenHook 0ff027e0aebf nufmt: use rustPlatform.bindgenHook 9f069654459c nixos-rebuild-ng: don't repeat the keep_going argument (#360287) b5dea63a56c8 apacheHttpd: remove support for mod_tls 01ccbb3e0735 rustls-ffi: 0.13.0 -> 0.14.1 b22490d19883 julia.withPackages: expose the version on the derivation (#360303) 7fb8df28b5d1 edgedb: 5.5.2 -> 6.0.0 f3739b3e2318 opentabletdriver: remove `with lib` from meta, remove meta.description from desktop 49f647ab8a1d opentabletdriver: fix updateScript 0ee5d53bc1a6 python312Packages.herepy: 3.6.4 -> 3.6.5 (#360403) 226e750730a0 python312Packages.aiovlc: 0.6.2 -> 0.6.3 (#360407) 8221c09ff574 nixos/lib/test-driver: fix linting after compatibility clean‐up 9837d6fa7f69 python313Packages.pycurl: 7.45.3 -> 7.45.3-unstable-2024-10-17 a63fd65d7aa9 cacert: 3.104 -> 3.107 a92ea1ff2696 nixos/lib/test-driver: remove legacy args handling cec59f9c7078 e2fsprogs: remove compat patch a98c9fb24f06 curl: backport other netrc regression fix 0e2bef0920e5 tk: fix x64 darwin build adc2a4959def nodejs_20: 20.18.0 -> 20.18.1 54b8917845bb xcbuild: const can't desctruct. fix build a8e4d3a32ee6 xcbuild: find system toolchain on macOS Sonoma and earlier 7639abd4d473 Revert "nixStatic: mark as broken on darwin (#357185)" 39809ed175a0 libarchive: add patch to fix `.pc` file d5694f2b8650 watchman: add techknowlogick to maintainers dc710f78da3a watchman: add emily to maintainers 9dee8b4b853b watchman: add update script 08973610476c watchman: strip references to `folly.fmt.dev` d24cff2abd17 watchman: enable tests ebfe3dde3713 watchman: use upstream default for `stateDir` cc8a407545bd watchman: set `CMAKE_INSTALL_RPATH_USE_LINK_PATH` 6bb3a25d51be watchman: use `lib.cmake{Bool,Feature}` e59693e606ba watchman: 2024.03.11.00 -> 2024.11.18.00 7fdaae10d5f6 watchman: use Ninja c981f0f2c99b watchman: clean up inputs be7d4ecda3cf watchman: reorder inputs to match upstream file dcfeafd6a0ce watchman: reorder attributes d55bdcafd3ef watchman: use `refs/tags/` a5c612576b5e watchman: remove `with lib;` 9328dc460d69 watchman: use `finalAttrs` 826d6ff12ce6 watchman: move to `pkgs/by-name` 7d0b2bec84a0 watchman: convert to new Darwin SDK pattern 04a3542010f5 watchman: format with `nixfmt-rfc-style` 86a5932c68ee cpptoml: add patch for GCC 11 a7174ed8cfb5 edencommon: add techknowlogick to maintainers 6093af001070 edencommon: add emily to maintainers 7596981f7a9b edencommon: add update script 7c00b4f02152 edencommon: split outputs 6f34541ac8d1 edencommon: enable tests 9a4458eb893c edencommon: condition shared libraries on platform setting 2c5a6292a040 edencommon: 2024.03.11.00 -> 2024.11.18.00 814e5bff8719 edencommon: use Ninja 55bf720fe3eb edencommon: add explicit `gflags` dependency 94c9aa7d4ece edencommon: reorder inputs to match upstream file 8a6656246ec8 edencommon: use `hash` fafc2fc2b668 edencommon: use `refs/tags/` 2cf8a161affc edencommon: remove `with lib;` 9c19f0579623 edencommon: use `finalAttrs` 20cd2e5ed037 edencommon: move to `pkgs/by-name` f46f5f6e032f edencommon: convert to new Darwin SDK pattern 1b3fa8d9bd40 edencommon: format with `nixfmt-rfc-style` e22927367dc8 fb303: add techknowlogick to maintainers 72c9c31e854e fb303: add emily to maintainers 90b414f6dab1 fb303: add update script 8d9e9c0b7926 fb303: split outputs e6213d5a4d26 fb303: condition shared libraries on platform setting a6d05097d21e fb303: 2024.03.11.00 -> 2024.11.18.00 6266ce9ebf85 fb303: use Ninja 05f382622dbf fb303: use `lib.cmakeBool` 5b0e064340fc fb303: remove `python3` input 6d8f62f2f874 fb303: add explicit `gflags` input 0642824e7fc8 fb303: reorder inputs to match upstream file 8732b37e60af fb303: reorder attributes e99730c8c721 fb303: use `hash` 80dcc25e43f0 fb303: use `refs/tags/` 668359885b55 fb303: remove `with lib;` f8ac058129fa fb303: use `finalAttrs` 752764c06bc7 fb303: move to `pkgs/by-name` b156f19c35ed fb303: convert to new Darwin SDK pattern 762d5ea73593 fb303: format with `nixfmt-rfc-style` 21d5e06f9b8e fbthrift: add techknowlogick to maintainers ed8dc3578e4b fbthrift: add emily to maintainers 460f42b13dd2 fbthrift: add update script a1f828720ca2 fbthrift: split outputs 09a11691b283 fbthrift: add note about tests 7ca0641e273d fbthrift: propagate required dependencies c9b3a4d10144 fbthrift: condition shared libraries on platform setting e6b873e84a58 fbthrift: 2024.03.11.00 -> 2024.11.11.00 4bb4cb508252 fbthrift: use Ninja ce97828a78a1 fbthrift: remove unnecessary inputs 23b97b382836 fbthrift: reorder inputs to match upstream file bbe7a25e21f4 fbthrift: reorder attributes 8054f6f15ed1 fbthrift: use `hash` 50fa13715691 fbthrift: use `refs/tags/` 0d5352e05e76 fbthrift: remove `with lib;` 2d4f3a64cda9 fbthrift: use `finalAttrs` 887ed58bb715 fbthrift: move to `pkgs/by-name` c7f7fcb26f53 fbthrift: convert to new Darwin SDK pattern efd8415a9523 fbthrift: format with `nixfmt-rfc-style` fcc3b011ccce wangle: add techknowlogick to maintainers b06e63bb8b93 wangle: add emily to maintainers 3c09f4a220ac wangle: add update script e8ede7fa2195 wangle: split outputs 09404adf7956 wangle: condition shared libraries on platform setting 8ba76a94004f wangle: 2024.03.11.00 -> 2024.11.18.00 380d74b6d6c2 wangle: set `__darwinAllowLocalNetworking` 9c57e637bbfd wangle: use Ninja 334e0aff3685 wangle: remove unnecessary CMake flag a10e14c54ccd wangle: reorder inputs to match upstream file fbeae37f530a wangle: reorder attributes b2977e0bf293 wangle: use `hash` f09790e46137 wangle: use `refs/tags/` 2e7106f7f070 wangle: remove `with lib;` 18d703bc06ed wangle: move to `pkgs/by-name` 152d24ff5b60 wangle: convert to new Darwin SDK pattern 6da918656a32 wangle: format with `nixfmt-rfc-style` e28d5ba2e13d mvfst: add techknowlogick to maintainers 2ec53247bc19 mvfst: add emily to maintainers 3befd629d71b mvfst: add update script 0258bacd2404 mvfst: split outputs 54d127112539 mvfst: enable tests 5388bfbe4661 mvfst: propagate required dependencies c308963558ae mvfst: condition shared libraries on platform setting d3fa762d4b38 mvfst: 2024.03.11.00 -> 2024.11.18.00 a4f0bcf3bee2 mvfst: use Ninja 8be72a38f1ef mvfst: reorder inputs c99681181d61 mvfst: use `hash` d7c47e4a9e53 mvfst: use `refs/tags/` 4acafb04da1d mvfst: remove `with lib;` 73d25fcdd122 mvfst: use `finalAttrs` 4bc143027796 mvfst: move to `pkgs/by-name` 550a372c868f mvfst: convert to new Darwin SDK pattern 0e41aed8ab5d mvfst: format with `nixfmt-rfc-style` 3a36eb8022bc fizz: add techknowlogick to maintainers 2eb6b359a58d fizz: add emily to maintainers c4e23b859a2f fizz: add update script 0f8b79d2f667 fizz: split outputs 166682236389 fizz: enable more tests 5dfc2a7c4ee4 fizz: propagate required dependencies c5f8cd9ff9cf fizz: condition shared libraries on platform setting e05b1fc74ebf fizz: 2024.03.11.00 -> 2024.11.11.00 3f8da0cf4fba fizz: set `__darwinAllowLocalNetworking` 61c6aeaa3100 fizz: use Ninja b76f9f3439bc fizz: remove unnecessary CMake flag bc675bdc91d3 fizz: remove unnecessary `NIX_LDFLAGS` 7935fdcfd4a5 fizz: remove unnecessary input d8f1c1555c9e fizz: reorder inputs to match upstream file 3885093ab4a6 fizz: reorder attributes d53e52c2cadd fizz: remove `with lib;` 8b9a7a64bca3 fizz: move to `pkgs/by-name` 3aa8b5fcd476 fizz: convert to new Darwin SDK pattern 15de9b55e162 fizz: format with `nixfmt-rfc-style` 6a9e015730d1 folly: add techknowlogick to maintainers 3571e8d763e4 folly: add emily to maintainers ca120bbcdf8d folly: add update script 4809b6f333b0 folly: enable tests 387712f527e7 folly: bump to `fmt_11` f30af822fa83 folly: propagate required dependencies 5d2806e95ac4 folly: condition shared libraries on platform setting eab5ca3e51d4 folly: remove obsolete AArch64 hack c47376bbd135 folly: refine `-fpermissive` flag 012bca60e213 folly: fix split outputs 94862ed128cc folly: patch `pkg-config` file instead of CMake files 3befdb133baa folly: 2024.03.11.00 -> 2024.11.18.00 20ea752239a5 folly: use Ninja 25ae142a4ee6 folly: refine `meta.platforms` 4fc612be9dc7 folly: reorder inputs to match upstream file 80dd0dc4e623 folly: reorder attributes 685fd2c8c86e folly: use `hash` cdb033330bba folly: use `refs/tags/` bfba0d1825ea folly: remove `with lib;` 70ab289cf683 folly: use `finalAttrs` ae228e43c837 folly: move to `pkgs/by-name` 289a4465d9d1 folly: convert to new Darwin SDK pattern d245bc37529f folly: format with `nixfmt-rfc-style` 57b1a4b411fe meson.setupHook: Add timeout-multiplier c1f4c53d8d1b libgit2: switch to pcre2 7d85e7c1afdf libuv: disable test for darwin sandbox 85492cd5fd4c llvmPackages_12.compiler-rt: fix build race aarch64-darwin 0c1ab1f5b586 darwin bazelDeps hashes e04a98ac0f23 bazel_7: 7.4.0 -> 7.4.1 72deeb8efb0f Revert "systemd: revert boot-breaking systemd-boot change" e608a7688ac4 autoconf-archive: fix quoting of m4_fatal 6b98b10a65e7 python312Packages.setuptools: 75.1.0 -> 75.1.1 67de25922b06 curl: backport netrc regression fix 6309f136703e llvmPackages_12.clang: use nostdlibinc patch instead of sed command fcb5d10d261d llvmPackages_12.compiler-rt: move codesign patch into versioned dir f0f66c41d484 llvmPackages_12: build from monorepo source fe5ea976bfba llvmPackages_{12,13}.lldb: don't try to find nonexistent patch 85f95c56e4a1 stdenv: elaborate on nature of mass rebuilds d93cc6973459 Revert "stdenv: set NIX_DONT_SET_RPATH_FOR_TARGET on Darwin" 17738b264859 systemd: 256.7 -> 256.8 ef7dc14ab428 postgresql: drop build-time dependency on GHC 88cd14d0f245 postgresql_16: 16.4 -> 16.5 df7b79ae5a95 systemd: revert boot-breaking systemd-boot change c81f064ea855 librist: fix build for musl 31a7cdb7be4f tk: 8.6.13 -> 8.6.15 f02861764364 tcl: 8.6.13 -> 8.6.15 a1868a1013b1 xorg.libX11: Fix spurious Xerror when running synchronized 9692c173aeb4 cargo-xwin: use new darwin sdk pattern 71622a3d824f python312Packages.dbt-snowflake: 1.8.3 -> 1.8.4 (#360433) 1502af5a9f35 python312Packages.kbcstorage: 0.9.1 -> 0.9.2 (#360377) 43a6c7cbdc30 python312Packages.fastcore: 1.7.20 -> 1.7.22 (#360397) 3cfb033b0f6b python312Packages.dbt-bigquery: 1.8.2 -> 1.8.3 16351967eda9 gcov2lcov: 1.1.0 -> 1.1.1 (#360205) adf9e0757862 python312Packages.pyoverkiz: 1.15.0 -> 1.15.1 (#360329) debeda222a77 mlx42: 2.4.0 -> 2.4.1 (#360338) 44c70837465d highs: 1.8.0 -> 1.8.1 7064bc9d9914 python312Packages.dbt-snowflake: 1.8.3 -> 1.8.4 c14b9064de04 python312Packages.latexrestricted: 0.6.0 -> 0.6.2 (#360351) 67f3c2a29f5b nchat: 5.2.11 -> 5.3.5 880ca7e7cc8a kubecfg: 0.35.0 -> 0.35.1 (#360358) a874ed2e831d python312Packages.pystac-client: 0.8.4 -> 0.8.5 (#360360) 68c011a90ce9 cargo-xwin: 0.17.3 -> 0.17.4 2a59d4daed03 microsoft-identity-broker: fix hash mismatch (#360248) c583c7cdc531 restinio: 0.7.2 -> 0.7.3 (#360161) 8d07d2cae357 lockbook: init at 0.9.15 (#358794) 488a5de3baeb nufmt: 0-unstable-2024-10-20 -> 0-unstable-2024-11-21 (#360299) 82919b8e74ed mxt-app: 1.40 -> 1.41 (#360302) b4a5d25d3f3c python312Packages.opensearch-py: 2.7.1 -> 2.8.0 (#360318) fa3abc3441e0 kube-bench: 0.9.0 -> 0.9.2 (#360257) 8e07d8423e8d terraform-backend-git: 0.1.7 -> 0.1.8 (#360266) e06fd9023948 privatebin: fix description typo 84abec6a3ddd svd2rust: 0.33.5 -> 0.35.0 (#360269) 516c5a192155 mpvScripts.mpv-image-viewer.equalizer: 0-unstable-2023-03-03 -> 0-unstable-2024-11-23 (#360276) 431621bba735 cargo-tarpaulin: 0.31.2 -> 0.31.3 (#360278) f873018b613b grpcui: 1.4.1 -> 1.4.2 (#360279) 955a3e01f282 legcord: 1.0.4 -> 1.0.5 (#360228) d2666490351a python312Packages.moderngl-window: 2.4.6 -> 3.0.0 (#360362) cb923be9782f mqtt-randompub: 0.2.2 -> 0.3.0 a1d35315cad1 Merge: postgresqlPackages.pg-gvm: move from top-level package (#359421) 32106323977a python312Packages.crontab: 0.23.0 -> 3.2.0 511b0843c746 postgresqlPackages.pg-gvm: move from top-level package 0c78ebd8009f buildFHSEnv: fix cross compilation (#360359) 4e0999e058f1 nixosTests.vscodium: Workaround OCR tests (#360404) f40efe1ce90f hdf5_1_10: enable cpp support (#359531) 8fe12bdf8c64 python312Packages.unstructured: 0.15.14 -> 0.16.8 (#360187) 977c297cc688 Merge: dmarc-metrics-exporter: 1.1.0 -> 1.2.0 (#359710) 0e27bc3f9e23 github/workflows/eval: add markdown of added, removed and changed d2593f01e1bf runInLinuxVM: pass .attrs.sh explicitly instead of whole /build directory 99c3d04cf229 python312Packages.aiovlc: 0.6.2 -> 0.6.3 566e47e45f09 prowler: 4.4.1 -> 4.6.1 8b3d16a807d9 mdformat: 0.7.18 -> 0.7.19 cd45cfe9c49e nixosTests.vscodium: Workaround OCR tests 58570e75d9bd runInLinuxVM: refactor vmRunCommand 437e6dbbb0f2 runInLinuxVM: load stdenv/setup with fixed environment in stage2Init 9f6b99e1ef93 runInLinuxVM: minimize saved-env 3952f870fc7b runInLinuxVM: clean up 7a6eb7e69dcc chainsaw 2.9.2 -> 2.10.1 (#360011) 16135549ea0f python312Packages.signxml: 4.0.2 -> 4.0.3 e43c892dcee0 python312Packages.publicsuffixlist: 1.0.2.20241129 -> 1.0.2.20241130 0633f26e7b10 python312Packages.fastcore: 1.7.20 -> 1.7.22 efc0501a3059 python312Packages.cyclopts: 3.1.1 -> 3.1.2 0c8cd8c1d39f python312Packages.aiortm: 0.9.36 -> 0.9.37 4e480bb11dc6 morf: init at 1.0.0 (#360202) 183d46031585 python312Packages.glances-api: 0.8.0 -> 0.9.0 (#352978) 808f48405db5 ggshield: 1.33.0 -> 1.34.0 56597456e194 python312Packages.herepy: 3.6.4 -> 3.6.5 a68512db54c2 lact: mention NVIDIA 7c5423a666f9 python312Packages.msticpy: init at 2.14.0 f02092f1875b python312Packages.cache: init at 1.0.3 b7396ef667e6 python312Packages.azure-kusto-ingest: refactor 528f3ea62a48 roon-server: 2.0-1470 -> 2.0-1483 747acc25bf0d python312Packages.azure-kusto-data: refactor a3f0dacb1204 Merge: pg_top: 3.7.0 -> 4.1.0 (#358676) fafa1755825e ugrep: 7.1.0 -> 7.1.1 33f830be769c moodle: 4.4.1 -> 4.4.3 (#334639) 2fe4a84888ac bombsquad: fix hash mismatch (#360201) 0f26801e4f75 opentabletdriver: 0.6.4.0 -> 0.6.4.0-unstable-2024-11-25 262a7c4efe27 Merge master into staging-next f122659b692d python312Packages.databricks-sdk: 0.35.0 -> 0.38.0 dfd6a4a50f90 linuxKernel.packages.linux_6_12.evdi: add support for kernel >= 6.12 (#360378) 234cba32460e tree-sitter: fix two grammar pnames 5bd4f7e74925 python312Packages.tensorflow: rename generated wheel from tensorflow_cpu to tensorflow de7867c22629 runInLinuxVM: add simple structuredAttrs test 73710fe75176 linux_latest-libre: 19663 -> 19675 (#359464) 3cf4fac9258e buildFHSEnv: symlink libexec into the FHS tree a81305c367b8 rabbitmq-server: 4.0.2 → 4.0.4 (#358653) 6e867a01c7a2 meow: 2.1.3 -> 2.1.4 cad8b485ed3b jetbrains.rider: use dotnet sdk 8 as sdk 7 has been marked insecure dec1fc5f8564 opentabletdriver: replace sed with substituteInPlace 292bf38106c2 opentabletdriver: format with nixfmt-rfc-style 77b57f0a525c armadillo: 14.0.3 -> 14.2.1 ad6e3db7c445 opentabletdriver: move to pkgs/by-name ffdc0742421f linuxKernel.packages.linux_6_12.evdi: add support for kernel >= 6.12 c18529fe1658 python312Packages.kbcstorage: 0.9.1 -> 0.9.2 a5ea1f37d270 nfs-ganesha: 6.2 -> 6.3 (#359179) 94ff31ecb8a4 jwx: 2.1.1 -> 2.1.3 (#360363) 4dcfb6a8bb63 coroot: 1.5.11 -> 1.6.3 a4ca6063fc26 weechat: 4.4.3 -> 4.4.4 136c3ef4a8ee apt: 2.9.8 -> 2.9.16 77a34c1488ed ntirpc: 6.0.1 -> 6.3 f3bb835a462a gapless: 4.0 -> 4.2 e30795390335 rfc: 1.0.0 -> 1.0.1 3c818433d567 oxipng: 9.1.2 -> 9.1.3 (#360304) 1f506d83a563 python312Packages.moderngl-window: 2.4.6 -> 3.0.0 1850f582bf9e python3Packages.dbus-next: remove sfrijters as maintainer 9460d79e918a python3Packages.dbus-next: disable tests 0dd1c943d703 jwx: 2.1.1 -> 2.1.3 9e34adf224d0 magic-wormhole-rs: 0.7.3 -> 0.7.4 (#360356) 617a7655c23c python312Packages.pystac-client: 0.8.4 -> 0.8.5 8a667a5213f1 buildFHSEnv: fix cross compilation 425683af2dc2 kubecfg: 0.35.0 -> 0.35.1 08ae94860803 redlib: 0.35.1-unstable-2024-11-01 -> 0.35.1-unstable-2024-11-22 (#358226) 65036e0ef9c0 nix-serve-ng: fix build against nix 2.24 513229662d38 nix-web: unpin unsupported nix version e571f2451ee6 nixVersions.nix_2_18: drop 5d193551cd32 gitxray: 1.0.16 -> 1.0.16.4 397b693e7663 magic-wormhole-rs: 0.7.3 -> 0.7.4 9b8a47473073 mate.mate-terminal: fix cross compilation, format with nixfmt (#360189) 97520c9ed00a mate.mate-calc: fix cross compilation, format with nixfmt (#360185) fb35df9f914a julia.withPackages: expose pname/version and move things to passthru 14df465130ab mate.mate-system-monitor: fix cross compilation, format with nixfmt (#360186) 395d59f54be1 qgis-ltr: 3.34.11 -> 3.34.13 9fc2250e80ee qgis-ltr: build with same pyqt version as qgis c989da7576d5 qgis: 3.38.3 -> 3.40.1 87e00e577b2e qgis: use default python version (#359758) b0a667f16d0c nix-plugin-pijul: 0.1.4 -> 0.1.5 (#360005) 64d83722982f python312Packages.latexrestricted: 0.6.0 -> 0.6.2 c363307fac50 python312Packages.aiowmi: init at 0.2.3 (#359995) c60179cdcabf python312Packages.jh2: init at 5.0.4 (#359996) 972f716b4f32 mqtt-randompub: init at 0.2.2 (#360094) 32c14266fff2 ytdownloader: 3.18.3 -> 3.18.4 (#360118) 6f860d8ef6d6 strawberry: drop PCRE dependency 10ce0b2de853 strawberry: 1.1.3 -> 1.2.2 e3a9c19e8666 strawberry: drop strawberry-qt5 in favor of strawberry-qt6 9cb83c2af476 nixos/tests/networking: fix GRE test 2ba711361fdd gitlab: 17.3.7 -> 17.5.2 (#360160) 923e2e59ccda redlib: 0.35.1-unstable-2024-11-01 -> 0.35.1-unstable-2024-11-27 7274f7361aa9 pupdate: 3.19.0 -> 3.20.0 e012442a7e0b workflows/eval: Clear unnecessary rebuild labels (#360277) 46fba614728c workflows/eval: Make sure to compare against the push run (#360274) be214b4f0ef9 mlx42: 2.4.0 -> 2.4.1 b0822b5dcb21 tbls: 1.78.0 -> 1.79.4 86911616f777 halloy: fix add halloy url scheme handler (#351700) 866939c5b21c python312Packages.pyoverkiz: 1.15.0 -> 1.15.1 57feb2a16f70 libstroke: fix build with gcc14 (#358142) 2885c268281e vermin: init a 1.6.0 (#356403) 93dd0f49d812 jogger: 1.2.4-unstable-2024-04-05 -> 1.2.5 (#360093) b9274aa7a594 libcamera: re-sign IPA modules after fixup (#353336) 49d45711a6bb btrfs-progs: 6.11 -> 6.12 357fff0f4463 nixos/networkd: allow configuring RTTSec for CAKE qdisc (#285737) 0d48c50f4b01 nixos/networkd: use upstream wait-online@ unit 3f36a68d94a5 xeus-cling: wrap with library args and add smoke check 0ea5454f75c7 nixos/networkd: fix eval (#360315) 18cf9ad14b95 nixos/networkd: fix eval 51c693837f3c raffi: 0.5.1 -> 0.6.0 aa33135b3bd0 Merge master into staging-next 8819a28de8d4 python312Packages.opensearch-py: 2.7.1 -> 2.8.0 e383460f0907 nixos/networkd: add dhcpServerConfig.PersistLeases option (#353189) e5a4cc81abc7 nixos/networkd: add some new options in systemd 256 (#330662) 9a75f507da68 pappl: 1.4.7 -> 1.4.8 (#360307) 8de0d4c50166 typstyle: 0.12.4 -> 0.12.5 (#360263) f87e97504867 mistral-rs: switch to fetchCargoVendor; use config.cudaCapability as default for cudaCapability (#359997) b422806efbc2 git-graph: unstable-23-01-14 -> 0.6.0 (#359806) 7214855ea422 pythonPackages.pyshark: fix capture test 4ebd9725e1aa wireshark: switch to zlib-ng 5d87db84aa4b wireshark: 4.2.6 -> 4.4.2 3546de54ee7e pappl: 1.4.7 -> 1.4.8 c494726b98c3 incus: fix container tests from image rename 9ab59bb5fb94 incus: format 8ad72fe6962e nixos/doc/rl-2505: add omnom (#360188) a162fd2c8360 oxipng: 9.1.2 -> 9.1.3 69f0f79b22e3 cling: avoid dynamic linking against libLLVM.so to fix xeus-cling bb3c18e58d8f cruft: init at 2.15.0 (#299346) 5a32f1dbafd4 mxt-app: 1.40 -> 1.41 cf833bdebfa9 meteo-qt: add .desktop file (#359109) 8f9968055f57 nufmt: 0-unstable-2024-10-20 -> 0-unstable-2024-11-21 9ae3dd306933 microsoft-identity-broker: fix hash mismatch fe1d869538a5 microsoft-identity-broker: format ba9d401ad628 python312Packages.ihcsdk: 2.8.7 -> 2.8.9 4703b8d2c708 pkgs.dockertools.buildLayeredImage: customisable layering strategy (#122608) a1ef7f82b037 python312Packages.cirq-rigetti: add meta 28e909519d7e python312Packages.qcs-sdk-python: 0.20.1 -> 0.21.4 fdd0048a2cf8 python312Packages.quil: 0.12.1 -> 0.13.2 ed30be523ac2 melonDS: 0.9.5-unstable-2024-09-29 -> 1.0rc-unstable-2024-11-27 (#360034) a76379e89cea Revert "zen-browser: init at 1.0.1-a.22" (#360291) cf84acca6b85 Revert "zen-browser: init at 1.0.1-a.22" f6b4c1a4d75b obs-studio-plugins.input-overlay: 5.0.5 -> 5.0.6 9a6d55f82524 librewolf: 132.0.2-1 -> 133.0-1 (#360170) fd5d1e6df110 rattler-build: init at 0.29.0 (#355402) ad356675a803 nixos-rebuild-ng: don't repeat the keep_going argument df47280e162e cwtch-ui: init at 1.15.0 (#320396) 8989584d83b9 zen-browser: init at 1.0.1-a.22 (#347222) 88bd81e177bd gkraken,nixos/gkraken: Drop (#358200) 23a7a5d3cc33 ci/check-shell: fix `ci/**` path (#360283) 715ce088a41f gose: init at 0.8.0 (#354159) bcb2e3071f3c enchant: fix broken release URL (#360079) e09014221957 alpaca: 2.8.0 -> 2.9.0 (#360033) 6bff67cfbb52 radicale3: move to aliases 7e8137033ccb radicale2: drop c318085efa81 ci/check-shell: fix `ci/**` path f2ad84dc9b5d doc: fix/improve NIXOS_LUSTRATE installation instructions 3be17711c3ff grpcui: 1.4.1 -> 1.4.2 a156cee721f8 bats: 1.11.0 -> 1.11.1 4d39a7b8e637 cargo-tarpaulin: 0.31.2 -> 0.31.3 ea65e3038a72 workflows/eval: Clear unnecessary rebuild labels 9d0f1281e434 bitwig-studio: Add wrapper to fix onset and beat detection 69f2173cf686 maintainers: remove stnley (#360275) f96263643968 mpvScripts.mpv-image-viewer.equalizer: 0-unstable-2023-03-03 -> 0-unstable-2024-11-23 4dd2fd771615 switch-to-configuration-ng: prevent error during NIXOS_LUSTRATE install 6394be51d20a maintainers: remove stnley b3e8e251f308 workflows/eval: Make sure to compare against the push run 5196f6a891ce vencord: 1.10.7 -> 1.10.8 962a6862f07b erigon, nodeinfo: fix `tags` for `buildGoModule` (#360030) a4242293ee02 svd2rust: 0.33.5 -> 0.35.0 4278c679eaf3 ooniprobe-cli: 3.23.0 -> 3.24.0 (#359338) 318dd6182f7e x42-plugins: 20230315 -> 20240611 8c4cc0b2c104 terraform-backend-git: 0.1.7 -> 0.1.8 07079b57ec69 libdeltachat: 1.151.1 -> 1.151.2 7eddd28f340e Merge master into staging-next bcc5c141bf43 terraform-providers.vinyldns: init at 0.10.3 ef688ab1caaf typstyle: 0.12.4 -> 0.12.5 1bd7dce3ac14 Merge master into staging-next f31600fd0fc1 workflows/backport: Use GitHub App to create PRs to make GHA trigger on them 175d8c885446 python312Packages.pyvo: 1.5.3 -> 1.6 14ce5a5a3d7f xpipe: 12.0 -> 13.2 836aba16120b webdav: 5.4.3 -> 5.4.4 (#360253) 9396352fba8f lib/systems: elaborate properly with non-matching system / config / parsed args (#351608) 3b56519f5084 hyprgui: 0.1.8 -> 0.1.9 (#357029) 50d277f9e774 kube-bench: 0.9.0 -> 0.9.2 e16d20f2ba9f nixos/version: allow overriding, use 24-bit colour code (#351736) 33cca9243adf rl-2411: `lib` release notes (#359887) 96a833668a59 ci/check-shell: only run if `shell.nix` or `./ci/**` is changed (#360249) 02e1f93cb4e7 nixos/version: add extraOSReleaseArgs and extraLSBReleaseArgs 61d0cc13efb9 python312Packages.huggingface-hub: 0.26.2 -> 0.26.3 (#359829) b4d7b9ade25a nixos/version: use 24-bit ANSI colour code bf5d64a13026 nixos/os-release: make default_hostname distribution default (#359571) 9ba5483ef306 webdav: 5.4.3 -> 5.4.4 c32996b67383 unigine-superposition: fix fhsenv version (#359966) 79a75faeb9b9 emulationstation-de: 2.2.1 -> 3.0.2 (#299298) cb016f116bf8 ci/check-shell: only run if `shell.nix` or `./ci/**` is changed 82434f382c30 Use GHA eval to assign rebuild labels (#359704) ba5a5fac7bb6 flattenReferencesGraph: fix use of lib.fileset c9c090608576 python312Packages.rmsd: 1.5.1 -> 1.6.0 (#360054) bc604cb91257 flatpak: set meta.mainProgram (#358995) da01f1f995dd android-studio: fix fhsenv version (#359961) 64de6c47ca24 rl-2411: `lib` release notes 9ae0f7757760 flattenReferencesGraph: use lib.fileset instead of gitignoreSource 266283bec3ae build-support/docker: use runCommand in make-layers.nix ada2b1255ee3 freebsd.libc: break into many small derivations (#359190) c1d4a2c2c128 mutt: remove ? null from packages (#359273) 223586a61734 virtualisation: Use system.build.image, normalize file names (#359339) 61f3a9680a6e nixos/prometheus.exporters.unifi: drop e3199efe3592 bluejeans-gui: drop (#360173) 88bdfb156538 flatten_references_graph: fix typo egdes => edges 4a98c23fd0f7 mpvScripts.mpv-image-viewer: init at 0-unstable-2023-03-03 (#347323) 87ad190dceb5 pcsx2: 2.1.127 -> 2.3.39 2aabd1196124 ci/eval: don't allow IFD (#360225) cf28257e4f93 Merge: percona-server_8_0: 8.0.37-29 -> 8.0.39-30, percona-server: 8.4.0-1 -> 8.4.2-2 (#359824) 2fd0802cbf3b arduino-cli: fix fhsenv version (#359959) 207dd001b471 Merge: matrix-synapse: 1.119.0 -> 1.120.0 (#359402) 4880c3b1c9ac Merge master into staging-next 5978e7fa2fbe ci/eval: don't allow IFD 1591aa5856e7 zrythm: format 88f32cf694a7 to-html: Add shell completions 8f28ab10cfe3 to-html: 0.1.4 -> 0.1.6 dd884440dffe python312Packages.kafka-python-ng: 2.2.2 -> 2.2.3 (#360223) c055f6bc0a7e nixos/mysql: fix evaluation of percona test 37715c31379d legcord: 1.0.4 -> 1.0.5 2c7123c52231 nagstamon: 3.14.0 -> 3.16.2 (#349714) 47da8867f3cf python312Packages.kafka-python-ng: 2.2.2 -> 2.2.3 7de65171332b orca-slicer: remove FLATPAK option 63c36f819ca3 python312Packages.pynecil: 0.2.1 -> 1.0.1 b9816a9ba61e treewide: remove AndersonTorres from maintainers (#360012) f5e33aca67c4 mupen64plus: 2.5.9 -> 2.6.0 (#347487) 230b623a4700 snowflake: 2.9.2 -> 2.10.1 937d3c9fa0a1 python312Packages.rmscene: 0.5.0 -> 0.6.0 bb2555a09449 mongoc: 1.28.0 -> 1.29.0 (#360090) b6354e922504 pnpm: 9.14.2 -> 9.14.4 (#360139) 4c5015ad7dce gcov2lcov: 1.1.0 -> 1.1.1 d3e082767138 nixos-rebuild-ng: implement `--target-host` (#359097) 39ae3fa19892 bitwig-studio: 5.2.5 -> 5.2.7 2f9c22f53b48 bombsquad: fix hash mismatch 55d1ba40f24f morf: init at 1.0.0 1b02b613fa71 python312Packages.aiomisc: 17.5.26 -> 17.5.29 (#359976) 689cdd9c4b3c python312Packages.python-can: 4.4.2 -> 4.5.0 (#359979) f89a5a2a26d7 python312Packages.spotifyaio: 0.8.8 -> 0.8.10 (#359981) 2eaa53ac8ceb mate.mate-terminal: fix cross compilation, format with nixfmt a344bfd09ab3 nixos/doc/rl-2505: add omnom e3ac562312bd firefox-sync-client: init at 1.8.0 (#359637) bf50468b8f4a mate.mate-system-monitor: fix cross compilation, format with nixfmt 3c18c8fcc295 arduino-cli: fix fhsenv version a403221cb81a treewide/nixos: remove `with lib;` part 3 (#335623) 463095e1f61d bitscope.*: fix fhsenv version ae944e6d41b7 python312Packages.unstructured: 0.15.14 -> 0.16.8 a551c5a12ebc sidequest: fix fhsenv version (#359965) 20ddc00cb1cc Merge master into staging-next 26981a812c34 bazel_7: fix fhsenv version (#359958) 5de6a11a5082 pragtical: 3.5.0 -> 3.5.1 b99353c1584b samba: fix broken tarball URLs (#360157) b61dffc48e1c ant: modernize, update primary name (#360077) 167244df67f9 meteo-qt: add .desktop file 03f953d285b9 bluejeans-gui: remove cdc2e32ea44c samba: fix broken tarball URLs 01c33fb6d72c treewide: add `--enable-wayland-ime` flag to all Electron packages that uses `NIXOS_OZONE_WL` (#358620) 326602a98369 mate.mate-calc: fix cross compilation, format with nixfmt b9da4f27d941 nixos/omnom: init module (#357830) cd2aa80f1c87 ocamlPackages.sedlex: 3.2 → 3.3 (#359890) 78bccf712560 python312Packages.imgcat: 0.5.0 -> 0.6.0; fix (#360142) 7f33274e2bf4 websurfx: init at 1.20.7 (#359459) 85540a4af0ce libevdevc: fix cross compilation, format with nixfmt 1ddee49c20c7 python312Packages.uxsim: 1.7.0 -> 1.7.1 2a8bd1bc8c6d librewolf: 132.0.2-1 -> 133.0-1 0589c0d36406 mill: 0.12.2 -> 0.12.3 (#359491) ab4517e2fce1 bloat: 0-unstable-2024-06-17 -> 0-unstable-2024-10-28 cc90b03c71a9 python312Packages.jupyterlab-server: remove jupyterlab_server.pytest_plugin from import checks 93b806da897a gamescope: fix cross compilation fbbfa557fd2c dbgate: add desktop entries eebd4c3b0133 gitlab: 17.3.7 -> 17.5.2 8ee82bb6f619 restinio: 0.7.2 -> 0.7.3 9b0e7e5e504f lockbook: init at 0.9.15 0eac31b71594 python312Packages.tskit: 0.5.8 -> 0.6.0 (#359358) 785d9b39fea7 amazon-cloudwatch-agent: 1.300049.1 -> 1.300050.0 (#357907) 3846c5486693 podman: 5.3.0 -> 5.3.1 (#359117) 8a6e2fb4702e pt2-clone: 1.70 -> 1.71 (#359495) 3dbf6e83997b php81Extensions.blackfire: 1.92.25 -> 1.92.28 (#359827) 15ae63f20356 blackfire: 2.28.13 -> 2.28.20 (#359648) 410b2d7f0792 factoriolab: 3.8.1 -> 3.8.4 (#359720) d063ad64cbb5 archipelago-minecraft: 0.5.0 -> 0.5.1 (#359472) d3f13a2d1c38 mackerel-agent: 0.82.0 -> 0.83.0 (#359337) eab3a12f092b tigerbeetle: 0.16.12 -> 0.16.14 (#359386) dee0bf3ba96e anilibria-winmaclinux: 2.2.20 -> 2.2.22 (#359275) 3896ef1df742 mtr-exporter: 0.3.0 -> 0.4.0 (#359175) b32bafe364f1 python312Packages.inform: 1.31 -> 1.32 (#358489) f8eae6bfde7b python312Packages.click-odoo-contrib: 1.19 -> 1.20 (#358334) 47dc99eace45 phraze: 0.3.15 -> 0.3.17 (#359745) 4992f3d99701 archi: 5.3.0 -> 5.4.3 (#342229) c78003c4e080 image/images: Add image modules defined in virtualisation/ 0aa1319ab1b2 Update .git-blame-ignore-revs 91d74082c43b virtualisation/proxmox-lxc: use system.build.image 06ad3811a856 virtualisation/lxc-container: use system.build.image f3563c996e07 virtualisation/azure-image: use system.build.image 77fce1dc584c virtualisation/digital-ocean: use system.build.image 41db5209c745 virtualisation/google-compute: use system.build.image a230d5228d9e virtualisation/hyperv-image: hyperv.vmFileName -> image.fileName 6d50a8c57fa2 virtualisation/kubevirt: use system.build.image d8410d8366d3 virtualisation/oci-image: use system.build.image a0ce661c998c virtualisation/proxmox-image: use system.build.image 342a5021dfbb virtualisation/vagrant-virtualbox: use system.build.image 6cc7449e308b virtualisation/virtualbox: virtualbox.vmFileName -> image.fileName b0b3a756769a virtualisation/vmware-image: vmware.vmFileName -> image.fileName 47c83cb43829 virtualisation/linode-image: Use system.build.image 40142caad071 format files with nixfmt e6b629da2735 mpvScripts.uosc: 5.6.0 -> 5.6.2 (#359802) 55303d50c406 python312Packages.django-rest-registration: fix build (#359565) e255a9090e25 emscripten: 3.1.64 -> 3.1.73 6a49785456ac binaryen: 118 -> 119 77e646f17154 libblake3: 1.5.4 -> 1.5.5 (#359566) 95428bab8c5a Merge #359866 (mpvScripts: Use `lib.packagesFromDirectoryRecursive`) ed307b9aac25 fastly: 10.16.0 -> 10.17.0 (#359629) e64110968764 bibata-cursors: fix normal variant and build right-hand variant (#359604) fed6fcbdd6d1 scaleway-cli: 2.34.0 -> 2.35.0 b6df5d10fa77 wasm-tools: 1.220.0 -> 1.221.0 (#359634) 6de1312a383d nixos/lxc/container: fix useDhcp with veth (#358806) 84ace4a41299 tenv: 3.1.0 -> 3.2.10 (#359661) f50a1bd99de9 nixos/lxc/container: fix useDhcp with veth 3ac012e7e27e crossplane-cli: 1.17.1 -> 1.18.0 (#359694) 5b0ffc8037af gettext: remove dead patch causing failures on BSDs (#360044) dd363fd877db anki-sync-server: fix cross compilation (#359878) b989e7e8ad85 python312Packages.imgcat: 0.5.0 -> 0.6.0 4ea11c695060 python312Packages.aioacaia: 0.1.9 -> 0.1.10 7f6123b2ac25 shadershark: simplify update script (#342342) 5436a94e655e ciscoPacketTracer{7,8}: disown (#342352) ea0adc05b506 pnpm: 9.14.2 -> 9.14.4 1170690e2465 cloudflared: fix cross compilation (#359897) db00b7e57fb6 bear: fix cross compilation, set strictDeps (#359880) c0f61fe3d4a7 parca-debuginfo: init at 0.11.0 cc9e038ab7d8 minutor: init at 2.21.0 1e74cae2a178 deno: 2.1.1 -> 2.1.2 be9539b79400 treefmt2: 2.1.0 -> 2.1.1 (#360123) a23730505eb0 parca-agent: init at 0.35.0 04ad1f46f961 gswatcher: init at 1.7.1 (#359789) 62510f7f048f python312Packages.withings-sync: 4.2.5 -> 4.2.6 (#359780) 31f44e216439 python312Packages.types-awscrt: 0.23.0 -> 0.23.1 (#359778) 99b2f3707d29 Merge: Nextcloud: Update apps (#360095) a0559c7b2bf2 Release 24.11 056ebe065a28 ergo: 5.0.23 -> 5.0.24 (#360114) 854baca4aa80 nixos/renovate: unset service restart (#359403) 95cc09922216 cargo-component: 0.17.0 -> 0.19.0 (#360119) eca5c988af27 python312Packages.asteroid-filterbanks: fix tests (#360116) a4ad23a1119e node-red: 4.0.4 -> 4.0.5 (#360041) fc89c62ec75d enchant: fix broken release URL 96e1dd3cc947 python312Packages.growattserver: 1.5.0 -> 1.6.0 (#360057) c7d5bac624eb python312Packages.authcaptureproxy: 1.3.2 -> 1.3.3 (#360061) c3329f7b0c64 qadwaitadecorations-qt6: 0.1.5 -> 0.1.6 (#360063) 45d974dfd7e3 python312Packages.publicsuffixlist: 1.0.2.20241127 -> 1.0.2.20241129 (#360064) a5141d0d5612 python312Packages.python-arango: 8.1.2 -> 8.1.3 (#360067) 2194be419330 glamoroustoolkit: 1.1.7 -> 1.1.8 (#360069) 0255169931ee python312Packages.datasette: 0.65 -> 0.65.1 (#360071) 2ed1d21df186 python312Packages.pylint-django: 2.6.0 -> 2.6.1 (#360074) ff51c1beb83c c2fmzq: 0.4.22 -> 0.4.25 (#360087) e4647f0245a9 jumppad: 0.15.0 -> 0.16.0 (#360091) 16b1fd41291c ipfs-cluster: 1.1.1 -> 1.1.2 (#360027) 74831549826c vunnel: 0.28.0 -> 0.29.0 (#359994) 9af3e7da9be3 vkdt: 0.9.0 -> 0.9.1 (#360000) b67f6c616aec python312Packages.markdownify: 0.13.1 -> 0.14.1 (#360014) 8e9268dfbbde checkov: 3.2.316 -> 3.2.322 (#359969) 836d207c6c64 nixos-render-docs-redirects: init (#357383) c8089754eec4 cnspec: 11.31.1 -> 11.32.0 (#359970) 8a3d41aa0fb5 python312Packages.asteroid-filterbanks: fix tests db7c27acdfbb exploitdb: 2024-11-16 -> 2024-11-26 (#359971) 7a6698e0aaa1 python312Packages.tencentcloud-sdk-python: 3.0.1273 -> 3.0.1274 (#359972) 3b4d2f4c5c9e phrase-cli: 2.33.1 -> 2.34.1 7bff6409e34f python312Packages.neo4j: 5.26.0 -> 5.27.0 (#359977) c941d80adfda python312Packages.boto3-stubs: 1.35.29 -> 1.35.71, python312Packages.botocore-stubs: 1.35.29 -> 1.35.71 (#359978) 76d6ef5dde4d ldeep: 1.0.75 -> 1.0.76 (#359980) 268eadc6ba0c trufflehog: 3.84.0 -> 3.84.1 (#359982) 3756c546a2d3 greenmask: 0.2.3 -> 0.2.5 (#359983) 09da4761e124 vermin: init a 1.6.0 ad52fb854b75 python312Packages.checkdmarc: 5.5.0 -> 5.7.8 (#359986) 1cba7befa3d3 python312Packages.haversine: 2.8.1 -> 2.9.0 (#359987) 2ad0246b9455 python312Packages.garminconnect: 0.2.21 -> 0.2.23 (#359988) 923fccbf92e5 python312Packages.halohome: 0.6.0 -> 0.7.0 (#359990) 195e5ba5a8c9 kubernetes-controller-tools: 0.16.4 -> 0.16.5 a5865295af1a websurfx: init at 1.20.7 4a3071c6137d cargo-feature: fix test failure (#359761) 2d2b2dd2e2d0 rl-2411: Match to release branch (#360111) 311ccd7dd82d cargo-component: 0.17.0 -> 0.19.0 a59fd8c0893d quilt: enable strictDeps b62f26270daa ytdownloader: 3.18.3 -> 3.18.4 56e97be9b032 python312Packages.jupyter-ydoc: 3.0.0 -> 3.0.1 (#360109) 0196082f6cad ergo: 5.0.23 -> 5.0.24 1f51c3bd5de7 Merge master into staging-next b8d9c3b2adb1 ocamlPackages.melange: init at 4.0.1-52 + 4.0.0-51 + 4.0.0-414 (#359923) f3d53e22f75c mupen64plus: 2.5.9 -> 2.6.0 b4fd89b737b3 rl-2411: Match to release branch 300d4f73bd86 release notes: Move cacheNetwork note to 25.05 (#359946) 8f6163d138e2 svt-av1-psy: 2.2.1-B -> 2.3.0 (#360107) 7bcf4b31fe0d typst: remove unnecessary darwin build dependencies (#360108) 14f8fd6e81b9 python312Packages.jupyter-ydoc: 3.0.0 -> 3.0.1 cb460d69fbcc gswatcher: init at 1.7.1 828496d1a418 svt-av1-psy: 2.2.1-B -> 2.3.0 1c30becbdd07 depotdownloader: 2.7.3 -> 2.7.4 (#359705) d1fc66799f00 git-graph: Add matthiasbeyer as maintainer c0f23c4e5d54 git-graph: unstable-23-01-14 -> 0.6.0 994a7709246f typst: remove unnecessary darwin build dependencies 49d26b7cd6ab nixos/scion: fix nixosTest dates and validity period for TRCs (#360098) 5b7acac7d292 python312Packages.txtai: 7.4.0 -> 8.0.0; fix (#352153) 9483e2e6354d diffpdf: fix homepage path typo in meta (#360099) 179f72ed4d72 diffpdf: fix homepage path typo in meta 1e925a2dfd14 nixos/scion: fix nixosTest dates and validity period for TRCs 14877193e282 doc/release-notes: init wiki section (#360006) de24042fede2 root: 6.32.08 -> 6.34.00 c1d9c706d3b6 got: 0.105 -> 0.106 260fe04e8557 sile: 0.15.6 -> 0.15.7 (#359859) 98bbdd1246eb nextcloud30Packages: update 2d7406c6827a nextcloud29Packages: update 2deaa487264c nextcloud28Packages: update 6ede23a8573d python312Packages.fido2: 1.1.3 -> 1.2.0 (#359632) c55f24450df2 ogre: 14.3.1 -> 14.3.2 (#359709) 32d6f520080d mqtt-randompub: init at 0.2.2 1f33e2a756ac nixos/cupsd: Fix permissions on shared directories (#360022) a1ed423d07e3 jogger: 1.2.4-unstable-2024-04-05 -> 1.2.5 8e750424b4cf jumppad: 0.15.0 -> 0.16.0 ae165c04aeeb bitbox: init at 4.46.3 a5fb96baf0e0 vapoursynth: fix darwin build (#359263) be84d0bc4475 mongoc: 1.28.0 -> 1.29.0 bdf1baf6849d c2fmzq: 0.4.22 -> 0.4.25 0d739c9456d3 php84Extensions.xdebug: remove broken flag (#360084) 65517c04a475 php84Extensions.xdebug: remove broken flag 43d34c4e9664 bfg-repo-cleaner: format with nixfmt-rfc-style and add passthru.tests.version (#357491) 14147f11dacd fishnet: format with nixfmt-rfc-style and add passthru.tests.version (#357516) e1c06e7f8462 .github/labeler.yml: add ruby label for gem changes (#357031) 63863a88478b nb: add passthru.tests.version and updateScript (#356342) ba80e23a7475 act: add passthru.tests.version (#356374) 0ea2d3a4467d ghq: add passthru.tests.version and updateScript (#356244) dff42fc1b8d3 acr-cli: init at 0.14 (#359508) b860c30ef81a python312Packages.llama-index-vector-stores-postgres: relax pgvector dependency version 84dafe5c5d37 archimede: init at 0.0.2 (#355257) 7389d32232d5 nixos/cupsd: Fix permissions on shared directories 22a3deafeed6 python312Packages.pgvector: 0.2.4 -> 0.3.6 cd6c2bc48f72 python312Packages.txtai: 7.4.0 -> 8.0.0 53f77a5620cb rider: add avalonia libs needed for dotMemory (#348338) 1f197e6da28d ponysay: fix SyntaxWarning (#357413) 44a426a44fe3 tesh: fix build (#357625) 6fb81c30b5e7 cargo-deb: fix build failure (#359774) e43ca6ae7712 python312Packages.pylint-django: 2.6.0 -> 2.6.1 130f661d36fe bluej: move to `by-name`, `with lib;` cleanup, RFC format (#356009) a9464b38c30b rainfrog: add passthru.tests.version (#357443) 299f7c8d48bd nodemon: fix package meta (#359572) fb9e5b105938 activitywatch: add meta.mainProgram (#359809) a68d0d6c2b72 caf: apply formatting (#352592) a7c0f23bd647 maintainers: remove email for amuckstot30 (#360059) 7d5c030bdf8f foliate: 3.1.1 -> 3.2.0 (#359860) b04ca6b759bd python312Packages.datasette: 0.65 -> 0.65.1 b0bb6ea98567 glamoroustoolkit: 1.1.7 -> 1.1.8 cf88138cad3d python312Packages.python-socketio; onionshare: fix on darwin (#359885) 38260c284ce9 python312Packages.python-arango: 8.1.2 -> 8.1.3 564e219aa5ca python312Packages.nanobind: 2.1.0 -> 2.2.0 (#358621) 23038522f118 julia.withPackages: set empty JULIA_SSL_CA_ROOTS_PATH on darwin c31efe915045 julia.withPackages: fix artifact fixupPhase on darwin cafc21fb166d python312Packages.glances-api: 0.8.0 -> 0.9.0 6f48feb65378 ignite-cli: 28.5.3 -> 28.6.0 (#359488) 614d70992128 python312Packages.publicsuffixlist: 1.0.2.20241127 -> 1.0.2.20241129 20b02e33c9a8 nvrh: 0.1.14 -> 0.1.15 (#360036) d566f2494f0e qadwaitadecorations-qt6: 0.1.5 -> 0.1.6 5d55f09c224b python312Packages.authcaptureproxy: 1.3.2 -> 1.3.3 1b5237a9bdf0 maintainers: remove email for amuckstot30 bb9af90bf2eb python312Packages.google-cloud-datacatalog: 3.21.0 -> 3.23.0 (#359790) 2099a8d7cc18 python311Packages.graphrag: 0.3.6 -> 0.5.0 (#359792) 01c1cbeea27e python312Packages.pytest-codspeed: fix typo (#359793) c688c75483bf eza: 0.20.9 -> 0.20.10 (#359760) fb08995413ce pbpctrl: 0.1.6 -> 0.1.7 (#359291) b402ee42850f breakpad: 2023.01.27 -> 2023.06.01 (#359529) 769f42e45a71 mumble-overlay: just build it the upstream way (#359620) 4feee5384781 python312Packages.growattserver: 1.5.0 -> 1.6.0 3df2bbc1ec66 Merge master into staging-next e892b4118707 python312Packages.rmsd: 1.5.1 -> 1.6.0 683217666611 nginxModules.subsFilter: 2022-01-24 (#359905) bd06cd59e9f7 php84Extensions.xdebug: 3.3.2 -> 3.4.0 (#360049) 65d311a74581 php84Extensions.xdebug: 3.3.2 -> 3.4.0 abf234f409a9 sgt-puzzles: 20240928.182b3d9 -> 20241123.5e74004 33e47243a2d2 node-red: 4.0.4 -> 4.0.5 7e027363e226 python3Packages.cruft: init at 2.15.0 d1d622625837 nvrh: 0.1.14 -> 0.1.15 79466231490c chainsaw 2.9.2 -> 2.10.1 aabf3a0c61af melonDS: 0.9.5-unstable-2024-09-29 -> 1.0rc-unstable-2024-11-27 f3f3a3eee096 alpaca: 2.8.0 -> 2.9.0 3afd26366a39 nodeinfo: fix tags (should be a list) 4b39e819bfe4 erigon: fix tags fec9222abfd8 folio: 24.12 -> 24.13 (#359558) 2adb5faba249 lla: init at 0.2.9 (#359293) b0fb9d547c02 ipfs-cluster: 1.1.1 -> 1.1.2 ed90cb9e2664 grpcurl: 1.9.1 -> 1.9.2 39a078a3ef58 python312Packages.mss: 9.0.2 -> 10.0.0 (#359644) 9080387f029a latexminted: 0.3.0 -> 0.3.2 5aa819d0e0b1 pegasus-frontend: update 0-unstable-2023-12-05 -> 0-unstable-2024-11-11 (#359306) a7ada678dda2 check-jsonschema: 0.29.2 -> 0.29.4 0b87b1feb602 ant: use finalAttrs acf1b4900e58 .git-blame-ignore-revs: add 2538d58436b8d0b56d29780aeebf4bf720ddb9ea 2538d58436b8 ant: format with nixfmt-rfc-style 4f2b642f6cff apacheAnt: make ant the primary name 539559631621 updatecli: 0.82.0 -> 0.88.0 5b9f28cf6e42 proxmark3: 4.18994 -> 4.19552 (#358172) 8ed9e1be0443 moonfire-nvr: 0.7.7 -> 0.7.17 d60e53724909 release notes: Move agorakit to 25.05 (#359942) 913dffe34cee python312Packages.markdownify: 0.13.1 -> 0.14.1 0c67dd591ed4 Merge master into staging-next e7387f290c67 treewide: remove AndersonTorres from maintainers 95dbdbbd9a4b gnmic: fix version reporting (#359655) 1d62a85ff5be nixos/mailman: add option to expand the uwsgi settings (#333315) 970e93b9f82e terraform-providers.doppler: 1.11.0 -> 1.12.0 f8b32a49213a terraform-providers.yandex: 0.130.0 -> 0.133.0 199ab2b32194 terraform-providers.mongodbatlas: 1.21.1 -> 1.22.0 97d45f98f22f ocamlPackages.melange: init at 4.0.1-52 + 4.0.0-51 + 4.0.0-414 319cef6187b1 doc/release-notes: init wiki section 6399331a255e nix-plugin-pijul: 0.1.4 -> 0.1.5 522d5d85db83 python312Packages.qcodes: 0.50.0 -> 0.50.1 (#359828) 42e77274c86b lomiri.lomiri-url-dispatcher: Fix libexec binary location in services (#359687) d61106e5093c onionshare: add update script 393d40b4d2a1 binwalk: fix `checkPhase` on Darwin 421aafb453c1 vkdt: 0.9.0 -> 0.9.1 58fa16394676 metasploit: add versionTest to detect runtime errors 7ae70a97d5c9 metasploit: update dependencies to fix runtime error 64f6de59cc95 mistral-rs: switch to fetchCargoVendor bfff65c1e5e9 python312Packages.jh2: init at 5.0.4 2b1e9f0252dc python312Packages.aiowmi: init at 0.2.3 665fcc80ea74 onionshare: fix on darwin 0b75c4e176d8 onionshare: move to by-name; refactor 02fe29395df8 python312Packages.aemet-opendata: 0.5.5 -> 0.6.3 (#359663) 3c268106ae97 vunnel: 0.28.0 -> 0.29.0 51c0f230d5f0 python312Packages.halohome: 0.6.0 -> 0.7.0 171142d09cbe python312Packages.checkdmarc: 5.5.0 -> 5.7.8 a2e747664b70 strawberry: format with nixfmt 504fcfb198a1 python312Packages.haversine: 2.8.1 -> 2.9.0 d5845527960e diffstat: add a trivial updater 5706049cf6a0 diffstat: 1.66 -> 1.67 bc05d768e3b0 python312Packages.garminconnect: 0.2.21 -> 0.2.23 b3e8cfc28b06 greenmask: 0.2.3 -> 0.2.5 3e3d4ca65ada trufflehog: 3.84.0 -> 3.84.1 8d41c901450c ldeep: 1.0.75 -> 1.0.76 95a92c04299a python312Packages.spotifyaio: 0.8.8 -> 0.8.10 69eb494e6862 python312Packages.python-can: 4.4.2 -> 4.5.0 c2c53cb7b1c2 onionshare: format 3b6448baa5cc python312Packages.neo4j: 5.26.0 -> 5.27.0 bfe7bb410f3c nixos/printing: fix ShellCheck issues dfb9a94013dc python312Packages.botocore-stubs: 1.35.29 -> 1.35.71 81684eba3f5d python312Packages.boto3-stubs: 1.35.29 -> 1.35.71 61fdb8e0d4c2 python312Packages.meilisearch: 0.31.6 -> 0.32.0 eeab2e4e5e9d phpactor: 2024.11.05.0 -> 2024.11.28.0 (#359939) 70b1a96bf54e n98-magerun2: 7.4.0 -> 7.5.0 (#359963) 49c8101b6feb python312Packages.aiomisc: 17.5.26 -> 17.5.29 2f682051a979 python312Packages.tencentcloud-sdk-python: 3.0.1273 -> 3.0.1274 3ebbc677637d cnspec: 11.31.1 -> 11.32.0 572df3a23383 exploitdb: 2024-11-16 -> 2024-11-26 2330454c04ad checkov: 3.2.316 -> 3.2.322 8d4851c6f2e4 unigine-superposition: fix fhsenv version af1aa40e7332 workflows/eval.yml: Run on dev branch pushes and apply rebuild labels d2a0baa169f8 sidequest: fix fhsenv version 41711056e6cb ssb-patchwork: fix appimageTools version 085b17a0671d steam-rom-manager: fix appimageTools version e62e20249fb3 android-studio: fix fhsenv version 73b6cbce5ca2 php81Packages.phpstan: 1.11.8 -> 2.0.2 (#359957) 3c02da2176bc n98-magerun2: 7.4.0 -> 7.5.0 543abba9d00b bazel_7: fix fhsenv version cb20f06e97f4 feishin: 0.12.0 -> 0.12.1 115b31f2a363 php81Packages.phpstan: 1.11.8 -> 2.0.2 7a294f6ffb7b warp-terminal: 0.2024.11.19.08.02.stable_01 -> 0.2024.11.19.08.02.stable_03 ff3faba639ed vscode-extensions.visualjj.visualjj: 0.12.5 -> 0.13.0 (#359956) 43b7d775302d python312Packages.spsdk: 2.2.1 -> 2.4.0 (#359513) edd47f7c850c nixfmt-rfc-style: 2024-08-16 -> 2024-11-26 (#359904) 47048ebe1e89 vscode-extensions.visualjj.visualjj: 0.12.5 -> 0.13.0 e72faf80155f level-zero: 1.18.3 -> 1.19.2 (#359682) c8bacdae500b php81Packages.grumphp: 2.6.0 -> 2.9.0 (#359926) 6a134c9a3532 vscode-extensions.github.copilot: 1.243.1191 -> 1.246.1233 (#359947) 0d83445493a2 zrythm: 1.0.0-rc.2 -> 1.0.0 ae933cb7df57 vscode-extensions.github.copilot: 1.243.1191 -> 1.246.1233 c8aeacd0ae3a release notes: Move cacheNetwork note to 25.05 30ccc85dd929 README: Update to 24.11 12cadcb077d3 formats.libconfig: add support for dashes (#359308) 02d838abb98e python312Packages.influxdb3-python: 0.9.0 -> 0.10.0 (#359619) acd9b02b6dcc webkitgtk_6_0: 2.46.3 → 2.46.4 6e70ecb4af54 glab: 1.49.0 -> 1.50.0 99d776a64ce3 phpactor: 2024.11.05.0 -> 2024.11.28.0 dabd3bd5fab9 basedpyright: 1.21.1 -> 1.22.0 (#359715) 875cba81ba1d python312Packages.python-socketio: add __darwinAllowLocalNetworking 3380c823c996 linuxPackages.openafs: Patch for Linux kernel 6.12 (#358842) 51fcc9d33558 mysql-shell{,_8,-innovation}: format with nixfmt (#358604) 6dfdf6749f30 trunk-io: 1.3.2 -> 1.3.4 (#358302) efd30bb7bc99 step-ca: 0.27.5 -> 0.28.0 (#357083) c39f3576f44d gf: unstable-2023-08-09 -> 0-unstable-2024-08-21; include extensions and add plugin support (#357435) 8cad8436de73 rainfrog: 0.2.9 -> 0.2.10 (#357442) 4b8921fde42d tesseract: 5.3.4 -> 5.5.0 (#353902) b71f4a89a41a python312Packages.fastnlo-toolkit: fix build (#359805) 265b3aa46a81 php81Packages.grumphp: 2.6.0 -> 2.9.0 017d88ec837e waypipe: 0.9.1 -> 0.9.2 (#357168) 7904efb866fb amiri: 1.000 -> 1.001 (#357329) 892247b9b858 ncdu: 2.6 -> 2.7 (#357479) 251e822f9737 notepad-next: 0.8 -> 0.9 (#357598) 6bf4c9b790d7 seclists: 2024.3 -> 2024.4 (#357660) ac0c0e1c3374 maintainers: add vog 1fdd6dfe48f7 firefox-sync-client: init at 1.8.0 58cca6e00961 discord: add pipewire to fix screensharing; discord-canary: 0.0.527 -> 0.0.528 (#359666) f946c505ed28 zen-browser: init at 1.0.1-a.22 521bba39df48 croc: 10.1.0 -> 10.1.1 (#359896) b99959d762c5 maintainers: remove keys from matthewpi 07894f4f304c nixos/services.stunnel: remove `with lib;` 93d6b8180e0c nixos/services.oink: remove `with lib;` 2d4a4c110ab0 nixos/services.nylon: remove `with lib;` 2bf4393a9b32 nixos/networking.nftables: remove `with lib;` 83cc2cd01fd4 nixos/services.nebula: remove `with lib;` e14d1dc1986e nixos/services.ncdns: remove `with lib;` e4ffb753b1c9 nixos/services.glusterfs: remove `with lib;` 4dbf3a75ae48 nixos/services.drbd: remove `with lib;` 44985668d834 nixos/services.diod: remove `with lib;` a9748cc11851 nixos/services.cachefilesd: remove `with lib;` 5f44beaebbc8 nixos/services.watchdogd: remove `with lib;` e8e5c6c79b13 nixos/services.vnstat: remove `with lib;` cc88c367bbe0 nixos/services.uptime-kuma: remove `with lib;` 6974870a0a5d nixos/services.tuptime: remove `with lib;` 307f280e81eb nixos/services.tremor-rs: remove `with lib;` 851d23320b41 nixos/services.telegraf: remove `with lib;` 8eb355e97807 nixos/services.sysstat: remove `with lib;` 8b8b523eb932 nixos/services.statsd: remove `with lib;` 084011a1b4f6 nixos/services.smartd: remove `with lib;` b3796eddc428 nixos/services.scollector: remove `with lib;` a7f917375fca nixos/services.riemann: remove `with lib;` 36b176c8e31f nixos/services.riemann-tools: remove `with lib;` 9f025e3df543 nixos/services.riemann-dash: remove `with lib;` 4f4731400344 nixos/services.prometheus.xmpp-alerts: remove `with lib;` f9825ae10027 nixos/services.prometheus.sachet: remove `with lib;` 3b6ddc5927f3 nixos/services.prometheus.pushgateway: remove `with lib;` ea4bd5327457 nixos/services.prometheus.alertmanager: remove `with lib;` 951787fba30b nixos/services.prometheus.alertmanagerWebhookLogger: remove `with lib;` c617a4cb83f2 nixos/services.prometheus.alertmanagerIrcRelay: remove `with lib;` 500c84cedd93 nixos/services.osquery: remove `with lib;` f88528a137be nixos/services.netdata: remove `with lib;` c93d8f88a719 nixos/services.nagios: remove `with lib;` 34970fdcf3b5 nixos/services.munin-[cron,node]: remove `with lib;` faf7fde49ebd nixos/services.monit: remove `with lib;` 5419e3778fb4 nixos/services.mackerel-agent: remove `with lib;` 56bd2c2da6d0 nixos/services.longview: remove `with lib;` 9353cb1b7428 nixos/services.kthxbye: remove `with lib;` 1e44f5e3df81 nixos/services.karma: remove `with lib;` 588c1c985b21 nixos/services.kapacitor: remove `with lib;` 5b483238377e nixos/services.incron: remove `with lib;` baece5fb08e8 nixos/services.heapster: remove `with lib;` 95e5f256d664 nixos/services.hdapsd: remove `with lib;` 8f9336460b3c nixos/services.grafana_reporter: remove `with lib;` f1019c7adb84 nixos/services.grafana-image-renderer: remove `with lib;` e86917ad3001 nixos/services.grafana-agent: remove `with lib;` 69dd091d5150 nixos/services.fusionInventory: remove `with lib;` 699ee515a142 nixos/services.do-agent: remove `with lib;` 4bfa9c3f97c4 nixos/services.datadog-agent: remove `with lib;` 357422f21b05 nixos/services.das_watchdog: remove `with lib;` c39797b55e3b nixos/services.collectd: remove `with lib;` 5ced735a898a nixos/services.cadvisor: remove `with lib;` 278fc7501c9c nixos/services.bosun: remove `with lib;` 66ea353e1c01 nixos/services.below: remove `with lib;` 7123ef8458a9 nixos/services.arbtt: remove `with lib;` 3fa1cc4f5fa3 nixos/services.apcupsd: remove `with lib;` 03ba605ab088 nixos/services.alloy: remove `with lib;` 44990e93c306 nixos/services.alerta: remove `with lib;` 59a4e8349e6e nixos/services.zookeeper: remove `with lib;` f8b0d3a75682 nixos/services.xmrig: remove `with lib;` fe175fe57571 nixos/services.weechat: remove `with lib;` 43e70943dab8 nixos/services.uhub: remove `with lib;` b04e01279b06 nixos/services.tzupdate: remove `with lib;` f89578e7977f nixos/programs.tuxclocker: remove `with lib;` 11904bba7374 nixos/services.tp-auto-kbbl: remove `with lib;` d279b64dc1fb nixos/services.tiddlywiki: remove `with lib;` 2ecc659ae8b8 nixos/services.tautulli: remove `with lib;` cc25de02a5da nixos/services.tandoor-recipes: remove `with lib;` 334d6eb4920e nixos/services.synergy: remove `with lib;` 165ad257f7c4 nixos/services.svnserve: remove `with lib;` 07819ffd98de nixos/services.sundtek: remove `with lib;` 5adb3502aa51 nixos/services.subsonic: remove `with lib;` 269e2407e919 nixos/services.sssd: remove `with lib;` 4a435c16d296 nixos/services.spice-webdavd: remove `with lib;` e4c0bdd97fe4 nixos/services.spice-vdagentd: remove `with lib;` 7abfa8873a9f nixos/services.sonarr: remove `with lib;` b84a9d0112d8 nixos/services.soft-serve: remove `with lib;` 288a6271548e nixos/services.siproxd: remove `with lib;` 2a8d189e9b6e nixos/services.signald: remove `with lib;` e593a4c094d5 nixos/services.sickbeard: remove `with lib;` 1b4c241f80ef nixos/services.serviio: remove `with lib;` 1bf69e64ec7f nixos/services.sdrplayApi: remove `with lib;` 1d3ea1dbe548 nixos/services.safeeyes: remove `with lib;` e3f2e1c9fb1f nixos/services.rmfakecloud: remove `with lib;` 724f15d7d878 nixos/services.rkvm: remove `with lib;` 0280cad9996e nixos/services.rippleDataApi: remove `with lib;` ff06ef206836 Merge master into staging-next aa912dbb9570 factorio-mods: drop (#359695) 0ed2ac3ee5fa sile: build with luajit by default c7c136a61058 kanidm: allow hydra to cache alternative build with secret provisioning (#358782) 60e11b72fad8 comrak: 0.23.0 -> 0.31.0 (#359209) 8c5c3e5bc22d python312Packages.soxr: fix build on x86_64-darwin (#359539) 7edacad9b7f5 sile: make it easier to setup a modified luaEnv when writing documents d8791f8ac395 open-webui: add `env.NODE_OPTIONS` (#359891) 31b8963cf827 protonmail-bridge: 3.14.0 -> 3.15.0 8a2c001038cb cloudflared: fix cross compilation f34a78551414 croc: 10.1.0 -> 10.1.1 581d7e4d23b9 jetbrains.rider: Use unwrapped location of sdk (#358178) bed88b7c2c61 opentofu: patch plugins to use opentofu plugin registry (#358522) 2b79771aa104 stackit-cli: 0.16.0 -> 0.17.0 7b404c8aee95 open-webui: add `env.NODE_OPTIONS` c52537868cc3 ocamlPackages.sedlex: 3.2 → 3.3 13b953c8644e lib.packagesFromDirectoryRecursive: More precise type signature 5c2988371e99 ios-deploy: migrate to new apple-sdk pattern 6c59ecc7699b ios-deploy: reformat af1286f0e9a9 ios-deploy: rename from darwin.ios-deploy 0ecd14bacb65 discrete-scroll: 0.1.1 -> 1.2.1 (#359465) c85ddc48b7fe botan{2,3}: always set --cpu, fix cross compilation 602c7e45533c python312Packages.python-gvm: 24.8.0 -> 24.11.0 9941229fd90d bear: use lib.cmakeFeature, drop with lib 542b211fa736 bear: fix cross compilation, set strictDeps e7535d9bc9b0 mpvScripts: mpv → builtins 3f7d6de841ca anki-sync-server: use new darwin sdk pattern, format with nixfmt 1bca51002363 mpvScripts: Use `lib.packagesFromDirectoryRecursive` 9dea01228a5a anki-sync-server: fix cross compilation 21b1a91c2afb ox: 0.7.1 -> 0.7.2 bf173b318479 python312Packages.niaclass: 0.2.0 -> 0.2.1 6ce5063d8275 feishin: 0.11.1 -> 0.12.0 a04f8743c791 taler-exchange,taler-merchant: fix description (#359858) 1a33aa67b29b mopac: 23.0.0 -> 23.0.2 (#358949) 9bdf42fec35d taler-exchange,taler-merchant: fix description 64b2f13b2eca rclip: 1.10.3 -> 1.11.0 (#359848) e439619ef81b ugm: 1.5.0 -> 1.6.0 (#359657) 9884d8921a59 rclip: 1.10.3 -> 1.11.0 e79c1007de55 rclip: format 4b27a143520b python312Packages.rawpy: init at 0.23.2 1ec09830979b klog-time-tracker: 6.4 -> 6.5 72dc28520ec7 rogcat: 0.4.7 -> 0.5.0 (#359627) 54a93b6c5a85 ants: 2.5.3 -> 2.5.4 (#359485) 6a98838fbf7d terraform-providers.pagerduty: 3.16.0 -> 3.18.1 (#359823) ee79e0dae5a5 sqlitestudio: 3.4.5 -> 3.4.6 (#359730) 9a687953146d sile: 0.15.6 -> 0.15.7 a0d6d9ed6702 fh: 0.1.18 -> 0.1.19 (#359757) d28ba31b06b5 foliate: 3.1.1 -> 3.2.0 35c69434e61e python312Packages.aiortm: 0.9.32 -> 0.9.36 (#359765) 13324edce0e4 python312Packages.aioopenexchangerates: 0.6.13 -> 0.6.16 (#359766) 55a8bee3cdaa python312Packages.findimports: 2.5.1 -> 2.5.2 (#359769) 0447b7a53d22 python312Packages.elmax-api: 0.0.6.1 -> 0.0.6.2 (#359770) 4054dc1b472b python312Packages.cyclopts: 3.1.0 -> 3.1.1 (#359771) f32d3b5fad8d python312Packages.mypy-boto3-*: updates (#359775) 4c277aea43aa python312Packages.meshtastic: 2.5.4 -> 2.5.5 (#359776) ac0ef9675a71 python312Packages.tencentcloud-sdk-python: 3.0.1272 -> 3.0.1273 (#359777) 9ec849f2813a python312Packages.aiorwlock: 1.4.0 -> 1.5.0 (#359784) e785acdef531 python312Packages.aiolifx-themes: 0.5.6 -> 0.5.7 (#359785) 60e64ed72cf1 python312Packages.coinmetrics-api-client: 2024.10.31.17 -> 2024.11.21.20 (#359788) 97b2472542ec docker-credential-gcr: 2.1.25 -> 2.1.26 (#359711) 5f633006f0f7 cascadia-code: 2404.23 -> 2407.24 (#359719) e5dcb6d8cc59 castxml: 0.6.8 -> 0.6.10 (#359727) ff29f0ac755a php84Extensions.mongodb: 1.20.0 -> 1.20.1 (#359729) c4b0987e5a77 calcure: 3.0.2 -> 3.1 (#359736) adc0e5c9b1a6 bacon: 3.2.0 -> 3.3.0 (#359738) 44028b598982 pandoc-include: 1.4.0 -> 1.4.1 (#359691) d25ed0a789ec renode-dts2repl: 0-unstable-2024-10-09 -> 0-unstable-2024-11-27 (#359706) e2cab77f216c soundconverter: 4.0.5 -> 4.0.6 (#359707) f3125d2f71b8 sile: remove now unneeded darwin inputs b65739e061fb zotero: 7.0.8 → 7.0.10 754f5fb90dbc zram-generator: format with nixfmt, use --replace-fail instead of --replace ff3f176cdd2b zram-generator: move to by-name 08aab4041b19 zram-generator: 1.2.0 -> 1.2.1 508d3d102289 zram-generator: 1.1.2 -> 1.2.0 f8d32a0023f4 zram-generator: use latest tags instead of release in update script 7fa0fa45a884 buildkite-agent: 3.87.0 -> 3.87.1 (#359617) 6822ad5dba25 sequoia-sq: 0.39.0 -> 0.40.0 abdb2b1f8695 Cinnamon updates 2024-11-26 (#359288) 8e9dfecc0939 ffms: fix vapoursynth plugin on darwin (#359262) dc8d92608d40 Add tests bbfafe9c3a86 apko: 0.19.6 -> 0.20.1 f5080d12b384 Rebuild password update functionality, add tests dfee0f49403b mapproxy: 3.1.0 -> 3.1.2 (#358854) 6d53ec21a026 lla: init at 0.2.9 595e00cbcac5 mpvScripts: handle nested attrsets (#359625) 5a6ea278da9a nixos/os-release: make default_hostname distroId 92714a6519a6 Merge master into staging-next cee3b715318c mycelium: 0.5.6 -> 0.5.7 (#359794) 5ca1ce25e140 zammad: move to pkgs/by-name/, use stdenvNoCC and format with rfc-style (#359530) 1cd22bbd500a python312Packages.huggingface-hub: 0.26.2 -> 0.26.3 009616cc4db6 php81Extensions.blackfire: 1.92.25 -> 1.92.28 5e281ad29aba sp800-90b-entropyassessment: 1.1.6 -> 1.1.8 (#359576) 954f9b947ae2 percona-server_8_0: 8.0.37-29 -> 8.0.39-30 2fbd23ab9ee1 percona-server: 8.4.0-1 -> 8.4.2-2 5a7a6c2f251d em100: Build and include makedpfw tool (#359734) 6f7f48833e8e terraform-providers.pagerduty: 3.16.0 -> 3.18.1 a4308aba7242 buildGoModule: no longer filter out vendorSha256 (#359798) 07c91eefe41f musl: set arch for aarch64 (#359046) 992dd01f1141 tbb_2021_11: fix build on musl (#359051) b22393b73f76 python312Packages.qcodes: 0.50.0 -> 0.50.1 201bef8a3e47 fire: 1.0.0.3 -> 1.0.1-unstable-2024-10-22, modernise, fix Darwin (#358181) 335b323f4d10 dexed: unstable-2022-07-09 -> 0.9.8, modernise, fix Darwin (#358164) 8e0186778196 python3Packages.python-pptx: 0.6.23 -> 1.0.2 (#359781) 20fb3d9b9ef5 python312Packages.cleanlab: disabled failing test on python 3.12 (#359810) aef7105b3dda jwt-cli: 6.1.1 -> 6.2.0 ea60c79b79d0 treewide: unpin most LLVM-14s in all-packages.nix (#358871) 922853783af4 python312Packages.cleanlab: disabled failing test on python 3.12 a930012b7581 mailmap: remap moni's email (#359624) c3677f8ca7ea activitywatch: add meta.mainProgram 46e484a4ff37 ocaml: don't add `bin-utils` for darwin (#359759) 0b671fc6e11f python312Packages.stable-baselines3: 2.3.2-unstable-2024-11-04 -> 2.4.0 (#359773) d3021e5509bd python312Packagesfastnlo-toolkit: fix build 17399d3824ab fastnlo-toolkit: nixfmt 50bfbbd7d48f enableAllTerminfo: re-add unbroken contour (#359542) 583cf8753332 gancio: remove mkYarnPackage usage (#341917) c6ce9eaf37c2 atlas: 0.28.1 -> 0.29.0 (#359587) 9b7c788f89ab fuzzel: support building with librsvg backend (#356621) c417f4153b4d mycelium: 0.5.6 -> 0.5.7 149f9897d5a6 python312Packages.pytest-codspeed: fix typo 277ad755e733 protobuf_29: init at 29.0 (#359696) 0419cb537e6e python312Packages.django-rest-registration: fix build 9230f0ec9d30 python311Packages.graphrag: 0.3.6 -> 0.5.0 d05336fe3fbc python312Packages.google-cloud-datacatalog: 3.21.0 -> 3.23.0 03454a0cac7a python312Packages.coinmetrics-api-client: 2024.10.31.17 -> 2024.11.21.20 a4dd838b6601 terraform-providers.alicloud: 1.231.0 -> 1.235.0 aa8b44010845 python312Packages.aiorwlock: 1.4.0 -> 1.5.0 ae281b2cbafa python3Packages.python-pptx: 0.6.23 -> 1.0.2 60da38b473bc add python-updates to dev branches (#359756) d4265a89973f python312Packages.aiolifx-themes: 0.5.6 -> 0.5.7 884b5b4f48d6 python312Packages.aiohttp-fast-zlib: 0.1.1 -> 0.2.0 9a4eeca7a676 python312Packages.withings-sync: 4.2.5 -> 4.2.6 14d8890fb9ed coqPackages.ssprove: 0.2.1 → 0.2.2 cebaaf501b5e python312Packages.securetar: 2024.2.1 -> 2024.11.0 (#359253) a944e46c81d5 outline: 0.81.0 -> 0.81.1 bc563dea3274 python312Packages.types-awscrt: 0.23.0 -> 0.23.1 e1e6f5acd33b python312Packages.tencentcloud-sdk-python: 3.0.1272 -> 3.0.1273 cf4e92a01090 python312Packages.mypy-boto3-fsx: 1.35.27 -> 1.35.71 2310dcb750f7 python312Packages.mypy-boto3-ec2: 1.35.67 -> 1.35.70 1a98618560bf python312Packages.mypy-boto3-connect: 1.35.68 -> 1.35.70 c9fba96dba46 python312Packages.mypy-boto3-config: 1.35.0 -> 1.35.71 a19d9041fd53 python312Packages.meshtastic: 2.5.4 -> 2.5.5 e820bbfd879d python312Packages.stable-baselines3: 2.3.2-unstable-2024-11-04 -> 2.4.0 ae379c99c9e4 cargo-deb: fix build failure 79d58249978f python312Packages.findimports: 2.5.1 -> 2.5.2 8e6429857088 python312Packages.elmax-api: 0.0.6.1 -> 0.0.6.2 8142620c3719 python312Packages.cyclopts: 3.1.0 -> 3.1.1 89ff8b6b8d8f python312Packages.aiortm: 0.9.32 -> 0.9.36 f9ad7eee79ca sm64coopdx: 1.0.3 -> 1.0.4 62f028f40932 python312Packages.aioopenexchangerates: 0.6.13 -> 0.6.16 226216574ada vimPlugins.blink-cmp: 0.5.1. -> 0.6.2 (#359752) 013b002ff947 python3Packages.pyflipper: init at unstable 2024-04-15 (#343729) 594590193596 python3Packages.django-apscheduler: init at 0.7.0 (#358890) 7bc536f6f1e9 aider-chat: 0.62.0 -> 0.65.0 (#358832) c85e05343ff3 python312Packages.turrishw: init at 1.0.0 (#359434) fd4a692661e8 python312Packages.pytest-codspeed: init at 3.0.0 (#359443) 695e6a025f78 haskellPackages.unordered-containers: disable hanging tests on 32bit (#359690) a5db1dd47711 eza: 0.20.9 -> 0.20.10 5020a1c82a38 ocaml: don't add `bin-utils` for darwin 145b28d89928 qgis: use default python version 8a30b22d0a25 python312Packages.aioacaia: init at 0.1.9 (#359461) 712f670bb33f burpsuite: add changelog to meta (#359510) b9d1c3ee1395 python312Packages.django-colorful: refactor (#359519) c92969282744 python3Packages.pymodes: init at 2.11 (#359536) 991195ade7f0 python312Packages.iocsearcher: 1.0.0 -> 2.4.3-unstable-2024-10-08 (#359545) 668d72c474b1 add python-updates to dev branches b26135cd5c8b cargo-feature: fix build failure f1745cb78fec fh: 0.1.18 -> 0.1.19 e22a76560587 scheherazade-new: 4.000 → 4.300 bdf12d1a0682 vimPlugins.blink-cmp: 0.5.1. -> 0.6.2 cf99465f46a5 parca: init at 0.22.0 (#359635) e405f3051316 `flutterPackages-source.*.engine`: don't remove `gen` (#359123) d00aba92dfd3 gping: 1.17.3 -> 1.18.0 (#356624) 2202fa533b5b protobuf: format (#359703) 134d72cd4c4b phraze: 0.3.15 -> 0.3.17 34892a2aa07e fheroes2: 1.1.3 -> 1.1.4 c78d3b84652b coqPackages.Ordinal: init at 0.5.3 bbe77e1e879e maintainers: add damhiya 2a4bd880237d Merge master into staging-next 2685312ba9cd bacon: 3.2.0 -> 3.3.0 b386cae5bad3 calcure: 3.0.2 -> 3.1 258e563d2cb3 python312Packages.polyfactory: 2.18.0 -> 2.18.1 (#359283) ea757832c127 iosevka: 31.8.0 -> 32.1.0 (#359598) c49e02474547 em100: Build and include makedpfw tool 18a80ee43c6b linuxPackages_latest.broadcom_sta: add patch to compile on Kernel 6.12 444f948e3c73 dissent: 0.0.30 -> 0.0.31 (#359728) f01de68f50fc python312Packages.recurring-ical-events: unpin x-wr-timezone c945a25c0b77 jx: 3.10.156 -> 3.11.1 (#359676) 7fbad767dfe1 python3Packages.django-apscheduler: init at 0.7.0 053ae2cfff10 sqlitestudio: 3.4.5 -> 3.4.6 a253c2d94cbf wdt: 1.27.1612021-unstable-2024-08-22 -> 1.27.1612021-unstable-2024-11-14 (#359716) 70696367330d krop: pin pypdf2 version (#357570) eba5e18f5ead dissent: 0.0.30 -> 0.0.31 47866d72ca02 php84Extensions.mongodb: 1.20.0 -> 1.20.1 47e05fadce42 aider-chat: 0.62.0 -> 0.65.0 faf198371aca python312Packages.litellm: 1.51.2 -> 1.52.16 2d9cb77fbc19 quill: 0.2.17 -> 0.5.1 (#356925) b3756fbfe1e4 castxml: 0.6.8 -> 0.6.10 fa42b5a5f401 normcap: 0.5.8 -> 0.5.9 (#355312) 470dff29fa79 factoriolab: 3.8.1 -> 3.8.4 49efe5ed3c74 sequin: init at 0.2.0 (#358034) 3cb3833253c3 task-keeper: init at 0.27.0 (#352935) 95357bc93690 cascadia-code: 2404.23 -> 2407.24 142f3a52bc42 gf: unstable-2023-08-09 -> 0-unstable-2024-08-21; include extensions and add plugin support ffa0b587db51 terraform-providers.tencentcloud: 1.81.133 -> 1.81.142 ab94a4272877 wdt: 1.27.1612021-unstable-2024-08-22 -> 1.27.1612021-unstable-2024-11-14 2861fbe57249 basedpyright: 1.21.1 -> 1.22.0 ad34a33ee8c3 xfce.xfce4-notes-plugin: Generate C code with newer Vala (#359006) 5d8070e38822 digikam: 8.4.0 → 8.5.0 (#358934) 241087650ac6 docker-credential-gcr: 2.1.25 -> 2.1.26 8d3f01650b1b Merge master into staging-next 76fe013a4b7c treewide: use dpkg setup hook (#359417) 4e8039602804 dmarc-metrics-exporter: 1.1.0 -> 1.2.0 a41402058279 ogre: 14.3.1 -> 14.3.2 12dbe9fb05ed zed-editor: 0.162.5 -> 0.163.2 (#359652) ba6e7e10bb36 nixos/services.readarr: remove `with lib;` 39d9937d053e nixos/services.radarr: remove `with lib;` f5c2c7bbf2d9 nixos/services.pykms: remove `with lib;` 247134aefb55 nixos/services.prowlarr: remove `with lib;` 6a73a0aca934 nixos/services.preload: remove `with lib;` 257f608dfcb1 nixos/services.polaris: remove `with lib;` 66fecabb5fe0 nixos/services.plikd: remove `with lib;` 8553d979a176 nixos/services.plex: remove `with lib;` bb74224921fb nixos/services.pinnwand: remove `with lib;` 59061eb9ea8b nixos/services.parsoid: remove `with lib;` 9540ed87477e nixos/services.paperless: remove `with lib;` e58e1161de26 discrete-scroll: 0.1.1 -> 1.2.1 ad50df338480 discrete-scroll: refactor 6bb8101aaf2b soundconverter: 4.0.5 -> 4.0.6 64d681ac931f gh: 2.62.0 -> 2.63.0 51503b1c36b8 renode-dts2repl: 0-unstable-2024-10-09 -> 0-unstable-2024-11-27 54313579bb0f protobuf: format 07fc04c4595c terraform: 1.9.8 -> 1.10.0 817e1ed8f409 terraform-providers.minio: 2.5.1 -> 3.2.1 3b074e283e34 terraform-providers.tfe: 0.59.0 -> 0.60.1 013f23de0422 coolercontrol.*: 1.4.0 -> 1.4.4 (#358289) e0c4e8953500 depotdownloader: 2.7.3 -> 2.7.4 fe1509dc6cd0 buildFHSEnv: void ldconfig warnings (#359080) 3ed3828ad715 python312Packages.boltztrap2: fix build e79d2ffbfca7 python3Packages.rio-tiler: 7.0.1 -> 7.2.2 9ea0de6394c7 protobuf_29: init at 29.0 16e096e34e0e vapoursynth-znedi3: fix darwin build e7af7017b1db vapoursynth-nnedi3: fix darwin build 31cb06a26a82 vapoursynth-editor: fix darwin build cc114432567f factorio-mods: drop 25bc2d8c4503 crossplane-cli: 1.17.1 -> 1.18.0 45dab5318859 vimPlugins: add missing dependencies (#359307) 3a730b8cdd4a dropbox: add version and pname (#359678) 10eb3ebd781c haskellPackages.unordered-containers: disable hanging tests on 32bit d4b44717863b pandoc-include: 1.4.0 -> 1.4.1 1af52db2011e nixos/mailman: wrap mailman cli to start as mailman user (#332847) 61d15c60fcdc nixos/mailman: add option to expand the uwsgi settings 6d6744357fdf golangci-lint: 1.62.0 -> 1.62.2 (#359278) 9f210d877d03 searxng: 0-unstable-2024-11-17 -> 0-unstable-2024-11-25; python312Packages.fasttext-predict: 0.9.2.2 -> 0.9.2.4 (#359002) 649af92bce3d python312Packages.mitmproxy: 11.0.0 -> 11.0.1 (#358996) 2fd17b59d889 hydra: 0-unstable-2024-10-24 -> 0-unstable-2024-11-25 (#356391) 35a18e866600 beets: allow darwin builds (#357903) 0da9e4ec6b56 vscode-extensions.ms-python.python: Add aarch64-linux support (#358779) 07a1577c5b89 python3Packages.rasterio: 1.4.0 -> 1.4.2 bd1f484c0505 lomiri.lomiri-url-dispatcher: Fix libexec binary location in services 76bb4843c7f9 treewide: pin Gradle 8 where deprecation warning present in build log (#359177) b50564b9387d dropbox: add version and pname b5ad44e06e9d nixos/lvm: expand enable description to better inform users about the… (#355463) 07fb8bb1a6e8 level-zero: 1.18.3 -> 1.19.2 411c5609d007 pdal: add upstream patch for GDAL 3.10 e2d3e2e33ce8 jx: 3.10.156 -> 3.11.1 01218209dc20 nixos/services.duplicity: remove `with lib;` 699a0f8601c7 nixos/services.duplicati: remove `with lib;` ef50268985fd nixos/services.borgmatic: remove `with lib;` f600d6a3b162 nixos/services.ympd: remove `with lib;` 9d80afc3c4d0 nixos/services.spotifyd: remove `with lib;` f6a10dfc0951 nixos/services.slimserver: remove `with lib;` ecb168c8d775 nixos/services.roon-server: remove `with lib;` 794d3952b0e0 nixos/services.roon-bridge: remove `with lib;` bde5fcc9b8b8 nixos/services.networkaudiod: remove `with lib;` b477479cb7b1 nixos/services.mpdscribble: remove `with lib;` de5c62db29d3 nixos/services.liquidsoap: remove `with lib;` f645147c7e16 nixos/services.jmusicbot: remove `with lib;` 291d92e5290e nixos/services.jack: remove `with lib;` e8fa5a92e93e nixos/services.icecast: remove `with lib;` 1d19c390cf02 nixos/services.hqplayerd: remove `with lib;` dfd031a486d3 nixos/services.goxlr-utility: remove `with lib;` 496d11787dd7 nixos/services.gonic: remove `with lib;` cab8ab375c5b nixos/services.gmediarender: remove `with lib;` c62a55f1b60b nixos/services.botamusique: remove `with lib;` 82146f6a7105 nixos/services.activemq: remove `with lib;` 5a670b332ab7 nixos/services.salt.minion: remove `with lib;` 503fd3014a47 nixos/services.oxidized: remove `with lib;` 3c80b14a8145 nixos/security.please: remove `with lib;` a62e66394b7b nixos/security.audit: remove `with lib;` 236ed7869df0 nixos/security.apparmor: remove `with lib;` b1a2522f05c2 nixos/fcast-receiver: remove `with lib;` 9a8512f4600d nixos/meta: remove `with lib;` 0334b1bf8ebf nixos/label: remove `with lib;` 4feff6c9b5b1 nixos/crashdump: remove `with lib;` 650b7695e0b7 nixos/assertions: remove `with lib;` 387be4f6c369 nixos/i18n.inputMethod.uim: remove `with lib;` d5a377e94eee nixos/i18n.inputMethod.nabi: remove `with lib;` 3eb92bcce7c4 nixos/i18n.inputMethod.ibus: remove `with lib;` 17c011592a1a nixos/i18n.inputMethod.hime: remove `with lib;` 1cd3957e37f2 python3Packages.scikit-survival: fix and update (#359183) 9a9f9a021ef2 python312Packages.taco: fix build (#358929) d99f51ac601a opentofu: patch plugins to use opentofu plugin registry 187ef4d65ba3 opentofu: apply nixfmt cbe847702f08 python312Packages.logilab-common: fix build (#359252) 920193c24af0 paperlib: fix darwin build (#359118) b020b8ecfde0 horizon-eda: fix build (#358910) 4a60dea06b61 gdcm: switch to new sdk pattern on darwin and fixes build (#358792) 567a36cf623e vimPlugins: cleanup with self 83ebb5d0316e vimPlugins: add missing dependencies 4e927186d759 vimPlugins.{spacevim,SpaceVim}: point to spacevim; spacevim: 1.8.0 -> 2.3.0; spacevim: change maintainers (#359304) 8b173e8bb24f nixVersions.nix_2_19: drop (#354148) 98dece1bf5f6 nixos/iso-image: fix `isoImage.grubTheme = null;` (#359374) 554298b72632 flashmq: 1.17.3 → 1.18.2 (#358591) eb44521ffbc8 rectangle: 0.84 -> 0.85 (#358674) 357a34001970 various: remove left-over rtc_cmos rootModule (#359416) 7535f259a57c mitimasu: init at 0-unstable-2023-10-24 (#357618) 1b02ba59aa34 treewide: hide more deprecated stuff if allowAliases is false (#354709) cd16e39a1e9a Exegol update 4.3.1 to 4.3.8 (#345103) a8ae141ee912 discord-canary: 0.0.527 -> 0.0.528 ac08a31d7fea discord: add `pipewire` to fix screensharing 79e34d35d6b6 vimPlugins.{spacevim, SpaceVim}: point to top-level `spacevim` instead e93754bc37d9 spacevim: change maintainer 507333f48465 spacevim: update and add general improvements 238f0190ba7e python312Packages.aemet-opendata: 0.5.5 -> 0.6.3 f7882744e728 gk-cli: 2.1.1 -> 2.1.2 (#359447) 656e285fa35c tenv: 3.1.0 -> 3.2.10 6a579d58434a plex: 1.41.0.8994-f2c27da23 -> 1.41.2.9200-c6bbc1b53 edbb4903fa48 flutterPackages-source.*.engine: don't remove `gen` 2d5f7226a03f snis: fix meta (#359435) 85abd79badd7 rbspy: 0.25.0 -> 0.27.0 (#359423) 2e2c7f54fd44 treewide: hide more deprecated stuff if allowAliases is false 8d33e4ff7d37 nodemon: fix package meta 3426d4110f34 desktopToDarwinBundle: fix 16x, 32x app icons (#358247) 8b7f17ce3ad8 wl-clipboard-rs: 0.9.0 -> 0.9.1 (#359015) e28b3f071327 ugm: 1.5.0 -> 1.6.0 edf127d95b04 meli: 0.8.8 -> 0.8.9 998c477262fb gnmic: fix version reporting 4329ff5f84e6 space-station-14-launcher: fix fhsenv version (#359409) 377b520bab7a nixos/mopidy: restart the systemd service on failure (#357250) d08734b18ceb python312Packages.py3status: 3.59 -> 3.60 cb607f7ddcad zed-editor: 0.162.5 -> 0.163.2 8b94fcb97560 audiobookshelf: 2.17.1 -> 2.17.2 (#359250) b5b106707d48 python312Packages.libtmux: 0.37.0 -> 0.39.0 (#359392) f70536516736 python312Packages.google-cloud-websecurityscanner: 1.15.0 -> 1.15.1 (#359393) b1fd577c0f38 python312Packages.google-cloud-secret-manager: 2.21.0 -> 2.21.1 (#359394) 818684b246b0 python312Packages.google-cloud-securitycenter: 1.35.0 -> 1.35.1 (#359395) 8aa18c7a3301 python311Packages.angr: 9.2.129 -> 9.2.130 (#359380) 74ae778b6204 python312Packages.githubkit: 0.11.14 -> 0.12.0 (#359383) 6326717a08ca uwsm: 0.20.4 -> 0.20.5 (#359301) e893090d19eb blackfire: 2.28.13 -> 2.28.20 34652663b100 esphome: 2024.11.1 -> 2024.11.2 47e0d37b8ad9 tor-browser: 14.0.2 -> 14.0.3, mullvad-browser: 14.0 -> 14.0.3 (#359368) e15a4acd8462 Merge master into staging-next 7c9fe1b04cd7 virt-manager: 4.1.0 -> 5.0.0 4f6eafbb37cb tiny-cuda-nn: fix a couple of build issues 445e5f83d472 parca: init at 0.22.0 4aa9f8fb7682 python312Packages.x-wr-timezone: 1.0.1 -> 2.0.0 a3a67865fbbd Merge #356158: init mpvScripts.autosub at 0-unstable-2021-06-29 c33e7bf9b4e0 wasm-tools: 1.220.0 -> 1.221.0 582cd0d2de9c microsoft-edge: 130.0.2849.46 -> 131.0.2903.70 (#359364) e687982294c5 fastly: 10.16.0 -> 10.17.0 e148d958c50f python312Packages.py3status: Fix typelib 7a71540369e3 rogcat: 0.4.7 -> 0.5.0 db380853679a mailmap: remap moni's email 089247932fa9 _7z2hashcat: renamed from '7z2hashcat' (#359525) 57decfd591ab nixos/wg-access-server: bugfix missing cfg dns.enabled (#352839) ebbbe4c8aae8 mumble-overlay: just build it the upstream way 07d95b3be7b2 zammad: format with nixfmt-rfc-style fd92780d7400 opam: 2.2.0 → 2.3.0 (#359044) d1d5334c2f47 adminer-pematon: init at 4.12 (#358530) cdc7b2d51d05 zammad: use stdenvNoCC 6cb5eb6735a2 python312Packages.influxdb3-python: 0.9.0 -> 0.10.0 19f40a308c81 stdenv/custom: avoid aliases (#359492) 8cfd191f91e4 python312Packages.samsungtvws: 2.6.0 -> 2.7.0 (#359502) 2432cb68e4a8 acr-cli: init at 0.14 ea567964ecca mpvScripts.youtube-chat: init at unstable-2024-06-08 (#264578) 7542b942a467 buildGoModule: no longer filter out vendorSha256 49ab9e2f2bf2 bibata-cursors: build right-hand variant df146dcf5ca2 bibata-cursors: fix normal variant ecc7160125ab python312Packages.notus-scanner: 22.6.4 -> 22.6.5 726322087086 python312Packages.spsdk: 2.2.1 -> 2.4.0 7413190665da python312Packages.libuuu: init at 1.5.82 99799235a7d0 python312Packages.fido2: 1.1.3 -> 1.2.0 6490fd94d60c wlvncc: unstable-2023-01-05 -> unstable-2024-11-24 (#357566) 0dcd0870db40 readarr: 0.4.3.2665 -> 0.4.4.2686 fe48be2ab5fd formats.libconfig: add support for dashes f719a8a49b87 iosevka: 31.8.0 -> 32.1.0 64edd99db0e7 kraft: 0.8.6 -> 0.9.4, add cloudripper as maintainer (#359088) 3f8feb8ec81a magic-vlsi: 8.3.497 -> 8.3.501 535e0c8a5824 pegasus-frontend: 0-unstable-2023-12-05 -> 0-unstable-2024-11-11 d47f8a2b5445 shiori: embed version in executable (#359146) d071bf3b4a80 eyedropper: 1.0.0 -> 2.0.1 (#352751) e245a698cd49 railway: 3.17.10 -> 3.18.0 (#357082) 6644b9e5c020 wasmer: 5.0.1 -> 5.0.2 (#358718) c117ad640e9e sequoia-chameleon-gnupg: set meta.mainProgram (#359023) f9afd9e5f3b7 kraft: 0.8.6 -> 0.9.4, add cloudripper as maintainer 2a96285bde56 c2patool: 0.9.10 -> 0.9.12 (#358921) 2522cb3faf3a python312Packages.airtouch5py: 0.2.10 -> 0.2.11 (#359028) cf594a7db1b8 sq: 0.48.3 -> 0.48.4 (#359055) 4aab86471b07 praat: 6.4.22 -> 6.4.23 (#359103) 4b0a9f7f03fd python312Packages.iteration-utilities: 0.12.1 -> 0.13.0 (#359119) 5cbc6f562383 nixos-rebuild-ng: use argparse groups to group nix flags 87fc1dd618e1 clusterctl: 1.8.4 -> 1.8.5 (#359234) de7c32b0455f sing-box: 1.10.1 -> 1.10.3 (#359561) d2ae1878af57 goreman: 0.3.15 -> 0.3.16 (#359300) 794160b70e90 powerline-go: 1.24 -> 1.25 (#359315) ecd9ae435c6b tektoncd-cli: 0.38.1 -> 0.39.0 (#359341) 8d9c3f67a01d yara-x: 0.10.0 -> 0.11.0 (#359354) 527c254473e0 sasutils: 0.5.0 -> 0.6.1 (#359418) 935c1e36c55c angular-language-server: remove overjealous templating (#354195) caeec1f97d44 nixos/mautrix-telegram: use ffmpeg-headless instead of ffmpeg-full (#358225) 4d40d318f817 atlas: 0.28.1 -> 0.29.0 270dc7bf9287 python312Packages.aiosomecomfort: 0.0.25 -> 0.0.26 c93e66162c3e python312Packages.pyvista: 0.44.1 -> 0.44.2 (#359503) 07a88f022db8 qbec: 0.15.2 -> 0.16.2 (#359507) 080f5b22311f python312Packages.weheat: 2024.09.23 -> 2024.11.2 (#353369) 6110ec549ca9 python312Packages.publicsuffixlist: 1.0.2.20241124 -> 1.0.2.20241127 (#359516) 6473ecdc0853 nixos/acme: Set /var/lib/acme permissions to 755 (#353659) 0fdc9361ac66 b3sum: 1.5.4 -> 1.5.5 (#359582) e813a732f909 python312Packages.pyswitchbot: 0.53.2 -> 0.54.0 (#359454) 5a1eae61446f python312Packages.stookwijzer: 1.5.0 -> 1.5.1 (#359463) 8371d8431c29 argocd-autopilot: 0.4.17 -> 0.4.18 (#359470) 0cd0bea8188a arcticons-sans: 0.580 -> 0.590 (#359474) f79630208453 nkeys: 0.4.7 -> 0.4.8 (#359480) 2f08dcba2630 buildpack: 0.35.1 -> 0.36.0 (#359482) 4a989c6a00fc Fix UI language selection in virtualbox (#358400) aafd155ac4ad python312Packages.ring-doorbell: 0.9.12 -> 0.9.13 (#359452) b6fff454c2d7 checkov: 3.2.296 -> 3.2.316, python312Packages.bc-detect-secrets: 1.5.18 -> 1.5.27 (#359281) 9be8bd417bc3 b3sum: 1.5.4 -> 1.5.5 352dc5c8005e nginx: fix compatibility with zlib-ng (#358812) c177b3a0cc4b dvc: 3.56.0 -> 3.57.0 (#359295) c8112a1d667f nodeinfo: adopt new package style (#351480) 074e9f773b26 factorio: 2.0.20 → 2.0.21, factorio-experimental: 2.0.20 → 2.0.22 (#359574) 35b166469927 meerk40t: 0.9.4000 -> 0.9.5300 (#359556) 0db7473448a0 svix-server: 1.38.0 -> 1.40.0 (#356034) 168438eb23e2 vivaldi: use coreutils from nixpkgs (#357003) 5fce87c2d60a kando: 1.4.0 -> 1.5.1 (#357538) 02d524df8b84 qspeakers: 1.6.9 -> 1.6.10 (#357543) 665019c80e78 sp800-90b-entropyassessment: 1.1.6 -> 1.1.8 860855c3b5c0 libdivsufsort: enable 64-Bit mode 2affc0e5911b factoriolab: init at 3.8.1 (#358014) 1c1dfd06c28f julia.withPackages: fix multiprocessing usage to work on macOS f9b4435b5ae3 python312Packages.soxr: fix build on x86_64-darwin f3a31ba4cccb rofi-wayland: add patch for niri (#356106) bf239275a274 libblake3: 1.5.4 -> 1.5.5 460168f833ef rofi-wayland: add patch for niri 6c50ca762454 efm-langserver: 0.0.53 -> 0.0.54 (#359292) 13a8cc8aed8d singular: 4.3.2p16 -> 4.4.0p6 (#357545) cb0414ada4ac sing-box: 1.10.1 -> 1.10.3 92a4d1d60df2 enableAllTerminfo: re-add unbroken contour f56c2b74bf6a Merge master into staging-next 796d9387ed2f folio: 24.12 -> 24.13 722661d33bbc gnome-maps: fix cross compilation (#357238) e318c714083e meerk40t: 0.9.4000 -> 0.9.5300 b8eb67b861ad cobang: fix build (#358962) 69251dc99cc2 buildRustPackage: fix passing depsExtraArgs to fetchCargoVendor (#359211) e1f3e7b0d1d3 cutter: fix build against PySide 6.8 (#359245) e6c5279f6896 python312Packages.podman: 5.2.0 -> 5.3.0 (#359185) 1588793de6e8 krop: pin pypdf2 version 407b526314fb abuild: 3.13.0 -> 3.14.1 (#359271) 287518360aaa nixos-rebuild-ng: validate NIX_SSHOPTS e94df9b3bcd6 gotemplate: 3.10.1 -> 3.11.0 078f1251c02e python312Packages.plotnine: 0.14.2 -> 0.14.3 (#359336) f59b0967930a woodpecker-server: 2.7.1 -> 2.7.3 (#359540) c1a2aa061137 jetbrains.clion: 2024.2.3 -> 2024.3 (#357916) 2a334fbfa3f7 python312Packages.iocsearcher: 1.0.0 -> 2.4.3-unstable-2024-10-08 7209005f424a woodpecker-server: 2.7.1 -> 2.7.3 6b88838224de discord: bump all versions (#358730) 261ec4e6d99e python312Packages.pymodes: 2.11 -> 2.19 da5d2f176df3 python3Packages.pymodes: init at 2.11 8835e6c8eac1 aliae: 0.22.2 -> 0.23.0 (#359289) d3f007d0398b buildMavenPackage: Add `overrideMavenAttrs` function and `buildOffline` documentation (#313152) b94e85208a62 stract: init at version 0-unstable-2024-09-14 (#343811) 49a11892ea83 maven: add tricktron to maintainer list ab34686a5b93 zammad: move to pkgs/by-name/ 75bbe5108df7 zammad: 6.3.1 -> 6.4.0 (#355199) 5463082f3fbf breakpad: 2023.01.27 -> 2023.06.01 d176104afd5b heroic: fix fhsenv version (#359407) e906b8b4a8cd _7z2hashcat: renamed from '7z2hashcat' 82961f880e8b open-webui: 0.4.5 -> 0.4.6 (#359523) fe795fd1707a open-webui: 0.4.5 -> 0.4.6 49dcd55e30d8 python312Packages.django-colorful: refactor d1e0ed627678 toot: 0.45.0 -> 0.47.0 (#359210) 51383099e792 rPackages.Rhdf5lib: remove hdf5_1_10 override aebb41980c3c hdf5_1_10: add stephen-huan as maintainer 9896808a2529 hdf5_1_10: enable cpp support 7cf5c32d49bb python312Packages.publicsuffixlist: 1.0.2.20241124 -> 1.0.2.20241127 01090d3c9f83 vimPlugins.floating-nvim: remove plugin (#359493) 6b0a1f812353 freebsd.libc: break into many small derivations a605d065a90f jasmin-compiler: 2024.07.1 → 2024.07.2 6665c7402996 gopass-jsonapi: 1.15.14 -> 1.15.15 (#358760) 668709c820a8 burpsuite: add changelog to meta 04dea6fd9a96 {libqalculate, qalculate-gtk, qalculate-qt}: 5.3.0 -> 5.4.0 (#359212) a19506c41ccc codux: 15.35.2 -> 15.37.3 (#359216) 82358988a620 python312Packages.weheat: 2024.11.2 -> 2024.11.26 7eca84731464 burpsuite: add myself as maintainer 9c09b2546bf8 genzai: init at 1.0 (#359224) 46e6c6d8af06 python312Packages.flatten-json: init at 0.1.13 (#359227) ece5dc716611 python312Packages.ecoaliface: 0.5.0 -> 0.7.0 (#359249) 437cfaf27c60 python312Packages.msgraph-sdk: 1.12.0 -> 1.13.0 (#359260) 931210bbbb1f above: init at 2.7 (#359228) 235392c63c18 python312Packages.jsonformatter: 0.3.2 -> 0.3.4 (#358055) b7de343ca765 python312Packages.cached-property: 1.5.2 -> 2.0.1 (#357869) 318ce3e00f08 python311Packages.ml-collections: 0.1.1 -> 1.0.0 (#359265) 0a2ecc76d5b3 python312Packages.nsapi: 3.0.5 -> 3.1.2 (#359034) c20ecb9c8b69 Burpsuite: 2024.8.5 -> 2024.10.1 (#357898) 6a05105b8974 jsonwatch: 0.6.0 -> 0.7.0 (#358872) a708493e9a0f python312Packages.tinygrad: 0.9.2 -> 0.10.0 (#357177) 36bd945fc6d7 Add binutils to ocaml so that static compiler can build correctly (#359231) 0eec0da3b5db ollama: 0.4.4 -> 0.4.5 (#359478) 520f316f95dc qbec: 0.15.2 -> 0.16.2 3563ab5bf1b5 Merge master into staging-next 0c59695ccc5d R: patchelf libraries missing libR.so (#354819) 43e88080cfe4 fpc: fix darwin build (#359218) 241ced5a31fd libreoffice: build with jdk21 (#359040) 44a085ace416 python312Packages.samsungtvws: 2.6.0 -> 2.7.0 760b9f71de66 python312Packages.pyvista: 0.44.1 -> 0.44.2 c5461ecc191a vimPlugins.floating-nvim: remove plugin 27759f6798ae pt2-clone: 1.70 -> 1.71 9cd16e9bd8d6 k2pdfopt: pin tesseract version (#357698) 92c2525fbf2d gcsan2pdf: update and pin tesseract version (#358158) e6a064f749df stdenv/custom: avoid aliases 157c60782584 mill: 0.12.2 -> 0.12.3 7818372094b1 nginx: fix building with clang on linux (#358999) a41b6f0e2416 treewide: add mainProgram attribute to lisp compilers (#358036) 8d123ca4b2c0 ignite-cli: 28.5.3 -> 28.6.0 27dbbeec4f90 Fix cross-compilation for fwupd (#351182) c68ee69b06bd samba: resurrect cross compilation patch (#357988) 22208f710a98 timew-sync-client: init at 1.0.1-unstable-2024-08-05 (#326945) b2a83dc1e6bf ants: 2.5.3 -> 2.5.4 53c10e89fdc8 buildpack: 0.35.1 -> 0.36.0 b99b70778001 comet-gog: 0.1.2 -> 0.2.0 884c9bdf2e17 nkeys: 0.4.7 -> 0.4.8 a7d269c59c31 vscode-extensions.ms-python.vscode-pylance: 2024.10.1 -> 2024.11.3 (#359384) 1282bf0ce4ba anvil-editor: init at 0.4 a622540b8169 python312Packages.pypalazzetti: init at 0.1.14 (#359453) f32410348d9e devtoolbox: 1.2 -> 1.2.1 (#359079) dacf10336929 terraform-providers.aws: 5.72.0 -> 5.78.0 2342b52b9c55 nerd-fonts: move release note to 25.05 (#359225) 4f19436c96c5 arcticons-sans: 0.580 -> 0.590 6d50055523fa ollama: 0.4.4 -> 0.4.5 36f0b3aeb23c home-assistant: support azure_data_explorer component (#359438) 77b1e50e9e32 lxqt.lxqt-panel: 2.1.1 -> 2.1.2 (#358859) 6caec5318470 glib: disable sysprof feature on FreeBSD (#356762) 07f863882875 freebsd: Add support for aarch64 (#358053) e66816264781 Meilisearch module (#359206) e0643f7d8323 firefox-unwrapped: 132.0.2 -> 133.0 (#359324) 12da01a2e255 archipelago-minecraft: 0.5.0 -> 0.5.1 f133af54eb9e argocd-autopilot: 0.4.17 -> 0.4.18 943df479973b terraform-providers.acme: 2.26.0 -> 2.28.1 6cf30a9fcf4b home-assistant: support azure_data_explorer component 4cdafcf6917d python3Packages.azure-kusto-ingest: init at 4.6.1 54f25b85873f python3Packages.azure-kusto-data: init at 4.6.1 14824c32cbc4 terraform-providers.google: 6.7.0 -> 6.12.0 2e0988846d6f Merge master into staging-next b079cadebca9 python312Packages.weaviate-client: 4.9.3 -> 4.9.4 cac396db249b sequin: init at 0.2.0 69661586d1c9 python312Packages.urwid-readline: 0.14 -> 0.15.1 (#359042) d66e8f8ec44f bitwarden-cli: 2024.9.0 -> 2024.11.0 (#350601) f08c20d7ec96 clang-uml: 0.5.5 -> 0.5.6 (#359297) a2430c57d74d discrete-scroll: rename from darwin.discrete-scroll a37f86de8afd python312Packages.stookwijzer: 1.5.0 -> 1.5.1 f6751bc435bd task-keeper: init at 0.27.0 b4d11602b837 python312Packages.aioacaia: init at 0.1.9 d957d4029c99 shticker-book-unwritten: fix fhsenv version (#359405) 5bd113113f8d fwupd: 2.0.1 -> 2.0.2 (#359279) a848fde40e15 nagstamon: 3.14.0 -> 3.16.2 8b9c0509f614 vtk: switch to new sdk pattern on darwin (#358790) 347e857eac26 flashmq: 1.17.3 → 1.18.2 5e37ffea81f8 python312Packages.pyswitchbot: 0.53.2 -> 0.54.0 f213d95528fb home-assistant: update component-packages be61bb842578 python312Packages.pypalazzetti: init at 0.1.14 797eb297e473 librenms: 24.10.1 -> 24.11.0 ad1320e2593f freebsd: set `BOOTSTRAPPING` when building for Linux (#337351) 075f0a4fe125 {luaPackages, vimPlugins}: update on 2024-11-26 (#359373) baa08bdda822 python312Packages.ring-doorbell: 0.9.12 -> 0.9.13 bc1c7d04824b patroni: 4.0.3 -> 4.0.4 (#359334) be5be57cb212 python312Packages.dnachisel: 3.2.11 -> 3.2.12 (#359317) de2b3e103448 bottles: fix fhsenv version (#359406) 1d44f10c1e04 tana: 1.0.16 -> 1.0.17 (#356236) df24ba5a5522 .github/labeler.yml: add more paths to Java (#358523) 4bbc60da7bc1 bfg-repo-cleaner: 1.13.0 -> 1.14.0 (#357490) 1c7cca7058fe magnetic-catppuccin-gtk: 0-unstable-2024-06-27 -> 0-unstable-2024-11-06 (#358305) f35670674d3e gk-cli: 2.1.1 -> 2.1.2 d33a9b41db92 r2modman: 3.1.50 -> 3.1.54 (#358592) 82917ce828c6 gh-f: 1.1.6 -> 1.2.0 (#359172) bf306abcc031 htmldoc: 1.9.18 -> 1.9.19 (#358039) 52316bd12d5c python3Packages.radio-beam: 0.3.7 -> 0.3.8 (#358766) b247f03fcd48 python312Packages.pytest-codspeed: init at 3.0.0 90dfafee3599 nixos/mopidy: restart the systemd service on failure c0bdabf2fea9 marksman: 2024-10-07 -> 2024-11-20 (#359018) 62f720072f2a pocketbase: 0.22.22 -> 0.23.1 (#358946) 30d8e1a204a2 tautulli: 2.14.6 -> 2.15.0 (#358983) 73b9d2dfad73 moon: 1.29.0 -> 1.29.4 (#358984) 127fb39fb624 floorp: 11.20.0 -> 11.21.0 (#358775) 92736ffd66ff platformio: fix fhsenv version (#359396) 619c34f8e86d lutris: fix fhsenv version (#359400) 0d528f6c5709 ugrep: 7.0.3 -> 7.1.0 (#358239) 3ef018f5e3e8 nixos-rebuild-ng: set process.run_wrapper check=True by default 3f22bc5e373d snis: fix meta a35d17293448 python312Packages.turrishw: init at 1.0.0 e6515ac86233 tmuxPlugins.tmux-powerline: init at 3.0.0 (#356160) 1b826fcb970e vieb: 12.0.0 -> 12.1.0 (#359065) 0a68a614431f zabbix70: 7.0.5 -> 7.0.6 (#357877) ef9353273f3d hqplayer-desktop: 4.22.0-65 -> 5.8.2-25 (#283631) 625e42131745 sparrow: fix fhsenv version (#359397) 67c56d9e4a87 python312Packages.asyncstdlib: 3.12.5 -> 3.13.0 (#350846) 0ad468475379 agorakit: unbreak by setting valid database package 196f141973be tiddit: init at 3.6.1 602605237b42 fermi2: init at unstable-2021-05-21 d4f3facaae0b shiori: embed version in executable e897da8080be envision: fix fhsenv version (#359408) 9a06b2ee9284 rbspy: 0.25.0 -> 0.27.0 7025e30f43c1 python312Packages.pyflipper: minor changes 81bfbe3d828a ropebwt2: init at 0-unstable-2021-02-01 cc1e73d10d1a python3.pkgs.geoarrow-pandas: init at 0.1.2 (#349312) 982495641456 libdeltachat: 1.150.0 -> 1.151.1 (#358852) d232880c20d3 various: remove left-over rtc_cmos rootModule c4da9c72d0f9 Merge: prometheus-redis-exporter: 1.65.0 -> 1.66.0 (#359110) c76a5481df18 sasutils: 0.5.0 -> 0.6.1 ea7b88c2876b space-station-14-launcher: fix fhsenv version 1ad988e405d0 svkbd: format with nixfmt-rfc-style e51a9df08a20 treewide: use dpkg setup hook 9e6936a3cee5 svkbd: 0.4.1 -> 0.4.2 71a874cbe299 heroic: fix fhsenv version cbe4fa7a64f1 binwalk: 2.4.3 -> 3.1.0 (#357991) 482f93e1a686 envision: fix fhsenv version 99175d3ee82a bottles: fix fhsenv version 12fbc1e31f1f shticker-book-unwritten: fix fhsenv version 849225f9a1b8 nixos/renovate: unset service restart 488fde7d06af matrix-synapse: 1.119.0 -> 1.120.0 43f6a895e516 image/images: init (#359328) 3c93ac1150bd lutris: fix fhsenv version 41961a54e167 make-disk-image: Allow passing of image baseName (#359326) a7f17f6ee443 python312Packages.securetar: refactor e605aab74296 python312Packages.pytransportnswv2: fix build (#359113) 73ff1cbe8952 tmuxp: 1.47.0 -> 1.49.0 269e66cbcb74 sparrow: fix fhsenv version 1d83df1da15e platformio: fix fhsenv version 75d7e973495b python312Packages.google-cloud-securitycenter: 1.35.0 -> 1.35.1 b62dde8f71bc python312Packages.google-cloud-websecurityscanner: 1.15.0 -> 1.15.1 5f59342d1aec python312Packages.google-cloud-secret-manager: 2.21.0 -> 2.21.1 3a080abf135a nixos-rebuild-ng: import nix module instead of each individual function 00b2dcce8394 python312Packages.libtmux: 0.37.0 -> 0.39.0 f3258367c29c tracexec: 0.5.2 -> 0.8.0 (#358870) 47f6cf666d20 gerrit: Apply nixfmt a4633945f09d gerrit: 3.10.2 -> 3.10.3 ee15da51b685 prometheus: 2.55.0 -> 3.0.0 (#358862) 721ab5fbdc42 vimPlugins.nvim-treesitter: update grammars 3714b2ec3e06 vimPlugins: resolve github repository redirects f2490e391268 vimPlugins: update on 2024-11-26 da35acc93daf luaPackages: update on 2024-11-26 65a50ea453ed runInLinuxVM: remove `hwclock -s` invocation (#359309) bc67ed671b18 tigerbeetle: 0.16.12 -> 0.16.14 1da6760927db python312Packages.githubkit: update disabled c5a95b52a3fb python312Packages.githubkit: 0.11.14 -> 0.12.0 0accd91c9584 vscode-extensions.ms-python.vscode-pylance: 2024.10.1 -> 2024.11.3 26bdab53b81b python312Packages.fastapi-mail: 1.4.1 -> 1.4.2 (#359073) 5ae0b27ab985 nginx: fix compatibility with zlib-ng 6a33974913d9 python311Packages.angr: 9.2.129 -> 9.2.130 7f4db643bc15 python312Packages.cle: 9.2.129 -> 9.2.130 e546ce88d146 python312Packages.claripy: 9.2.129 -> 9.2.130 594cc1316faa python312Packages.pyvex: 9.2.129 -> 9.2.130 e4ae7ade5d41 python312Packages.ailment: 9.2.129 -> 9.2.130 94972e9595f3 python312Packages.jc: 1.25.3 -> 1.25.4 (#359327) 704c9941fdf1 python312Packages.archinfo: 9.2.129 -> 9.2.130 b5168a9900ec nixos/iso-image: fix `isoImage.grubTheme = null;` 09913b80234b reposilite: 3.5.18 -> 3.5.19 (#358380) 666a4348c2ec matrix-alertmanager: 0.7.2 -> 0.8.0 293e982bdda1 perlPackages.ModuleScanDeps: 1.34 -> 1.37 (#357430) 852436a2a22f open-webui: 0.4.4 -> 0.4.5 (#359361) 8928e8d4a82c mullvad-browser: 14.0 -> 14.0.3 16ab44ae2f6c tor-browser: 14.0.2 -> 14.0.3 3ecd1bade7a6 nixos/scion: hardcode large expiry timestamps in bootstrap.sh (#359321) 95823c14115d prusa-slicer: fix build with GCC 14 and strictDeps (#359083) e7fd316d61a0 microsoft-edge: 130.0.2849.46 -> 131.0.2903.70 d8cc119540d4 cloudflare-warp: 2024.9.346 -> 2024.11.309 (#358952) fe295e219326 python312Packages.syrupy: 4.7.2 -> 4.8.0 (#358624) 60b6d112f33a sunvox: Add back wayback machine fallback src (#357726) 82d9b9187676 open-webui: 0.4.4 -> 0.4.5 08b9155e20ad image/images: init 148ba0671702 image/file-options: init 8c2d58df123a Merge master into staging-next 8af60309bad9 python312Packages.tskit: 0.5.8 -> 0.6.0 b70d51fc8605 python312Packages.python-bitcoinlib: rename from bitcoinlib (#358492) c8da2f827c5e sqlite3-to-mysql: 2.3.1 -> 2.3.2 (#359087) f1759180ecdc yara-x: 0.10.0 -> 0.11.0 62e97383c2e9 geant4: move to by-name, drop deprecated enableQT argument (#358781) fd55f1875ec9 diesel-cli: 2.2.4 -> 2.2.5 (#359092) 048985033f40 goreleaser: 2.4.5 -> 2.4.8 (#358985) 088785adf843 nixos-rebuild-ng: split parser_args in get_parser 6974df1a15ae python312Packages.python-etcd: fix on darwin d2e3ec6d427c patroni: 4.0.3 -> 4.0.4 c50074fffdf4 vapoursynth: fix plugin interface on darwin efc130177781 handheld-daemon: 3.5.7 -> 3.6.1 0479ef41062f nixos-rebuild-ng: remove explicit check for git and instead check exception 8f9753343fb6 qmmp: add libxmp and libsidplayfp to buildInputs 01cb82366fcb vapoursynth: reformat plugin interface fcd6566830b5 tektoncd-cli: 0.38.1 -> 0.39.0 199697f54ed4 vapoursynth: fix darwin build 56f8cbd77539 ooniprobe-cli: 3.23.0 -> 3.24.0 db857d9474b0 python312Packages.plotnine: 0.14.2 -> 0.14.3 7ac450eaa047 mackerel-agent: 0.82.0 -> 0.83.0 470e6e641f41 coqPackages.fourcolor: 1.3.1 → 1.4.0 20e121f31a5e vscodium: 1.95.2 -> 1.95.3 (#358857) 7233ce069735 python312Packages.python-bitcoinlib: rename from bitcoinlib 2e4d75535113 nixos-rebuild-ng: do not use TTY for `--target-host` 10f2b080c31d nixos-rebuild-ng: move test to the correct file 4adad7f6648a nixos-rebuild-ng: implement `--target-host` for `--rollback` e37e7e348dc1 nixos-rebuild-ng: cleanup SSH ControlMaster at exit f443299c5825 nixos-rebuild-ng: remove support for env in process.run_wrapper 866e1786e331 nixos-rebuild-ng: move models.Ssh to process.Remote 37d6a2688f0d nixos-rebuild-ng: get remote hostname 56203bca4e15 nixos-rebuild-ng: add allow_tty parameter to process.run_wrapper 8bd70ef6992b nixos-rebuild-ng: error when `--rollback` is called with incompatible action a2cbe67701fe nixos-rebuild-ng: implement `--target-host` fd1cd69315b9 nixos-rebuild-ng: add pythonpath to pytest config 3d7fbe88ab4f nixos-rebuild-ng: parse NIX_SSHOPTS instead of SSH_OPTS env var a6b9aaba1b11 nixos-rebuild-ng: add TTY allocation in SSH 31e9e8c0aa0b nixos-rebuild-ng: run -> run_wrapper, handle encode errors and add extra_env e47b17e239c6 nixos-rebuild-ng: create instance for dataclass from Self 6c6d08dc4f0a nixos-rebuild-ng: add --sudo/--use-remote-sudo flags 3b41ec0691a4 nixos-rebuild-ng: explicitly parse Nix flags bb6586c4e69b make-disk-image: Allow passing of image baseName 5bdc51167df3 nixos/logrotate: allow change mode of a file (#359322) afa7cf9d8cdb python312Packages.jc: 1.25.3 -> 1.25.4 3fa8e947c850 firefox-esr-128-unwrapped: 128.4.0esr -> 128.5.0esr 9a4a69dc462b firefox-bin-unwrapped: 132.0.2 -> 133.0 3c4382fb2ba3 firefox-unwrapped: 132.0.2 -> 133.0 048619c66aae audacious: move to pkgs/by-name (#359063) c8446a92ab72 nixos/scion: hardcode large expiry timestamps in bootstrap.sh a7c8d553aefa nixos/logrotate: allow change mode of a file 6b75aa3623ac hyprgui: 0.1.8 -> 0.1.9 8e82ef5df119 nixos/binfmt: add option `addEmulatedSystemsToNixSandbox` (#354533) e83bfaacfb07 python312Packages.dnachisel: 3.2.11 -> 3.2.12 fdff94179a56 powerline-go: 1.24 -> 1.25 ab6f62edfc5e patroni: format d79beaac42ca vimPlugins: Remove the nvim-cmp dependency on cmp-sources (#358809) 9f9553ee5a8b python312Packages.nanobind: 2.1.0 -> 2.2.0 6f3d8a72ea28 runInLinuxVM: remove `hwclock -s` invocation 8fc978774f53 apfsprogs: 0-unstable-2024-09-27 -> 0.2.0 (#354191) bd4d2031f342 kdePackages: Plasma 6.2.3 -> 6.2.4 (#359299) 944e227b6af9 libstdcxx5: remove (#358909) c8bb7b26f2c6 7z2hashcat: init at 2.0 (#356347) 92de54386d0e stdenv: don't discard string context from ContentAddressed derivations (#359098) ab380b8d228f horizon-eda: fix build 8f1334f790fc horizon-eda: nixfmt e15fcb16cfb9 python3Packages.python-mapnik: mark broken (#355713) 9458f0618b4e kdePackages: Plasma 6.2.3 -> 6.2.4 96f812b50a8f uwsm: 0.20.4 -> 0.20.5 c638d5c0c2e2 goreman: 0.3.15 -> 0.3.16 f7337d66df0a llama-cpp: 3887 -> 4154 (#358908) 29c7384772f9 clang-uml: 0.5.5 -> 0.5.6 06de6bb66090 dvc: 3.56.0 -> 3.57.0 3f36a03842b5 pbpctrl: add cafkafk to maintainers c7b0f4de4a30 pbpctrl: 0.1.6 -> 0.1.7 a17db8891e22 nezha-agent: add updateScript; 0.20.3 -> 0.20.5 (#358660) 0e2986a636b8 efm-langserver: 0.0.53 -> 0.0.54 1b1d91f46669 linuxPackages.nvidiaPackages.production: 550.127.05 -> 550.135 (#358567) ebcb81f90f70 alpaca: 2.7.0 -> 2.8.0 (#359053) 13aa55463336 python312Packages.azure-mgmt-resource: 23.1.1 -> 23.2.0 (#351923) ba93d44435ef python312Packages.teslajsonpy: 3.12.2 -> 3.12.3 (#359256) 6c9f549fc3b9 python312Packages.mypy-boto3-*: updates (#359258) c1547bbdacd6 python312Packages.tencentcloud-sdk-python: 3.0.1271 -> 3.0.1272 (#359259) 3852f0d9a97d python312Packages.pbs-installer: 2024.10.08 -> 2024.10.16 (#359229) dbe9f44ceb4a rasm: 2.2.8 -> 2.2.11 (#359241) 3c51e8868480 python312Packages.lacuscore: 1.12.3 -> 1.12.5 (#359247) 98e3bc7aaab0 python312Packages.garminconnect: 0.2.20 -> 0.2.21 (#359248) e249f0cf5909 python312Packages.pygitguardian: 1.17.0 -> 1.18.0 (#359255) eaaebd53319a Merge remote-tracking branch 'origin/master' into staging-next 84151e088b81 folder-color-switcher: 1.6.4 -> 1.6.5 a608ec048bfb mint-themes: 2.1.8 -> 2.1.9 1e191cba1e4b mint-x-icons: 1.7.1 -> 1.7.2 354c08e5585e mint-y-icons: 1.7.7 -> 1.7.8 36e403d7e44c mint-l-icons: 1.7.2 -> 1.7.3 5f93d3f0e2ac xed-editor: 3.6.6 -> 3.6.7 94fe01900a55 xapp: 2.8.5 -> 2.8.6 d5ba75979a07 lightdm-slick-greeter: 2.0.6 -> 2.0.7 c466c2294539 xdg-desktop-portal-xapp: 1.0.9 -> 1.1.0 429e2dfc3fba python312Packages.pipdeptree: 2.23.4 -> 2.24.0 (#359195) d59b4dc5deda toxiproxy: 2.9.0 -> 2.11.0 (#359199) b1e76ef96dc1 aliae: 0.22.2 -> 0.23.0 2057afb5c039 python312Packages.reolink-aio: 0.11.2 -> 0.11.3 (#359221) 4b56be9a015d gitea: 1.22.3 -> 1.22.4 (#359100) ed78bf48223e cargo-run-bin: 1.7.3 -> 1.7.4 (#359166) 3dbbdfe08db8 ceph-csi: 3.12.2 -> 3.12.3 (#359169) b9e2cc9f6910 python312Packages.polyfactory: 2.18.0 -> 2.18.1 66de0485fffa nhost-cli: 1.27.0 -> 1.27.1 (#359180) e0aa70649e47 python312Packages.casbin: 1.36.3 -> 1.37.0 (#359181) d3fcf5412f39 python312Packages.scmrepo: 3.3.8 -> 3.3.9 (#359186) 40b3e9f1d396 handheld-daemon: 3.4.1 -> 3.5.7 290ff1996f96 python312Packages.pre-commit-hooks: 4.6.0 -> 5.0.0 (#359135) ff8d6fc2824e checkov: 3.2.296 -> 3.2.316 2daa3cc6e42f star-history: 1.0.22 -> 1.0.26 (#359144) ec823512a9e1 python312Packages.bc-detect-secrets: 1.5.18 -> 1.5.27 7bbaef90300c nodeinfo: strip and link static 86d818075911 Revert "nixos/iso-image: fix isoImage.grubTheme = null; logic" (#359280) 7cc68ba10546 python312Packages.python-engineio: 4.9.1 -> 4.10.1 (#349064) 76feffcd7dd5 starboard: 0.15.21 -> 0.15.22 (#359147) ccca3410117d bloop: fix service (#358951) 08e45748c6d5 dgraph: 24.0.4 -> 24.0.5 (#359149) a9acc685ef77 zpaqfranz: 60.7 -> 60.9 (#359154) aa96873f08aa nodeinfo: adopt new package style 2845e1c7b81e fwupd: 2.0.1 -> 2.0.2 80ec892b740b Revert "nixos/iso-image: fix isoImage.grubTheme = null; logic" e016b8954d9c em100: init at 0-unstable-2024-11-14 (#355998) 951ce5938ebf chirp: 0.4.0-unstable-2024-11-11 -> 0.4.0-unstable-2024-11-22 (#358955) 5dd9b598cf8f python312Packages.pytest-celery: 0.1.0 -> 1.1.1 (#335330) 77f1e9959881 golangci-lint: 1.62.0 -> 1.62.2 ce05a490acde python312Packages.qcodes: 0.49.0 -> 0.50.0 (#359127) 04ea80e1002d python312Packages.eliot: 1.15.0 -> 1.16.0 (#358979) 1bd9d101cc4f abctl: 0.13.1 -> 0.22.0 056733b9ec31 terragrunt: 0.68.7 -> 0.69.1 (#358803) e89738c2baa8 xfce.xfce4-settings: Fix screen locked but lockscreen invisible after suspend (#358747) 67e16b74c7a2 anilibria-winmaclinux: 2.2.20 -> 2.2.22 b683d9035507 mutt: remove ? null from packages 6ab2c6b578f8 abuild: 3.13.0 -> 3.14.1 a17b5209a087 abuild: nixfmt 3975f808f042 limesctl: drop (#358945) 3d20b485d9ac ocamlPackages.findlib: 1.9.7 → 1.9.8 95f1023aa9d2 pomerium: 0.27.2 -> 0.28.0 (#357536) 4c3cd1c677f6 python311Packages.ml-collections: 0.1.1 -> 1.0.0 2c74543896c2 splash: 3.10.3 -> 3.11.0 (#359043) 15fa96fd94a3 vapoursynth: use new darwin sdk pattern 4ca369a023de gopass-jsonapi: 1.15.14 -> 1.15.15 6a915e63125b ffms: add wegank as maintainer 8cf68bd0543a ffms: fix vapoursynth plugin on darwin e904075ee666 ffms: reformat 3e2f5ef1a68b python3Packages.fairseq: Relaxing Python dependencies restrictions (#359115) 1d5b7f4edc0c abracadabra: 2.7.0 -> 2.7.1 (#358943) d594f57f09cd python312Packages.teslajsonpy: 3.12.2 -> 3.12.3 4329e73073e4 redpanda-client: 24.2.6 -> 24.2.11 (#359243) 4279574f1fdd python312Packages.logilab-common: fix build 1ffc6e0c7a1b python312Packages.securetar: 2024.2.1 -> 2024.11.0 c582905e5a5e python312Packages.pygitguardian: 1.17.0 -> 1.18.0 460d09233615 audiobookshelf: 2.17.1 -> 2.17.2 722d7e26a9d5 kcl: 0.10.0 -> 0.10.9 (#353108) eb7a59d06724 python312Packages.mypy-boto3-s3: 1.35.67 -> 1.35.69 ef1f077b34ce python312Packages.mypy-boto3-networkmanager: 1.35.0 -> 1.35.69 5818ad941f93 python312Packages.mypy-boto3-directconnect: 1.35.0 -> 1.35.69 119e7b496f83 python312Packages.tencentcloud-sdk-python: 3.0.1271 -> 3.0.1272 cbfb7fd3615d python312Packages.msgraph-sdk: 1.12.0 -> 1.13.0 9b7a3c3ef4b0 python312Packages.lacuscore: 1.12.3 -> 1.12.5 a0883dea63ca python312Packages.garminconnect: 0.2.20 -> 0.2.21 8e239a2e6c76 python312Packages.ecoaliface: 0.5.0 -> 0.7.0 771d0b7622f2 python312Packages.scmrepo: update disabled ce9d0969213a jsonwatch: refactor a33164156a66 cutter: fix build against PySide 6.8 c506809699c8 redpanda-client: 24.2.6 -> 24.2.11 dafe47b3c8bb xbar: init at 2.1.7-beta (#209794) 0766e2152f66 rasm: 2.2.8 -> 2.2.11 e01c3b9ff3ca wl-clipboard-rs: add man pages and shell completions f2a0dc5399da lxqt.lxqt-wayland-session: 0.1.0 -> 0.1.1 0040c97904de cargo-shear: 1.1.3 -> 1.1.4 (#358998) 8ddd87d8e10c tartufo: relax cached-property af51545ec9a4 gcc: restore dropped `isl` line (#359235) 1f5aa7a0f1fc burpsuite: 2024.8.5 -> 2024.10.1 cf71af617655 gcc: restore dropped `isl` line a833a6d94a8e rime-ls: init at 0.4.0 (#351508) 52b7f0d233bb added binutils to ocaml so that static compiler can build correctly d0c6c51f85f6 clusterctl: 1.8.4 -> 1.8.5 9071fbfd927b above: init at 2.7 5422cafbb343 python312Packages.pbs-installer: 2024.10.08 -> 2024.10.16 0338be53f0b1 gcfflasher: 4.4.0 -> 4.5.2 (#359001) 949b67679d4a nerd-fonts: move release note to 25.05 45f0035a83ed lib/types: Add deprecation to attrsWith a889656579a4 python312Packages.flatten-json: init at 0.1.13 2fa59ab86bb5 gopass-jsonapi: move to pkgs/by-name 73bdf512abcc gopass-jsonapi: add doronbehar as maintainer 8a46035a29f1 gopass-jsonapi: nixfmt; no with lib; in meta. b8c778b37bc1 genzai: init at 1.0 9e1c3dd0a5d5 python312Packages.podman: update disabled de4dbc58fdeb nerdfonts: separate into individual font packages, 3.2.1 -> 3.3.0 (#354543) 052ae4f0d4db python312Packages.reolink-aio: 0.11.2 -> 0.11.3 416be31d221d python312Packages.nsapi: refactor fdb2b486a234 python312Packages.docstring-parser: 0.15 -> 0.16 (#352217) ce40ce79f144 fpc: fix darwin build 4b3b0792dcdf python312Packages.icalendar: 6.0.1 -> 6.1.0 (#358628) b73471412c63 codux: 15.35.2 -> 15.37.3 6cd29a4cd0c3 uwsm: prefer user env binaries at runtime (#358883) 6077aa2a7055 nix-inspect: fix build with nix 2.24 c2c2ac8d2ae2 nix: drop unused fetchpatch 45e940777e0b nixVersions.nix_2_19: drop 53cbef91e4a3 penelope: init at 0.12.4-unstable-2024-10-21 (#358819) 41cc9cd1ec75 ldeep: 1.0.73 -> 1.0.75 (#358911) 376236a76134 seclists: 2024.3 -> 2024.4 (#358931) be20176e23b8 python312Packages.librouteros: 3.2.1 -> 3.3.0 (#358963) d47d670e1121 python312Packages.cyclopts: 3.0.1 -> 3.1.0 (#358964) ea6ba18570a9 python312Packages.publicsuffixlist: 1.0.2.20241123 -> 1.0.2.20241124 (#358965) 9e6e5ca860e1 python312Packages.pyexploitdb: 0.2.55 -> 0.2.56 (#358966) 304a7fe2495d python312Packages.pyvicare: 2.36.0 -> 2.37.0 (#358967) e0e9580c2f13 python312Packages.playwrightcapture: 1.27.1 -> 1.27.3 (#358968) db4b43c1eb6b python312Packages.lxmf: 0.5.7 -> 0.5.8 (#358969) b185471c21cd python312Packages.jsonformatter: enable tests a0412e1acec5 {libqalculate, qalculate-gtk, qalculate-qt}: 5.3.0 -> 5.4.0 00b0dc5bbdfc python312Packages.jsonformatter: refactor 455241a0366b buildRustPackage: fix passing depsExtraArgs to fetchCargoVendor 3b68f421f5c8 toot: 0.45.0 -> 0.47.0 1fb09cba7f56 gdcm: switch to new sdk pattern on darwin e5df03ca910d comrak: 0.23.0 -> 0.31.0 4f456b4dece7 nixos/meilisearch: add to systemPackages ab7abb5c80ca nixos/meilisearch: format d95aee96e15c zammad: 6.3.1 -> 6.4.0 096ede7f2b18 comrak: add self as maintainer (#359197) 632d183322bf cbmc: 6.0.1 -> 6.4.0 (#355122) cc8047cc5ab2 bililiverecorder: 2.12.0 -> 2.13.0 (#358199) f162d6a47bc8 toxiproxy: 2.9.0 -> 2.11.0 54e1724fff85 comrak: add kivikakk as maintainer b550ea1c836d maintainers: add kivikakk f0d9bf64cd2f llama-cpp: 3887 -> 4154 6cb4c6915bd2 Merge master into staging-next 099b6c54fb3e rattler-build: init at 0.29.0 19e40cd9cf92 python312Packages.pipdeptree: 2.23.4 -> 2.24.0 f746a8407520 triptych.nvim: add plenary-nvim as required dependency (#358924) 4c013db1d64f katawa-shoujo-re-engineered: 1.4.8 -> 1.4.9 (#358917) 21a450026b35 lightningcss: 1.28.0 → 1.28.2 (#358926) ea6bc563b598 terraform-providers.buildkite: 1.12.0 -> 1.13.0 08f2d47f71cc terraform-providers.snowflake: 0.97.0 -> 0.98.0 521ad721e93c python312Packages.scmrepo: 3.3.8 -> 3.3.9 08f0f69af217 python312Packages.podman: 5.2.0 -> 5.3.0 d46de59371ea tidal-hifi: 5.16.0 -> 5.17.0 (#358887) c8e9bfe9e94f python312Packages.scikit-survival: 0.23.0 -> 0.23.1 4852068c580c python312Packages.scikit-survival: use github src; fix build fce2e9004799 python312Packages.casbin: 1.36.3 -> 1.37.0 aee73ac48858 archimede: init at 0.0.2 f70a484eaa26 nhost-cli: 1.27.0 -> 1.27.1 7dd27c337636 nfs-ganesha: 6.2 -> 6.3 9b37174df017 ghidra: pin to Gradle 8 cf1bfe275a1a openjfx23: pin to Gradle 8 41a7fd4662d3 hydra: 0-unstable-2024-10-24 -> 0-unstable-2024-11-25 0bed3f1cef2a mtr-exporter: 0.3.0 -> 0.4.0 9ebedd309118 jadx: pin to Gradle 8 d2b828fbeb1a atlauncher: pin to Gradle 8 33c8fa3a3c89 armitage: pin to Gradle 8 04338e96bb98 mucommander: pin to Gradle 8 e4be1efabfcc nextflow: pin to Gradle 8 c64ddb7d6a37 libeufin: pin to Gradle 8 9795412499c2 mindustry: pin to Gradle 8 eddcbd19d3de pdftk: pin to Gradle 8 b433620b611e shattered-pixel-dungeon: pin to Gradle 8 89079b37ec19 signald: pin to Gradle 8 bd0e24d9de78 gh-f: 1.1.6 -> 1.2.0 cbdb3a015cb5 scrcpy: 2.7 -> 3.0 (#358820) 102b68144a96 ceph-csi: 3.12.2 -> 3.12.3 5e86512c8fba cargo-run-bin: 1.7.3 -> 1.7.4 1df6850c4fd0 Merge master into staging-next 57975ac59685 xfce.xfce4-notes-plugin: Generate C code with newer Vala 8e1a49bfa38a arduino-cli: 1.0.4 -> 1.1.1 (#354244) 7b8d29fcd6fb adguardhome: 0.107.53 -> 0.107.54 (#355011) 87f46ee633c9 fetchsvn: add system certificate authorities bundle (#356829) 46ed4bbb0c1d trealla: 2.57.1 -> 2.60.18 (#358900) c17ff529549d python312Packages.dirigera: mark broken if pydantic older than versoin 2 (#359112) 4eb325e6725a Rbw fix darwin (#358894) ddf870cb983e komikku: 1.63.0 -> 1.64.0 b5a3b984df15 zpaqfranz: 60.7 -> 60.9 b718c275a986 ladybird: 0-unstable-2024-11-06 -> 0-unstable-2024-11-21 (#357995) 61b63f3c19ae dgraph: 24.0.4 -> 24.0.5 428141a973ad freebsd: improve overridability of entire package set (#339912) 96b1a7a00f22 starboard: 0.15.21 -> 0.15.22 70f4e3b2d6a7 telegram-bot-api: 7.11 -> 8.0 (#358021) fa4b9638fa6d nixos/iso-image: fix isoImage.grubTheme = null; logic (#156754) 313065f7f41e em100: init at 0-unstable-2024-11-14 914616a6b6ee skypeforlinux: 8.132.0.201 -> 8.133.0.202 (#358741) 53d984f16e1c star-history: 1.0.22 -> 1.0.26 c27366f518ad decent-sampler: 1.12.1 -> 1.12.5 (#358774) 1640581ccd74 python3Packages.globus-sdk: 3.45.0 -> 3.48.0 (#358880) e1c35275ac6d flare-signal: 0.15.2 -> 0.15.6 (#359047) 8586e0559fc8 chromium: resolve ref to rev for blink version string (#358997) 657103bc411c firefox-beta-unwrapped: 133.0b1 -> 133.0b9 (#357537) 8a22c82467ea cue: 0.10.1 -> 0.11.0 (#357449) 58424e10eb55 python312Packages.pre-commit-hooks: 4.6.0 -> 5.0.0 882842d2a908 unciv: 4.14.5-patch1 -> 4.14.9 (#357456) 59133ee77040 python312Packages.python-socks: 2.5.2 -> 2.5.3 (#357461) ea039077b77d python312Packages.cachecontrol: 0.14.0 -> 0.14.1 (#354297) d225878f0f48 python312Packages.ocrmypdf: 16.5.0 -> 16.6.2 (#352270) d328c0c5f48b gleam: 1.6.1 -> 1.6.2 (#358888) f590fcc053af python312Packages.openai: 1.52.1 -> 1.54.5 (#354068) a914d7e87a49 flutter: revert remove usages of aliases {build,host,target}Platform (#357173) 3e1f2bc01606 python312Packages.eliot: 1.15.0 -> 1.16.0 1942e92ea40b python312Packages.pyschlage: 2024.8.0 -> 2024.11.0 (#359071) 87b163f9479b python312Packages.facedancer: 3.0.4 -> 3.0.5 (#359067) af9f001dc80e typstyle: 0.12.3 -> 0.12.4 (#359056) 16001585a370 paperlib: fix darwin build 2632b1aa0dea cemu-ti: platform changes (#356874) 8cf303b877c0 python312Packages.iteration-utilities: 0.12.1 -> 0.13.0 06a2b04963ed podman: 5.3.0 -> 5.3.1 a0795adba096 python312Packages.pytransportnswv2: fix build af5fee29788c python312Packages.dirigera: mark broken if pydantic older than versoin 2 d323fab80807 python3Packages.fairseq: Relaxing Python dependencies restrictions 6347c8ba51d0 gose: init at 0.8.0 b2e4b6b22e36 tmuxPlugins.tmux-powerline: init at 3.0.0 71fbdd81909d vtk: switch to new sdk pattern on darwin 73c88140ed0c prometheus-redis-exporter: 1.65.0 -> 1.66.0 203401241d7a youki: add systemd build flag (#355607) 9372fffd29ce devtoolbox: 1.2 -> 1.2.1 bdf3bbe6b660 libbitcoin{,-client,-explorer,-network,-protocol}: drop; boost175: drop (#358867) b17934bcf5e3 gitea: 1.22.3 -> 1.22.4 613c347a262f nvc: 1.14.1 -> 1.14.2 (#358689) 89b96743cb6f praat: 6.4.22 -> 6.4.23 075597b340f9 stdenv: don't discard string context from ContentAddressed derivations bf84cc7ff008 wordpress: 6.7 -> 6.7.1 (#358426) ba76e1585901 rippled: drop (#358864) 4f313139e3fc sumokoin: drop (#358866) 779a2855bc39 python312Packages.pinocchio: Disable test that fails on darwin (#358668) a0a8e91e8152 suitesparse-graphblas: 9.3.1 -> 9.4.2 (#357761) 452ecaa89c31 diesel-cli: 2.2.4 -> 2.2.5 77a71a8b1531 markdown-oxide: 0.24.2 -> 0.24.3 (#358830) 5707d4ed6404 sqlite3-to-mysql: 2.3.1 -> 2.3.2 69b3452a0ce2 git-prole: 0.5.1 -> 0.5.3 (#357066) 910f66b28b86 prusa-slicer: fix build with GCC 14 and strictDeps 07bee95ee07a lua-language-server: 3.13.0 -> 3.13.2 (#357849) 609330138ef5 cups-kyocera-3500-4500: reorder source URLs a488b52c8ff0 python3Packages.django-fsm: init at 3.0.0 b59765289c39 froide: init at 0-unstable-2024-11-22 96be30f0b0b4 netbird-dashboard: 2.5.0 -> 2.7.0 (#356738) 756c907d41e8 buildFHSEnv: void ldconfig warnings 01fdad87c4e5 stdenv: add Silvermont support, remove incorrect AES support (#355127) 82648db7a954 prometheus-aruba-exporter: init at unstable-2023-01-18 (#356827) 90eeeea61556 aspellDicts: expose pname and version (#356318) 1ff4137a05f1 vscode-extensions: set pname (#354740) ac24b971561d nixos/zammad: refactor package, module and nixos-test (#277456) 3eb54812cd71 vault: 1.18.1 -> 1.18.2 (#358001) d0ca65eb993e woof-doom: 14.5.0 -> 15.0.0 (#358579) 6d0eadc43951 maintainers: add parth e80357c95b3c ghq: format with nixfmt-rfc-style e250f56a19f1 ghq: add updateScript abd0237851af ghq: add passthru.tests.version fd66d4ac6813 linuxPackages.nvidiaPackages.production: 550.127.05 -> 550.135 dd13d93bc3f8 python312Packages.fastapi-mail: 1.4.1 -> 1.4.2 58334e683a65 zizmor: 0.2.1 -> 0.5.0 (#358793) 86b225187164 taterclient-ddnet: 8.6.1 -> 9.0.0 (#358727) 64cf4de3f9a9 sql-studio: 0.1.27 -> 0.1.32 (#358764) f16a14f3710a python312Packages.pyschlage: 2024.8.0 -> 2024.11.0 36241274ce78 chiptrack: 0.3.1 -> 0.5 (#355208) 62742e9d5e21 singularity-tools: enable __structuredAttrs and pass contents directly (#358723) 9af37651f588 spl: 0.4.0 -> 0.4.1 (#358826) 6c058a9e8504 vscode-extensions.chanhx.crabviz: init at 0.4.0 (#358114) d2b29e653cee convbin: 3.7 -> 5.1 (#356192) 40d327867117 python312Packages.facedancer: 3.0.4 -> 3.0.5 e423d1dd46b7 edk2: 202408.01 -> 202411 (#358771) d0b8e7beace0 audacious: move to pkgs/by-name 5a39f9caaabb audacious: format with nixfmt-rfc-style 4637550101bd audacious-plugins: move to pkgs/by-name e2f8979c6161 pmbootstrap: 2.3.1 > 3.0.0 (#355579) 85206393e9a0 vieb: 12.0.0 -> 12.1.0 a102f137f54a nixos/manticore: fix mkKeyValueDefault (#358673) d8a95443b41b audacious-plugins: format with nixfmt-rfc-style b41a09978bb1 vgmstream: format with nixfmt-rfc-style 13020da8a870 audacious-bare: init at 4.4.2 7fa27c075266 fwupd: fix build when cross compiling 92d6437fd460 typstyle: 0.12.3 -> 0.12.4 fedd9d123012 python312Packages.tinygrad: 0.9.2 -> 0.10.0 1b5d0bc061aa tinymist: 0.12.0 -> 0.12.4 (#357498) 2496c495ef93 tbb_2021_11: fix build on musl 7b147a804bae alpaca: 2.7.0 -> 2.8.0 b7e6298f6dfc sq: 0.48.3 -> 0.48.4 6b83f7004cbe retroarch: refactor (#358405) b470ee270726 tipp10: support running under wayland 97ebfb68e5e3 nixVersions.{nix_2_20,nix_2_21,nix_2_22,nix_2_23}: drop (#359024) 84d3fd1fab9f python3Packages.pyside2-tools: fix eb720681e38b radicle-{explorer,httpd}: 0.17.0 -> 0.17.1 (#358720) 45556cbdb8eb musl: set arch for aarch64 5358d7efed5e python312Packages.urwid-readline: 0.14 -> 0.15.1 e162d35f0467 opam: 2.2.0 → 2.3.0 30965469fe8f splash: 3.10.3 -> 3.11.0 af64a865e434 ocamlPackages.eio: 1.1 → 1.2 31fa07312f8d libreoffice: build with jdk21 fd17f3cd76eb cplay-ng: 5.2.0 -> 5.3.1 12d14a9d5911 openutau: bump dotnet version 7 -> 8 (#340611) edac51dc0bc1 python312Packages.nsapi: 3.0.5 -> 3.1.2 e9e23cd28c80 nixos/aria2: allow fine tuning download file permissions 21595ae60aae home-assistant-custom-components.solax_modbus: 2024.11.1 -> 2024.11.2 (#358971) f8d40e267717 rime-ls: init at 0.4.0 091621ce37da ghidra: add wasm extension (#349645) 7c18ea34a228 llvmPackages: Make targetLlvmLibraries overridable (#355001) b994c8ca43c3 llvmPackages.compiler_rt: Fix version tests for git (#354471) 27ac5f6196aa python312Packages.airtouch5py: 0.2.10 -> 0.2.11 cf12b6d2b789 nixVersions.{nix_2_20,nix_2_21,nix_2_22,nix_2_23}: drop e77e86d5e047 sequoia-chameleon-gnupg: set meta.mainProgram ba4c0e502ac9 dotnet-{sdk,runtime,aspnetcore}_{6,7}: mark as EOL (#358533) 415d1932eae0 lib/types: Test attrsWith type merging 9443f54b4dde qlog: 0.39.0 -> 0.40.0 (#358767) 187a67c62821 factorio: fix `updateScript` definition (#357689) 5ace30a83415 radicale: 3.3.0 -> 3.3.1 (#358813) 2c4fbc03139f wl-clipboard-rs: 0.9.0 -> 0.9.1 222e2c86bd6e searxng: 0-unstable-2024-11-17 -> 0-unstable-2024-11-25 d33a22199933 Merge master into staging-next 504e3ecdd955 gcc: do not allow version skew when cross-building gcc (#352821) 47e35e59a8c7 marksman: 2024-10-07 -> 2024-11-20 2de990d16863 Update Haskell-Nix bindings, hercules-ci-agent, cachix nix library version (#357224) 9ec2da8299b4 python312Packages.netbox-reorder-rack: 1.1.2 -> 1.1.3 (#358274) 90bb5c11f1f8 Merge: epson-escpr2: 1.2.20 -> 1.2.21 (#358755) b715a39a9e99 python312Packages.pyftdi: 0.55.4 -> 0.56.0 (#358637) ff16ab0cbcba azure-static-sites-client: 19449a00c0269fefc8f29a6d01801c4b19308181 -> 53b7d0e07fe5c34bf68929fab92f87ce910288dc (#358221) d1af4a2b819b python3Packages.stable-baselines3: init at 2.3.2 (#355954) ed44a65978a6 vivaldi: 7.0.3495.6 -> 7.0.3495.18 (#358331) 40f086a50eb8 Revert "singularity-tools: don't preserve store content ownership" (#358817) f493a4599792 sysdig-cli-scanner: do not use `--dbpath` arg when `--iac` is set (#337736) 636a7d3df492 glaze: 4.0.0 -> 4.0.1 (#358464) 1a482b25f7e3 cairo-lang: 2.8.4 -> 2.8.5 (#358594) 30fad0fd2901 circom: 2.2.0 -> 2.2.1 (#358598) ffc5efd60e05 python312Packages.fasttext-predict: 0.9.2.2 -> 0.9.2.4 eab50d932544 python312Packages.pymeteireann: 2021.8.0 -> 2024.11.0 (#358642) c4a9529071d5 lib/types: init {types.attrsWith} 052b7b7c93f4 python312Packages.elasticsearchdsl: 8.15.3 -> 8.16.0 (#358697) 9ca7693cdcc4 prometheus-statsd-exporter: 0.27.2 -> 0.28.0 (#358715) fbfa5c5e560a hishtory: 0.304 -> 0.318 (#358732) 43cd4c93f7f5 bicep: 0.30.23 -> 0.31.92 (#358736) 95030d2e236f python312Packages.h5netcdf: 1.4.0 -> 1.4.1 (#358784) bd7cf9d3d0db python312Packages.python-hcl2: 5.0.0 -> 5.1.1 (#358786) c8b7043ed3d8 gcfflasher: 4.4.0 -> 4.5.2 696ff473788e flatpak: set meta.mainProgram 2a0903c538b3 xenon: 0.9.1 -> 0.9.3 (#358987) 63cc33a7f6c2 i3bar-river: 1.0.1 -> 1.1.0 (#358954) 38b883295003 govc: 0.44.0 -> 0.46.2 (#358936) 1a780f3be17f terraform-providers.dnsimple: 1.7.0 -> 1.8.0 (#358935) d2874ac84863 terraform-providers.digitalocean: 2.42.0 -> 2.44.1 (#358932) bc4c0371541a aerospike: 7.2.0.1 -> 7.2.0.4 (#358916) efe54beb6492 godns: 3.1.8 -> 3.1.9 (#358863) c020f7d83e9a cargo-shear: 1.1.3 -> 1.1.4 e2418cc2a283 python312Packages.mitmproxy: 11.0.0 -> 11.0.1 bb545cc43195 markdown-oxide: 0.24.2 -> 0.24.3 2a765dfbad34 chromium: resolve ref to rev for blink version string aefcf4c91eba dynamodb-local: 2.5.2 -> 2.5.3 (#358814) 235a151786cc jsonwatch: 0.6.0 -> 0.7.0 262d7b9aabb6 yggdrasil: 0.5.9 -> 0.5.10 (#358708) 9e7eb7cd6d23 c2patool: 0.9.10 -> 0.9.12 80fec3bbe5f9 lock: 1.1.3 -> 1.2.0 (#358714) 913135d8d5ac python311Packages.pyoverkiz: 1.14.2 -> 1.15.0 (#358905) bf253b269e74 eigenmath: 3.27-unstable-2024-10-18 -> 3.33-unstable-2024-11-22 (#358933) 8571045ea9ff nginx: fix building with clang on linux d1dbc08b4f25 gopass-hibp: 1.15.14 -> 1.15.15 (#358868) 2c488941e751 melody: 0.19.0 -> 0.20.0 (#358873) 1f25c008c644 git-credential-gopass: 1.15.14 -> 1.15.15 (#358876) 18ad21dd8d47 globalping-cli: 1.4.0 -> 1.4.3 (#358891) 6c3afcf70a99 picom-pijulius: 8.2-unstable-2024-11-12 -> 8.2-unstable-2024-11-15 (#358893) 9afad3c3cec3 python312Packages.tencentcloud-sdk-python: 3.0.1270 -> 3.0.1271 (#358829) 3c225dac2247 flyctl: 0.3.37 -> 0.3.40 (#358835) 27b3fdf8bd32 python312Packages.mitmproxy-rs: 0.9.2 -> 0.10.7 e17e5ac7b082 xenon: 0.9.1 -> 0.9.3 d12dfaf2d755 goreleaser: 2.4.5 -> 2.4.8 bc43c1bf8f95 gitkraken: 10.4.1 -> 10.5.0 (#358938) ecf5ffb5552e regal: 0.28.0 -> 0.29.2 (#358789) dd4939081d97 moon: 1.29.0 -> 1.29.4 0706f4f5390f tautulli: 2.14.6 -> 2.15.0 7b87a185a84f nixos/clatd: use `clat-dev` if it exists in settings 7665f6cb3493 nixos/clatd: fix NetworkManager integration for dispatcher script f6d9b1683ff1 pulsar: 1.122.0 -> 1.123.0 (#358575) 54a0f23cb4a9 notmuch-mailmover: 0.4.0 -> 0.5.0 (#358716) 1cf584fe517a python312Packages.dask-ml: disable broken tests (#358849) 6b4a2bcffbb7 python312Packages.compressai: disable flaky test (#358796) 6cd7910f1a47 python312Packages.papis: 0.13 -> 0.14 (#354823) 017849d3b533 home-assistant-custom-components.solax_modbus: 2024.11.1 -> 2024.11.2 e2d43a652c1b roddhjav-apparmor-rules: 0-unstable-2024-10-06 -> 0-unstable-2024-11-24 (#358958) 5d33f18b8b6f python312Packages.lxmf: 0.5.7 -> 0.5.8 dfa2cb5482fa python312Packages.pyvicare: 2.36.0 -> 2.37.0 a8e9cae4c419 python312Packages.playwrightcapture: 1.27.1 -> 1.27.3 2a9e028c450f python312Packages.pyexploitdb: 0.2.55 -> 0.2.56 6c74308bfc5d python312Packages.librouteros: 3.2.1 -> 3.3.0 190128840345 cobang: fix build e5ab4f857142 python312Packages.cyclopts: 3.0.1 -> 3.1.0 073b870d295b python312Packages.publicsuffixlist: 1.0.2.20241123 -> 1.0.2.20241124 073e31e9b91e python312Packages.mypy-boto3-*: updates (#358509) 86476b482968 cobang: nixfmt 904070f0ada9 cobang: move to by-name e85991681117 python312Packages.rns: 0.8.5 -> 0.8.6 (#358761) 1effcb11fff8 roddhjav-apparmor-rules: 0-unstable-2024-10-06 -> 0-unstable-2024-11-24 134c8fab1823 chirp: 0.4.0-unstable-2024-11-11 -> 0.4.0-unstable-2024-11-22 54f9beddbfb6 i3bar-river: 1.0.1 -> 1.1.0 3a2d84ad3374 ncmpc: 0.49 -> 0.51 (#353958) 94b04b2a93bf cloudflare-warp: 2024.9.346 -> 2024.11.309 87647a1bf9e5 bloop: fix service 0e107c167af9 mdcat: 2.6.1 -> 2.7.0 (#358801) 65e7ddabb498 mopac: 23.0.0 -> 23.0.2 86d22fd32fd6 bun: fix darwin build and runtime issues (#358195) 37e6520b6c17 vimPlugins.gitlab-vim: init at 2024-11-22 (#358768) dee1b880431d limesctl: drop 85e03f3c0b8e pocketbase: 0.22.22 -> 0.23.1 a5b22ac2b0cc abracadabra: 2.7.0 -> 2.7.1 31efc3ee347f python312Packages.taco: fix build 6bb61e56d561 gitkraken: 10.4.1 -> 10.5.0 160facf7c161 python312Packages.qcodes: 0.49.0 -> 0.50.0 8bf50d016a83 govc: 0.44.0 -> 0.46.2 8a8bce8b04a5 ncmpc: fails on darwin e999a6f576ed ncmpc: build manpage and enable regex d73bbaaebdda ncmpc: reformat with nixfmt-rfc-style b45fe742d314 ncmpc: 0.49 -> 0.51 4842516f6afd terraform-providers.dnsimple: 1.7.0 -> 1.8.0 853bcb8549cb eigenmath: 3.27-unstable-2024-10-18 -> 3.33-unstable-2024-11-22 c2678467d98c terraform-providers.digitalocean: 2.42.0 -> 2.44.1 61aa4ba718e1 nixos/open-webui: update doc link url (#354446) 7e6ce248824a iterm2: 3.5.4 -> 3.5.10 (#357721) 700701eb67d4 vimPlugins.codecompanion-nvim: init at 2024-11-24 (#358913) da8eea70a5bc taco: nixfmt 696244274815 tinymist: 0.12.0 -> 0.12.4 90474914ee2c gcc: do not allow version skew when cross-building gcc f014b0d41520 nixos/frr: make runtime directory world-readable 1d64cd968a5b lightningcss: 1.28.0 → 1.28.2 1f772d5684d8 triptych.nvim: add plenary-nvim as required dependency ff57eb8c6cf0 python312Packages.craft-parts: 2.1.2 -> 2.1.3 (#358777) 0d7132079700 cbmc: 6.0.1 -> 6.4.0 1d2443c3d7b1 cbmc: nixfmt 1e7b94dac5c7 digikam: 8.4.0 → 8.5.0 cd7b8f7f5cc8 seclists: 2024.3 -> 2024.4 37c985d24185 katawa-shoujo-re-engineered: 1.4.8 -> 1.4.9 2de18b37cfac aerospike: 7.2.0.1 -> 7.2.0.4 7d819dfd5e53 vimPlugins.spaceman-nvim: init at 2024-11-03 (#358884) 95f9d5d2b3bf vimPlugins.codecompanion-nvim: init at 2024-11-24 c76b79b7d2f7 libstdcxx5: remove 4ae22ca15cdd ldeep: 1.0.73 -> 1.0.75 29ef7a233df3 treewide: remove deprecations after 24.11 branch-off (#358735) 23ed5b9d5538 python312Packages.pyftdi: update disabled 094453260dd2 cinnamon: remove 4633a7c72337 ocamlPackages.menhir: support --suggest-menhirLib (#358146) 1044b2ccdb4e nixos/paperless: add environmentFile option (#350944) a7f52c590569 stirling-pdf: 0.30.1 -> 0.33.1 (#357412) 422e9c14e3c9 python311Packages.pyoverkiz: 1.14.2 -> 1.15.0 0f9abba69d62 Merge: mautrix-signal: 0.7.2 -> 0.7.3 (#358785) b9a481fc4ff2 lan-mouse: 0.9.1 → 0.10.0 (#358745) 9437ab6a5324 squeak: fix build (#358156) 52158e94532a trealla: 2.57.1 -> 2.60.18 a18fac9e1a0f vte: 0.78.1 -> 0.78.2 68eacce4f7a5 rbw: fix darwin build e18aee47b356 rbw: nix-fmt rfc style a77a60f882cc picom-pijulius: 8.2-unstable-2024-11-12 -> 8.2-unstable-2024-11-15 36f39ba1abbd Merge master into staging-next 988507244d59 python3Packages.hydrogram: init at 0.1.4 (#299966) 58e31a2445b0 globalping-cli: 1.4.0 -> 1.4.3 bb102da5dece gleam: 1.6.1 -> 1.6.2 837190757566 tidal-hifi: 5.16.0 -> 5.17.0 f792ec7d1555 python312Packages.skops: disable flaky test (#358630) 6561131f8dc6 streamcontroller: Use commit hash to fetch releases (#358608) 33f90436f536 adminer-pematon: init at 4.12 8cc8dbc1afe7 glsl_analyzer: fix on x86_64-darwin (#356886) 167c90ca01ba nixos/firefly-iii-data-importer: Changes to clear cache more consistently upon updates fcc06517a070 firefly-iii-data-importer: 1.5.6 -> 1.5.7 0c7f7224aa3e nixos/firefly-iii: Changes to clear cache more consistently upon updates and other minor updates to align with new RFC formatter. 814a5c0285b8 firefly-iii: 6.1.21 -> 6.1.24 2b2e6614ce5b {nodePackages.jsonlint,luaPackages.luacheck}: add meta.mainProgram (#358173) a20bd2cca935 uwsm: add missing systemd dependency 6239ac5d0615 uwsm: prefer user env binaries 6d404af7beee glsl_analyzer: fix on x86_64-darwin b3e9840b742b litecoin{,d}: drop (#358865) a0ffe5aefaac vimPlugins.spaceman-nvim: init at 2024-11-03 af7318fcb17d kubectl-gadget: 0.33.0 -> 0.34.0 (#358667) f780ed7b05c2 xcp: 0.21.3 -> 0.22.0 (#355776) f5ed2b604136 python3Packages.globus-sdk: 3.45.0 -> 3.48.0 09a863cd274a deno: 2.0.6 -> 2.1.1 (#357942) c05012cead62 mollysocket: 1.5.2 -> 1.5.3 (#358245) 1901f9687bf4 python312Packages.qt5reactor: disable (#358266) 449d1f763813 impression: 3.2.0 -> 3.3.0 (#358308) b5af449a6f4e git-credential-gopass: 1.15.14 -> 1.15.15 ad14846166e1 Revert "limesctl: drop" (#358874) 5c6f35fe6b6f Revert "limesctl: drop" 31c6a65ecad4 python312Packages.cachecontrol: 0.14.0 -> 0.14.1 98d17cfc77e5 limesctl: drop (#353788) 1fcc0e1569e1 melody: 0.19.0 -> 0.20.0 6b92b09f0354 cemu-ti: mark x86_64-linux broken 6960c3bacccb cemu-ti: add aarch64-linux platform d64939879612 xdp-tools: unpin LLVM-14 c5a0fff8793b zcash: unpin LLVM-14 f02f51572567 cvise: unpin LLVM-14 ec11f1cc9705 ccls: unpin LLVM-14 c90e5ad038b4 clazy: unpin LLVM-14 7c1b6a3abce3 codon: LLVM-14 unpin 532ae122a70a tracexec: 0.5.2 -> 0.8.0 f1dd207da75d rippled{,-validator-keys-tool}: drop 3856d658d0ae python312Packages.tensorflow: use tensorflow-bin by default (#345658) fb2dd4aed7c3 boost175: drop 03675716cf60 litecoin{,d}: drop 2b1c7203dfb0 gopass-hibp: 1.15.14 -> 1.15.15 8d3e3da1863a sumokoin: drop c983d7bc802f libbitcoin{,-client,-explorer,-network,-protocol}: drop 5bf97cd7f860 prometheus: 2.55.0 -> 3.0.0 b15e5b006343 godns: 3.1.8 -> 3.1.9 1635ae0b386e terraform-providers.project: 1.8.0 -> 1.9.1 76407ce99dcb terraform-providers.github: 6.3.1 -> 6.4.0 c4c062825da3 terraform-providers.ns1: 2.4.4 -> 2.4.5 cc15ead64f3a terraform-providers.scaleway: 2.46.0 -> 2.47.0 95c5d22ad7ef python312Packages.bcc: 0.31.0 -> 0.32.0 (#358640) 6b3731b732c3 texlive: 2023-final -> 2024.20241027 (#351790) b5ceafbc7360 blender: 4.2.3 -> 4.3.0 (#358085) abc052ca6d9f alist: split versions; 3.39.2 -> 3.40.0 (#358658) 644459679a5b lxqt.lxqt-panel: 2.1.1 -> 2.1.2 aac60d6a8742 vscodium: 1.95.2 -> 1.95.3 b2c3907f9b8f vscodium: fix update script to work with longer hashes 2d04db6ed961 kubernetes-kcp: init at 0.26.0 551bea6443dc mapproxy: 3.1.0 -> 3.1.2 a6d28112eadd warp: 0.7.0 -> 0.8.0 (#358325) 28739cf8f8aa Merge master into staging-next ffe0631728b9 libdeltachat: 1.150.0 -> 1.151.1 545716083af3 python312Packages.dask-ml: disable broken tests bfec9ac86589 python312Packages.papis: 0.13 -> 0.14 89281cba811d python312Packages.arxiv: init at 2.1.0 142020d5ace8 maintainers: add octvs as maintainer 0a3f291dd71f sea-orm-cli: 1.0.1 -> 1.1.1 (#357165) 658159e0cb85 nixos/java: Java team ownership, format with nixfmt-rfc-style (#358840) 880c2da8d073 convbin: 3.7 -> 5.1 315c43d480a6 ghstack: 0.9.3 -> 0.9.4 (#357740) dfe5c76f37ac flclash: 0.8.66 -> 0.8.68 (#354587) 2a6bf99e788a linuxPackages.openafs: Patch for Linux kernel 6.12. b64a65b71ef9 lazydocker: 0.23.3 -> 0.24.1 (#358480) 0c2a7f8159ce OWNERS: add Java team as owner of Java module 3a37944f58d9 vault-tasks: 0.4.0 -> 0.5.0 (#358758) 5bb480bf8f0f nixos/java: format with nixfmt-rfc-style 2faaf8f4289e virtualbox: Fix UI language selection in virtualbox 8ccdb34f50d5 svelte-language-server: 0.17.5 -> 0.17.7 (#358807) 81ff7b56ac1d flyctl: 0.3.37 -> 0.3.40 579f606e7104 python312Packages.tencentcloud-sdk-python: 3.0.1270 -> 3.0.1271 85bc438264cc php81Packages.castor: 0.20.0 -> 0.21.0 (#358583) 8d8d408cb7b9 spl: 0.4.0 -> 0.4.1 2ab65ea56b1e jruby: 9.4.8.0 -> 9.4.9.0 (#358224) 14654ec0d030 mission-center: switch to using fetchCargoVendor (#358788) 57ceab248ae4 python312Packages.mlxtend: 0.23.1 -> 0.23.2 (#355306) dd7b1eb241fb kazumi: 1.4.3 -> 1.4.4 (#358300) 600ffd15b214 retroarch: use makeBinaryWrapper 50c7be19f3ca retroarch-bare: add missing . in longDescription 3d616665d6df retroarch-{bare,free}: use lib instead of builtins 60d1565d29c9 retroarch: define it using wrapRetroArch instead retroarch-bare.wrapper 2d0d7ee55aca retroarch-bare: remove top-level `with lib` in meta e981e0a249b3 retroarch-free: init b3cc74f3f8ea libretro: update README.md 61d8a91f52e9 libretro: renamed from retroarch 3aa0725cb357 retroarch: add withCores helper 3c11d3ede137 retroarch-bare: move to pkgs/by-name bc078e1e31f0 retroarch-bare: add passthru.wrapper, refactor derivation to use it 006b13c56c74 retroarch-{bare,full}: renamed from retroarch{Bare,Full} 7ae7e0df8611 retroarch: format with nixfmt-rfc-style b65ca14edeb3 kodi-retroarch-advanced-launchers: move to pkgs/by-name, format with nixfmt-rfc-style 859926a5b57e retroarch-joypad-autoconfig: move to pkgs/by-name, format by nixfmt-rfc-style 1a6115afb561 retroarch-assets: move to pkgs/by-name, format with nixfmt-rfc-style e34cd11e1dce libretro-core-info: move to pkgs/by-name, format with nixfmt-rfc-style f22e732cda2a kpt: 0.39.3 -> 1.0.0-beta.55 (#356224) 1d220ad5523b penelope: init at 0.12.4-unstable-2024-10-21 f958b757890a uutils-coreutils: 0.0.27 -> 0.0.28 (#357097) 1c6dea27f720 scrcpy: 2.7 -> 3.0 077802d97425 python312Packages.radicale-infcloud: modernize 9a524549d645 Add passwordHash option 7f8b93f1fad1 kubesec: 2.14.1 -> 2.14.2 (#358186) 31fb039bd455 vimPlugins: Remove the nvim-cmp dependency on cmp-sources 8dca27661f80 radicale: format with nixfmt-rfc-style 2fe2ad56a458 lan-mouse: 0.9.1 → 0.10.0 f32fd441276e dynamodb-local: 2.5.2 -> 2.5.3 6c1474baf0f5 radicale: 3.3.0 -> 3.3.1 b14b10581ae8 u3-tool: 0.3 -> 1.0 (#351980) b2cfcea82a30 svelte-language-server: 0.17.5 -> 0.17.7 d9b684cda479 rucola: init at 0.4.1 4343b4f09f82 piped: init at 0-unstable-2024-11-04 (#354259) 356af207229b terragrunt: 0.68.7 -> 0.69.1 4a58b6f6b83d python3Packages.torch: fix MKL build (#358555) 6626e36190fe mdcat: 2.6.1 -> 2.7.0 c4461bbe1cee singularity-tools: remove deprecated shellScript and mkLayer 8ac9869133ec python: remove pythonForBuild passthru 8893429fc5b9 avahi: drop assert 2425e26e4f67 addOpenGLRunpath: covert to throw af10dd201409 lib/customisation: remove overrideScope' f6cd55f50b94 arduino: fix fhsenv version (#358738) 719c7cd96349 omnom: 0-unstable-2024-08-29 -> 0-unstable-2024-11-20 (#357835) 49d9ef16b15a treewide: remove deprecations up until 24.11 (#356732) 7f37b926d86e python312Packages.compressai: disable flaky test d7705cc9211d zizmor: 0.2.1 -> 0.5.0 260c65a04da7 python312Packages.dask: 2024.10.0 -> 2024.11.2 (#354636) be27f0361a48 regal: 0.28.0 -> 0.29.2 56ea76053d66 mission-center: switch to using fetchCargoVendor e53e68d1b51e Merge: php: 8.2.25 -> 8.2.26, 8.1.30 -> 8.1.31, 8.3.13 -> 8.3.14 (#358600) cfc067b5c9fb python312Packages.python-hcl2: 5.0.0 -> 5.1.1 0b27578d20f1 nvim-lsp-file-operations: init at 2024-10-24 (#358250) 705ae9b92e70 mautrix-signal: 0.7.2 -> 0.7.3 576701eebcee libsignal-ffi: 0.58.3 -> 0.62.0 211a54292cfd php81: 8.1.30 -> 8.1.31 4fdc3370b7e1 nvim-lsp-file-operations: init at 2024-10-24 6f6d0f283887 php83: 8.3.13 -> 8.3.14 91cbd96ffe01 kanidm: allow hydra to cache alternative build with secret provisioning f663b14524ef Revert "singularity-tools: don't preserve store content ownership" 71f6103e6b8c vscode-extensions.ms-python.python: Add aarch64-linux support c9ac44d1f1a3 php82: 8.2.25 -> 8.2.26 a5972fa105cd Merge master into staging-next d7831a0f3f02 python312Packages.h5netcdf: 1.4.0 -> 1.4.1 536dc87db6ea nerd-fonts: 3.2.1 -> 3.3.0 ee2bb9be3e79 nerdfonts: separate into packages under nerd-fonts df694054ab4e floorp: 11.20.0 -> 11.21.0 9d9693035c1f python312Packages.craft-parts: 2.1.2 -> 2.1.3 924dd674814a librenms: 24.9.1 -> 24.10.1 (#354216) fc827af1dcce decent-sampler: 1.12.1 -> 1.12.5 bef3f40f05fb edk2: 202408.01 -> 202411 2c8074dfa79e binwalk: 2.4.3 -> 3.1.0 2d7c55054ac0 openscad-unstable: 2024-11-10 -> 2024-11-18 (#358384) b32389d78cdb qlog: 0.39.0 -> 0.40.0 3a2ff8ac13d6 sql-studio: 0.1.27 -> 0.1.32 6ac9416b744b python3Packages.radio-beam: 0.3.7 -> 0.3.8 53bc18243bd2 python312Packages.equinox: 0.11.8 -> 0.11.9 (#358731) d2c8837098af trayscale: 0.13.5 -> 0.14.0 (#358748) 628a933c8a4d python312Packages.rns: 0.8.5 -> 0.8.6 bbffc418d29a vimPlugins.gitlab-vim: init at 2024-11-22 3ab7056874d6 rigel-engine: init at 0-unstable-2024-05-26 (#358744) 72809add269e vault-tasks: 0.4.0 -> 0.5.0 91878b746f68 epson-escpr2: 1.2.20 -> 1.2.21 03a516ee2e33 rigel-engine: init at 0-unstable-2024-05-26 d4b1fcdbe64e nixos/redlib: format, add maintainer, add cfg.settings, use upstream systemd unit (#345715) 44d36ad12ffd tuxedo-drivers: 4.9.0 -> 4.11.3 (#357945) a0cefba4f74c onefetch: 2.21.0 -> 2.22.0, migrate to by-name (#355063) 552eca9ad9a7 llvmPackages.llvm-manpages: fix eval on Darwin (#357697) 0ed56980f968 {gcc{7,8}{,Stdenv},gfortran{7,8}}: drop (#357657) f19e0f76f469 xfce.xfce4-settings: Fix screen locked but lockscreen invisible after suspend df1bc6491a8c trayscale: 0.13.5 -> 0.14.0 3e79601b1ce1 python3Packages.django-storages: Enable one test (#358429) 018bd5d26808 archivebox: add SingleFile 029bc6ad7ec6 skypeforlinux: 8.132.0.201 -> 8.133.0.202 6632eed37b6b nixos/haka: fix assert (#358675) d11140fa35ad neovim: add 'autoconfigure' setting (#356271) ffc17f1a1bef archivebox: fix build b6ef6fe53aa9 arduino: fix fhsenv version aaffe2513c83 bicep: 0.30.23 -> 0.31.92 73307b55a1e5 cwtch-ui: init at 1.15.1 a53505b4523b cwtch: init at 0.1.3 cd0c48f3f663 python312Packages.equinox: 0.11.8 -> 0.11.9 a149b3de32b7 hishtory: 0.304 -> 0.318 b675ca747f89 nixos/mopidy: test & cleanup (#356021) 955dff85b361 discord: bump all versions d657cbc539e2 mpris-timer: init at 1.1.1 (#357092) 0fd499992dcc python312Packages.pinocchio: Disable test that fails on darwin b2508395f1c3 taterclient-ddnet: 8.6.1 -> 9.0.0 ea8ced0c4c4c sublime-merge: set meta.mainProgram ae30ebbdb208 dovecot_fts_xapian: 1.7.14 -> 1.8 (#357546) 16f9ad9986ac vscode: 1.95.2 -> 1.95.3 (#358512) 73450ebccf10 lan-mouse: reformat eff53a213598 singularity-tools: enable __structuredAttrs and pass contents directly edfc76c52e8a radicle-{explorer,httpd}: 0.17.0 -> 0.17.1 4f60875ee6fb wasmer: 5.0.1 -> 5.0.2 65dc95e52f49 feat: Allow setting a password on cmdline for pxe boot 10c475aeb9d3 ocamlPackages: add __darwinAllowLocalNetworking to fix sandbox builds (#358360) 55fdcb491066 etherguard: init at 0.3.5-f5 (#354933) 081c12aadada quake-injector: init at 06 (#358031) cd555e71de0f termbg: init at 0.6.0 (#352093) a475f173ad2a bash-env-json: init at 0.9.1 (#358140) 42ec1e396dd4 twig-language-server: init at 0.5.1 (#355056) cf3c5726cbf4 python312Packages.transformers: fix optional-dependencies.ray (#358576) 23605324ae65 python312Packages.libpwquality: fix build (#355674) 896ee659d1f5 btrfs-list: init at 2.3 (#351468) 1d8947c6b78e protoc-gen-go: 1.35.1 -> 1.35.2 (#358701) 4ad703d62e7c nixos/tests/zammad: refactor test f41f218e0df5 nixos/zammad: refactor module 1dc3b902a6e7 torq: drop (#358683) 79facd2bb623 zammad: refactor package 3298b5421728 python312Packages.pymeteireann: 2021.8.0 -> 2024.11.0 b84c7c214ee1 nixos/nezha-agent: add options for new features 54d9129de60e notmuch-mailmover: 0.4.0 -> 0.5.0 f5a4dd81d64c prometheus-statsd-exporter: 0.27.2 -> 0.28.0 626d3e44e52c Merge: runInLinuxVM: fix `createEmptyImage`/`preVM` case (#358705) 5a2387f4fc07 sqlite-utils: 3.37 -> 3.38 (#358652) 66027a3751ff code-cursor: 0.42.5 -> 0.43.0 (#358654) 11731f16408e python312Packages.yalexs-ble: 2.5.0 -> 2.5.1 (#358657) b98f05ae319e lock: 1.1.3 -> 1.2.0 e348df2e7748 txtpbfmt: 0-unstable-2024-06-11 -> 0-unstable-2024-11-12 (#358297) b300c9a2b199 python312Packages.cantools: 39.4.8 -> 39.4.11 (#358665) 9bd1d5605fe1 nerdfix: 0.4.1 -> 0.4.2 (#358602) 288987d8abd3 starlark: 0-unstable-2024-05-21 -> 0-unstable-2024-11-19 (#358298) ba1bef897dfd brave: 1.73.89 -> 1.73.91 (#358616) 81bfb6e43e32 haskellPackages.sym: mark broken on darwin (#358693) 687b5906f8e5 cnquery: 11.19.1 -> 11.31.1 (#358622) a6c4d718c5e4 adwsteamgtk: 0.7.1 -> 0.7.2 (#358623) b314c165d60b terraform-providers.exoscale: 0.61.0 -> 0.62.0 (#358632) 78288e4f603b heptabase: 1.41.1 -> 1.46.1 (#358634) 9d34f3ceb56e wlvncc: unstable-2023-01-05 -> unstable-2024-11-24 594d2c2ae81f python312Packages.apollo-fpga: 1.1.0 -> 1.1.1 (#358636) 4e2ce1ba9440 apptainer.tests.image-hello-cowsay: remove obsolete `rmdir "$out"` 26eba2557738 runInLinuxVM: re-add sourcing of stdenv & .attrs.sh 554de33dcf84 python312Packages.tencentcloud-sdk-python: 3.0.1269 -> 3.0.1270 (#358506) 98ff582f2575 bearer: 1.46.2 -> 1.47.0 (#358593) beee8b63c9f9 yggdrasil: 0.5.9 -> 0.5.10 fa60622567d5 crawley: 1.7.8 -> 1.7.10 (#358597) 73f20f3d661d timewall: init at 1.2.0 (#357968) b34a2eb7a1a7 clifm: 1.21 -> 1.22 (#358599) 4220a62d70cc Merge: nixos/victoriametrics: check config, more tests & update desc (#353950) 1531badaec4c gscreenshot: 3.6.3 -> 3.7.0 (#358527) a60c401e897a netbird: 0.32.0 -> 0.33.0 (#358249) 89ac0fe6d195 qualisys-cpp-sdk: init at 2024.2 (#354254) 549b6df4047f vidcutter: init at 6.0.5.3 (#353504) 11faa20dff78 terraform-providers.porkbun: 0.2.5 -> 0.3.0 (#358539) ac2f3ec345ac python312Packages.solax: 3.1.1 -> 3.2.1 (#358541) 09b496addb78 git-cola: 4.8.2 -> 4.9.0 (#358406) f7771c7dd1c7 python312Packages.pytenable: 1.5.3 -> 1.6.0 (#358542) af1a3fa09a33 python312Packages.publicsuffixlist: 1.0.2.20241121 -> 1.0.2.20241123 (#358543) ca5d2e685086 violet: 0.5.0 -> 0.5.1 (#358549) febbe73d5b18 bitwarden-desktop: 2024.9.0 -> 2024.11.1 (#355978) fa2a9bfdbf2b typstyle: 0.12.1 -> 0.12.2 (#358573) 2e77b9b2b85c typstyle: 0.12.1 -> 0.12.3 c9bcd0e639ac multiviewer-for-f1: 1.35.2 -> 1.36.1 (#353104) d6ae0902917a aactivator: init at 2.0.0 (#357493) 70fc3487df0b rogcat: init at 0.4.7 (#357615) 15faba4dfb1f chirpstack-concentratord: init at 4.4.2 (#353921) ce7cc9146eee torq: drop bdd3c0a1f7ab chirpstack-mqtt-forwarder: init at 4.3.1 (#353917) 4284da6a650b chirpstack-rest-api: init at 4.9.0 (#353916) 1a8005b4d448 chirpstack-udp-forwarder: init at 4.1.8 (#353918) 44e53da6651b chirpstack-gateway-bridge: init at 4.0.11 (#353919) 3c27399f0f93 chirpstack-fuota-server: init at 3.0.0-test.4-unstable-2024-04-02 (#353920) ef39c35c8470 versitygw: init at 1.0.8 (#355588) e03c843a7acf hcloud: 1.48.0 -> 1.49.0 (#357080) 4b218e54ae22 turtle: 0.10 -> 0.11 (#358280) 2636739e7ac4 nixos/monado: add forceDefaultRuntime option (#348815) 8dfc7cb9087b rippled: fix build (#358479) 622dc438f982 monado: backport reproducibility fix (#350271) b4088ccab5d2 github-runner: fix test execution on build (#358445) ecf6e3cc41db protoc-gen-go: 1.35.1 -> 1.35.2 544f509f66bd astyle: 3.6.3 -> 3.6.4 (#354966) 62447acaf424 python312Packages.elasticsearchdsl: 8.15.3 -> 8.16.0 3ded5887a27b ams-lv2: Mark broken (#344543) d0b68f1b8b84 python312Packages.py-aosmith: 1.0.10 -> 1.0.11 (#358656) a2c2ebc1d1cb haskellPackages.sym: mark broken on darwin 701da0af4866 bign-handheld-thumbnailer: init at 1.1.1 (#358279) 36afa30c8ee9 Merge master into staging-next 1ca5dab7077f luminance: init at 1.1.0 (#357231) 9624dc8089c4 lock: init at 1.1.3 (#358278) 7806b5877311 stl-to-obj: init at 0.3 (#355988) 2acfd434f46f nvc: 1.14.1 -> 1.14.2 de944af7f393 goread: 1.6.5 -> 1.7.0 (#358294) 2d84ab4d22d2 cups-kyocera-3500-4500: fix broken download URL (#358536) ecdda28a3a3a php: support two- and zero-argument overrideAttrs forms (#356870) 4f1da3ec5e74 nvc: reformat 7c5948b7f99f nvc: move to pkgs/by-name 65f013da3a2d treewide: add mainProgram attribute to lisp compilers f3cb98c1ee35 decent-sampler: 1.10.0 -> 1.12.1 (#350026) 563d01c2dded Pantheon updates 2024-11-23 (#358311) 1d8d6f2dbba9 lvtk: 1.2.0 -> 1.2.0-unstable-2024-11-06 (#356644) 5c99958613dd nixos/haka: fix assert 78824546545f nixos/manticore: fix mkKeyValueDefault 9a795338a416 rectangle: 0.84 -> 0.85 e36b87dce3d8 pg_top: nixfmt c73e275bfa48 pg_top: 3.7.0 -> 4.1.0 2570b87e71ea aw-watcher-window-wayland: 6108ad3df8e157965a43566fa35cdaf144b1c51b -> unstable-2024-10-08; switch to fetchCargoVendor (#358396) b013efdaa8b2 python312Packages.gurobipy: 11.0.3 -> 12.0.0 (#357427) 9262fc48f95d nixos/mopidy: use lib.getExe 73ede0a42d6a mopidy: fmt 0c585a601a6e fast-float: 6.1.6 -> 7.0.0 (#358044) dddc9d800a91 nixos/mopidy: fmt 8f6ffd06a4ec nixos/mopidy: add test fba9ba64b37a nixos/mopidy: remove "with" statment 46c222a1211d aw-watcher-window-wayland: 6108ad3df8e157965a43566fa35cdaf144b1c51b -> 0-unstable-2024-10-08; switch to fetchCargoVendor 3469a7c92fca kubectl-gadget: 0.33.0 -> 0.34.0 54834bdfc72e python312Packages.bidsschematools: 0.11.3 -> 0.11.3.post3 (#357423) 0c84ae52a0e3 memtier-benchmark: fix hash mismatch (#358416) b234fd831af3 lib.types.defaultTypeMerge: refactor functor.{payload,wrapped} merging (#350906) 8b6f73b7d3c0 libxmlb: 0.3.20 -> 0.3.21 (#358336) c74cfd9030b5 python312Packages.cantools: 39.4.8 -> 39.4.11 7235e9075d7c blender : 4.2.3 -> 4.3.0 30abd650aa57 hyprwall: 0.1.8 -> 0.1.9 (#358466) 83aba6074641 wordpress: 6.7 -> 6.7.1 29f3cc5e81c5 typst: remove local `cargo.lock`, use `fetchCargoVendor` (#358648) 78c80ec3842f nezha-agent: 0.20.3 -> 0.20.5 3f34ba46d6e6 nezha-agent: add updateScript d717982cd8c4 fwupd: 1.9.25 -> 2.0.1 (#351772) f7b82e06e3f1 alist: 3.39.2 -> 3.40.0 8ccddb644140 alist: use fetchzip to get web dist f32b5f997fcd alist: split webVersion from version 3c8b6223345e whitesur-kde: 2022-05-01-unstable-2024-11-01 -> 2024-11-18 (#357368) 3bca3c099090 whitesur-gtk-theme: 2024.09.02 -> 2024-11-18 (#357072) 041623d21914 python312Packages.yalexs-ble: 2.5.0 -> 2.5.1 29b4442a2eb0 cyrus-imapd: fix wrong mainProgram; remove unused inputs (#354680) 1f5b080fa9e0 python312Packages.py-aosmith: 1.0.10 -> 1.0.11 5883fb4ab6d1 code-cursor: 0.42.5 -> 0.43.0 383f676a1bcd matrix-sliding-sync: remove the word 'simply' from option rename (#358544) 94869937ff1e tpm2-openssl: use nix-update-script (#358504) d1761537ac54 rabbitmq-server: move to by-name hierarchy ec7e61744071 rabbitmq-server: use the latest compatible Erlang version 13b508e96868 rabbitmq-server: 4.0.2 → 4.0.4 a91beb2d34b6 sqlite-utils: 3.37 -> 3.38 f95f434d2736 stravaweblib: use nix-update-script (#358503) ba1b15be08b1 squeak: fix build 14aa5dc39d39 ollama: 0.3.12 -> 0.4.4 (#354969) bc7d2a3129d5 typst: remove local `cargo.lock`, use `fetchCargoVendor` ef95c99dd0e4 metasploit: 6.4.36 -> 6.4.37 (#358442) 2b8b999143d9 python311Packages.aiopegelonline: 0.0.10 -> 0.1.0 (#358351) bf756576ebef go-musicfox: 4.5.3 -> 4.5.7 (#357857) ded74383ba8d python311Packages.mozart-api: 4.1.1.116.0 -> 4.1.1.116.3 (#358349) 3f06ef6d6fc7 rabbitmq-server: migrate to the new macOS SDK (#357333) 2cbf5b1c4b12 suricata: link nixosTests.suricata to passthru.tests 74a650ef9ca0 suricata: move to pkgs/by-name 77fffb09ec86 suricata: take versioned params instead of overriding at top-level cbe0d6722726 swayrbar: 0.4.0 -> 0.4.2 041855ac563c nixos/scx: cleanup (#358339) 518c682a1613 waagent: 2.11.1.12 -> 2.12.0.2 (#357728) 147ecc75640b python312Packages.bcc: 0.31.0 -> 0.32.0 beabad550587 hyprlandPlugins.hyprscroller: 0-unstable-2024-11-09 -> 0-unstable-2024-11-23 (#358404) fb3ba5ec5b19 python312Packages.pyftdi: 0.55.4 -> 0.56.0 fe61d5b377bc python312Packages.apollo-fpga: 1.1.0 -> 1.1.1 f9d6f6774557 versitygw: init at 1.0.8 de7630ccc57c git-machete: 3.29.3 -> 3.31.0 (#358535) 85cf44dc03d3 polyglot: init at version 3.5.1 (#316541) de716269153f heptabase: 1.41.1 -> 1.46.1 5991ed35dad1 nixos/open-webui: update doc link url dbd0c8dcd051 terraform-providers.exoscale: 0.61.0 -> 0.62.0 87ed7eb7d3fd python312Packages.dbt-semantic-interfaces: 0.7.4 -> 0.8.1 (#356908) 3f631d658b12 ollama: 0.3.12 -> 0.4.4 81d4b4ce91aa Merge master into staging-next 13981dc98c5d python312Packages.skops: disable flaky test 21b0706dadb0 osquery: 5.13.1 -> 5.14.1 (#357068) cc5811f63940 metacubexd: 1.168.0 -> 1.171.0 (#357720) 73232cb2615c deskflow: 1.17.1 -> 1.17.2 (#357645) 2a9cd7436ca9 infisical: 0.31.2 -> 0.31.8 (#357940) d2c66ead4165 intentrace: 0.2.5 -> 0.2.6 (#357441) 159f059ad606 python312Packages.syrupy: 4.7.2 -> 4.8.0 bf9b48352032 goldwarden: 0.3.4 -> 0.3.6 (#355002) ff9102c2f4a4 aaaaxy: 1.5.208 -> 1.5.220 (#354202) 4a9e4b629928 adwsteamgtk: 0.7.1 -> 0.7.2 7e497c2f68b1 git-spice: 0.7.0 -> 0.8.1 (#354922) 3f038acf2dae ufetch: 0.3 -> 0.4 (#358611) efb434511a0a python312Packages.icalendar: 6.0.1 -> 6.1.0 cf1bb0ec9f29 cnquery: 11.19.1 -> 11.31.1 8ae2932d567c add `--enable-wayland-ime` flag to all Electron packages that uses `NIXOS_OZONE_WL` d305ef0ea5c6 duckdb: 1.1.2 -> 1.1.3 (#355903) 1b02d50938ea fvwm3: remove libstroke from buildInputs (#358138) 392c15874540 hyprland: 0.45.0 -> 0.45.2 (#358381) f5d2455bcd87 emmet-language-server: 2.2.0 -> 2.6.0 (#356181) 8e57e3e1b3c5 glamoroustoolkit: 1.1.4 -> 1.1.7 (#356201) 9a7c0cf0f8f1 delfin: 0.4.7 -> 0.4.8 (#358267) 494019607724 avdump3: init at 8293_stable (#324183) 8d2c025ea942 ox: 0.6.10 -> 0.7.1 (#356179) 302e800a1e70 libkrun: 1.9.6 -> 1.9.8 (#358288) f680acb4d739 mud: 1.0.1 -> 1.0.10 (#355446) 435dcea9ce0a passepartui: init at 0.1.3 (#357156) 8551853609ac k9s: 0.32.5 -> 0.32.6 (#356238) a4bc6ec028cc varia: 2024.5.7 -> 2024.11.7-1 (#358577) 6bf0840f11a0 databricks-cli: 0.229.0 -> 0.234.0 (#356926) fb8da23762ac brave: 1.73.89 -> 1.73.91 https://community.brave.com/t/release-channel-1-73-91/582123 36e24daa942a rcp: 0.13.0 -> 0.15.0 (#356855) 9a23dc358ff3 azurite: 3.31.0 -> 3.33.0 (#355012) 7e7d48390e8b ufetch: 0.3 -> 0.4 3917762ed3fe bite: 0.2.1 -> 0.3, fix x86_64-darwin build (#355807) 56ba82504d92 tilt: 0.33.17 -> 0.33.21 (#355691) 328d190ab8f3 hyprlauncher: 0.1.2 -> 0.2.2 (#355756) d924e070ea23 dezoomify-rs: migrate to new apple-sdk pattern (#355561) 0b701929992f ast-grep: 0.28.1 -> 0.30.0 (#355839) 460e8af3fa36 temporal-cli: 1.0.0 → 1.1.1 (#355781) 6d0fee0f6c02 streamcontroller: Use commit hash to fetch releases b5ccdea5caec lunatask: 2.0.12 -> 2.0.13 (#356154) 41262c1f433a linuxPackages.nvidiaPackages.vulkan_beta: 550.40.79 -> 550.40.80 (#358235) ff4aa2c94ca4 klog-rs: 0.1.0 -> 0.2.0 (#356088) 58feae3a90df pingvin-share: 1.2.4 -> 1.4.0 (#356551) 2b02a18ef799 freebsd: Add support for aarch64 9d2d6318d9ad tex-fmt: 0.4.6 -> 0.4.7 (#356151) 00452c8bbe1d nushellPlugins.skim: 0.8.0 -> 0.9.1 (#356039) 2443452fa258 endless-sky: 0.10.8 -> 0.10.10 (#356051) a469349e62f6 polarity: 0-unstable-2024-06-28 -> 0-unstable-2024-11-15 (#356215) b2cbe680b4d5 ghq: 1.6.3 -> 1.7.1 (#356243) 9feafb7f33d7 go-task: 3.39.2 -> 3.40.0 (#356214) 72ae79b7d256 streamcontroller: fix 1.5.0-beta.7 hash (#356610) c72e2bdfab79 iotas: 0.2.10 -> 0.9.5 (#356613) 55611438f037 f2: 1.9.1 -> 2.0.1 (#356620) 86579c77258e Gitnuro 1.3.1 -> 1.4.2 (#358051) 3e8d408a5e78 mysql-shell{,_8,-innovation}: format with nixfmt 1677c4a3d575 gdal: add libavif optional dependency cd5b40ab2b03 gdal: 3.9.3 -> 3.10.0 14571a9f9686 r2modman: 3.1.50 -> 3.1.54 55f55e3c0f7f nerdfix: 0.4.1 -> 0.4.2 2fa4f5358cc4 clifm: 1.21 -> 1.22 77be1499afb1 opentofu: 1.8.5 -> 1.8.6 (#358176) 9e708b3c14db libdeltachat: 1.148.7 -> 1.150.0 (#358240) 5b9e7d16ec0a circom: 2.2.0 -> 2.2.1 e25bf97f7061 python312Packages.debugpy: 1.8.8 -> 1.8.9 (#358498) 8f247cd3f4c0 crawley: 1.7.8 -> 1.7.10 db679bc91935 aquamarine: 0.4.4 -> 0.5.0 (#358565) 3abc2b70af00 raycast: 1.85.2 -> 1.86.0 (#357579) 6357f592127c zrok: 0.4.39 -> 0.4.44 (#356822) 2b585512cd1d cairo-lang: 2.8.4 -> 2.8.5 7377f8136941 bearer: 1.46.2 -> 1.47.0 835ae0f7b0e4 Merge master into staging-next 2206081622dd gitlab-ci-local: 4.53.0 -> 4.55.0 (#358253) 12b229e7115f python312Packages.boltons: 24.0.0 -> 24.1.0 (#353260) 2754eec61b3d python312Packages.marisa-trie: 1.2.0 -> 1.2.1 (#348777) 459330abc20a python312Packages.crc: 7.0.0 -> 7.1.0 (#354302) 6585cbd0e000 stirling-pdf: 0.30.1 -> 0.33.1 2ed86e28551d seabios: adopt ade41e6fd783 scarab: add sigmasquadron as co-maintainer d4f3fe7de3c0 fish: add sigmasquadron as co-maintainer 4f41851f812e steamguard-cli: add sigmasquadron as co-maintainer ab413c8047b1 music-player: adopt 5b9772431280 mullvad-browser: add sigmasquadron as co-maintainer dca118b096a8 lazygit: add sigmasquadron as co-maintainer 7fccd0fad5f6 freetube: add sigmasquadron as co-maintainer 33cbff8371b8 eza: add sigmasquadron as co-maintainer ec3d4c6c836a er-patcher: adopt 817bda8d0556 duf: add sigmasquadron as co-maintainer 9374b8b083b2 dev86: add sigmasquadron as co-maintainer 8050a6bbc393 cryfs: add sigmasquadron as co-maintainer 03b4c534849d cntr: add sigmasquadron as co-maintainer f611da92a7ba bat: add sigmasquadron as co-maintainer aac54d9b210f asciiquarium: add sigmasquadron as co-maintainer 4a972e311577 OVMF: add sigmasquadron as co-maintainer d890c3f85893 keepassxc: add sigmasquadron as co-maintainer 6b6bbe1aae8c nano: add sigmasquadron as co-maintainer 75fcc15c1619 php81Packages.castor: 0.20.0 -> 0.21.0 4238856f159e incus: 6.6.0 -> 6.7.0 (#356230) 8d83dc54575d vimPlugins.tsc-nvim: init at 2024-08-14 (#357769) 0d7512f7d616 woof-doom: 14.5.0 -> 15.0.0 0c4555b60e2b emacsPackages.voicemacs: 0-unstable-2024-01-03 -> 0-unstable-2024-10-11 (#358563) 9830727394da varia: 2024.5.7 -> 2024.11.7-1 bd28c20f67c6 tetragon: 0.1.1 -> 1.2.0 (#356642) 2c06a623f5ca python312Packages.transformers: fix optional-dependencies.ray c9fa9802a6f1 codeberg-pages: 5.1 -> 6.1 (#358270) 919d4b8e15fe maintainers: add rytswd 362c5b1825f2 python312Packages.unicorn: rename unicorn-emu input to unicorn (#355779) 571df58ae398 python312Packages.uarray: 0.9.0 -> 0.9.1 (#356907) ed24c80ef651 incus: add tpm to container test ba6917004716 ufetch: init at 0.3 (#266274) 63613a732632 pulsar: 1.122.0 -> 1.123.0 0e12722d4b51 incus: fix tpm support 57ff99d7bd25 Merge: php: 8.2 -> 8.3 (#354568) 99d697b87b11 iterm2: 3.5.4 -> 3.5.10 f4bcc2592ba6 hugo: 0.138.0 -> 0.139.0 (#357532) 8d3b1a87c98d python312Packages.pymupdf: 1.24.10 -> 1.24.14 fb42deb6615a python312Packages.slack-sdk: 3.33.3 -> 3.33.4 (#358119) 8653ea453d81 linuxPackages.nvidiaPackages.{latest,vulkan_beta}: broken on 6.12 3b81fc76dfa5 aquamarine: 0.4.4 -> 0.5.0 ab7b1a09f830 linuxPackages.nvidiaPackages.*: convert patches between variants 0262e2562a6c await: 1.0.5 -> 1.0.7 (#358211) 2b20fd90e056 emacsPackages.voicemacs: 0-unstable-2024-01-03 -> 0-unstable-2024-10-11 06e8efb692de n98-magerun2: fix build by changing vendorHash (#358460) c9e243b7ed62 swiftpm2nix: use nurl instead of nix-prefetch-git (#358546) 5bd3eeba769d python3Packages.hydrogram: init at 0.1.4 cfc3088edcc6 swiftpm2nix: use nurl instead of nix-prefetch-git 0a92232f3f15 bambu-studio: 01.09.07.52 > 01.10.01.50 (#356673) 6d86d77aaed8 element-desktop: 1.11.85 -> 1.11.86 746f6ce73f26 python3Packages.torch: fix MKL build d2ed89833bd7 php: 8.2 -> 8.3 52aad27d73d2 nixos/castopod: pin to php 8.2 975e7e7c20be Merge: postgresql: remove globin and ivan from maintainers (#358540) 053e9d35f379 incus: add lvm to storage test (#358528) eb3dcb6bb9a9 python312Packages.fastembed: unpin pillow (#358505) 979ba96ede09 bisq-desktop: drop (#356730) 60f142682c56 violet: 0.5.0 -> 0.5.1 2ce151821bc7 signal-desktop: move to pkgs/by-name; signal-desktop{x86_64-linux, aarch64-linux, darwin}: 7.33.0 -> 7.34.0; add myself to maintainers (#358187) 3c7196f05b3c nixos/networkd-dispatcher: add extraArgs option 2256f11410db networkd-dispatcher: don't patch conf file path f0f05c91fc2c python312Packages.solax: 3.1.1 -> 3.2.1 d6128750fb12 matrix-sliding-sync: remove the word 'simply' from option rename c2d79ee20646 python312Packages.pytenable: 1.5.3 -> 1.6.0 8e63bfaa6a37 python312Packages.publicsuffixlist: 1.0.2.20241121 -> 1.0.2.20241123 f51153540e83 postgresql: remove globin and ivan from maintainers ea24e14d5671 gh-gei: 1.8.0 -> 1.9.0 (#357588) 573e141a9e99 open62541pp: 0.15.0 -> 0.16.0 (#358467) 5445bd068e7b cyrus-imapd.meta: add changelog ebfff36b8f3d terraform-providers.porkbun: 0.2.5 -> 0.3.0 b9f213f07e89 cups-kyocera-3500-4500: fix broken download URL 15bd4e405978 librewolf: 132.0.1-1 -> 132.0.2-1 (#357638) 6c258ee2bd97 lammps: remove mpi passthru b6c3e15ee527 redocly: remove compat symlink 97c3fa4ebd11 hocon: remove deprecated indicators 2342cc1a4062 .github/labeler.yml: add more paths to Java 1d9afb7df9b5 python3Packages.setuptools-odoo: fix (#358469) 3561b1dd74cc dotnet-{sdk,runtime,aspnetcore}_{6,7}: mark as EOL 76b474c7243b markdownlint-cli: 0.42.0 -> 0.43.0 (#358491) 28dc7a74a632 git-machete: 3.29.3 -> 3.31.0 5bc0af1336b5 python3Packages.sphinx-multiversion: fix build (#358468) 496390848dbb incus: add lvm to storage test dce14bda870d linux_xanmod, linux_xanmod_latest: 2024-11-22 (#358228) d8b67f6e05f5 gscreenshot: 3.6.3 -> 3.7.0 f176d9b7b6c8 luaPackages.luacheck: add meta.mainProgram af6f9b7aa816 lnav: add a few missing dependencies (#357675) 41845d16d3aa Merge master into staging-next 9ef8694ce286 glfw3: general improvements (#358007) 0bb3d51aad2a lunarvim: fix alias neovim is still in node-packages.nix 2ce65e56b519 Merge: postgresqlPackages.{pgvecto-rs,timescaledb_toolkit}: fix build on darwin (#358403) ee8e3dfe39fd otree: init at 0.3.0 (#358397) 1b6f14e4a726 croc: 10.0.13 -> 10.1.0 (#355219) d1c079db10ac nixos/suricata: Fix module and add to module-list (#349826) 7f5d4dfafc5a home-assistant-custom-components.homematicip_local: 1.71.0 -> 1.72.0 (#358058) 64db9966f762 python312Packages.mypy-boto3-workspaces: 1.35.66 -> 1.35.68 fcd38562d36c python312Packages.mypy-boto3-stepfunctions: 1.35.54 -> 1.35.68 9ad5b78f4bb8 python312Packages.mypy-boto3-sns: 1.35.0 -> 1.35.68 04200acdbe47 python312Packages.mypy-boto3-ses: 1.35.3 -> 1.35.68 3b64a4eabff1 python312Packages.mypy-boto3-sagemaker: 1.35.61 -> 1.35.68 421ac24759b4 python312Packages.mypy-boto3-quicksight: 1.35.61 -> 1.35.68 7e2ab09055a3 python312Packages.mypy-boto3-omics: 1.35.66 -> 1.35.68 07a6bfbd39f2 keycloak: 26.0.5 -> 26.0.6 (#358153) 9d96720f5733 python312Packages.mypy-boto3-lambda: 1.35.67 -> 1.35.68 2f17043f208d python312Packages.mypy-boto3-inspector2: 1.35.58 -> 1.35.68 a9ecec220fcc python312Packages.mypy-boto3-emr: 1.35.39 -> 1.35.68 2a29b401f3b1 python312Packages.mypy-boto3-elbv2: 1.35.67 -> 1.35.68 65aa13131c9a python312Packages.mypy-boto3-connect: 1.35.64 -> 1.35.68 38de9d652171 python312Packages.mypy-boto3-cognito-idp: 1.35.18 -> 1.35.68 1f048282cf78 python312Packages.mypy-boto3-codepipeline: 1.35.40 -> 1.35.68 9dda8887d695 python312Packages.mypy-boto3-ce: 1.35.67 -> 1.35.68 3cf742a06ba4 python312Packages.mypy-boto3-autoscaling: 1.35.66 -> 1.35.68 f7e1e7c724ea vscode 1.95.3 5aa666930760 cpuinfo: 0-unstable-2024-09-26 -> 0-unstable-2024-11-14 (#358269) 3088b4082b20 python312Packages.fastembed: unpin pillow 2e07e3990d5e kubo: 0.29.0 -> 0.32.1 (#357960) a33a6fc89fcc google-play: 1.5.8 -> 1.6.3 (#358456) 243a3f5f05c7 tpm2-openssl: use nix-update-script a52f4f2ff8ca alice-lg: use nix-update-script (#358499) 10e5cc4726a2 gortr: use nix-update-script (#358501) be995149f18c birdwatcher: use nix-update-script (#358500) 23f674f53d20 stravaweblib: use nix-update-script 3585cfd19a0e ocsinventory-agent: 2.10.1 -> 2.10.4 5259df7001a3 tomcat9: 9.0.95 -> 9.0.97 2416a0224fb9 gortr: use nix-update-script 62b175ed2190 postgresqlPackages.{pgvecto-rs,timescaledb_toolkit}: fix build on darwin 1f42163298cd birdwatcher: use nix-update-script ffbe28a0202f lnav: adopt 439337b9e694 lnav: enable debug symbols 62b205eff53a lnav: add missing optional dependencies 16edd2ed345d alice-lg: use nix-update-script 8d35585477a4 Merge: Revert "postgresqlPackages.pgvecto-rs: 0.3.0 -> 0.4.0" (#358496) 398f231c2c18 nicotine-plus: 3.3.5 -> 3.3.6 (#356319) 6bd30c77a0bc python312Packages.debugpy: 1.8.8 -> 1.8.9 2911adffc79d pre-commit: fix meta hooks (#306444) 1c6e710aa32a chirpstack-udp-forwarder: init at 4.1.8 1cfdb5c81693 chirpstack-rest-api: init at 4.9.0 a929772d7863 nixos/prometheus-postfix-exporter: add package option and format (#356564) 59c2685a24b3 nixos/mackerel-agent: fix pkgs (#358476) 0e70d9b61b70 chirpstack-mqtt-forwarder: init at 4.3.1 5f2a72aa7a82 chirpstack-gateway-bridge: init at 4.0.11 e0bf198048c3 Revert "postgresqlPackages.pgvecto-rs: 0.3.0 -> 0.4.0" d657918db816 python3Packages.textblob: init at 0.18.0 (#334134) 4344d8e575f2 chirpstack-fuota-server: init at 3.0.0-test.4-unstable-2024-04-02 1942b34845c2 vscode-extensions.mhutchie.git-graph: correct license (#358474) 430bc942dae9 chirpstack-concentratord: init at 4.4.5 adaa460a69a3 Revert "cargo-pgrx_0_12_0_alpha_1: remove" 5f78560fca1c python312Packages.rotary-embedding-torch: 0.8.4 -> 0.8.5 (#355383) f783d5e826cf markdownlint-cli: 0.42.0 -> 0.43.0 c8eb734b5af2 matrix-sliding-sync: improve assertion/deprecation message (#355938) a5c236e30d3d python3Packages.sphinx-multiversion: fix build 198e6f212ed4 python312Packages.inform: 1.31 -> 1.32 ebec53b444cb mousai: 0.7.7 -> 0.7.8 9c3233afc41c graalvmCEPackages.graaljs: 24.0.1 -> 24.1.1 c6369bb94a6a nixos-containers: fix enableTun option (#357276) 27f4a1265a66 stl-to-obj: init at 0.3 5f7dc9c86936 katana: 1.1.0 -> 1.1.1 (#351915) 27618b26fe8f python3Packages.duet: disable failing test due to builder being too busy (#358371) 2a226b64c71f github-runner: fix test execution on build 91c994231cf4 myst-docutils: fix failure in amsmath test (#358446) b5d1a150678a khronos-ocl-icd-loader: 2024.05.08 -> 2024.10.24 (#354479) e02875dc3d83 rippled: fix build ae94b60d543b nixos/mackerel-agent: fix pkgs 8f1ab21c5d59 python312Packages.tencentcloud-sdk-python: 3.0.1269 -> 3.0.1270 d3b87ba53f99 python312Packages.sphinx-intl: 2.2.0 -> 2.3.0 (#355044) c1fb3d817b7d nixos/virtualisation: fix rendering of example in diskSize (#355944) f5ef8d61ee81 lazydocker: 0.23.3 -> 0.24.1 39be4840b9c3 kubeshark: 52.3.82 -> 52.3.89 (#355731) 9dfe674927c9 flashgbx: 4.2 -> 4.3 (#355787) 697143459c26 python312Packages.rich-click: 1.8.3 -> 1.8.4 (#355714) 088c7de656dc selinux-python: fix build (#358461) ec41e550bb7f ckan: 1.35.0 -> 1.35.2 (#355875) 613839482321 minify: 2.20.37 -> 2.21.1 (#356287) 561232db1556 fix format 9c4b9f2f99ea mopidy: make PipeWire a buildInput to add GStreamer dependency (#355922) 2659e6a0a935 python3Packages.setuptools-odoo: fix 34134be7a2db chickenPackages_5.chickenEggs.lowdown: fix build (#358455) 62d7ba173d58 python312Packages.gmqtt: 0.6.16 -> 0.7.0 (#358170) 6c81d58398ba linuxPackages.nvidiaPackages.beta.open: fix compatibility with linux 6.12 (#358047) ed651e06d9d4 prometheus-sabnzbd-exporter: 0.1.73 -> 0.1.78 (#358191) 3e2bc2e9593d vscode-extensions.mhutchie.git-graph: correct license 0f8228bc4065 Try to fix issue on Darwin 89ba4d2a77cf chickenPackages_5.chickenEggs.lowdown: fix build 861eae933e27 showmethekey: 1.16.0 -> 1.17.0 (#358082) 9e346f67c17b fwupd: 1.9.25 -> 2.0.1 2c60d1d87999 fwupd: format a9d40dfda5c4 open62541pp: 0.15.0 -> 0.16.0 070f5d08c0ca hyprwall: 0.1.8 -> 0.1.9 c26faf0c26de grumphp: fix build by changing vendorHash (#358395) d07378548249 selinux-python: fix build 1a05dd1d68fd wealthfolio: 1.0.18 -> 1.0.21 (#355939) 28c8e79c0d34 lock: init at 1.1.3 6e391940966f glaze: 4.0.0 -> 4.0.1 a6e1ae0d1150 myst-docutils: fix failure in amsmath test 3b52cd4c1bde desktopToDarwinBundle: fix 16x, 32x app icons 059ac8281d2c icnsutil: include pillow dependency 40b86283064a update aardvark-dns to version 1.13.1 (#357557) 1c005b9bf455 otree: init at 0.3.0 227433e39ba8 n98-magerun2: fix build by changing vendorHash cbb3cec851be doc/maven: document how to override maven attrs 3fdf84e853ef rep-gtk: fix build by ignoring clang errors (#358417) 695b7fde3aa8 orcania: fix build by ignoring clang errors (#358427) 4eccca90ee90 python312Packages.json-repair: 0.29.6 -> 0.30.2 (#357943) fff394da8854 drone-oss: 2.24.0 -> 2.25.0 (#357961) 2629bb467bd0 chickenPackages_5.chickenEggs.medea: fix build (#358365) 7702925ebdf8 lychee: 0.16.1 -> 0.17.0 (#358127) 8f3346fc6d14 fnm: 1.37.2 -> 1.38.1 (#358132) 04223e4113b1 dmarc-report-converter: refactor the package.nix (#351666) ca1f1341e0e0 google-play: 1.5.8 -> 1.6.3 a76cf1a3f4bc yarn-berry: 4.5.0 -> 4.5.2 (#358332) f524defde0f2 multiviewer-for-f1: 1.35.2 -> 1.36.2 296063131cd1 json2ts: fix build on darwin; allow case insensitive import (#358398) 26f2b6133cb7 Fix zug and lager builds on darwin (#358399) ea0fa359223e python312Packages.amqp: disable flaky test on darwin (#358392) 44b8e9d7a19a fcitx5-mellow-themes: init at 0-unstable-2024-11-11 (#355185) 20e65a18ed64 python312Packages.app-model: 0.3.0 -> 0.3.1 (#358237) 9338b7aadd5d libutp_3_4: 0-unstable-2023-11-14 -> 0-unstable-2024-11-16 (#358244) 888af184f97f zlog: fix build (#358363) 52adf0469dfd dotslash: 0.4.1 -> 0.4.3 (#358246) 473902e4f313 tfswitch: 1.2.3 -> 1.2.4 (#358319) 0b8cd831a11b bitrise: 2.22.0 -> 2.24.3 (#358348) 65e3a64b30c2 squeezelite: 2.0.0.1488 -> 2.0.0.1504 (#358354) 7d6f312bbcd7 uuu: 1.5.182 -> 1.5.191 (#358376) 657a6b2e29f9 terraform-providers.opennebula: 1.4.0 -> 1.4.1 (#358414) 7c661dfb804d terraform-providers.okta: 4.11.0 -> 4.11.1 (#358421) 75621e67f950 python312Packages.netbox-reorder-rack: 1.1.2 -> 1.1.3 5ab4bf722db3 kubesec: refactor b15cc65623d3 syncstorage-rs: 0.17.12 -> 0.17.15 (#358282) bcf111d08268 Add package sm64coopdx (#344305) a9867a8afb50 sarasa-gothic: 1.0.23 -> 1.0.24 (#357422) af436ba881d7 terraform-providers.fortios: 1.21.0 -> 1.21.1 (#358283) a507fe86c632 python312Packages.murmurhash: 1.0.10 -> 1.0.11 (#358301) ad8534e40749 cyrus-imapd.meta: fix wrong mainProgram 2dc2a5da9cb5 metasploit: 6.4.36 -> 6.4.37 f4c5bea9bd23 python312Packages.halohome: 0.5.0 -> 0.6.0 (#358304) 6aa7edd8c6ce python312Packages.app-model: update disabled 8f77bbf22956 gphoto2: Include upstream type cast fix as patch (#358431) 74d5eb6a966b cyrus-imapd: remove unused inputs fdaec3ebce09 mediawriter: 5.1.90 -> 5.2.0 (#358163) 960c72853a13 python312Packages.reptor: 0.23 -> 0.24 (#358182) 421fe9003522 cli-tips: init at 0-unstable-2024-11-14 (#355870) bea025042f8f home-assistant-custom-components.prometheus_sensor: 1.1.0 -> 1.1.2 (#353816) 2db55bdf7d34 zlog: fix build 8ac1f15e2c47 teal-language-server: dev-1 -> 0.0.5.1 (#356677) d9fa16a2e46e nss_latest: 3.106 -> 3.107 (#357986) 4d1e1e51d154 rep-gtk: fix build by ignoring clang errors 20db00824f87 orcania: fix build by ignoring clang errors e410f223fcc9 esphome: 2024.11.0 -> 2024.11.1 (#358018) f28080028925 cypress: add x86_64-darwin support (#357138) 63e4b90ebe91 python3Packages.pdf2image: fix providing of `poppler_utils` (#348783) ee25f3700313 gkraken,nixos/gkraken: Drop 03f063f5aff6 home-assistant-custom-component.epex_spot: 2.3.8 -> 2.3.9 (#358394) 77bb2a4e7960 python312Packages.libpwquality: fix build 90aeb519ef7a libpwquality: format a59253a50479 enscript: add meta.mainProgram (#357189) 8f0923a07dde mono: set meta.mainProgram (#358022) 9492bc8f7aa8 buildMavenPackage: add overrideMavenAttrs function 340d52007bf6 bibata-cursors: 2.0.6 -> 2.0.7 (#357706) be3424c6ee8f waveterm: fix hash mismatch (#357157) 9464799e8e37 python3Packages.django-storages: Enable one test 8f54153a332c addwater: init at 1.1.6 (#350254) 453d242b07d6 kdesvn: init at 2.1 (#357893) 3fd7ff572ddf nvtop: fix meta.platforms (#358415) 0776386a424c gphoto2: Include upstream type cast fix as patch 1b30c5fb9579 overturemaps: 0.9.0 -> 0.10.0 (#358141) cc6745aafcb1 warp-terminal: 0.2024.11.12.08.02.stable_02 -> 0.2024.11.19.08.02.stable_01 (#358149) 3dbaadcc5479 bash-env-json: init at 0.9.1 558df1d03ae1 terraform-providers.okta: 4.11.0 -> 4.11.1 ea9f234f68b1 deployer: fix build by changing vendorHash 30b3b966c70b nvtop: fix meta.platforms ae44597db596 terraform-providers.opennebula: 1.4.0 -> 1.4.1 fcdc4b97678b python312Packages.streamlit: 1.39.0 -> 1.40.1, cleanup dependencies (#357977) 2d248d1281a9 kanidm: 1.4.2 -> 1.4.3 (#358125) 993640ddaceb memtier-benchmark: fix hash mismatch e25ed78f2048 cinny-desktop: fix build failure (#357482) 4e305c3a5454 hyprlandPlugins.hyprscroller: 0-unstable-2024-11-09 -> 0-unstable-2024-11-23 c9a8698f80b7 nixos/etesync-dav: update default apiurl (#358373) aea7e7636da1 mdbook-alerts: 0.6.7 -> 0.6.10 (#357851) a67aa19da198 Merge master into staging-next 04f0c72e5956 nix-init: refactor with nixfmt-rfc-style, passthru.tests.version and removing darwin sdk (#356985) 71d5dab9f123 stackblur-go: init at 1.1.0 (#309117) 63068efb9704 python312Packages.treescope: 0.1.5 -> 0.1.6 (#358026) 75d107c276a5 lnav: reformat 5bbdfc101a38 imewlconverter: init at 3.1.1 (#354935) 16dc5bb9b79f open62541pp: init at 0.15.0 (#354879) ee0c8ed9123e vault-tasks: init at 0.4.0 (#354744) b292fd8aca08 google-cloud-sdk: fix gsutil (#358015) b9ec0c45f6b6 curtail: 1.11.0 -> 1.11.1 (#358370) 708ef463a8a9 lager: fix build on darwin 36f68a9471e1 json2ts: fix build on darwin; allow case insensitive import fc26d5c5649c mercury: add maintainer (#350011) 65a6fbf06392 git-cola: 4.8.2 -> 4.9.0 81e3acd7c478 zug: fix build on darwin 90190ac71c30 mercury: add vieta to maintainers 73c54cb3171b maintainers: add vieta ae8e51d81792 python312Packages.amqp: disable flaky test on 1c79f7f85262 python3Packages.mdp: drop (#356134) 66ecaffd13d2 offpunk: 2.3 -> 2.4 (#358387) 3ecfad3b771b postgresqlPackages.pgvecto-rs: 0.3.0 -> 0.4.0 (#357677) 0f0c673b42dc grumphp: fix build by changing vendorHash d7f2c8617119 moonlight-qt: fix build on x86_64-darwin (#358201) f66ed00555e3 gdal: disable flaky tests; fix darwin (#354783) e8e41d6f23dc offpunk: 2.3 -> 2.4 b26dcdde27d2 clanlib: 4.1.0 -> 4.2.0; methane: 2.0.1 -> 2.1.0 (#354481) 0d992c680b79 contour: 0.4.3.6442 -> 0.5.1.7247 (#353255) c5d7865d837e nixos/etesync-dav: update default apiurl f42d17fb0ecb python3Packages.measurement: 3.2.2 -> 4.0a8 (#356137) 6738af774721 libkazv: pin to libcpr_1_10_5 (#353997) 5904f8766b88 rogcat: init at 0.4.7 ed4d769d9ea1 openscad-unstable: 2024-11-10 -> 2024-11-18 5af83619bbf5 hyprland: 0.45.0 -> 0.45.2 ca2d99b1e028 python3Packages.django-ninja: 1.3.0 -> 1.3.0-unstable-2024-11-13 (#356206) 05e5594ea36f reposilite: 3.5.18 -> 3.5.19 4d1d9e9ba090 python3Packages.mdp: drop c786abfbd9f3 uuu: 1.5.182 -> 1.5.191 2a8cac1d474f blender: use numpy 1.x 5e2ac4cf3ecd python3Packages.brian2: fix build (#355662) a8a042fcf045 python package: duet: Remove failing test due to builder being too busy 29d19ea0228b libretro: refactor infrastructure (#357228) 4d775ee4327b graalvmCEPackages: add recurseIntoAttrs to callPackage call; maintainers/team-list: remove thiagokokada from graalvm-ce (#358135) acbc72187c71 libkazv: pin to libcpr_1_10_5 7208ddbb7a38 google-play: init at 1.5.8 (#349627) 2ca6859d93e8 curtail: 1.11.0 -> 1.11.1 3023aeb20a88 taizen: fix build (#356288) 464a260b7de9 dragmap: init at 1.3.0 (#309006) b468a08276b1 cargo-pgrx_0_12_0_alpha_1: remove 03a3e2acec4a postgresqlPackages.pgvecto-rs: run nixfmt 80e13b103225 postgresqlPackages.pgvecto-rs: 0.3.0 -> 0.4.0 dc1e6a5f3e19 cargo-pgrx: run nixfmt cdc84fdd5ef7 go9p: init at 0.25.0 (#357312) c8610bba9f2f cargo-pgrx_0_12_5: init b789043d3d95 vimPlugins.vim-nixhash: 2023-01-09 -> 2024-11-20 97a301595afa python312Packages.momepy: 0.8.1 -> 0.9.0 (#358322) fbbf8d36c267 chickenPackages_5.chickenEggs.medea: fix build a2052d759ac0 open-webui: 0.4.3 -> 0.4.4 (#358337) f34aac0ca93c patchance, raysession: fix pipewire compatibility (#353201) 419a5ca82ff7 taizen: fix build badf0750d44b openbsd_snmp3_check: fix overuse of with lib (#357242) c31f2feb342c manubulon-snmp-plugins: fix overuse of with lib (#357243) 476f3a140a6f check_interfaces: fix overuse of with lib (#357244) a54e87a25418 util-linux: fix FreeBSD build (#357471) a3e0c8cd6e93 pugl: fix x86_64-darwin build 66af7da8a696 desk-exec: init at 1.0.2 (#356280) 65b37917edec ocamlPackages.domain-local-await: fix darwin sandbox build aa33fe730061 ocamlPackages.ssl: fix darwin sandbox build fc094ec215ad biblioteca: init at 1.5 (#357841) ccd7474c9435 rubyPackages.ncursesw: 1.4.10 -> 1.4.11 (#357011) 7b4dbe2e6033 cbmc-viewer: init at 3.8 (#306266) cc707500a57f python312Packages.tensorly: unbreak (incorrect source hash) (#357704) 39e9566b3209 gurk-rs: add passthru.tests.version (#356356) 096089fe4785 squeezelite: 2.0.0.1488 -> 2.0.0.1504 1fb3496b1e54 nixVersions.latest: set to nix 2.25 (#357056) 1b1578268d4c apacheHttpdPackages.mod_tile: 0.7.1 -> 0.7.2 (#321406) 015c3112c0ac python311Packages.mozart-api: 4.1.1.116.0 -> 4.1.1.116.3 3e448c61b6fb python311Packages.aiopegelonline: 0.0.10 -> 0.1.0 5369acfb820f stu: 0.6.4 -> 0.6.5 (#358134) cf52ad3a0af1 bitrise: 2.22.0 -> 2.24.3 6deea16edca9 Merge: runInLinuxVM: fix for structured attrs (#354535) 223ff708c112 termbg: init at 0.6.0 6eda86c02fa7 python312Packages.docstring-parser: refactor 0c8d661707ee Merge: nixos/pgbouncer: rework RFC42 integration (#356965) cdc9f635c220 opencomposite: add meta.platforms (#357198) 206473584d1d kernelPackages.ivsc-driver: mark as broken on kernels >= 6.9 (#357033) cafb1b403a4d rubyPackages.ovirt-engine-sdk: set meta.broken (#356544) f5a27bfa74ea grails: 6.2.1 -> 6.2.2 8659f1bb9f7c python312Packages.pywerview: 0.7.0 -> 0.7.1 (#357799) fc8f58848e5b nixos/scx: cleanup 8ab204a201a5 python312Packages.halohome: refactor c23a93a31b2f python312Packages.azure-servicemanagement-legacy: 0.20.7 -> 0.20.8 (#357856) 27fc35352a14 python312Packages.azure-mgmt-appconfiguration: 3.1.0 -> 4.0.0 (#357859) 6aa7f496e9d5 python312Packages.yfinance: 0.2.49 -> 0.2.50 (#357876) 19de0e87bd10 knockpy: 7.0.1 -> 7.0.2 (#358096) 405bbcdd723c python312Packages.tencentcloud-sdk-python: 3.0.1268 -> 3.0.1269 (#358097) 98b4858b751e python312Packages.pysmi: 1.5.4 -> 1.5.9 (#358103) b739296b3242 python312Packages.mypy-boto3-*: updates (#358104) 65f296c84ae9 python312Packages.faraday-plugins: 1.19.1 -> 1.20.0 (#358105) 7426ad0c69a1 open-webui: 0.4.3 -> 0.4.4 3fa87fea6644 python3Packages.inject: init at 5.2.1 (#356609) 7e3f7b05f476 libxmlb: 0.3.20 -> 0.3.21 0b8b1b527370 python312Packages.click-odoo-contrib: 1.19 -> 1.20 cb0240eec72a vivaldi: 7.0.3495.6 -> 7.0.3495.18 70dd9c006f6b yarn-berry: 4.5.0 -> 4.5.2 3dc8daa6e116 cyan: 0.3.1-2 -> 0.4.0-1 e6c6a56f6456 teal-language-server: dev-1 -> 0.0.5.1 0967e2f2c518 tl: 0.15.3-1 -> 0.24.1-1 f7b46bfd5f41 lusc_luv: init at 4.0.1-1 488a41bcbcd9 etherguard: init at 0.3.5-f5 28d3bad9e500 Merge master into staging-next b03d0eda20ab libadwaita: 1.6.1 -> 1.6.2 d440628dda31 python312Packages.solarlog-cli: 0.3.2 -> 0.4.0 (#358323) 71527f55cd78 warp: move to pkgs/by-name 25a572885e00 warp: 0.7.0 -> 0.8.0 83f7f0c21772 go-ethereum: 1.14.11 -> 1.14.12 (#358106) 4c7b68f5d8ae python312Packages.solarlog-cli: 0.3.2 -> 0.4.0 9c6695c525eb python312Packages.momepy: 0.8.1 -> 0.9.0 ce9753254697 tfswitch: 1.2.3 -> 1.2.4 f6f10a28199d txtpbfmt: 0-unstable-2024-06-11 -> 0-unstable-2024-11-12 950205b1cd50 flutter_volume_controller: remove unused input 1a5c76167922 sacc: fix Darwin build (#358095) 05cf591edb4c vuze: drop (#358309) d25befdbcf8f unciv: 4.14.5-patch1 -> 4.14.9 268ae6a302b0 vuze: drop 8b81bddc76dd paperless-ngx: fix tests with OCRmyPDF 16.6 9dfbe512437e python312Packages.ocrmypdf: 16.5.0 -> 16.6.2 7ef33d8610e9 pantheon.granite7: 7.5.0 -> 7.6.0 12cb286d9a40 impression: 3.2.0 -> 3.3.0 373134e69213 pantheon.wingpanel-quick-settings: 1.0.0 -> 1.0.1 d2c8c3a358c9 python312Packages.forecast-solar: 3.1.0 -> 4.0.0 (#357438) 7986f15e98e3 pantheon.elementary-camera: 8.0.0 -> 8.0.1 a695a6183f56 magnetic-catppuccin-gtk: 0-unstable-2024-06-27 -> 0-unstable-2024-11-06 a112c12b61f8 Pantheon updates 2024-11-21 (#357882) c2d06847548e python312Packages.halohome: 0.5.0 -> 0.6.0 d92e4e2f270b duti: update to new darwin SDK pattern (#357745) 92222bebc30c trunk-io: 1.3.2 -> 1.3.4 9f4511da1a65 trunk-io: format with nixfmt 6d1e1e14cc42 kazumi: 1.4.3 -> 1.4.4 773ebf1f3742 scx: 1.0.5 -> 1.0.6; build all rust subpackages together (#358154) c92e61cbc797 starlark: 0-unstable-2024-05-21 -> 0-unstable-2024-11-19 e5a4768ebace python312Packages.murmurhash: 1.0.10 -> 1.0.11 b350a5de72ce starlark: format with nixfmt 99bcd6175358 txtpbfmt: format with nixfmt ed8e72640cb2 duti: update to new darwin SDK pattern 0d509f76348d sqlitestudio: 3.4.4 -> 3.4.5 (#357760) 9765b57a8bac python312Packages.django-markup: 1.9 -> 1.9.1 (#358290) b5f4eca83781 goread: 1.6.5 -> 1.7.0 9570c6a8f3d4 python312Packages.django-markup: 1.9 -> 1.9.1 029b8c50ea3f coolercontrol.*: nixfmt, drop meta-wide "with lib" 0dc339e10aa9 libkrun: 1.9.6 -> 1.9.8 bf332f885a7a nushellPlugins.skim: 0.8.0 -> 0.9.1 4e54bbdea18a nixos/activation: Add pre-switch checks (#236375) 5177bf330e11 ufetch: init at 0.3 bd772a88471a terraform-providers.fortios: 1.21.0 -> 1.21.1 41153887f033 libsecret: use python3Packages instead of python3.pkgs to fix cross compilation (#347441) 80dd5c18b78c terraform-providers.ibm: 1.70.0 -> 1.71.2 f4b2154d3ec4 syncstorage-rs: 0.17.12 -> 0.17.15 f9a652fbecb2 duplicity: 3.0.2 -> 3.0.3.1 (#358259) 76c9e6b5a195 turtle: 0.10 -> 0.11 30626227b08a bign-handheld-thumbnailer: init at 1.1.1 ae6f2c441777 Merge master into staging-next 3650335dcb40 coolercontrol.*: 1.4.0 -> 1.4.4 7eb0c197fbdc frigate: coral tpu support, audio model, nvidia ffmpeg hwaccel, other fixes (#357717) 82bb9f42b9d9 bitwarden-cli: 2024.9.0 -> 2024.11.0 21e00d7f2f6f velero: 1.14.1 -> 1.15.0 (#354461) 1dc36f17313f lcov: 2.1 -> 2.2 (#354788) 922ba1fed20e plfit: 0.9.6 -> 1.0.0 (#357921) 38655c535700 fltk: do not propagate fontconfig (#357470) 728fc11ae93a codeberg-pages: 5.1 -> 6.1 53b69fd41c15 samba: add pkgsCross.aarch64-multiplatform.samba to passthru.tests 9e5d4b3b17da python312Packages.qt5reactor: disable 14d30c5f9a40 delfin: 0.4.7 -> 0.4.8 ba1cb7c8e0be python312Packages.pyhanko: 0.25.1 -> 0.25.3 (#357713) 53fb28e0f55a cpuinfo: 0-unstable-2024-09-26 -> 0-unstable-2024-11-14 a02982617844 python312Packages.ray: 2.38.0 -> 2.39.0 (#357548) 7df67599ea83 nixos/prometheus-postfix-exporter: add package option and format b34206cb7cca homer: init 24.11.4 (#354293) 869c1dda1081 duplicity: 3.0.2 -> 3.0.3.1 6229cb20ccf3 aactivator: init at 2.0.0 0e4de9bc5099 maintainers: add keller00 72f688496625 vscode-extensions.jetmartin.bats: init at 0.1.10 (#357529) dbd615ab069a gitlab-ci-local: 4.53.0 -> 4.55.0 d84ee239fef9 gleam: 1.5.1 -> 1.6.1 (#357974) 988b26f3eef6 homer: init 24.11.4 9e34cf9fd0c4 rabbit: 2.2.0 -> 2.3.1 (#357922) 9de9b82e2063 open-webui: 0.3.35 -> 0.4.3 (#357540) 710b3ec00b83 netbird: 0.32.0 -> 0.33.0 2f204ba2e478 maintainers: update DataHearth's GPG fingerprint efad6261977a tesseract: 5.3.4 -> 5.5.0 494d5c1958a9 pytesseract: disable tests broken on tesseract 5.5.0 d9b7db22c1dd home-assistant: 2024.11.2 -> 2024.11.3 (#358242) 8a8e88fd9d9f dotslash: 0.4.1 -> 0.4.3 daccfd63916b mollysocket: 1.5.2 -> 1.5.3 352f462ad9d2 {qt5,qt6}: remove overrideScope' errors 89981f1968f2 singularity: remove deprecated arguments 6646eeb500ee makeSetupHook: remove deprecated deps argument 51da8b6b00c2 writeReferencesToFile: remove 15db220b93d9 lib.systems.examples: set `rust.rustcTarget` for ucrtAarch64 (#357847) 0b2d9d53e254 ocamlPackages.merlin-extend: 0.6 → 0.6.2 (#358077) 9480c8be07f5 nixos/scx: remove dead reference to scx.rustland 5236e4e46cb2 home-assistant-custom-lovelace-modules.mushroom: 4.1.1 -> 4.2.0 a08c650eb557 scx: add aarch64-linux to badPlatforms 41ee6d013b54 ugrep: 7.0.3 -> 7.1.0 495b303a1b55 libdeltachat: 1.148.7 -> 1.150.0 565a5a081651 deltachat-desktop: pin deltachat-rpc-server ad02ccaae2c2 zed-editor: 0.162.3 -> 0.162.5 (#358197) 1d1234babf67 libutp_3_4: 0-unstable-2023-11-14 -> 0-unstable-2024-11-16 65fc9cab6b7b linuxPackages.nvidiaPackages.vulkan_beta: 550.40.79 -> 550.40.80 4beb2224c385 chez: 10.0.0 -> 10.1.0 (#356057) 3719805988f4 just: 1.36.0 -> 1.37.0 (#358069) 8f01ef142420 python312Packages.app-model: 0.3.0 -> 0.3.1 e63248fa8929 python312Packages.homeassistant-stubs: 2024.11.2 -> 2024.11.3 1f32e11a1899 home-assistant: 2024.11.2 -> 2024.11.3 8171128674e3 jellyfin{,-web}: 10.10.2 → 10.10.3 a65119508bd2 television: 0.5.0 -> 0.5.1 (#358151) 6ead5e70c054 passepartui: init at 0.1.4 6a9900c19feb mpris-timer: init at 1.0.2 328ebf20943c nixos/containerd: load after `local-fs.target` & `dbus.service` 711aab6d45fc containerd: add cross compilation tests 3f48f68ef056 containerd: conditionally build manpages 0422fd66356a containerd: add getchoo to maintainers 845831e7822f docker: only install containerd binaries eb399ae2b222 containerd: add meta.mainProgram 514c2e583573 containerd: split outputs 5fe62be1168b containerd: add override for btrfs support 429c01fff2ab containerd: add updateScript 7d3a899c1054 containerd: use best practices 5db7ee741022 containerd: use standard attributes for make d697b384d57a containerd: 1.7.23 -> 2.0.0 2939d2142711 kid3: 3.9.5 -> 3.9.6 (#357846) 39a771d25180 meshoptimizer: 0.21 -> 0.22 (#355560) 9e9774ee89f3 containerd: format with nixfmt ecd6e1eed151 nixos/netbird: fix port conflict on metrics endpoint (#357105) 97ed6b4565e7 runInLinuxVM: fix for structured attrs 8f89eb9e52fa linux_xanmod_latest: 6.11.9 -> 6.11.10 b9cad2207698 linux_xanmod: 6.6.62 -> 6.6.63 9d9c9b1bfdf8 OWNERS: Add azuwis to .github/workflows (#358165) b10effcf0fb7 scx.full: 1.0.5 -> 1.0.6 6a0186a14d5e scx.full: add passthru.updateScript b284c986f129 scx: refactor derivation f1623a720d9f signal-desktop(darwin): 7.33.0 -> 7.34.0 48f14f056214 signal-desktop: remove unused `callPackage` 3aed0c6941ce signal-desktop: format with nixfmt b9a39f9e79ce signal-desktop: add myself to maintainers 14b412b91816 signal-desktop(aarch64-linux): 7.33.0 -> 7.34.0 04b54626656b signal-desktop: 7.33.0 -> 7.34.0 49035161b9ab font-awesome: 6.6.0 -> 6.7.1 (#357127) 5aa904b61e7c nixos/mautrix-telegram: use ffmpeg-headless instead of ffmpeg-full eeed5c04c92b dmarc-report-converter: add checkFlags to run the unittests 4449484156e8 dmarc-report-converter: replace custom test with testers.testVersion eafc83d37d11 dmarc-report-converter: remove with statements 86ad92070cbf dmarc-report-converter: format with nixfmt 2cf18cc6c0f7 jruby: 9.4.8.0 -> 9.4.9.0 1967d5fdcf47 azure-static-sites-client: 19449a00c0269fefc8f29a6d01801c4b19308181 -> 53b7d0e07fe5c34bf68929fab92f87ce910288dc f197f54f7943 Merge master into staging-next 20c5d9222a90 isl_0_17: drop 86b5f88a2f39 {gcc8{,Stdenv},gfortran8}: drop a5bc2142537d qmk: use the default GCC version for AVR d3d474e85c62 {gcc7{,Stdenv},gfortran7}: drop ac283f30a585 gcc: remove GCC < 7 detritus 811c0af5f59b dcgm: 3.3.5 -> 3.3.9; cudaPackages_10{,_0,_1,_2}: drop (#357655) 7baa9f1e15b7 libdeltachat: use fetchCargoVendor (#357358) a5fb39cb8754 await: 1.0.5 -> 1.0.7 89b870bfb6a3 meshoptimizer: add bouk to maintainers (#358198) 2d31028ce6e3 jetbrains.clion: fix .NET version for Clion 2024.3 73945d013599 organicmaps: 2024.09.08-7 -> 2024.11.12-7 ad79ca02ec87 Merge: phpExtensions.soap: re-add soap patch (#358196) 4255d7a658c0 nixos/archisteamfarm: remove dataDir fallback e1e2193dff27 nixos/pipewire: remove version reference from warning message 8bdfc5eca22d nixos/screen: remove assertion 9966353ee7cd nixos/garage: remove assertions 749a6fe1adb3 nixos/zigbee2mqtt: remove renamed-option warning de69ff528bb5 nixos/lib/make-options-doc: remove optionsDocBook 73df63f8ef1e lib/options: remove mdDoc a5d52b7a45df bun: run post hooks after patchelf 14ac480f28a8 python312Packages.strawberry-graphql: 0.243.1 -> 0.251.0 (#357872) ad06fc936dd5 nixos/victoriametrics: check config, more tests, update desc 591ebd39fb05 frigate: patch path to birdseye graphic 1c07d9209955 nixos/frigate: allow configuring a libva driver 7411b8562915 nixos/frigate: allow GPU use for video acceleration 2b56a916ca59 nixos/frigate: use shellscript to clear frigate cache a810c07ff275 nixos/frigate: inherit required functions from lib 81001625a7a7 linuxPackages_latest.gasket: fix build with 6.12 7e33e470df5d nixos/frigate: provide ffmpeg-full for nvidia hw accel 4abc3dfc2811 frigate: provide the tflite audio model d31bf00e2baf nixos/frigate: stop enabling recommendedProxySettings globally b96c4a67b9b8 nixos/frigate: add support for Coral devices 2b2a669741df nixos/coral: init 1fd02d90c6c0 heroic: fix cursor issues (#358010) 8acb39b5a75c meshoptimizer: add bouk to maintainers d233eb89118b zed-editor: 0.162.3 -> 0.162.5 ab6c0b73558f phpExtensions.soap: re-add soap patch 9461bfbeea1b Kernel updates for 2024-11-22 (#358167) 9bd6a6b49710 prometheus-sabnzbd-exporter: format with nixfmt-rfc-style 832aeacb1851 bililiverecorder: 2.12.0 -> 2.13.0 46d6088267f8 rekor-cli: 1.3.6 -> 1.3.7 (#358062) 43988cfb991a kubesec: 2.14.1 -> 2.14.2 05bfa822d6d4 kubesec: format 8ed6119fbbcd prometheus-sabnzbd-exporter: Add nixosTests to passthru.tests 25bd3f097195 bun: fix missing symbol crash on macOS 12 07a431c62f30 bun: fix hanging build on x86_64-darwin 964bdaac3057 lzfse: modernize derivation (#348766) aa57d29b009d signal-desktop: move to `pkgs/by-name` 3b072fe4cd0e python312Packages.reptor: 0.23 -> 0.24 0b8c0c5467b4 prometheus-sabnzbd-exporter: 0.1.73 -> 0.1.78 d04595402d1e samba: set correct pythondir f9f571f5d107 samba: resurrect cross compilation patch 6520fb92dc03 OWNERS: Add azuwis to .github/workflows aa0a26280dbc libedgetpu: use dedicated coral group 652d9def63a5 fire: Move to pkgs/by-name d63d41ffd4fc opentofu: 1.8.5 -> 1.8.6 f5afe5b45254 fire: Modernise, nixfmt b8c9d52b8465 fire: 1.0.0.3 -> 1.0.1-unstable-2024-10-22 b9dec6d59f54 nixos/test-driver: apply ruff check suggestions (#358150) 2995b3825e14 nixos/pgbouncer: rework RFC42 integration f3ea13c87991 jetbrains.rider: Use unwrapped location of sdk 172a35f8ce8d nixos/test-driver: target python 3.12 5b5f018586e7 ruff: add nixosTests.nixos-test-driver.busybox to passthru.tests e23f1733c6fc nixos/test-driver: use ruff format in place of black ef2d3c542a89 nixos/test-driver: modernize 42d4046e94dc nixos/test-driver: format with nixfmt b25360a7e552 nixos/test-driver: apply ruff check suggestions 6ed14b40743f nodePackages.jsonlint: add meta.mainProgram f6d43fcff88a proxmark3: 4.18994 -> 4.19552 9069a281a73b python312Packages.cffsubr: reset meta.broken (#358144) 2ab676bc4cea python312Packages.gmqtt: 0.6.16 -> 0.7.0 2f84e7307d07 linux_6_1: 6.1.118 -> 6.1.119 0bbb3937269b linux_6_6: 6.6.62 -> 6.6.63 5c617efdc8c3 linux_6_11: 6.11.9 -> 6.11.10 2f9f2895cf1a linux_6_12: 6.12 -> 6.12.1 e4c8127a4f91 moonlight-qt: fix build on x86_64-darwin f58a54e64ab8 Merge: lnav: 0.12.2 -> 0.12.3 (#358117) fbc630fc15b1 dexed: Move to pkgs/by-name 01d2807d896b Merge: nixos/postgresql: update docs with extraPlugins to extensions rename (#358159) f3110c93dcb7 Merge: cargo-pgrx: drop obsolete versions (#357670) 4ffa98835d06 dexed: Modernise, nixfmt 395f2e303119 mediawriter: 5.1.90 -> 5.2.0 3f8bf41b9378 dexed: unstable-2022-07-09 -> 0.9.8 17b91ea65213 remnote: 1.16.127 -> 1.17.21 (#357959) e09d531013f2 tsukimi: 0.16.9 -> 0.17.3 (#357894) 3156de49baad nixos/postgresql: update docs with extraPlugins to extensions rename 8bb356dda993 gscan2pdf: 2.13.3 -> 2.13.4 d45cc1f9005e gcsan2pdf: pin tesseract version 2daa4abaf95b algia: init at 0.0.74 (#324971) 4cf5dc8ecf8e wgnlpy: init at 0.1.5 (#281134) 83232efb417c keycloak: 26.0.5 -> 26.0.6 0b43f970ec55 arduino-cli: 1.1.0 -> 1.1.1 695022dedc3d ferdium: 6.7.7 -> 7.0.0 (#357526) c8318492ca92 arduino-cli: 1.0.4 -> 1.1.0 8171d5b3a676 television: 0.5.0 -> 0.5.1 fb9d2d5f7d86 warp-terminal: 0.2024.11.12.08.02.stable_02 -> 0.2024.11.19.08.02.stable_01 323b64d759c5 add actionlint script and fix linting errors (#358087) 2b1d10717f6e python312Packages.apsystems-ez1: 2.3.0 -> 2.4.0 (#358129) 398c3278bc2c python312Packages.reolink-aio: 0.11.1 -> 0.11.2 (#358094) 6b30f651769d soplex: 7.1.1 -> 712 (#357936) 0da0c943bef4 supermariowar: 2023-unstable-2024-09-21 -> 2023-unstable-2024-10-17 (#357948) d84c2c8a1f7a antimatter-dimensions: 0-unstable-2024-08-12 -> 0-unstable-2024-10-16 (#357958) 32a6049ad5fc ocamlPackages.menhir: support --suggest-menhirLib 948fbac0d32e python312Packages.cftime: 1.6.4 -> 1.6.4.post1 (#357996) 936c762b8e8c tesseract: add patrickdag as maintainer ff51f58e1d14 tesseract: format ee2d6d1ea425 nix-init: remove unnecessary darwin sdk 26cea2436d94 nix-init: add passthru.tests.version b128929035da nix-init: format with nixfmt-rfc-style 0767ddbcf51b gh-i: 0.0.8 -> 0.0.10 (#358037) a45df1faaf7b goose: 3.22.1 -> 3.23.0 (#358038) 467cc1c91861 treewide: remove AndersonTorres from some packages' meta.maintainers (#358027) 2f5bba6041ec nomino: 1.3.5 -> 1.3.6 (#358064) 70b6609a243f kubedock: 0.17.0 -> 0.17.1 (#358067) 16a3151bcb8f python312Packages.cffsubr: reset meta.broken 1606cbd447b5 python312Packages.pyenphase: 1.22.0 -> 1.23.0 (#358068) ad62813bfe59 python312Packages.datadog: 0.50.1 -> 0.50.2 (#358081) 6e4c4dbd46ca nuclei: 3.3.5 -> 3.3.6 (#358083) 1c222fb7e14e superfile: 1.1.5 -> 1.1.6 (#358084) e3dc6e4445d3 plattenalbum: 2.2.0 -> 2.2.1 (#358102) ea103a02af2b libstroke: fix build with gcc14 13c5dc6e5280 darcs-to-git: 0-unstable-2024-09-30 -> 0-unstable-2024-11-07 (#358121) be4eaf60abc3 hysteria: 2.5.2 -> 2.6.0 (#358124) a0ab362d5a09 lychee: 0.16.1 -> 0.17.0 4493f3b342f7 python312Packages.accuweather: update disabled, drop with lib (#358139) 3b603722f9eb fnm: 1.37.2 -> 1.38.1 ac1dbe26e206 stu: 0.6.4 -> 0.6.5 3934cda54d13 fossil: 2.24 -> 2.25 (#357155) 489a187705df python312Packages.jianpu-ly: init at 1.801 (#328894) 73c5cd5f929b librenms: add netali to maintainers 09c32b486373 librenms: 24.9.1 -> 24.10.1 4d832756997c python312Packages.accuweather: update disabled, drop with lib bf6aefce63b7 python312Packages.edk2-pytool-library: 0.22.2 -> 0.22.3 (#358089) 34220446ae6a python312Packages.restview: 3.0.1 -> 3.0.2 (#357873) f887e8915cf0 python312Packages.plotnine: 0.14.1 -> 0.14.2 (#358013) f8f4b5c88376 overturemaps: 0.9.0 -> 0.10.0 9f14e44d4e58 starpls: 0.1.14 -> 0.1.15 (#349717) 12e66587fe43 python312Packages.slack-bolt: fix on darwin; clean c104826f0cf9 python312Packages.slack-sdk: 3.33.3 -> 3.33.4 55bcff938bd8 fvwm3: remove libstroke from buildInputs 0e95987a6bc5 miru: 5.5.8 -> 5.5.9 (#357984) bf7a26d43f9a arc-browser: 1.69.0-55816 -> 1.70.0-56062 (#357994) eeb87082a9c5 add actionlint script 2adf40958121 ci/check-nixf-tidy: replace sed with variable substitution c7f43f2d7c9e maintainers/team-list: remove thiagokokada from graalvm-ce 1757f8a24f1f graalvmCEPackages: add recurseIntoAttrs to callPackage call 4c7a95cac9e8 linuxKernel.packages.linux_6_11.evdi: set broken for kernel >= 6.12 (#357624) c83af730d63e operator-sdk: 1.37.0 -> 1.38.0 (#357679) e8c9fa5bc83a plausible: 2.0.0 -> 2.1.4 8b14b5156649 openai-whisper-cpp: 1.7.1 -> 1.7.2 (#357700) 0ce35d30142c snis: update to the newest commits and add assets (#338667) baa412f46dc8 nixos/kanidm: allow origin url ending without slash (#355216) b51fd13e16f2 scx.cscheds: split into multiple outputs d285c731edc0 scx.cscheds: let it fetch it's own libbpf 67fd9cc23ac3 ecapture: 0.8.9 -> 0.8.10 (#357714) 219b984dfe32 python312Packages.apsystems-ez1: 2.3.0 -> 2.4.0 7b64d9a30484 python312Packages.bluetooth-adapters: 0.20.0 -> 0.20.2 (#357827) 9ef587a97727 python3Packages.pyvex: fix cross (#354109) 1af1932b3695 Merge: php84: 8.4.0RC4 -> 8.4.1 (#357904) 0c6e6d27815a Merge master into staging-next 02aa685f17c1 ruff: 0.7.4 -> 0.8.0 (#358120) 0bdc21db7b5e ocamlPackages.typerep: 0.17.0 → 0.17.1 (#357929) ef58cadcd0c5 python312Packages.ruff-lsp: 0.0.58 -> 0.0.59 9ae96cf560a1 kanidm: 1.4.2 -> 1.4.3 369019355665 piped: init at 0-unstable-2024-11-04 7eefb31cd135 php84Extensions.apcu: 5.1.23 -> 5.1.24 a3c2ca52b611 hysteria: 2.5.2 -> 2.6.0 6b816b8d2f61 darcs-to-git: 0-unstable-2024-09-30 -> 0-unstable-2024-11-07 c10dc1d3c07d kdesvn: init at 2.1 d403617d1876 ruff: 0.7.4 -> 0.8.0 03c702d21153 lnav: 0.12.2 -> 0.12.3 494f142f79c3 lnav: add updateScript bc7da8107fc8 vscode-extensions.chanhx.crabviz: init at 0.4.0 1f8150661e78 nixos-rebuild-ng: improve developer experience (#356468) ef3c223fdbec libretro: add 0-prefix before version 967dae48b218 libretro: update README.md d8c5c5e001a0 libretro.cores: clean-up, remove update_cores.py script b57fd97854c2 libretro.yabause: move to retroarch/cores a994304cda56 libretro.virtualjaguar: move to retroarch/cores 0c15ac65d46b libretro.vecx: move to retroarch/cores 52d42220c359 libretro.vba-next: move to retroarch/cores 55c673765c27 libretro.vba-m: move to retroarch/cores 9455b06a10aa libretro.twenty-fortyeight: move to retroarch/cores 0ea40e12d79d libretro.tic80: move to retroarch/cores dec2549c0c27 libretro.thepowdertoy: move to retroarch/cores dce5b44ed781 libretro.tgbdual: move to retroarch/cores 35a15946800b libretro.swanstation: move to retroarch/cores 0d5079de2d81 libretro.stella2014: move to retroarch/cores 5d49f432a20a libretro/stella: move to retroarch/cores 5819c9c742a8 libretro.snes9x2010: move to retroarch/cores 933b4db84b5a libretro.snes9x2005{,-plus}: move to retroarch/cores 6ea1c0b4142d libretro.snes9x2002: move to retroarch/cores e96e989b2651 libretro.snes9x: move to retroarch/cores e07d0ce6f693 libretro.smsplus-gx: move to retroarch/cores 9c470f7502c8 libretro.scumvmm: move to retroarch/cores ba77247b37f6 libretro.same_cdi: move to retroarch/cores 5674d17def50 libretro.sameboy: move to retroarch/cores bdd38425123d libretro.quicknes: move to retroarch/cores 9c4bcd0e97c8 libretro.puae: move to retroarch/cores eb45df7d86ba libretro.prosystem: move to retroarch/cores aa75a15f56b2 libretro.prboom: move to retroarch/cores 215e0d401257 libretro.ppsspp: move to retroarch/cores 46ab30c61f7b libretro.play: move to retroarch/cores 6defc5ebb787 libretro.picodrive: move to retroarch/cores 54b719f02d11 libretro.pcsx-rearmed: renamed from pcsx_rearmed, move to retroarch/cores bbb92a0b2700 libretro.pcsx2: move to retroarch/cores 1556d2c6de2b libretro.parallel-n64: move to retroarch/cores e1dcc59e2868 libretro.opera: move to retroarch/cores 45d04e07a4d2 libretro.o2em: move to retroarch/cores d9c95ab53e4d libretro.np2kai: move to retroarch/cores b336ab6fa3a8 libretro.nxengine: move to retroarch/cores 6f50f7cd46b2 libretro.nestopia: move to retroarch/cores baa6a603be37 libretro.neocd: move to retroarch/cores 87c06feb0129 libretro.mupen64plus: move to retroarch/cores 418e94858835 libretro.mrboom: move to retroarch/cores c6f6b7bd4a11 libretro.mgba: move to retroarch/cores 13130827a8a4 libretro.meteor: move to retroarch/cores 0d96487b3326 libretro.mesen-s: move to retroarch/cores 87fbbb55802b libretro.mesen: move to retroarch/cores bd99bc46159b libretro.melonds: move to retroarch/cores 21a3d16115a6 libretro.mame2016: move to retroarch/cores 45e8e2e77977 libretro.mame2015: move to retroarch/cores 3bb5ff0ceb41 libretro.mame2010: move to retroarch/cores 5dab5710c5c1 libretro.mame2003-plus: move to retroarch/cores 2aff23484753 libretro.mame2003: move to retroarch/cores 1d0c291d0dec libretro.mame2000: move to retroarch/cores fcd77c39f033 libretro.mame: move to retroarch/cores 35ec5e76a0bc libretro.hatari: move to retroarch/cores 7cc0ad3bf932 libretro.handy: move to retroarch/cores 7fa34b63f8d4 libretro.gw: move to retroarch/cores d5623dc94a8f libretro.gpsp: move to retroarch/cores c887658db423 libretro.genesis-plus-gx: move to retroarch/cores 7d2f1f1ce1f4 libretro.gambatte: move to retroarch/cores 893a1384e45d libretro.fuse: move to retroarch/cores 225b5a48769b libretro.freeintv: move to retroarch/cores 4724ea1666cd libretro.fmsx: move to retroarch/cores f66bd675c48a libretro.flycast: move to retroarch/cores 1e7e62c52a45 libretro.fceumm: move to retroarch/cores b3de16f47c4f libretro.fbneo: move to retroarch/cores c0433e2a9cae libretro.fbalpha2012: move to retroarch/cores 880d3c566527 libretro.eightyone: move to retroarch/cores 980add9eb94d libretro.easyrpg: move to retroarch/cores 12a9521009bc libretro.dosbox-pure: move to retroarch/cores 61c780f7b83c libretro.dosbox: move to retroarch/cores 41a7b6c5a85d libretro.dolphin: move to retroarch/cores a9249a3beac1 libretro.desmume2015: move to retroarch/cores 2c54c27cbe77 libretro.desmume: move to retroarch/cores 3f0e78e5b891 libretro.citra: unstable-2024-01-24 -> unstable-2024-04-01, move to retroarch/cores 813002b41134 libretro.bsnes-mercury{,-balanced,-performance}: move to retroarch/cores aac2ac2dbc0b libretro.bsnes-hd: move to retroarch/cores 5d6b38132087 libretro.bsnes: move to retroarch/cores ee8af6d04a6f libretro.bluemsx: move to retroarch/cores 573e6d71af33 libretro.blastem: move to retroarch/cores 4b51fe0a4966 libretro.beetle-wswan: move to retroarch/cores 8a29897d5f88 libretro.beetle-vb: move to retroarch/cores 72140b806d9d libretro.beetle-supergrafx: move to retroarch/cores ba415c8b021f libretro.beetle-supafaust: move to retroarch/cores 53e34f072109 libretro.beetle-saturn: move to retroarch/cores 174f6501e10c libretro.beetle-psx{,-hw}: move to retroarch/cores dc0eba7c0ddb libretro.beetle-pcfx: move to retroarch/cores 36ec2ddc20af libretro.beetle-pce-fast: move to retroarch/cores a00a3734e052 libretro.mednafen-pce: move to retroarch/cores 1066bbd6a401 libretro.beetle-ngp: move to retroarch/cores 9ead44754bdc libretro.beetle-lynx: move to retroarch/cores 36b0d8f9ece3 libretro.beetle-gba: move to retroarch/cores 654cf1989a19 libretro.atari800: unstable-2024-10-01 -> 0-unstable-2024-10-31, move to retroarch/cores 205b85c7dee8 libretro: make it a scope cbccc5f19595 akkuPackages.*: add an 'akku-' prefix to the package names (#346987) ba168748eb5b Merge: grafana: 11.3.0+security-01 -> 11.3.1 (#357417) 6a3316999d2d vscode-extensions.ionic.ionic: init at 1.96.0 (#350197) 4ba6843e51d9 Merge: Updates for Linux Hardened Kernels 2024-11-21 (#357920) a78684df8483 addwater: init at 1.1.6 7804c4d241c0 go-ethereum: 1.14.11 -> 1.14.12 a25e476c6a35 nixos/netbox: clear old static files on upgrade (#354036) 362df5e3cf27 python312Packages.pysmi: 1.5.4 -> 1.5.9 015760bf02e1 plattenalbum: 2.2.0 -> 2.2.1 8f5a6dd7b620 signal-desktop-beta: drop (#357587) 6a134a888ad4 python312Packages.mypy-boto3-xray: 1.35.0 -> 1.35.67 d3bb3b156344 python312Packages.mypy-boto3-ssm: 1.35.21 -> 1.35.67 d13b4947612e python312Packages.mypy-boto3-s3: 1.35.61 -> 1.35.67 a5c155d7c819 python312Packages.mypy-boto3-resiliencehub: 1.35.41 -> 1.35.67 c811fe9e2401 qidi-slicer-bin: init at 1.2.0 (#337224) 958ada22f0ed python312Packages.mypy-boto3-logs: 1.35.54 -> 1.35.67 9d7eb9671236 python312Packages.mypy-boto3-lambda: 1.35.66 -> 1.35.67 d4c487067317 python312Packages.mypy-boto3-iotfleetwise: 1.35.51 -> 1.35.67 2e2a7838820e python312Packages.mypy-boto3-iot-jobs-data: 1.35.0 -> 1.35.67 cc5ecbca2e40 python312Packages.mypy-boto3-iot: 1.35.63 -> 1.35.67 751e13313695 python312Packages.mypy-boto3-health: 1.35.0 -> 1.35.67 328d46650d62 python312Packages.mypy-boto3-elbv2: 1.35.66 -> 1.35.67 244fafddce98 python312Packages.mypy-boto3-elasticache: 1.35.36 -> 1.35.67 d2187dace25e python312Packages.mypy-boto3-ec2: 1.35.66 -> 1.35.67 f8416b62767c python312Packages.mypy-boto3-cloudtrail: 1.35.60 -> 1.35.67 9e968dd14ac4 python312Packages.mypy-boto3-cloudfront: 1.35.66 -> 1.35.67 b0d71d72d322 python312Packages.mypy-boto3-ce: 1.35.22 -> 1.35.67 b808ad854a09 python312Packages.mypy-boto3-appsync: 1.35.52 -> 1.35.67 f361b678346e python312Packages.mypy-boto3-application-autoscaling: 1.35.0 -> 1.35.67 ec6e7e47abcf python312Packages.mypy-boto3-apigateway: 1.35.25 -> 1.35.67 23e8294cdfc3 nph: fix build with nim-2.0 (#357703) 83116f631e0b python312Packages.faraday-plugins: 1.19.1 -> 1.20.0 e35cabfdd608 knockpy: 7.0.1 -> 7.0.2 7cf5fb2d53a3 qtscrcpy: switch to latest ffmpeg (#357575) fe2b858f1f14 gitify: init at 5.16.1 (#338744) fbf13b57e0e2 sacc: fix Darwin build a31265c0dfb0 python312Packages.restview: refactor 444cd38396e1 tplay: 0.5.0 -> 0.6.0 (#354940) 15e63114eefc python312Packages.tencentcloud-sdk-python: 3.0.1268 -> 3.0.1269 714edad78183 python312Packages.reolink-aio: 0.11.1 -> 0.11.2 f31a0f3ac17a python312Packages.azure-servicemanagement-legacy: 0.20.7 -> 0.20.8 4c1bfb83b092 biblioteca: init at 1.5 475e5aa20bec Merge: nextcloud: add news app (#357640) d2c1254ba997 aardvark-dns: 1.13.0 -> 1.13.1 6416e8b57085 open-webui: 0.3.35 -> 0.4.3 8f28bd7f1bb1 mdk-sdk: 0.29.1 -> 0.30.0 (#354751) 26963eeeb35e python312Packages.edk2-pytool-library: 0.22.2 -> 0.22.3 19b6c8ec2b25 python312Packages.azure-mgmt-appconfiguration: 3.1.0 -> 4.0.0 68b17deddaab python312Packages.google-cloud-redis: 2.16.0 -> 2.16.1 (#357871) 0f77709e0f82 nixosTests.redlib: test settings mechanic 4b05e36cf3c3 mitimasu: init at 0-unstable-2023-10-24 95628df27d34 drop gnome aliases (#357818) 8096f799942e python312Packages.publicsuffixlist: 1.0.2.20241108 -> 1.0.2.20241121 (#357798) 9605d9df0cba python312Packages.mypy-boto3-*: updates (#357787) 22d40af46aa0 python312Packages.aiortm: 0.9.25 -> 0.9.32 (#357791) 4a4573f15da1 trufflehog: 3.82.13 -> 3.84.0 (#357808) 1cc2d40d5adf python312Packages.azure-keyvault-administration: 4.4.0 -> 4.5.0 (#357863) af062fcb8472 python312Packages.azure-mgmt-extendedlocation: 1.1.0 -> 2.0.0 (#357861) f701f88712ee python312Packages.azure-mgmt-containerservice: 32.1.0 -> 33.0.0 (#357860) 3d2b33d9325a python312Packages.tldextract: 5.1.2 -> 5.1.3 (#353812) d8e7f6111fa1 scilla: 1.3.0 -> 1.3.1 (#357813) fad7f66698b4 nuclei-templates: 10.0.3 -> 10.0.4 (#357815) b99872332146 ci/editorconfig-v2: useless use of cat 5daed71cc3e8 python312Packages.pylacus: 1.11.1 -> 1.12.0 (#357816) a16dbd8c3518 python312Packages.azure-mgmt-scheduler: 2.0.0 -> 7.0.0 (#357867) 9f7b16591abb python312Packages.azure-storage-file-share: 12.19.0 -> 12.20.0 (#357865) 9b3997bcb196 python312Packages.azure-mgmt-cosmosdb: 9.6.0 -> 9.7.0 (#357858) 58503af4607d python312Packages.accuweather: 3.0.0 -> 4.0.0 (#357826) b805ad5326ec python312Packages.aiosonic: 0.21.0 -> 0.22.0 (#357854) 1680533cd37f python312Packages.plugwise: 1.5.0 -> 1.5.2 (#357784) 4a0893c1866a fixup! nixos/redlib: use upstream systemd service file 2b9249c6f803 superfile: 1.1.5 -> 1.1.6 2cbca95e622c nuclei: 3.3.5 -> 3.3.6 5966e603b9ec showmethekey: 1.16.0 -> 1.17.0 910bdb1c145e python312Packages.datadog: 0.50.1 -> 0.50.2 66c4e8d3e91f wayclip: init at 0.4.2 (#357267) 38e81014f72a ocamlPackages.merlin-extend: 0.6 → 0.6.2 312db796566f python312Packages.sphinx-intl: refactor 19f20fb7d3f1 container2wasm: 0.6.5 -> 0.7.0 (#355170) 553b0453f579 tomcat10: 10.1.30 -> 10.1.33 (#355513) 10791253f4fc tidb: 8.3.0 -> 8.4.0 (#355315) 5b4af5a018ea openxr-loader: 1.1.41 -> 1.1.42 (#355439) 1231a8bda1da quill-log: 7.3.0 -> 7.5.0 (#356514) a10e94864020 python312Packages.tubeup: 2023.9.19 -> 2024.11.13 (#355829) fc7bbc9e0552 snac2: 2.59 -> 2.63 (#356647) cb1e6e7f4d0b sydbox: 2.2.0 -> 3.28.3 (#356793) 262e13687445 kyverno: 1.12.6 -> 1.13.1 (#355899) 2449d96e59f1 textlint: 14.2.1 -> 14.3.0 (#355901) b2575e02dfd3 tryton: 7.2.6 -> 7.4.0 (#355917) 19daa683448d Merge master into staging-next ee0313ff0b9a just: 1.36.0 -> 1.37.0 e404986b3661 python312Packages.accuweather: 3.0.0 -> 4.0.0 (#356998) 81e5009052eb activemq: 6.1.3 -> 6.1.4 (#355570) 5ad0153b37b1 corretto{11,17,21}: {11.0.24.8.1,17.0.12.7.1,21.0.4.7.1} -> {11.0.25.9.1,17.0.13.11.1,21.0.5.11.1} (#356982) b76c352cb711 coqPackages.lemma-overloading: init at 8.12 613f4fff58b2 python312Packages.pyenphase: 1.22.0 -> 1.23.0 bd16ea0630ae kubedock: 0.17.0 -> 0.17.1 277e9b17f371 fheroes2: 1.1.2 -> 1.1.3 (#350646) a42bdea0a776 rfmakecloud: 0.0.18 -> 0.0.21 (#356963) c10f2c7583d9 wl-crosshair: init at 0.1.0-unstable-2024-05-09 (#315950) ef13e60f956f television: init at 0.5.0 (#357237) b2d5ac855d4c technium-dns-server: 13.0.2 -> 13.2 (#356520) 9990b0764dea nomino: 1.3.5 -> 1.3.6 5839edfa24ac finamp: 0.9.11-beta -> 0.9.12-beta (#355447) 689ef34b317d id3: init at 0.81 (#342634) 81b126de4e79 xlights: 2024.16 -> 2024.18 (#355646) 84c96dc458e2 id3: init at 0.81 8ba6ec90fe5a rekor-cli: 1.3.6 -> 1.3.7 d35dd741908a deno: 2.0.6 -> 2.1.1 6146b6ee599d tower-pixel-dungeon: init at 0.3.2 (#353424) 156366e7fd6b home-assistant-custom-components.homematicip_local: 1.71.0 -> 1.72.0 0eb3e2aebd87 python312Packages.hahomematic: 2024.11.7 -> 2024.11.8 6e0747312ea9 plfit: format with nixfmt-rfc-style 579f2539bccd overturemaps: init at 0.9.0 (#338317) c5bafb8dfd8c plfit: move to pkgs/by-name 7412ee1b2793 cardinal: fix cross-compilation (#357454) d5584b1f0371 syshud: 0-unstable-2024-11-04 -> 0-unstable-2024-11-12 (#357947) 0b7768a68c75 starpls: rename from starpls-bin f7e6035cfec8 starpls-bin: 0.1.14 -> 0.1.15 983931612864 python312Packages.jsonformatter: 0.3.2 -> 0.3.4 cb4b5fac5ff5 linuxPackages.nvidiaPackages.beta.open: fix compatibility with linux 6.12 291e11d98f56 pre-commit: fix import bug for built-in hooks ae7c1f0fb4fa pre-commit: Format using nixfmt-rfc-style eda00fd1440d Gitnuro 1.3.1 -> 1.4.2 fb3a557a4bea htmldoc: 1.9.18 -> 1.9.19 438da0034fa8 goose: 3.22.1 -> 3.23.0 b8c5802f8f3f gh-i: 0.0.8 -> 0.0.10 7ebc8047df0c fast-float: 6.1.6 -> 7.0.0 3890e029e310 nixos/zapret: extra features 8edf06bea5bc treewide: move to `by-name` (#357828) 14201d3a9d46 desk-exec: init at 1.0.2 91cbefb2b38f gitqlient: 1.6.2 -> 1.6.3 (#357365) e87e7defad70 fishnet: 2.9.3 -> 2.9.4 (#357512) 2dd36e9886db limine: 8.0.14 -> 8.4.0 b075b4ea4297 dcrwallet: 2.0.4 -> 2.0.5 (#355573) 48184b22385b backintime: 1.5.2 -> 1.5.3 (#355671) b3150cd73772 kubevirt: 1.3.1 -> 1.4.0 (#355706) 82a0eb242e23 xpadneo: fix build issues for kernel 6.12 (#357837) 5e463841f559 uutils-coreutils: 0.0.27 -> 0.0.28 ab37482a7966 python312Packages.nbdev: 2.3.31 -> 2.3.32 (#357682) b7bf9fc4f3fd home-assistant-custom-components.homematicip_local: 1.69.0 -> 1.71.0 (#357666) 63f748d12ab5 waveterm: 0.9.2 -> 0.9.3 97f68c19e43d quake-injector: init at 06 58fe14bdf96e treewide: remove AndersonTorres from some packages' meta.maintainers 3ab9e9654949 Merge master into staging-next df7cef32c349 python312Packages.b2sdk: 2.5.1 -> 2.6.0; backblaze-b2: 4.0.1 -> 4.2.0 (#355202) 6e0a8cdda949 robotframework-tidy: relax rich-click constraint b15871202565 python312Packages.treescope: 0.1.5 -> 0.1.6 351d61cf8758 vikunja: 0.24.4 -> 0.24.5 (#357992) 2adc5090b7af python3Packages.keke: init at 0.1.4 (#341621) 697286bf4dd7 nagstamon: format 250ac961c138 nagstamon: move to by-name 4d2a2ff20dd9 mono: set meta.mainProgram 17a8a6b7e475 mono: format 1aa5a568a6a8 telegram-bot-api: 7.11 -> 8.0 8d5c3efd80dd perf_data_converter: fix fixed derivation hash. (#356599) 80e0606afe4b python314: 3.14.0a1 -> 3.14.0a2 (#357452) 86b2f035e71a python312Packages.sudachipy: 0.6.8 -> 0.6.9 (#357614) e3d26a1815e6 cudaPackages_10{,_0,_1,_2}: drop d9ee62b6aa6d caffe: remove broken CUDA support 80996d5d59bf prometheus-dcgm-exporter: 3.3.5-3.4.0 -> 3.3.9-3.6.1 9d1d584c177f dcgm: enable tests 2301651b8c56 dcgm: patch for modern GCC decc7e8faf78 dcgm: remove static library cruft e75510817a50 dcgm: 3.3.5 -> 3.3.9 082273f5bb79 dcgm: use Ninja a4f77dc95ca9 esphome: 2024.11.0 -> 2024.11.1 ef9236d34063 amazon-ssm-agent: skip additional flaky test (#357924) 4b4f8ece42c1 google-cloud-sdk: fix gsutil 00b5f4e199b7 glfw3: nixfmt e584de581643 glfw3: remove with lib 1c6ac264654e glfw3: enable strictDeps and __structuredAttrs bc33d600bd94 glfw3: remove darwin build inputs 4347d8dee515 glfw3: add missing X11 substitutions fbf94f5a7d3d glfw3: harden wayland substitutions a913a8d655dc glfw3: fix library name overrides 455bf7ad57be python312Packages.opensearch-py: fix build (#357642) 02652438fcbe python3Packages.keke: init at 0.1.4 b261883ed273 sweethome3d.application: 7.3 -> 7.5 (#347910) f865c76c3e2c heroic: fix cursor issues 653b603cef4a notmuch: move the vim plugin to another output (#353500) 434c6fadcd95 yandex-music: 5.23.2 -> 5.28.4 (#357844) 8ff76bc039d3 vault-bin: 1.18.1 -> 1.18.2 410c68d8f5f8 vault: 1.18.1 -> 1.18.2 6e192c4489ea nixos/activation: Add pre-switch checks c3c14a9947d6 ladybird: 0-unstable-2024-11-06 -> 0-unstable-2024-11-21 74f7c2cd0214 arc-browser: 1.69.0-55816 -> 1.70.0-56062 04d5b525759d vikunja: 0.24.4 -> 0.24.5 29dd200c1b48 nss_latest: 3.106 -> 3.107 903651eba2c5 nicotine-plus: 3.3.5 -> 3.3.6 7926405c0d24 miru: 5.5.8 -> 5.5.9 45afcc12bebe python312Packages.streamlit: 1.39.0 -> 1.40.1, cleanup dependencies 328abff1f7a7 pnpm: 9.12.3 -> 9.14.2 (#355664) d7575919f540 immich: 1.120.1 -> 1.121.0 (#357683) 731b6b014a28 gleam: 1.5.1 -> 1.6.1 d34e17271a92 telegram-desktop: 5.7.1 -> 5.8.2 (#356727) 9273dc916452 timewall: init at 1.2.0 7d984c910056 python312Packages.asyncwhois: 1.1.5 -> 1.1.9 (#356900) ff2f00d425fc nixos/canaille: init module 09c2d481c18d canaille: init at 0.0.56 6849c636b475 python3Packages.zxcvbn-rs-py: init at 0.1.1 d6f955ba9b72 python3Packages.flask-themer: init at 2.0.0 e45e3313af1c pythonPackages.sqlalchemy-json: init at 0.7.0 45cc7f418109 python3Packages.flask-webtest: init at 0.1.4 ea8280c3a479 python3Packages.slapd: init at 0.1.5 670003530c1b python3Packages.pytest-smtpd: init at 0.1.0 d6c5afdca4b5 pluginupdate.py: add support for adding/updating individual plugins (#336137) 9597f3627e5a vimPlugins.lspecho-nvim: init at 2024-10-06 67d43ef9efca workflows/eval: Minor fixes, ensure the correct commit is checked out (#357965) eb2872ea67f6 nixos-render-docs: don't validate redirects if none were given 6f7c18e904bf faircamp: 0.15.1 -> 0.21.0 (#357089) 50400dd258ed Use nix 2.24 for eval ci task (#357805) bb19beaf770f OWNERS: Add myself to .github/workflows 19db54eda105 workflows/eval: Minor fixes, ensure the correct commit is checked out 5fb18cb6aedc python312Packages.pynina: 0.3.3 -> 0.3.4 (#357620) 827fd94936c8 puncia: 0.15-unstable-2024-03-23 -> 0.24 (#357603) c74bb1286a44 python312Packages.angr: 9.2.128 -> 9.2.129 (#357612) 1325d4c95494 python312Packages.aioopenexchangerates: 0.6.10 -> 0.6.13 (#357616) 68dd66c61e78 python312Packages.cftime: 1.6.4 -> 1.6.4.post1 abbbd12e01ff drone-oss: 2.24.0 -> 2.25.0 edc180ad4db9 remnote: 1.16.127 -> 1.17.21 50bbfb5788f8 nixos/nncp: recursively merge configurations 2e9c42e1c8a7 dnslink-std-go: init at 0.6.0 db1a685947b2 fix(#356524): update nim mangling patch 6c8ee2dfff97 antimatter-dimensions: 0-unstable-2024-08-12 -> 0-unstable-2024-10-16 27a548c03220 maintainers: add amadaluzia c824630f080e stackblur-go: init at 1.1.0 9662edb82b4d python312Packages.openai: 1.52.1 -> 1.54.5 fba84616e53e kubo: 0.30.0 -> 0.32.1 5742cb2a483f kubo: 0.29.0 -> 0.30.0 b4928123e829 koboldcpp: drop unused args, refactor darwin sdks (#349052) e872447fa6ca Merge master into staging-next 4e7bbd80ccff nvtopPackages.apple: darwin support (#356326) e931a9cfa04c lyra-cursors: init at 0-unstable-2021-12-04 (#308515) 4c79ccf34dd2 nixos/luksroot: make it harder to accidentially break cryptsetup (#355464) af48b9b14a9e python3Packages.stable-baselines3: init at 2.3.2 7b77b4ab6cf7 apfsprogs: 0-unstable-2024-09-27 -> 0.2.0 2c1a608bf7ab apfsprogs: format with nixfmt-rfc-style edadf1c80fc4 supermariowar: 2023-unstable-2024-09-21 -> 2023-unstable-2024-10-17 88a3df2ded60 syshud: 0-unstable-2024-11-04 -> 0-unstable-2024-11-12 66c076ed7413 oauth2c: 1.16.0 -> 1.17.0 (#357927) 19713d8414a6 infisical: 0.31.2 -> 0.31.8 bcbc708ec834 soplex: 7.1.1 -> 712 706ea6e2e46d python312Packages.json-repair: 0.29.6 -> 0.30.2 cd2105ad62ea neovim: fix ruby provider warning (#357902) 7a2b35f90435 webdav: 5.4.2 -> 5.4.3 (#357611) ba1667e2db3a gpauth: limit platforms to *-linux (#357181) 29c5d301e0cc zoom-us: 6.2.5.* -> 6.2.10.* (#357599) b3ac2f4ead48 nixos/meilisearch: fix disabling analytics (#356614) d60df245ce98 python312Packages.opensearch-py: fix build c532371d8423 python312Packages.mailsuite: 1.9.16 -> 1.9.18 2c6c67a61d88 python312Packages.mail-parser: 4.0.0 -> 4.1.2 df9a80ca76d4 python312Packages.parsedmarc: add missing `pygelf` dependency 01dbbb39ec48 python312Packages.pygelf: init at 0.4.2 572588c4e42c python312Packages.msgraph-core: 1.1.6 -> 1.1.7 (#357928) 61b0c55fd1a9 python312Packages.aemet-opendata: 0.5.4 -> 0.5.5 (#357926) d18faf4b8fd0 ocamlPackages.typerep: 0.17.0 → 0.17.1 d5609386acfa python312Packages.language-data: 1.2.0 -> 1.3.0 (#357357) 6a24c125f8ca python312Packages.msgraph-core: 1.1.6 -> 1.1.7 897954b8ae5c nixos/open-web-calendar: init module ad869c8f179b open-web-calendar: init at 1.41 717e0a53ec23 python3Packages.flask-allowed-hosts: init at 1.1.2 1ffc3bc18c9c oauth2c: 1.16.0 -> 1.17.0 7019530d14ef bisq-desktop: drop 519e0e44cfb5 python312Packages.aemet-opendata: 0.5.4 -> 0.5.5 e7b85eaca5c8 amazon-ssm-agent: skip additional flaky test 898c9e3c91fa nixos/activation: prevent error during NIXOS_LUSTRATE install 932358f69549 rabbit: 2.2.0 -> 2.3.1 8712585f72b2 opentelemetry-collector-releases: init at 0.114.0 (#357386) 9590e3221f7a linux/hardened/patches/6.6: v6.6.60-hardened1 -> v6.6.62-hardened1 3f0de246f44a linux/hardened/patches/6.11: v6.11.7-hardened1 -> v6.11.9-hardened1 6fe36d8ed86a linux/hardened/patches/6.1: v6.1.116-hardened1 -> v6.1.118-hardened1 6c769a79a9e5 linux/hardened/patches/5.4: v5.4.285-hardened1 -> v5.4.286-hardened1 abb7a527f6be linux/hardened/patches/5.15: v5.15.171-hardened1 -> v5.15.173-hardened1 b441ea9a9f5b linux/hardened/patches/5.10: v5.10.229-hardened1 -> v5.10.230-hardened1 c1e1a94f22ad python312Packages.plotnine: 0.14.1 -> 0.14.2 1bdff9175530 flutter: revert remove usages of aliases {build,host,target}Platform 6e17454c31dd python312Packages.aiostream: 0.6.3 -> 0.6.4 (#357853) 9cd5d0922a28 cargo-binstall: 1.10.7 -> 1.10.13 (#357450) 3449ad401323 galer: 0.1.0 -> 0.2.0 (#357561) 1c35850bf115 exfatprogs: 1.2.5 -> 1.2.6 (#357567) 5748684be265 searxng: 0-unstable-2024-10-05 -> 0-unstable-2024-11-17 (#357510) 932f30a1d92e python312Packages.aioairq: 0.4.2 -> 0.4.3 (#357605) 4bb0d51cef2e python312Packages.django-filer: 3.2.3 -> 3.3.0 (#357613) 27b3733b18f0 memtier-benchmark: 2.1.1 -> 2.1.2 (#357654) d37748d62e43 plfit: 0.9.6 -> 1.0.0 707cc904c982 tideways-daemon: 1.9.18 -> 1.9.22 (#357735) 4b8cfaf01adf php81Extensions.tideways: 5.13.0 -> 5.14.0 (#357737) 63de2723027e nixos/kanidm: add provisioning secret directories to BindReadOnlyPaths (#357440) 59c6202f3c2f noseyparker: 0.20.0 -> 0.21.0 (#357748) 5c282155115e tabiew: 0.6.2 -> 0.7.1 (#357788) d37c1931259e jetbrains.plugins: update e4c37a6375a2 jetbrains.clion: 2024.2.3 -> 2024.3 bfc2fd831b8e nmap-formatter: 3.0.1 -> 3.0.2 (#357885) a2eabcd62d3b walker: 0.8.12 -> 0.9.0 (#357892) 2a6e25ca28c1 ghidra-extensions.lightkeeper: 1.1.1 -> 1.2.0 (#357911) 144adf1580c5 iptraf-ng: 1.2.1 -> 1.2.2 (#357913) 6035ec65f0c1 python312Packages.aiovlc: 0.6.1 -> 0.6.2 (#357852) bc5014d67fb2 python312Packages.aiogram: 3.14.0 -> 3.15.0 (#357855) f6331d2322e1 python312Packages.ibm-cloud-sdk-core: 3.21.0 -> 3.22.0 (#357831) 955f251218aa python312Packages.elmax-api: 0.0.5 -> 0.0.6.1 (#357840) d7bacce6ee0a python312Packages.aio-pika: 9.4.3 -> 9.5.0 (#357850) bf180635cffe mdbook-alerts: 0.6.7 -> 0.6.10 0d98ca13c35f python312Packages.pytouchlinesl: 0.1.8 -> 0.2.0 (#357785) 9c2bbd48c2ca python312Packages.django-tastypie: 0.14.7 -> 0.15.0 (#357789) d43885c4864f python312Packages.cyclopts: 3.0.0 -> 3.0.1 (#357790) 87995828c652 python312Packages.asdf-astropy: 0.6.1 -> 0.7.0 (#357792) f637af13a055 troubadix: 24.10.0 -> 24.10.2 (#357795) 911315e9f327 python312Packages.types-docopt: 0.6.11.4 -> 0.6.11.20241107 (#357804) 0149756de9a5 python312Packages.ufmt: 2.7.3 -> 2.8.0 (#357811) fe9fd02ff5f0 cnspec: 11.30.0 -> 11.31.1 (#357807) 84eea7a5c17d python312Packages.tencentcloud-sdk-python: 3.0.1267 -> 3.0.1268 (#357809) 3ee13e6dda9d iptraf-ng: 1.2.1 -> 1.2.2 1c537cf04ac8 git-lfs: 3.5.1 -> 3.6.0 7dcb0af1dff5 python312Packages.environs: 11.1.0 -> 11.2.1 (#357796) 8c1de526a81c python312Packages.dnfile: 0.15.0 -> 0.15.1 (#357797) 121eeb599bc7 ghidra-extensions.lightkeeper: 1.1.1 -> 1.2.0 ebc49be5d8e9 python312Packages.types-deprecated: 1.2.9.20240311 -> 1.2.15.20241117 (#357801) dec402b1b5ab python312Packages.tololib: 1.1.0 -> 1.2.0 (#357802) 1f62f5853591 opentelemetry-collector-builder: move to the package set 3b73cec2ccb5 opentelemetry-collector-contrib: alias to opentelemetry-collector-releases.otelcol-contrib f89fdc3f6c38 opentelemetry-collector: alias to opentelemetry-collector-releases.otelcol b7f57e3b18ec opentelemetry-collector-releases: init at 0.114.0 be3a3ad0dafa opentelemetry-collector-builder: 0.112.0 -> 0.114.0 616735586ac8 p4: fix darwin build (#357381) d76eaf2d1ae6 jami: 20240823 -> 20241031.0; fix build with libgit2 1.8.4 (#356712) 376b19bfef11 python312Packages.pyswitchbot: 0.51.0 -> 0.53.2 (#357777) 40b061a29cc6 opensc: fix darwin build (#357494) 6d85e684d79a signalbackup-tools: 20241106-1 -> 20241119 (#357436) 54cc32c91db9 python312Packages.aioairq: 0.4.2 -> 0.4.3 (#357778) efcc81f56d89 python312Packages.thinqconnect: 1.0.0 -> 1.0.1 (#357779) dab49f2efee5 eza: 0.20.8 -> 0.20.9 (#357781) c256c03bee28 python312Packages.aioairzone: 0.9.5 -> 0.9.7 (#357782) dfcfe62912fb mlkit: 4.7.12 -> 4.7.13 (#357754) b0a25ca403cb python312Packages.django-tastypie: 0.14.7 -> 0.15.0 (#357756) 5e1bfacd19e9 python312Packages.coffea: 2024.10.0 -> 2024.11.0 (#357764) 080b8f1f576d php-packages: remove the merged soap patch 6838349887e1 php84: 8.4.0RC4 -> 8.4.1 19cf01e23626 seilfahrt: 2.0.0 -> 2.1.0 (#357767) 4524441c60d0 n8n: 1.61.0 -> 1.64.0, drop maintainer freezeboy (#350101) b9065e8344fb bottles: 51.13 -> 51.15; add Gliczy as maintainer (#353501) abc5566af957 amazon-cloudwatch-agent: 1.300049.1 -> 1.300050.0 279cd3cf9cff duti: add maintainer n-hass (#357747) c1b9d0ce79b1 nixos/alertmanager: add additional docs about envsubst (#302536) 86337a3e7aa6 firefox: enable darwin builds; also some of its derivatives (thunderbird, librewolf, floorp) (#350384) 6f88eaab1bc2 beets: allow darwin builds 7c2fe325787c neovim: fix ruby provider warning aadaa13a0ec0 lyra-cursors: init at 0-unstable-2021-12-04 87678783d013 doc: change allowInsecurePredicate example to a useful one (#356937) 9612e216ce6d nixos/tabby: fix typo (#355223) 254c77c2a299 openvino: 2024.4.1 -> 2024.5.0 (#357723) 24512fea9ffa yt-dlp: 2024.11.4 -> 2024.11.18 (#356945) 17a96536c3e5 tuxguitar: fix start script (#357246) f742f88460f7 tsukimi: 0.16.9 -> 0.17.3 c823dcf51eba doc/stdenv: fix a typo (#357485) 47914834c3bf walker: 0.8.12 -> 0.9.0 883004f10492 payload-dumper-go: 1.2.2 -> 1.3.0 (#357593) cd04f10e7e21 psst: move to by-name b9d0d70b1529 nmap-formatter: 3.0.1 -> 3.0.2 d8e545500a7a pantheon.elementary-settings-daemon: Backport fwupd 2.0.0 support 35d963f9c5c7 pantheon.switchboard-plug-about: Backport fwupd 2.0.0 support 2b331f344cca castopod: move to by-name 534769b8ac4c Merge master into staging-next 7a36e6ddbdec pantheon.elementary-gtk-theme: 8.1.0 -> 8.2.0 76fe1041bea3 pantheon.sideload: 6.2.2 -> 6.3.0 687fa135815c mpdcron: move to by-name d533f739c47f linuxPackages.ipu6-drivers: fix build on Linux >= 6.12, bump (#357050) fb61e646af00 loudgain: move to by-name 427ffbc994f5 botamusique: move to by-name b97f7beed1b2 xxx-pe: move to by-name 02287a8c0295 kubo-migrator: add migration from 15 to 16 (#344265) 112849562033 font-awesome: 6.6.0 -> 6.7.1 144d01dd49fd zabbix70: 7.0.5 -> 7.0.6 46385eee1e6c irust: 1.71.24 -> 1.71.29 (#357562) ebc7f53961b3 python312Packages.yfinance: 0.2.49 -> 0.2.50 6e7fc8cdeb67 python312Packages.strawberry-graphql: 0.243.1 -> 0.251.0 f4b2553be7b3 python312Packages.restview: 3.0.1 -> 3.0.2 d87419737d1e python312Packages.libcst: 1.5.0 -> 1.5.1 6049524d7011 python312Packages.google-cloud-redis: 2.16.0 -> 2.16.1 73bf44ceb684 python312Packages.cached-property: 1.5.2 -> 2.0.1 7183c4d4cecd python312Packages.azure-mgmt-scheduler: 2.0.0 -> 7.0.0 c66e65cb2ea8 nixos-rebuild-ng: use python3Packages a8b2af2a1201 nixos-rebuild-ng: add devShell 4def107627bc nixos-rebuild-ng: generate `.version-suffix` for classic Nix d55f8c84a5af nixos-rebuild-ng: reduce build closure by moving checks to passthru.tests 0ceb3a735b0a nixos-rebuild-ng: lazy import tabulate ae0fb8ecbabb python312Packages.azure-storage-file-share: 12.19.0 -> 12.20.0 32294d92ef0d python312Packages.azure-keyvault-secrets: 4.8.0 -> 4.9.0 0bbaf5505af8 ungoogled-chromium: 131.0.6778.69-1 -> 131.0.6778.85-1 (#357691) bdc85f481948 python312Packages.azure-keyvault-keys: 4.9.0 -> 4.10.0 ad58af67b2f6 python312Packages.azure-keyvault-certificates: 4.8.0 -> 4.9.0 4057acc55bb9 python312Packages.azure-keyvault-administration: 4.4.0 -> 4.5.0 2d0342923eb3 denaro: move to by-name 042a1e2c7f5e python312Packages.azure-mgmt-cosmosdb: 9.6.0 -> 9.7.0 7c52aa1efe9e python312Packages.azure-mgmt-containerservice: 32.1.0 -> 33.0.0 c1452c0a854a python312Packages.azure-mgmt-extendedlocation: 1.1.0 -> 2.0.0 778a616b6964 yandex-music: 5.23.2 -> 5.28.4 436199731ca3 python312Packages.aiovlc: 0.6.1 -> 0.6.2 aa0e7f56b102 python312Packages.aiostream: 0.6.3 -> 0.6.4 0f51db0c72a4 python312Packages.aiosonic: 0.21.0 -> 0.22.0 0b40beb7cdff python312Packages.aiogram: 3.14.0 -> 3.15.0 77e1fdf5629c python312Packages.aio-pika: 9.4.3 -> 9.5.0 aec5f24fed91 go-musicfox: format with nixfmt-rfc-style b79710e0affa go-musicfox: 4.5.3 -> 4.5.7 5f830be0e81d lua-language-server: 3.13.0 -> 3.13.2 14a02190a3a6 python312Packages.certbot-dns-route53: refactor 4d874d59e2a0 lib.systems.examples: set `rust.rustcTarget` for ucrtAarch64 4992f6224995 python312Packages.certbot-dns-route53: ignore DeprecationWarning 96ae446175c4 urh: add wrapGAppsHook3 (#357400) d0b528f26cad zed-editor: use fetchCargoVendor (#357701) 3dcad335b14f python312Packages.certbot-dns-rfc2136: ignore DeprecationWarning 487e53512283 python312Packages.certbot-dns-cloudflare: ignore DeprecationWarning aa56482ca191 gollama: 1.27.17 -> 1.27.19 (#357572) eca7e4cc74c0 python312Packages.certbot-dns-ovh: ignore DeprecationWarning 19f8e5f64f3d python312Packages.python-whois: 0.9.4 -> 0.9.5 (#356801) 943fe5165789 python312Packages.elmax-api: 0.0.5 -> 0.0.6.1 9777a72dd3ff Take over the role of maintainer luc65r (#356536) d696a5a53d7e coltrane: move by-name af2057249eac jekyll: move by-name 32c2991d8f4e aleo-fonts: init at 2.0.0-unstable-2023-06-03 (#295576) f585591dc65e pdfposter: move by-name 2196a645143a taskjuggler: move by-name 22260d7916e4 acpic: move by-name 339478c850e9 cotp: move by-name c44a31d3eac2 gollum: move by-name c0451e363899 autofs: enable NIS support (#350538) 5423890b9769 tuisky: 0.1.3 -> 0.1.5 (#357492) b985b36552e7 pylyzer: 0.0.70 -> 0.0.71 (#357602) 3ed0997e7185 xpadneo: fix build issues for kernel 6.12 e43015afa25b pt: move by-name 89c722b5e153 python312Packages.ibm-cloud-sdk-core: 3.21.0 -> 3.22.0 d6a60466acab doing: move to by-name 0c94fb56a695 cloak: move to by-name cc6c634b4537 python312Packages.bluetooth-adapters: 0.20.0 -> 0.20.2 bb3bf678201f omnom: 0-unstable-2024-10-01 -> 0-unstable-2024-11-20 f7729271c847 omnom: don't wrap binary or patch config 9e7cbd109593 omnom: package Firefox and Chrome addons 4d5c03fa7fec omnom: 0-unstable-2024-08-29 -> 0-unstable-2024-10-01 3fe9c65da3d4 python312Packages.accuweather: 3.0.0 -> 4.0.0 ef1aab32c9f6 kid3: 3.9.5 -> 3.9.6 4edaf66e6472 python312Packages.language-data: update disabled f512ddbb3aba galer: add changelog to meta d81d18c9d59a gnome: replace alias with throw 4fa019d876e0 google-chrome: 131.0.6778.69 -> 131.0.6778.85 (#357763) c12ea496545f snapcraft: 8.4.1 -> 8.5.0 (#357518) 14f4fef8dc80 homepage-dashboard: 0.9.10 -> 0.9.12 (#357477) 6f447d18a2e2 nuclei-templates: 10.0.3 -> 10.0.4 a8ef375d9cac python312Packages.pylacus: 1.11.1 -> 1.12.0 c47912b4a19c python312Packages.ufmt: 2.7.3 -> 2.8.0 a81f5f005faf git-smash: init at 0.1.1 (#351949) e2264471522f duti: add maintainer n-hass df778095e05d python312Packages.tencentcloud-sdk-python: 3.0.1267 -> 3.0.1268 85872d7fe690 scilla: 1.3.0 -> 1.3.1 fffbbb85bb25 qtscrcpy: switch to latest ffmpeg aeb56c6e8d14 trufflehog: 3.82.13 -> 3.84.0 dedec25f2f50 cnspec: 11.30.0 -> 11.31.1 d65d18f1e487 ci: use nix 2.24 2e877e8d91c6 snipaste: add desktop entries (#356553) 8677027f62c8 workflows/eval: avoid potential script injection attack (#357753) 551ae868031f wlink: fix overuse of with lib (#357240) 18e1305cc43f zls: fix build on Darwin (#357730) 3ee89c589cb0 python312Packages.types-docopt: 0.6.11.4 -> 0.6.11.20241107 7569b855d3ec python312Packages.types-deprecated: 1.2.9.20240311 -> 1.2.15.20241117 6a4405a5e5e3 python312Packages.tololib: 1.1.0 -> 1.2.0 bf4c8fc53aa0 python312Packages.pywerview: 0.7.0 -> 0.7.1 1e5fa97649f4 python312Packages.publicsuffixlist: 1.0.2.20241108 -> 1.0.2.20241121 0708559fe75a troubadix: 24.10.0 -> 24.10.2 143ce3aca909 python312Packages.awkward: 2.6.9 -> 2.7.1; python312Packages.uproot: 5.4.1 -> 5.5.0 (#354346) 8ef7600d5932 python312Packages.environs: 11.1.0 -> 11.2.1 a33697d84b0f ocamlPackages.tls: 1.0.2 -> 1.0.4 (#356286) 878b7c8622ce python312Packages.dnfile: 0.15.0 -> 0.15.1 6fa2bef83566 python312Packages.django-tastypie: 0.14.7 -> 0.15.0 cf5cb77b14dc python312Packages.cyclopts: 3.0.0 -> 3.0.1 263f287ccd1f python312Packages.aiortm: 0.9.25 -> 0.9.32 5dcbf2c8ec93 python312Packages.asdf-astropy: 0.6.1 -> 0.7.0 3f33818610ce azure-cli: 2.66.0 -> 2.67.0 (#357241) 42aa7a0817f2 python312Packages.mypy-boto3-workspaces-web: 1.35.23 -> 1.35.66 ec2510ecc93b python312Packages.mypy-boto3-workspaces: 1.35.43 -> 1.35.66 b8afc3502b66 python312Packages.mypy-boto3-timestream-query: 1.35.46 -> 1.35.66 ed158b375606 python312Packages.mypy-boto3-rds: 1.35.64 -> 1.35.66 5211041fcc1a python312Packages.mypy-boto3-rbin: 1.35.0 -> 1.35.66 0977439f97ea python312Packages.mypy-boto3-omics: 1.35.7 -> 1.35.66 14b1ca29fde5 python312Packages.mypy-boto3-mwaa: 1.35.0 -> 1.35.65 735e314e2827 python312Packages.mypy-boto3-mediapackagev2: 1.35.50 -> 1.35.66 2cdc0caa1b88 python312Packages.mypy-boto3-mediaconvert: 1.35.60 -> 1.35.66 7e9d7c11cb21 python312Packages.mypy-boto3-lambda: 1.35.58 -> 1.35.66 b9daa5b17a19 python312Packages.mypy-boto3-keyspaces: 1.35.52 -> 1.35.65 61da662732f1 python312Packages.mypy-boto3-glue: 1.35.53 -> 1.35.65 4a3e46a52a80 python312Packages.mypy-boto3-elbv2: 1.35.53 -> 1.35.66 af615ff65ebc python312Packages.mypy-boto3-efs: 1.35.0 -> 1.35.65 c05a66730e9c python312Packages.mypy-boto3-ecs: 1.35.64 -> 1.35.66 2670b230d328 python312Packages.mypy-boto3-ec2: 1.35.64 -> 1.35.66 6762af7afb3f python312Packages.mypy-boto3-discovery: 1.35.0 -> 1.35.66 b7e61c323edc python312Packages.mypy-boto3-controltower: 1.35.59 -> 1.35.66 5605b660a83e python312Packages.mypy-boto3-compute-optimizer: 1.35.0 -> 1.35.66 1ec61df30bfb python312Packages.mypy-boto3-cloudfront: 1.35.58 -> 1.35.66 7cfd6b1dca44 python312Packages.mypy-boto3-autoscaling: 1.35.64 -> 1.35.66 d68352860521 python312Packages.azure-mgmt-network: 27.0.0 -> 28.0.0 (#357060) 3ee6aa3e8913 python312Packages.pytouchlinesl: 0.1.8 -> 0.2.0 e633b6a3c90c tabiew: 0.6.2 -> 0.7.1 e90616dafa1d python312Packages.plugwise: 1.5.0 -> 1.5.2 ce4ef48fe91d python312Packages.aioairzone: 0.9.5 -> 0.9.7 6735eef1b1b5 nixos/libreswan: use `environment.etc."ipsec.secrets".text` (#357626) 4b15fd5225fa python312Packages.pyswitchbot: 0.51.0 -> 0.53.2 3cc7596e5657 python312Packages.aioairq: 0.4.2 -> 0.4.3 0380ef514f56 eza: 0.20.8 -> 0.20.9 b5847c2c30fb python312Packages.thinqconnect: 1.0.0 -> 1.0.1 33a604f5fdd8 kdePackages.powerdevil: Add ddcutil as build input (#351250) 2107702626ef python312Packages.tencentcloud-sdk-python: 3.0.1266 -> 3.0.1267 (#357551) e98178ef2b05 terraform-providers.gitlab: 17.4.0 -> 17.5.0 498c93d3dc6c bambu-studio: move to by-name c8021779cd36 amazon-cloudwatch-agent: init at 1.300049.1 (#337212) f6253960d354 sdrangel: 7.22.2 -> 7.22.4 6566172f70e1 Merge master into staging-next 2faac2e37a8c seilfahrt: 2.0.0 -> 2.1.0 1bbcdc041447 tuxedo-drivers: 4.9.0 -> 4.11.3 bfc160a84c63 nixos/netbird: fix port conflict on metrics endpoint bd6d61f02de6 google-chrome: 131.0.6778.69 -> 131.0.6778.85 969cf45ee407 python312Packages.coffea: 2024.10.0 -> 2024.11.0 36c71c53a037 suitesparse-graphblas: 9.3.1 -> 9.4.2 0f18abcf7ae5 sqlitestudio: 3.4.4 -> 3.4.5 69fd9db72856 terraform-providers.azurerm: 4.5.0 -> 4.10.0 aae1b3f6535c terraform-providers.oci: 6.13.0 -> 6.18.0 15daf99b9acd Merge master into staging-next 56bb92bd9576 python312Packages.django-tastypie: 0.14.7 -> 0.15.0 76d723ce4fff telegraf: 1.32.3 -> 1.32.3 28f4f47f4857 mlkit: 4.7.12 -> 4.7.13 8880ce30ec26 noseyparker: 0.20.0 -> 0.21.0 87c189e26bde logdy: 0.13.0 -> 0.13.1 516819d9b5b9 emacsPackages.lspce: 1.1.0-unstable-2024-09-07 -> 1.1.0-unstable-2024-10-07 (#356668) 43c3e8ba3184 ibm-plex: 6.4.0 -> 1.1.0, add @ryanccn as maintainer (#355652) e34e6cb18977 gitbutler: mark as broken c6ee5d0b579d acl2: mark as broken on darwin fcebbc872934 vagrant: mark as broken 98c41eed0656 codon: mark as broken a8b18d5ecda0 fzf: 0.56.2 -> 0.56.3 0414b4c9dcf3 php81Extensions.tideways: 5.13.0 -> 5.14.0 de9074338a5a ghstack: 0.9.3 -> 0.9.4 b19fcb8e4bd2 tideways-daemon: 1.9.18 -> 1.9.22 b3082cbeb6f9 zls: fix build on Darwin 5d844bc5c66a waagent: 2.11.1.12 -> 2.12.0.2 88700dd2611c openvino: 2024.4.1 -> 2024.5.0 4a43f36f2677 sunvox: Add back wayback machine fallback src acce0783838d Merge master into staging-next 2360e36da358 metacubexd: 1.168.0 -> 1.171.0 68b1892ad61a python312Packages.distutils: unbreak on Darwin (#357099) 95fc06c95944 ecapture: 0.8.9 -> 0.8.10 484eca6cecc8 llvmPackages.llvm-manpages: fix eval on Darwin 32e0d3a3da75 python312Packages.tensorly: unbreak (incorrect source hash) 618043c125b0 nph: fix build with nim-2.0 de79f65cfe7c zed-editor: use fetchCargoVendor d3b4ec2ec0a1 openai-whisper-cpp: 1.7.1 -> 1.7.2 18ceb0aadbc1 python312Packages.pyhanko: 0.25.1 -> 0.25.3 af5177004d0c python312Packages.certomancer: 0.12.0 -> 0.12.3 1563ad1a619b python312Packages.pyhanko-certvalidator: 0.26.3 -> 0.26.5 8657f42dcc38 k2pdfopt: pin tesseract version 4ae2d4df2ca3 k2pdfopt: format bd84f1c657c7 ungoogled-chromium: 131.0.6778.69-1 -> 131.0.6778.85-1 68d51619a279 chromium: use cached dependencies from other attributes in update script afa66f475581 factorio: fix `updateScript` definition 090642487838 chiptrack: 0.3.1 -> 0.5 7496b4ce2e63 u3-tool: fix style 0192be7d39a8 u3-tool: use github mirror bdedbe34dd3c u3-tool: 0.3 -> 1.0 f959feb88a61 factorio: 2.0.15 -> 2.0.20 (#357306) 60ee8fb18c27 meli: 0.8.7 -> 0.8.8 644c1802f099 wipeout-rewrite: nixfmt, modernise, bump (#354647) 06c42637cce3 python312Packages.nbdev: 2.3.31 -> 2.3.32 778f30c08c1e porn-vault: init at 0.30.0-rc.11 (#355785) a5c5f98a5aeb immich: 1.120.1 -> 1.121.0 dca46c1a6d87 chromium: fetch src from git instead of using release tarball, {ungoogled-,}chromium,chromedriver: 130.0.6723.116 -> 131.0.6778.69/85 (#357371) 7eac7962100e operator-sdk: 1.37.0 -> 1.38.0 2468db7a612c clash-rs: 0.7.0 -> 0.7.1 (#354419) 1910117ae666 siyuan: 3.1.8 -> 3.1.13 (#357032) 3903e1897ab6 cargo-pgrx_0_11_3: remove 7faa64b0aa79 cargo-pgrx_0_11_2: remove c8de5e8d85b1 cargo-pgrx_0_10_2: remove 9e81eb8444f6 cargo-pgrx: 0.11.2 -> 0.12.6 1596e0aa7dcf OWNERS: add postgres team to own cargo-pgrx 31b9d15443de postgresqlPackages.postgis: remove wolfgangwalther from maintainers c378776f2a98 python312Packages.textual: 0.82.0 -> 0.86.1, harlequin: 1.25.0 -> 1.25.2 (#356997) f10fc704df54 Merge: postgresqlPackages.timescaledb: 2.14.2 -> 2.17.2; adopt, nixfmt; postgresqlPackages.timescaledb_toolkit: 1.18.0 -> 1.19.0 (#348223) 63e45baa95b5 linuxKernel.packages.linux_6_11.evdi: adopt maintenance 7e6a62051ed6 linuxKernel.packages.linux_6_11.evdi: set broken for kernel >= 6.12 3b2787f1aa80 linuxKernel.packages.linux_6_11.evdi: autoformat with nixfmt e766b67731b9 rat-king-adventure: 2.0.1 -> 2.0.2 e35b0f3f9787 melodeon: 0.4.2 -> 0.4.3 (#356931) 1b7b747e0310 snis: add assets f528262028f8 uutils-coreutils: format 7a8b3506edce snis: update to the latest commit 3674a8e9f81c showmethekey: 1.15.1 -> 1.16.0 (#356920) eb364e3146d2 home-assistant-custom-components.homematicip_local: 1.69.0 -> 1.71.0 2f43c03cc94e python312Packages.hahomematic: 2024.10.17 -> 2024.11.7 f090ef7409d7 deltatouch: 1.6.0 -> 1.8.0 (#357429) 6216c3555f9e esphome: 2024.10.3 -> 2024.11.0 (#357617) c84609cac17d zed-editor: 0.161.2 -> 0.162.3 (#357630) c08263bc9b87 keypunch: 3.1 -> 4.0; adopt (#357221) 69b2f4dd5f23 gh-copilot: add auto-updating (#310681) 91fee431005a nixos/monado: add forceDefaultRuntime option 59aa5ea82911 morphosis: 1.3 -> 1.4.1 (#357233) 2c1afd1c3562 wchisp: remove overuse of with lib (#357239) 4814bb478f7c seclists: 2024.3 -> 2024.4 a92d51097a9e jwm: 2.4.5 -> 2.4.6 (#357364) 47f800bf1e8d blockbench: 4.11.1 -> 4.11.2 (#357384) d9f8532ec2f9 memtier-benchmark: 2.1.1 -> 2.1.2 4743e01fa0a3 freecad: 1.0rc4 -> 1.0 (#357360) dcbc753c4fb5 deskflow: 1.17.1 -> 1.17.2 4927639ec7da cryptomator: add maintainer gepbird c1e55529b3a7 cryptomator: 1.14.1 -> 1.14.2, unbreak 7f70a6698ce9 cryptomator: remove `with lib;`, order attrs ed6063f0945c cryptomator: migrate to by-name 3d7a916650b2 cryptomator: nixfmt 8f39372d6dfa wluma: 4.4.0 -> 4.5.1 (#356980) 370ff43b70ae toml-sort: 0.23.1 -> 0.24.2 (#357303) a8074e9ec89f gale: 0.8.11 -> 1.1.4 (#357393) 9757a370784c blasfeo: 0.1.3 -> 0.1.4 (#357288) 359b70da9ea3 plumber: 2.7.1 -> 2.8.0 (#357332) 5209b9257b4b pure-maps: 3.3.0 -> 3.4.0 (#351558) 0fb01611f304 clusternet: init at 0.17.1 a44b53284670 gtk4-layer-shell: fix cross compilation (#357230) 7a00388a1031 nodejs_23: add patches to fix parallel-os test (#356257) cba14f963eac nextcloud: add news app 51a1c9eab08f librewolf: 132.0.1-1 -> 132.0.2-1 f34edcd249cb alembic: fix hash (#357627) b4e1cd2196de python312Packages.arcam-fmj: 1.5.2 -> 1.6.0 (#357631) 7baa9da55272 postgresqlPackages.timescaledb_toolkit: switch to cargo-pgrx_0_12_6 07ba29fead7c cargo-pgrx_0_12_6: init at 0_12_6 ddb939709f59 television: init at 0.5.0 28bcb4477dfe nodejs_23: add patches to fix parallel-os test fc12f6809200 zed-editor: 0.161.2 -> 0.162.3 e87d0d725274 python312Packages.arcam-fmj: 1.5.2 -> 1.6.0 408404d8fec0 alembic: fix hash b294762bb9a9 nixos/libreswan: use `environment.etc."ipsec.secrets".text` 5f4f6718627f tesh: fix build 6d2d99ef570f Parallel GH actions workflow for Nixpkgs eval (#356023) cbc70ce46b6d evdi: 1.14.6 -> 1.14.7 (#344700) d834b054f4f6 nixos/scx: init module (#352300) 29e945ea3623 python312Packages.pynina: refactor ee73901639c3 python312Packages.pynina: 0.3.3 -> 0.3.4 0e333ace2428 esphome: 2024.10.3 -> 2024.11.0 2f620d4b5a53 python312Packages.aioopenexchangerates: 0.6.10 -> 0.6.13 f8283638a6b7 Merge master into staging-next b948c596aaa7 kdePackages.merkuro: add missing dependency on qtlocation (#357610) 62ccec5d8a55 kdePackages.merkuro: add missing dependency on qtlocation 4cecdc4c3310 python312Packages.sudachipy: 0.6.8 -> 0.6.9 995a25b404f9 python312Packages.django-filer: 3.2.3 -> 3.3.0 a81a1ca20ce9 sqldef: 0.17.20 -> 0.17.23 (#352019) 503dc93f1b99 python312Packages.angr: 9.2.128 -> 9.2.129 4fba5287c3b2 python312Packages.cle: 9.2.128 -> 9.2.129 f1bf4d74ef99 webdav: 5.4.2 -> 5.4.3 5ffafd6e202c python312Packages.claripy: 9.2.128 -> 9.2.129 d1ca2c779a52 python312Packages.pyvex: 9.2.128 -> 9.2.129 7d677ba5a162 python312Packages.ailment: 9.2.128 -> 9.2.129 200c150a5157 python312Packages.archinfo: 9.2.128 -> 9.2.129 9afbaab23f08 puncia: 0.15-unstable-2024-03-23 -> 0.24 7b97b0732cab libreoffice-fresh: fix failing tests, update (#357555) e43293f0c99d python312Packages.aioairq: 0.4.2 -> 0.4.3 a0f1c12faa94 pylyzer: 0.0.70 -> 0.0.71 66644c73b687 zoom-us: 6.2.5.* -> 6.2.10.* 58600bbcf92d notepad-next: 0.8 -> 0.9 d774cc7921b3 tideways-cli: init at 1.2.2 (#351192) ca01f3f15662 python312Packages.billiard: disable time sensitive tests c3f9d32635e9 python312Packages.captum: init at 0.7.0 (#356087) c0921fd9f119 payload-dumper-go: 1.2.2 -> 1.3.0 088ac6b39eae nvtopPackages: set platform accordingly 37cf6e3ee61d nvtopPackages: format 84e9fd9db5a9 nvtopPackages.full: mutually exclude gpus for darwin and linux 4a5287dcb87f python312Packages.manifold3d: 2.5.1 -> 3.0.0 (#356904) a2c826f6d062 python312Packages.captum: init at 0.7.0 ea9b26a6ba70 gh-gei: 1.8.0 -> 1.9.0 1e93f0620959 manifold: 2.5.1-unstable-2024-11-08 -> 3.0.0 (#356877) e713deb921ef pantheon.switchboard-plug-sound: 8.0.0 -> 8.0.1 (#357273) f8c5ffa59f34 signal-desktop-beta: drop d51508538c2a singular: 4.3.2p16 -> 4.4.0p6 ca26219ba6fe kubo-migrator: add migration from 15 to 16 9e2866d21526 kubo-migrator: rewrite be92b059e929 raycast: 1.85.2 -> 1.86.0 5624e1334b26 signal-desktop(aarch64-linux): 7.23.0 -> 7.33.0, signal-desktop(darwin): 7.29.0 -> 7.33.0 (#357569) 7b548a835d78 librewolf: 132.0.1 -> 132.0.1-1 (#355483) 03597e239e63 excalidraw_export: init at v1.1.0 (#341078) 8834e54892e3 gollama: 1.27.17 -> 1.27.19 0bcdcae905f1 signal-desktop(darwin): 7.29.0 -> 7.33.0 c48022dee971 signal-desktop(aarch64-linux): 7.23.0 -> 7.33.0 9cd675e112c8 saunafs: 4.5.1 -> 4.6.0 (#357353) 25dcc03d5645 exfatprogs: 1.2.5 -> 1.2.6 fc3800db5100 timew-sync-client: init at 1.0.1-unstable-2024-08-05 fbad0b97db46 linux_xanmod, linux_xanmod_latest: 2024-11-17 (#356262) 5e2c2958b3bf python311Packages.{pytensor,pymc}: fix hash (#357486) d813e62d2afa python-qt: 3.5.4 -> 3.5.6 (#347267) e2661ee1682e irust: 1.71.24 -> 1.71.29 b3f74344a21b python312Packages.lightning-utilities: 0.11.8 -> 0.11.9 (#357488) c5111283e207 python312Packages.flow-record: 3.17 -> 3.18 (#357352) d624b70de6f7 python312Packages.pubnub: 9.0.0 -> 9.1.0 (#357372) 5332020b297d havn: 0.1.13 -> 0.1.16 (#357446) a69e8882825f hyprutils: 0.2.5 -> 0.2.6 (#357465) fd8a55c791c0 ocamlPackages.x509: 1.0.4 -> 1.0.5 (#357469) 5a3c068fb868 httpdirfs: 1.2.6 -> 1.2.7 (#357474) 84ea6b93f2d9 llvmPackages_19: 19.1.3 -> 19.1.4 (#357453) 157265d3c2a3 proxsuite-nlp: 0.8.0 -> 0.10.0 (#352987) b959a6c86f0b microfetch: 0.4.0 -> 0.4.1 (#357476) e1cedaabe5a7 nixos/obs-studio: nullable package (#356845) d77424313a11 terraform-providers.linuxbox: 0.4.3 -> 0.5.6 (#357478) 44a747c34030 katana: 1.1.0 -> 1.1.1 21fa3c9289b8 gossa: 1.0.0 -> 1.1.2 (#357506) ab58dc04c315 galer: 0.1.0 -> 0.2.0 0d0270803dc0 viddy: 1.2.0 -> 1.2.1 (#357019) ced95a640bb8 harsh: 0.10.2 -> 0.10.4 (#357508) 5d85f3e1454c nwg-dock-hyprland: 0.3.2 -> 0.3.3 (#357524) 119e78041be3 terraform-providers.vpsadmin: 1.0.0 -> 1.1.0 (#357525) d167937f6dc7 goimports-reviser: 3.6.5 -> 3.7.4 (#357321) a261fc505b39 badger: 4.3.0 -> 4.4.0 (#357539) 120e717970b8 nixos/bind: Fix cacheNetworks option (#335832) e35305589cba libreoffice-fresh: skip another newly broken test e7766d29b5dc libreoffice-fresh: 24.8.2.1 -> 24.8.3.2 f80720823b65 workflows/eval: avoid potential script injection attack f077f7100ad0 python312Packages.mypy-boto3-*: updates (#357390) 14077a06abfc python312Packages.tencentcloud-sdk-python: 3.0.1266 -> 3.0.1267 4dc27d25a7e5 python312Packages.ray: 2.38.0 -> 2.39.0 21497ce96c1d Merge master into staging-next 80386aadf4ef dovecot_fts_xapian: 1.7.14 -> 1.8 b413874cd06e sage: 10.4 -> 10.5.rc0 (#357335) 71e5e9cd17f8 qspeakers: 1.6.9 -> 1.6.10 1c63bc845d45 powerjoular: 1.0.4 -> 1.0.5 (#357330) 703ad4e4621e kando: 1.4.0 -> 1.5.1 e30607d35beb badger: 4.3.0 -> 4.4.0 c1ce95d12238 firefox-beta-unwrapped: 133.0b1 -> 133.0b9 502d2808e00e pinocchio: 3.2.0 -> 3.3.0 (#354231) 511ae6d1787e pomerium: 0.27.2 -> 0.28.0 89c0a1604a40 pnpm: 9.12.3 -> 9.14.2 a9da88a2443d vimPlugins.nvim-compe: deprecate for nvim-cmp (#357347) 48cecf92bf11 vimPlugins.one-nvim: mark broken 1dd96bb0f4ab bambu-studio: 01.09.07.52 > 01.10.01.50 2d8c1c8ece53 qdigidoc: fix TSL loading (#357428) 2d8bfa3908fb hugo: 0.138.0 -> 0.139.0 80903fe41a5a qidi-slicer-bin: init at 1.2.0 d689a03ba0dd feat: add completions to spacectl (#357298) 0179217fb753 vscode-extensions.jetmartin.bats: init at 0.1.10 68abfed4469d ferdium: 6.7.7 -> 7.0.0 2ebd316de967 libretro.mesen: unstable-2024-06-09 -> unstable-2024-10-21 (#357458) 0ab9444a4807 libretro.dosbox-pure: unstable-2024-09-28 -> unstable-2024-11-16 (#357457) 388e6c8570f3 libretro.fmsx: unstable-2024-06-28 -> unstable-2024-10-21 (#357448) 02748fd29e68 libretro.beetle-wswan: unstable-2024-06-28 -> unstable-2024-10-21 (#357421) 4c8643dedfad libretro.nxengine: unstable-2024-06-28 -> unstable-2024-10-21 (#357419) c3f6eb019d0d libretro.fceumm: unstable-2024-09-23 -> unstable-2024-10-16 (#357418) 5b45e5e8f4bf libretro.bsnes-hd: unstable-2023-04-26 -> unstable-2024-10-21 (#357416) d689d517a8c6 libretro.flycast: unstable-2024-10-05 -> unstable-2024-11-17 (#357397) 00302f0fc414 libretro.atari800: unstable-2024-10-01 -> unstable-2024-10-31 (#357394) c19c86c8d76f libretro.fuse: unstable-2024-09-20 -> unstable-2024-11-18 (#357389) cac46a4c6161 libretro.freeintv: unstable-2024-06-28 -> unstable-2024-10-21 (#357388) 4f0776b19ae5 snapcraft: 8.4.1 -> 8.5.0 78757d400f17 python3Packages.craft-providers: 2.0.3 -> 2.0.4 4daafb51e304 python3Packages.craft-cli: 2.7.0 -> 2.10.1 66b4c35cbf7d python3Packages.craft-application: 4.2.5 -> 4.4.0 f0921f180313 terraform-providers.vpsadmin: 1.0.0 -> 1.1.0 e8f7a3a902be nwg-dock-hyprland: 0.3.2 -> 0.3.3 c06dd23aad5e python312Packages.optree: 0.13.0 -> 0.13.1 (#355478) 79245ef3bb49 python3Packages.gower: init at 0.1.2 (#350747) d0004299491a python312Packages.internetarchive: 5.0.0 -> 5.0.4 (#357270) f5a231b9ef27 prowlarr: 1.25.4.4818 -> 1.26.1.4844 (#357362) 7d6d354a1535 cinny-desktop: fix build failure 26fbd1adbe13 nixos/bind: Fix cacheNetworks option fbbe972898fc Parallel GH actions workflow for Nixpkgs eval bbaf0abf9ce8 fishnet: add passthru.tests.version f17c1d575af7 openasar: 0-unstable-2024-09-06 -> 0-unstable-2024-11-13 (#357376) 21eb9f187e9a fishnet: format with nixfmt-rfc-style 2e46495ea8b4 fishnet: 2.9.3 -> 2.9.4 ef02dff02c57 searxng: 0-unstable-2024-10-05 -> 0-unstable-2024-11-17 bf2dfaa7c788 mission-center: use RUSTFLAGS to link libGL and libvulkan; adopt (#357219) 4a79221efa1f libreoffice-fresh: skip yet another test broken by noto-fonts mismatch 204eed4c293d harsh: 0.10.2 -> 0.10.4 9b9e2b3a9abf gossa: 1.0.0 -> 1.1.2 41c096f9400b ente-web: init at 0.9.5 (#325824) 029a990d27d1 linuxPackages.ipu6-drivers: unstable-2024-10-10 -> unstable-2024-11-19 162195d35b12 linuxPackages.ipu6-drivers: fix build on Linux >= 6.12 9d7cfd7a2a58 openmpi: 5.0.5 -> 5.0.6 (#357194) 8d0a59ce4bd3 museum: modernize (#357300) 304d33e04d2a opensc: fix darwin build 62062d14fbba gnuradioPackages.fosphor: init at unstable-2024-03-23 (#280805) 4f9c49eaa10a Add vimPlugins.{nvzone-menu,nvzone-minty,nvzone-volt} (#357120) 5a4df0c14f94 bfg-repo-cleaner: add passthru.tests.version 8ad7b50bf836 bfg-repo-cleaner: format with nixfmt-rfc-style 20a29cb94fbc bfg-repo-cleaner: 1.13.0 -> 1.14.0 eba5f5a14f24 zellij: 0.41.1 -> 0.41.2 (#357261) 1c5a8e39c91c tuisky: 0.1.3 -> 0.1.5 d6b051f13cc6 python312Packages.lightning-utilities: 0.11.8 -> 0.11.9 6a875dd68ff2 lact: 0.5.6 -> 0.6.0 (#356625) 05abac7a92c9 python311Packages.{pytensor,pymc}: fix hash 2d4dfc04b44a doc/stdenv: fix a typo a7d148279913 nixos/goatcounter: Fix typo in link (#357451) 009bee2d92ae ncdu: 2.6 -> 2.7 92ef6d4218db path-of-building.data: 2.49.0 -> 2.49.2 (#357324) 7219d5dc34cd terraform-providers.linuxbox: 0.4.3 -> 0.5.6 861cd0e0588f homepage-dashboard: 0.9.10 -> 0.9.12 10f3fe9c7a45 microfetch: 0.4.0 -> 0.4.1 c273eb28b66b postgresqlPackages.timescaledb_toolkit: 1.18.0 -> 1.19.0 1f2ee293c669 nixos/doc/rl-2505: mention timescaledb 993b24e1a106 postgresqlPackages.timescaledb: nixfmt 86706a140b96 postgresqlPackages.timescaledb: 2.14.2 -> 2.17.2 1418c2426b6e siyuan: 3.1.8 -> 3.1.13 d0df7756dfb5 upscaler: init at 1.4.0 (#356497) 04fc5728f4a0 Merge master into staging-next db1dc023b74b httpdirfs: 1.2.6 -> 1.2.7 72f462bdbafa pkgs/top-level/release.nix: Don't include non-Hydra attributes with attrNamesOnly 2a2670af0a62 util-linux: fix FreeBSD build ca8c96e77856 ocamlPackages.x509: 1.0.4 -> 1.0.5 6bf67e730169 hyprutils: 0.2.5 -> 0.2.6 73acdf801667 polyglot: init at version 3.5.1 df36d6b5558c fltk: don't propagate fontconfig bd20b3a25f0b giada: add missing fontconfig dependency 5a27cc051d11 maintainers: update email for cloudripper (#357459) 9e9e585ca7c0 giada: format d028ee002899 python312Packages.python-socks: 2.5.2 -> 2.5.3 97fc62f6c7c9 maintainers: update email for cloudripper 975d598911d1 libretro.mesen: unstable-2024-06-09 -> unstable-2024-10-21 79dee6b25af7 libretro.dosbox-pure: unstable-2024-09-28 -> unstable-2024-11-16 6a668a7390ee cardinal: nixfmt 58dba3b4da2a cardinal: fix cross-compilation ef58249afdb9 python312Packages.transformers: 4.46.2 -> 4.46.3 (#357179) 1a32ccd82ff2 febio: 4.7 -> 4.8; febio-studio: 2.7 -> 2.8.1 (#357044) 54300c25d87c llvmPackages_19: 19.1.3 -> 19.1.4 8c6ead6774e9 alist: 3.38.0 -> 3.39.2 (#356776) f862225a1168 python314: 3.14.0a1 -> 3.14.0a2 9256f91881a7 nixos/goatcounter: Fix typo in link e70f97033283 cypress: add x86_64-darwin support f995dcd4d7c8 cue: 0.10.1 -> 0.11.0 323260bb1bf1 cargo-binstall: 1.10.7 -> 1.10.13 9e5fd6fb86dc libretro.fmsx: unstable-2024-06-28 -> unstable-2024-10-21 bbeed35f79aa cue: format with nixfmt 727db04acdbb havn: 0.1.13 -> 0.1.16 ad430b1b0999 rainfrog: add passthru.tests.version 6e397f45c204 rainfrog: 0.2.9 -> 0.2.10 eaa1bb9980eb chromium,chromedriver: 131.0.6778.69 -> 131.0.6778.85 1e44a426213f gitify: init at 5.16.1 8f4995f169f4 febio-studio: 2.7 -> 2.8.1 54c4207c53f7 febio: 4.7 -> 4.8 3e29e0560db6 nixos/kanidm: add provisioning secret directories to BindReadOnlyPaths 5261c3cda1fd {febio, febio-studio}: darwin sdk refactor; fix qt 6.8 build (#352943) 950625e87d4b pure-maps: 3.3.0 -> 3.4.0 43fd10564f19 s2geometry: 0.9.0 -> 0.11.1 c4009cf979ec libsForQt5.mapbox-gl-qml: 2.1.1 -> 3.0.0 3b8d5ba32a68 libsForQt5.maplibre-native-qt: init at 3.0.0 1bbc9c2d23af qt6Packages.maplibre-native-qt: init at 3.0.0 4ba8b30cb0af igraph: 0.10.13 -> 0.10.15 (#354144) 229964fc095c python312Packages.forecast-solar: 3.1.0 -> 4.0.0 29d91d2c04a1 Merge master into staging-next cc671e2b6baa nixos/porn-vault: init module 2e32c0cb683b signalbackup-tools: 20241106-1 -> 20241119 2a1f893b6ac8 perlPackages.ModuleScanDeps: 1.34 -> 1.37 1cbb18a94ad1 komikku: 1.62.0 -> 1.63.0 (#356835) c331ca2f35b1 tart: 2.19.3 -> 2.20.2 (#357069) 0503d76d61f7 deltatouch: 1.6.0 -> 1.8.0 73da8726b34b hqplayer-desktop: 4.22.0-65 -> 5.8.2-25 b859583f0019 nostui: use upstream lock file 9342b5d01ca4 gurk-rs: 0.5.1 -> 0.5.2 (#356353) 0748a9a5ceb0 scalp: unstable-2022-03-15 -> 0-unstable-2024-08-28 (#355476) 0e29f0060834 qdigidoc: fix TSL loading e973c8a041be python3Packages.django-filingcabinet: init at 0-unstable-2024-11-15 (#355390) c565ccd3264f freebsd: improve overridability of entire package set 40ffbfdc9ecc remind: 05.00.07 -> 05.01.01 (#356987) 45573a309c26 xtreemfs: fix, format (#356725) 41cbe1fe2724 gurobi: 11.0.3 -> 12.0.0 7e897232c976 kodiPackages.jellyfin: 1.0.5 -> 1.0.6 (#357150) 54b5b8b06b87 gurobi: reformat f3f2f65e6343 lvtk: 1.2.0 -> 1.2.0-unstable-2024-11-06 6e68add23712 pugl: init at 0-unstable-2024-10-06 dcfb03639573 python312Packages.gurobipy: 11.0.3 -> 12.0.0 bcc8c9a34366 intentrace: 0.2.5 -> 0.2.6 7de6008292bc python312Packages.bidsschematools: 0.11.3 -> 0.11.3.post3 55883b6aaee9 sarasa-gothic: 1.0.23 -> 1.0.24 27bc5d4ffa43 unrar: 7.0.9 -> 7.1.1 (#354876) c5f9f667373e libretro.beetle-wswan: unstable-2024-06-28 -> unstable-2024-10-21 4167057b32b5 ghidra: add wasm extension b3f4b60d5744 grafana: 11.3.0+security-01 -> 11.3.1 a8b460a1b284 libretro.nxengine: unstable-2024-06-28 -> unstable-2024-10-21 47076ad186bf libretro.fceumm: unstable-2024-09-23 -> unstable-2024-10-16 a37d2451bc59 fossil: 2.24 -> 2.25 b3ad0735d25c libretro.bsnes-hd: unstable-2023-04-26 -> unstable-2024-10-21 fe58058517b1 freefilesync: 13.7 -> 13.8 (#354976) ce346ad65f55 docker-compose: 2.30.0 -> 2.30.3 (#356765) 9fa90c07cc0c obsidian: 1.7.6 -> 1.7.7 (#357028) 05baf0089983 ponysay: fix SyntaxWarning 4310011ecd44 audiobookshelf: 2.16.2 -> 2.17.1 (#357085) 5bdc0862bfc8 wordpress: 6.6.2 -> 6.7 (#356449) f2ef8616ad1c vimPlugins.nvim-compe: deprecate 026fb07f148b vimPlugins.compe-zsh: deprecate d737d9acce6d vimPlugins.compe-tabnine: deprecate b6b65d0cdabb vimPlugins.compe-latex-symbols: deprecate bac42af79592 vimPlugins.compe-conjure: deprecate 8ceedba559e6 Merge: postgresqlPackages: enable update scripts and update many packages (#356283) 8bc2cc19bb21 nixos/opendkim: modernize, add expandable settings option, put config file under standard location (#333758) 9cae926b64e8 python312Packages.manim: don't depend on texlive.ms 7cd5f8cda004 texlive: 2023-final -> 2024.20241027 692eda737849 libretro.flycast: unstable-2024-10-05 -> unstable-2024-11-17 b1fdd13376dd gale: 0.8.11 -> 1.1.4 daf338866c37 ams-lv2: Mark broken 0634959ae9c7 jankyborders: 1.6.0 -> 1.7.0 (#357012) 53f89aac37b4 sketchybar: 2.21.0 -> 2.22.0 (#357010) 8933720411d5 uhdm, surelog 1.83 -> 1.84-unstable-2024-11-09 (#355048) 47200403b09b libretro.atari800: unstable-2024-10-01 -> unstable-2024-10-31 cd6e087c1d60 python312Packages.mypy-boto3-rds-data: 1.35.28 -> 1.35.64 12656d4c8eb9 python312Packages.mypy-boto3-rds: 1.35.59 -> 1.35.64 264086a373da python312Packages.mypy-boto3-iotsitewise: 1.35.6 -> 1.35.64 e85117fad5c5 python312Packages.mypy-boto3-ecs: 1.35.52 -> 1.35.64 207d0510e832 python312Packages.mypy-boto3-ec2: 1.35.63 -> 1.35.64 3fd234ba10cd python312Packages.mypy-boto3-customer-profiles: 1.35.29 -> 1.35.64 04e2161a3641 python312Packages.mypy-boto3-connect: 1.35.52 -> 1.35.64 253efd634c34 python312Packages.mypy-boto3-cloudformation: 1.35.41 -> 1.35.64 d0fc17ba5623 libretro.fuse: unstable-2024-09-20 -> unstable-2024-11-18 5b0bbef7ed79 python312Packages.mypy-boto3-autoscaling: 1.35.56 -> 1.35.64 8274bdd3cef1 python312Packages.mypy-boto3-appconfig: 1.35.48 -> 1.35.64 fd2ac1783185 libretro.freeintv: unstable-2024-06-28 -> unstable-2024-10-21 d4585492ce4f gnumeric: unmark as broken on darwin (#357140) 57d376b81ad3 dxvk_2: 2.5 -> 2.5.1 (#357295) b14d46d1c885 tootik: 0.12.6 -> 0.13.0 (#357373) e9cdb0d29ba9 blockbench: 4.11.1 -> 4.11.2 171e081b7288 coqPackages_8_20.dpdgraph: init at 1.0+8.20 e9398b57e488 qsv: 0.131.1 -> 0.138.0, build simplification (#356504) 66d20ec16fc6 rubyPackages.ovirt-engine-sdk: set meta.broken c99c3597e16b aleo-fonts: init at 2.0.0-unstable-2023-06-03 0a54d674cb3b p4: fix darwin build e65ba64c2920 prowlarr: 1.25.4.4818 -> 1.26.1.4844 1f27d2599650 brave: 1.71.123 -> 1.73.89 (#355751) 70082c7ac381 perlPackages.Imager: 1.019 -> 1.025 (#356833) a541745ff457 prowlarr: 1.24.3.4754 -> 1.25.4.4818 (#355016) 258174aeadb0 nixos/pay-respects: actually import the module (#356231) 5b22f50b397b k3s: 1.28.14+k3s1 -> 1.28.15+k3s1, 1.29.9+k3s1 -> 1.29.10+k3s1 (#356795) a9fe8ba0e4ef openasar: 0-unstable-2024-09-06 -> 0-unstable-2024-11-13 0082fde43de4 notmuch: move the vim plugin to another output 9fa35efd945c fishPlugins.spark: init at 1.2.0 (#357047) 685925b5d259 python312Packages.sentence-transformers: 3.3.0 -> 3.3.1 (#357102) 54d69a3c7942 ungoogled-chromium: 130.0.6723.116-1 -> 131.0.6778.69-1 875ae81fe547 chromium,chromedriver: 130.0.6723.116 -> 131.0.6778.69 8dd2f1add978 chromium: fetch src from git instead of using release tarball 4099ca5139a4 postgresqlPackages.timescaledb: add kirillrdy to maintainers d07cf2170429 tootik: 0.12.6 -> 0.13.0 ebb40bd5c29f chromium: remove "channel" argument acb352bd56eb python312Packages.pubnub: 9.0.0 -> 9.1.0 db29b761820c whitesur-kde: 2022-05-01-unstable-2024-11-01 -> 2024-11-18 a113a85dfa69 sbomnix: 1.6.1 -> 1.7.0 4e75fe3db61c gitqlient: 1.6.2 -> 1.6.3 f6e999d1b465 jwm: 2.4.5 -> 2.4.6 bf476a1d006a python312Packages.uproot: 5.4.1 -> 5.5.0 f002b218c2a4 python312Packages.awkward-pandas: init at 2023.8.0 42196ae6e122 python312Packages.awkward: 2.6.9 -> 2.7.1 b1ae817db5ae python312Packages.awkward-cpp: 39 -> 42 63b1496a2ce3 tuxguitar: nixfmt 1190fe0c1913 freecad: 1.0rc4 -> 1.0 55a51905434f libdeltachat: use fetchCargoVendor 6c4d710b9452 rustPlatform.buildRustPackage: allow specifying cargoDeps a254cdb551a3 walker: 0.7.7 -> 0.8.12 (#357049) 6b8507d724ad hyprlauncher: 0.1.2 -> 0.2.2 6e1436d0ad20 vvenc: 1.12.0 -> 1.12.1 (#357104) 1ce9b2ab3e56 saunafs: 4.5.1 -> 4.6.0 553bcb3688b4 python312Packages.flow-record: 3.17 -> 3.18 26b1258a937c rabbitmq-server: fix management agent crash when calling ps on macOS (#357337) f1f20757721e meilisearch: migrate to the new macOS SDK (#357277) 3c6b18fcb0d5 ocamlPackages.luv: fix clang build (#356635) 85254f32ee28 Merge master into staging-next dffdc71078d2 python312Packages.language-data: 1.2.0 -> 1.3.0 931f25ebdf30 clash-rs: 0.7.0 -> 0.7.1 d19bc236cffa nixos/release-notes-24.11: add scx module 3e710e6d15bd nixos/scx: init 7a1656b23006 spacectl: add shell completions 17840289bd67 python312Packages.dissect: 3.16.1 -> 3.17 (#357064) 63cc45e9eabd git-smash: init at 0.1.1 e7e3755d3502 rabbitmq-server: migrate to the new macOS SDK b5b85d068355 ccze: 0.2.1-2 -> 0.2.1-8, move to by-name (#354257) c11dc6f65c53 gap: 4.12.2 -> 4.13.1 c0f0acb78745 sage: 10.4 -> 10.5.rc0 9660fc3945d1 tuxguitar: format 36be531246b8 neovimUtils.grammarToPlugin: improve error message on invalid grammarPlugins (#357062) d6a0449d1021 freecad: make customizable (#347776) 2174b6acb905 rabbitmq-server: fix management agent crash when calling ps on macOS 76193bc2e99e libretro.mame: unstable-2024-10-04 -> unstable-2024-11-01 (#357287) e2cd38ef29c0 libretro.bluemsx: unstable-2024-10-01 -> unstable-2024-10-22 (#357291) 4a2ec7480a12 plumber: 2.7.1 -> 2.8.0 6164bad0ac0b Revert "opentelemetry-collector-contrib: 0.110.0 -> 0.112.0" (#357322) f98575959275 powerjoular: 1.0.4 -> 1.0.5 fe94d7da5ccb showtime: 46.3 -> 47.0 (#357248) d7fa8356942c path-of-building.data: 2.49.0 -> 2.49.2 f739f88a2f9f Revert "opentelemetry-collector-contrib: 0.110.0 -> 0.112.0" 95a65bf0a340 spotifyd: 0.3.5-unstable-2024-09-05 -> 0.3.5-unstable-2024-10-21 (#354328) 11be03b319bf rustup: add missing rust-darwin-setup script for ld-wrapper (#357314) 66d5ae1b3ebb morphosis: 1.3 -> 1.4.1 78dbb1f98cc9 vibrantlinux: 2.1.10 -> 2.2.0 (#304265) bca5ad68f099 goimports-reviser: 3.6.5 -> 3.7.4 d7bead5e624b prismlauncher-unwrapped: adopt new darwin SDK pattern (#357193) 739e9ee35f97 tuxguitar: apply suggestions 969ad19f9de5 nixos/monado: nixfmt b6af12e739f4 vibrantlinux: nixfmt f2ea5ad6a970 vibrantlinux: 2.1.10 -> 2.2.0 74ed1f82de55 libvibrant: nixfmt 462aa0d28222 libvibrant: 2100c09 -> 1.1.1 15e49d961bce meilisearch: migrate to the new macOS SDK bf20efd03cf6 rustPlatform.fetchCargoVendor: retry fetching tarballs (#357262) a4d711538eb9 treewide: migrate to the new rust fetcher (#356385) 34845dd5f012 go9p: init at 0.25.0 262b6bfde05b easyeffects: fix bug 'missing spectrum analyzer' (#344971) f89fd475c539 home-assistant-custom-components.xiaomi_miot: 0.7.21 -> 0.7.23 (#356947) fc1a0e3323ef nginx: upgrade pcre to pcre2 (#355989) 72e71af45972 rustup: add missing rust-darwin-setup script for ld-wrapper 64b5366ca540 gotemplate: 3.9.2 -> 3.10.1 (#356248) 1adaf376f2ec toml-sort: 0.23.1 -> 0.24.2 7943ba552686 museum: modernize 13d6e15352c0 github-runner: 2.320.0 -> 2.321.0 (#356300) 7cea3c6f75aa forgejo: use major version to target upgrade stream (#356593) 9cfd9e48303b dxvk_2: 2.5 -> 2.5.1 7d285821e9a4 wttrbar: 0.11.0 -> 0.11.2 (#357015) ffca9203bc16 jfrog-cli: 2.71.0 -> 2.71.4 (#355952) d91630e9955f vimPlugins.nvzone-menu: init 2024-11-06 8c7162fd2c54 vimPlugins.nvzone-minty: init 2024-11-16 dd90985ce908 zellij: misc cleaning 4dd5091bc4c0 zellij: use versionCheckHook instead of passthru.tests.version cbe59f30e699 Merge: strace: 6.11 -> 6.12 (#357084) 4f681fdcdddb amiri: 1.000 -> 1.001 0ecc88f77d4a `buildGoPackage`: remove (#349478) 09a0f56f1536 Merge: libpqxx: 7.7.5 -> 7.9.2 (#356414) d33fc745e4c6 zellij: 0.41.1 -> 0.41.2 c45f48cdee19 vimPlugins.nvzone-volt: init 2024-11-17 f853f8381e8e libretro.bluemsx: unstable-2024-10-01 -> unstable-2024-10-22 c2c256bdf803 libretro.mame: unstable-2024-10-04 -> unstable-2024-11-01 c1465c887fca python312Packages.sentence-transformers: 3.3.0 -> 3.3.1 710751d11903 ccze: 0.2.1-2 -> 0.2.1-8 7d8f4d6b449e ccze: move to pkgs/by-name, nixfmt as a result f8b656d071eb cardinal: add headless argument (#357100) f49c90926990 python3Packages.mandown: relax pillow dependency (#357190) 8f5d8862b2ee icloudpd: 1.24.3 -> 1.24.4 (#357203) e76a86e8c901 php81Extensions.zstd: 0.13.3 -> 0.14.0 (#357128) 0903b4388774 bpftune: 0-unstable-2024-06-07 -> 0-unstable-2024-10-25 (#357103) 7ba1fd603ad0 buildkite-agent: 3.86.0 -> 3.87.0 (#357074) 277475ce8bf3 flyctl: 0.3.29 -> 0.3.37 (#357076) 90b61cadeb80 nfpm: 2.40.0 -> 2.41.1 (#357077) 7c1f286645fc telegram-desktop: 5.8.1 -> 5.8.2 fe8fdf8ff2a3 nixos/snapserver: restart systemd service on failure (#356584) bb6e579b1acb graphite-cli: 1.4.6 -> 1.4.8 (#356844) 4feae6f2dd51 xst: 0.9.0 -> 0.10.0 (#357018) dda894cd3576 ttdl: 4.4.1 -> 4.5.0 (#357055) ec33f3c216b9 python312Packages.dissect-hypervisor: 3.15 -> 3.16 (#357059) 4d743e2921b0 python312Packages.dissect-ntfs: 3.12 -> 3.13 (#357073) 966d77153343 circleci-cli: 0.1.30995 -> 0.1.31151 (#357133) 2aec3b3f4a6a doppler: 3.69.1 -> 3.69.2 (#357134) 5ae12690467c geoipupdate: 7.0.1 -> 7.1.0 (#357136) dade5bb29e2a cargo-about: 0.6.4 -> 0.6.5 (#357143) 91ebbff91b10 python312Packages.docling-ibm-models: 2.0.3 -> 2.0.4 (#357147) b05dbffa6083 pantheon.switchboard-plug-sound: 8.0.0 -> 8.0.1 07bc54886b48 plantuml-server: 1.2024.7 -> 1.2024.8 (#357151) 7b7afdd895ce python312Packages.holidays: 0.60 -> 0.61 (#357158) 853d34898d84 nixos-containers: fix enableTun option 40d57e2dad1c blasfeo: 0.1.3 -> 0.1.4 d10efaffc57b aws-iam-authenticator: 0.6.27 -> 0.6.28 (#357160) 86861776c579 trivy: 0.57.0 -> 0.57.1 (#357171) 6d50139bc5ec python312Packages.optuna: 4.0.0 -> 4.1.0 (#355324) 22bfa583a536 cirrus-cli: 0.131.2 -> 0.132.0 (#357175) b0e61b05b538 libretro.virtualjaguar: unstable-2023-06-01 -> unstable-2024-10-21 (#357247) 2316ef147f36 libretro.parallel-n64: unstable-2024-06-29 -> unstable-2024-10-21 (#357251) 02b4591f5d87 libretro.puae: unstable-2024-09-25 -> unstable-2024-10-19 (#357252) 7409575d4a5b python312Packages.edalize: 0.5.4 -> 0.6.0 (#355825) b2aa67fb8190 iio-oscilloscope: init at 0.17 9b06b41c3c70 libretro.hatari: unstable-2024-10-01 -> unstable-2024-10-21 (#357255) 470ceca789ca python312Packages.internetarchive: 5.0.0 -> 5.0.4 1422e691d298 keypunch: add updateScript c3e908363d50 python312Packages.tubeup: switch to pypa builder 63839c6b9a84 python312Packages.google-cloud-bigtable: 2.26.0 -> 2.27.0 (#355831) f65de0f46acf nixos/doc/rl-2411: add highlight for the Darwin changes (#356689) 88fdfabb681f k3s: fix commit output of update script (#356786) 818bf628e8a6 python312Packages.fakeredis: 2.25.1 -> 2.26.1 (#356810) 85dbb578ca91 python312Packages.dissect-xfs: 3.10 -> 3.11 (#357025) 65bedf21c407 python312Packages.dissect-archive: 1.2 -> 1.4 (#357024) d8392c77b8f4 wayclip: init at 0.4.2 5b1d92d86bf2 python312Packages.dissect-extfs: 3.11 -> 3.12 (#357038) c75ffad5b6b1 python312Packages.dissect-vmfs: 3.9 -> 3.10 (#357043) 1f353bff5e04 python312Packages.dissect-ffs: 3.9 -> 3.10 (#357045) 058ea3f007e1 python312Packages.dissect-fat: 3.10 -> 3.11 (#357040) d9bfc17d4f21 OWNERS: add TomaSajt as owner for fetchCargoVendor (#357256) a9f74d6f77d4 python312Packages.acquire: 3.16 -> 3.17 (#357058) 6d967c01005e dooit: 3.0.3 -> 3.0.4 (#357016) 66b277980572 python312Packages.dissect-hypervisor: 3.15 -> 3.16 63565778a296 rustPlatform.fetchCargoVendor: retry fetching tarballs e00129e6cdec python312Packages.dissect-squashfs: 1.7 -> 1.8 (#357061) 83ccbe851b77 python312Packages.jaxtyping: 0.2.34 -> 0.2.36 (#356885) 5113c488afae nixos/doc/rl-2411: add highlight for the Darwin changes a80e3605e53b steampipe: 0.24.2 -> 1.0.0 (#357207) 91ed69e7b797 OWNERS: add TomaSajt as owner for fetchCargoVendor 7031d0fdd0c5 nixos/snapserver: restart the systemd service on failure dde8ee11792f nixos/shairport-sync: restart the systemd service on failure ee8dd8697567 libretro.hatari: unstable-2024-10-01 -> unstable-2024-10-21 c4c6f5030209 home-assistant-custom-components.xiaomi_miot: add meta.longDescription, remove `with lib` 2a3b26f7148c gh-dash: 4.7.1 -> 4.7.3 (#357178) b500c3a935a8 libretro.puae: unstable-2024-09-25 -> unstable-2024-10-19 49e038512f35 libretro.gpsp: unstable-2024-10-01 -> unstable-2024-10-21 (#357223) e75f747cc519 libretro.snes9x2002: unstable-2024-06-28 -> unstable-2024-10-21 (#357225) 4ff524497758 libretro.snes9x2010: unstable-2024-06-28 -> unstable-2024-11-18 (#357226) 3362a1bedb94 libretro.quicknes: unstable-2024-06-28 -> unstable-2024-10-21 (#357227) 645133d1f018 showtime: 46.3 -> 47.0 b71a30d88d30 libretro.parallel-n64: unstable-2024-06-29 -> unstable-2024-10-21 452d89869c18 libretro.virtualjaguar: unstable-2023-06-01 -> unstable-2024-10-21 30392773af69 openbsd_snmp3_check: fix overuse of with lib af51a7fb84ce manubulon-snmp-plugins: fix overuse of with lib 32cb2b2abe5a check_interfaces: fix overuse of with lib 810fcd88f8c0 tuxguitar: fix start script 293c377b4299 azure-cli-extensions.deidservice: remove 7a9a2d8f34e1 gnome-maps: fix cross compilation 3e9804ac0e84 wlink: fix overuse of with lib 240d44bc7475 gjs: assign meta.mainProgram e848c96f570c wchisp: remove overuse of with lib f1ca5602e7f0 azure-cli-extensions.amg: 2.5.2 -> 2.5.3 018c46d3d93a azure-cli-extensions.azure-firewall: 1.2.1 -> 1.2.2 aa3c25d68ea9 azure-cli-extensions.mdp: 1.0.0 -> 1.0.1 832131c99609 azure-cli-extensions.connectedmachine: 1.0.0 -> 1.1.0 70a1a9985e18 azure-cli-extensions.dns-resolver: 0.2.0 -> 1.0.0 e3a1939d6375 azure-cli-extensions.devcenter: 6.0.1 -> 6.1.0 dfbfc3eba3bb azure-cli-extensions.healthcareapis: 0.4.0 -> 1.0.0 9c8b4e76ded9 azure-cli-extensions.aks-preview: 13.0.0b1 -> 13.0.0b2 83c666c07c05 Merge master into staging-next 9a04a63f7c8c azure-cli: 2.66.0 -> 2.67.0 2970e5aaed68 python312Packages.azure-mgmt-postgresqlflexibleservers: 1.0.0 -> 1.1.0b1 b1182e548ab2 luminance: init at 1.1.0 d4ea27eb318e gtk4-layer-shell: fix cross compilation 9314da7ee8d2 Format 989f43ffaeea libretro.quicknes: unstable-2024-06-28 -> unstable-2024-10-21 392ca63d8b66 libretro.snes9x2010: unstable-2024-06-28 -> unstable-2024-11-18 b57fcf1cec2b libretro.snes9x2002: unstable-2024-06-28 -> unstable-2024-10-21 49964a0aa8da libretro.gpsp: unstable-2024-10-01 -> unstable-2024-10-21 19b4b39db4b0 hercules-ci-cnix-store/nix: 2.18 -> 2.24 fa47863e66c9 keypunch: add getchoo to maintainers 3b9f89bf4988 keypunch: 3.1 -> 4.0 c0d4dcc6fdb1 ente-web: init at 0.9.16 ee93a4f541cd haskellPackages.hercules-ci-agent: 0.10.4 -> 0.10.5 5092b77f7353 haskellPackages.hercules-ci-cnix-expr: 0.3.6.4 -> 0.3.6.5 e62e4c5dd8c2 haskellPackages.hercules-ci-cnix-store: 0.3.6.0 -> 0.3.6.1 56e2eb4d1ae5 mission-center: add getchoo to maintainers dd78a15b79aa mission-center: use RUSTFLAGS to link libGL and libvulkan 1110e5fe642a haskell-modules: Add replacements-by-name 4545329a81e4 jellyfin{,-web}: 10.10.1 → 10.10.2 963a14beaf32 mydumper: add version tests 69e0b18a2c62 steampipe: 0.24.2 -> 1.0.0 e65f4c7c1c5f 2024.17 -> 2024.18 3431d2041aeb upscaler: init at 1.4.0 6da00ff00301 upscayl-ncnn: init at 20240601-103425 73db838c1526 python312Packages.vulkan: init at 1.3.275.1 0af8b18cef1a python3Packages.gower: init at version 0.1.2 1902b4da5ebe icloudpd: 1.24.3 -> 1.24.4 5b88237651f4 silx: init at 2.1.1 704efbd9aa34 opencomposite: add meta.platforms f407e86350d6 prismlauncher-unwrapped: adopt new darwin SDK pattern 80ef2d8496ac librewolf: 132.0.1 -> 132.0.1-1 535667f0de57 maintainers: add dwrege fdd511f607b8 python3Packages.mandown: relax pillow dependency 27df1baaf14b enscript: add meta.mainProgram b978799f7162 lib.types.defaultTypeMerge: refactor functor.{payload,wrapped} merging df5830d01308 gpauth: limit platforms to *-linux 44b90a2cc040 python312Packages.docling-ibm-models: 2.0.3 -> 2.0.4 ac5f925c6cf9 gnuradioPackages.fosphor: init at unstable-2024-03-23 91012254f9fc gh-dash: 4.7.1 -> 4.7.3 2790c1ffe2d8 cirrus-cli: 0.131.2 -> 0.132.0 b2d20baecb52 trivy: 0.57.0 -> 0.57.1 21dea5914a26 waypipe: 0.9.1 -> 0.9.2 551322fdc4c9 python312Packages.transformers: 4.46.2 -> 4.46.3 f12447419641 sea-orm-cli: 1.0.1 -> 1.1.1 a541719b89bc Merge master into staging-next 8d286f8b476a alist: 3.38.0 -> 3.39.2 f745acf8bfd3 aws-iam-authenticator: 0.6.27 -> 0.6.28 ae6bb83a839b pdfium-binaries: fix updateScript bbedfbd065aa waveterm: fix hash mismatch adc249a54362 python312Packages.holidays: 0.60 -> 0.61 9476d9bfc266 pinact: add updateScript a058f359f8d2 pinact: simplify testers.testVersion dd9f103ceb9d pinact: format with nixfmt-rfc-style deb1a12a2cdf plantuml-server: 1.2024.7 -> 1.2024.8 e91bfbafead3 kodiPackages.jellyfin: 1.0.5 -> 1.0.6 9e335902fb3e gurk-rs: 0.5.1 -> 0.5.2 869c8565c618 gnumeric: unmark as broken on darwin 7d2908b81b65 sydbox: update meta.homepage 458173b1f71a viddy: 1.2.0 -> 1.2.1 6ec7f3a32fb4 viddy: fix update script b33a0b8886e3 geoipupdate: 7.0.1 -> 7.1.0 89e9ffad6d2e doppler: 3.69.1 -> 3.69.2 ba2a6b2c8b24 circleci-cli: 0.1.30995 -> 0.1.31151 c4b45f802cbb cargo-about: 0.6.4 -> 0.6.5 7caf0ad318a0 Fix indent style issue: use spaces not tabs ac305d692065 Hardcode version in package url as version attribute doesn't work fa810d82d943 php81Extensions.zstd: 0.13.3 -> 0.14.0 7b7a0d946313 Add link to the changelogs associated with patch f6f1f031038f remove empty line 06f8b75c3c00 use hash instead of sha256 attribute dd5fda8f0b8c use attribute instead of hardcoded version in package url bec44da823f7 Use postPatch instead of prePatch to apply fix 3d0e3156eafb amazon-cloudwatch-agent: init at 1.300049.1 b515f2811b67 backblaze-b2: 4.0.1 -> 4.2.0 e68fd2655521 Merge master into staging-next 1c82a1d6bf23 vvenc: 1.12.0 -> 1.12.1 74725fa54aae python312Packages.distutils: unbreak on Darwin 40891fc81942 bpftune: 0-unstable-2024-06-07 -> 0-unstable-2024-10-25 91726a756e03 cardinal: add headless argument 84a3cd93612f openresty: 1.25.3.2 -> 1.27.1.1 cc0d0e84165b faircamp: 0.15.1 -> 0.21.0 c35f615aea0c dragmap: init at 1.3.0 b27623aebee2 strace: 6.11 -> 6.12 34941a6aa430 step-ca: 0.27.5 -> 0.28.0 272ae2396694 railway: 3.17.10 -> 3.18.0 b5c19b4cb003 fuzzel: support building with librsvg backend 002cd3366ad6 hcloud: 1.48.0 -> 1.49.0 48a33a4df5b0 nfpm: 2.40.0 -> 2.41.1 74989eae3c81 flyctl: 0.3.29 -> 0.3.37 ab95b3badffa jfrog-cli: 2.71.0 -> 2.71.4 dd47611368ab gotemplate: 3.9.2 -> 3.10.1 2b6705529cdf buildkite-agent: 3.86.0 -> 3.87.0 5d4a036789dd python312Packages.dissect-ntfs: 3.12 -> 3.13 59dc99c57ee2 whitesur-gtk-theme: 2024.09.02 -> 2024-11-18 600f8504be7f neovimUtils.grammarToPlugin: improve error message on invalid grammarPlugins b172e87e42ea python312Packages.dissect-shellitem: disable Windows-specific tests a2d3a6232143 tart: 2.19.3 -> 2.20.2 130dc0114e67 osquery: 5.13.1 -> 5.14.1 ed59aeca7857 audiobookshelf: 2.16.2 -> 2.17.1 315b1ac93d9c remind: 05.00.07 -> 05.01.01 1a03c1d3835c git-prole: 0.5.1 -> 0.5.3 a3e65a509739 python312Packages.dissect: 3.16.1 -> 3.17 e527515209c9 python312Packages.acquire: 3.16 -> 3.17 2a6911efcaec python312Packages.dissect-btrfs: 1.5 -> 1.6 ca14d572fad7 python312Packages.dissect-xfs: 3.10 -> 3.11 13d7d7f76554 python312Packages.dissect-volume: 3.12 -> 3.13 676c03fdec71 python312Packages.dissect-vmfs: 3.9 -> 3.10 12ccd08f81cb python312Packages.dissect-util: 3.18 -> 3.19 fd6877887185 python312Packages.dissect-target: 3.19 -> 3.20 b993ecc4fba2 python312Packages.dissect-ntfs: 3.12 -> 3.13 34ea462cf676 python312Packages.dissect-hypervisor: 3.15 -> 3.16 c6bde9bed238 python312Packages.dissect-ffs: 3.9 -> 3.10 1ceec6f169a0 python312Packages.dissect-fat: 3.10 -> 3.11 cd8fa06e7c39 python312Packages.dissect-extfs: 3.11 -> 3.12 05705021a69c python312Packages.dissect-squashfs: 1.7 -> 1.8 4e4934e1a800 python312Packages.dissect-cstruct: 4.2 -> 4.3 7fcc05ff4a9c python312Packages.flow-record: 3.17 -> 3.18 c2c3fab717d6 python312Packages.azure-mgmt-network: 27.0.0 -> 28.0.0 056c5486edc7 python312Packages.dissect-squashfs: 1.7 -> 1.8 7ce39af03733 remove old Darwin SDK pattern (#354146) e76d13e9ba71 python312Packages.acquire: 3.16 -> 3.17 23cd038879f9 nixVersions.latest: set to nix 2.25 b3d4323124a1 nix: remove unused paranthese/nixVersions variable b3676d1ee144 nixVersions.nix_2_25: add missing python build dep for mdbook dc824a6bb9e3 ttdl: 4.4.1 -> 4.5.0 392b7a8718e3 xtreemfs: move `which` to `nativeBuildInputs` 273837695aa0 pingvin-share: 1.3.0 -> 1.4.0 fe0d4782250b walker: 0.7.7 -> 0.8.12 2a8b6e9721c0 fishPlugins.spark: init at 1.2.0 8e03d427e07c linux_xanmod_latest: 6.11.7 -> 6.11.9 36f09e35b6bb linux_xanmod: 6.6.60 -> 6.6.62 ca3abfe7941f python312Packages.dissect-ffs: 3.9 -> 3.10 746aa66e6bbb Merge master into staging-next 8bd9aca92eba python312Packages.dissect-vmfs: 3.9 -> 3.10 10f85c7f70b1 python312Packages.dissect-fat: 3.10 -> 3.11 e89aa1c16663 python312Packages.dissect-extfs: 3.11 -> 3.12 f0119d67e47a kernelPackages.ivsc-driver: mark as broken on kernels >= 6.9 05a28af51bc4 .github/labeler.yml: add ruby label for gem changes 31b53417f3cd obsidian: 1.7.6 -> 1.7.7 39e09b167374 python312Packages.jaxtyping: 0.2.34 -> 0.2.36 ee22085aeb51 openmpi: 5.0.5 -> 5.0.6 a16a1449a0e8 prrte: 3.0.5 -> 3.0.6 cfc679cb9480 python312Packages.dissect-xfs: 3.10 -> 3.11 3bacf66e418f python312Packages.dissect-archive: 1.2 -> 1.4 2e61f3236def febio-studio: fix qt 6.8 build d14392eaf6c6 nixos/obs-studio: nullable package c71c783fa90a xst: 0.9.0 -> 0.10.0 0ab169c6ef59 dooit: 3.0.3 -> 3.0.4 ae4e1dfb3d03 wttrbar: 0.11.0 -> 0.11.2 7eb17a4ecc92 jankyborders: 1.6.0 -> 1.7.0 68fca2812bca sketchybar: 2.21.0 -> 2.22.0 822966abb9ca rubyPackages.ncursesw: 1.4.10 -> 1.4.11 692c9fdbfaf5 vivaldi: use coreutils from nixpkgs f673b7793387 harlequin: enable tests e3b12254fbdc python312Packages.sqlfmt: refactor 2702f06d51f9 harlequin: 1.25.0 -> 1.25.2 add9ba09bbad python312Packages.textual-fastdatatable: refactor f6ce634c1bb7 python312Packages.accuweather: 3.0.0 -> 4.0.0 71936fca9802 corretto{11,17,21}: {11.0.24.8.1,17.0.12.7.1,21.0.4.7.1} -> {11.0.25.9.1,17.0.13.11.1,21.0.5.11.1} 29d327062dfa wluma: 4.4.0 -> 4.5.1 f27f1e093192 nixos/tests/rmfakecloud: new test 64a13b7609c4 nixos/rmfakecloud: remove outdated note about webui not included 6059f5ad4e78 rfmakecloud: 0.0.18 -> 0.0.21 b15ed174fabb rmfakecloud: run nixfmt 927bf0fee446 tetragon: 0.1.1 -> 1.2.0 41d71362538e buildGoModule: remove goPackagePath warning 2ac1f685b699 docs: update Go section after buildGoPackage removal 201985dc663e python312Packages.textual-textarea: refactor da277264a1fa python312Packages.textual-textarea: 0.14.2 -> 0.14.4 3c2d602caa06 python312Packages.textual-fastdatatable: 0.9.0 -> 0.10.0 ba407dd26b38 python312Packages.textual: 0.82.0 -> 0.86.1 d1cae02bdf0a python312Packages.dask-ml: fix darwin build 783f44cd4ebb python312Packages.dask: 2024.10.0 -> 2024.11.2 c5facb4c7df9 python312Packages.distributed: 2024.10.0 -> 2024.11.2 b594649f43fa python312Packages.dask-expr: 1.1.16 -> 1.1.19 216274522546 yt-dlp: 2024.11.4 -> 2024.11.18 03e9fb3803d7 home-assistant-custom-components.xiaomi_miot: 0.7.21 -> 0.7.23 73b6567c4122 doc: change allowInsecurePredicate example to a useful one c55b0f39469f python3Packages.django-filingcabinet: init at 0-unstable-2024-11-15 3132e3a3faff Merge master into staging-next 8a8e34934205 mpvScripts.autosub: init at 2021-06-29 306de5acc38c maintainers: add octvs as maintainer 6224134d7fa3 melodeon: 0.4.2 -> 0.4.3 97954a8515b0 quill: remove `with lib` from meta b5938e6b8c3c quill: 0.2.17 -> 0.5.1 347a3dd6b4ad showmethekey: 1.15.1 -> 1.16.0 1c8cc3b48810 databricks-cli: 0.229.0 -> 0.234.0 da4a805906b5 ibm-plex: add @ryanccn as maintainer 18ad5961d2b8 ibm-plex: 6.4.0 -> 1.1.0 16ec17e63006 quill: use `useFetchCargoVendor` 3d728b1d9af8 quill: format using nixfmt accaac8bb26f python312Packages.uarray: 0.9.0 -> 0.9.1 a7ab6aa51a14 doc: notice freecad customization an changelog 71f8956ee40b freecad: add tests for modules d3c8c86ac4b5 freecad: make customizable 063fa684a47f freecad: take in account module-path argument 7dad6b2d9f72 qsv: use `useFetchCargoVendor` instead of vendoring Cargo.lock d887275508bb pythonPackages.fabio: init at 24.4.0 b5849962dfb4 python312Packages.manifold3d: 2.5.1 -> 3.0.0 484e8beb12eb python312Packages.dbt-semantic-interfaces: 0.7.4 -> 0.8.1 9715e65d53e1 python312Packages.asyncwhois: 1.1.5 -> 1.1.9 ae1d8fc4da79 msgraph-cli: init a 1.9.0 4ad10975ec3f buildGoPackage: remove 59f03191ea00 Merge remote-tracking branch 'origin/master' into staging-next 8e9dc9f2febe Merge master into staging-next 0571bf83315d manifold: 2.5.1-unstable-2024-11-08 -> 3.0.0 f7ab39e5253c php: support two- and zero-argument overrideAttrs forms 3835c5a3f813 bite: 0.2.1 -> 0.3, fix x86_64-darwin build df1ec7d0937f freebsd.mkDerivation: move all environment variable declarations into env attrset c4b1d21e7be8 rcp: 0.13.0 -> 0.15.0 337b2fd99d13 freebsd.localedef: Fix formatting 623ecef987c4 freebsd: set `BOOTSTRAPPING` when building for Linux bc6d8e18bb21 python3Packages.sopel: Added missing package and missing meta.MainProgram 18b60a0ba298 graphite-cli: 1.4.6 -> 1.4.8 e3b55d3c6af3 perlPackages.Imager: 1.019 -> 1.025 5c96d47ddd42 komikku: 1.62.0 -> 1.63.0 db1d5cf76b0b github-runner: 2.320.0 -> 2.321.0 c8145a308cf9 prometheus-aruba-exporter: init at unstable-2023-01-18 934079c635cd fetchsvn: add system certificate authorities bundle d753a00a5a84 mullvad-vpn: 2024.6 -> 2024.7 6728211ec862 nixos/kanidm: allow origin url ending without slash 542c7dc59032 zrok: 0.4.39 -> 0.4.44 5c7471db6805 telegram-desktop: 5.8.0 -> 5.8.1 088f1e641b8c workflows/check-nix-format: reminder to rebase f497159195ef nixos/opendkim: put config file under standard location 1414b222f52b nixos/opendkim: add expandable settings option dfac70cb1d3a nixos/opendkim: modernize 479610e789a8 qsv: 0.131.1 -> 0.138.0 a9646b1400b9 python312Packages.fakeredis: 2.25.1 -> 2.26.1 acae8e9cc9bd python312Packages.readchar: 4.2.0 -> 4.2.1 3b48d0996c2f python3Packages.inject: init at 5.2.1 1e62ea6e0286 k3s_1_29: 1.29.9+k3s1 -> 1.29.10+k3s1 44c83e338dce k3s_1_28: 1.28.14+k3s1 -> 1.28.15+k3s1 bf6dafd182e0 sydbox: add getchoo to maintainers d02439295ca7 sydbox: add version test 3fe4a6a95caf sydbox: add updateScript 4929c87fed38 sydbox: add meta.mainProgram & cleanup meta 6272893175fc sydbox: 2.2.0 -> 3.28.3 6be7fb37a63d python3Packages.django-ninja: 1.3.0 -> 1.3.0-unstable-2024-11-13 027e77778c87 nixos/hostapd: allow octothorpe characters in SAE password adaf5f9b58aa maintainers: drop luc65r 7c66fb1ec583 migrate maintainership from luc65r to clevor 85900bc270cb k3s: fix commit output of update script 3b28568c6dd9 Merge master into staging-next eb80f0baa32c wealthfolio: 1.0.18 -> 1.0.21 40b196272f18 flclash: 0.8.67 -> 0.8.68 6558e173f902 python312Packages.python-whois: 0.9.4 -> 0.9.5 0813984e5473 docker-compose: 2.30.0 -> 2.30.3 572e623305c0 glib: disable sysprof feature on FreeBSD 8330c77eab5d ocamlPackages.luv: backport patch; fix clang build 640a6391c7cf netbird-dashboard: 2.5.0 -> 2.7.0 13a26c516c2a jami: 20240823 -> 20241031.0 4f0861ca1f9d telegram-desktop: 5.7.1 -> 5.8.0 b9932292ede7 xtreemfs: format 0cad06d22a61 xtreemfs: fix build d1da56f629d7 wordpressPackages: package and theme updates 5705ab5bc501 wordpress: 6.6.2 -> 6.7 6b4dfe719935 jami: fix build with libgit2 1.8.4 b143a809ea1d gping: 1.17.3 -> 1.18.0 18824744152c Merge master into staging-next 140939daca74 emacsPackages.lspce: 1.1.0-unstable-2024-09-07 -> 1.1.0-unstable-2024-10-07 d1455f5bce93 sydbox: format with nixfmt 8191db9d69ed snac2: 2.59 -> 2.63 0db89be68f17 Merge master into staging-next 5f047b8cc62d otb: init at 9.0.0 1d3663186c37 shark: init at 4.0-unstable-2024-05-25 b4fadb970489 itk_4_13: init at 4.13.3 bc2ad7fd696c lact: add atemu to maintainers 6e1ec4b79b54 lact: add libvulkan.so as NEEDED too 97a043ae9a35 lact: use --replace-fail be8bf5440a47 lact: refactor 4248ace0609b lact: 0.5.6 -> 0.6.0 e287024eb069 f2: 1.9.1 -> 2.0.1 4a42682ff80e nixos/meilisearch: fix disabling analytics 4a5fbe7489c1 maintainers: add ribru17 e003a0502da9 streamcontroller: fix 1.5.0-beta.7 hash 05087402224c Merge master into staging-next 5bc1af9524b4 iotas: 0.2.10 -> 0.9.5 de7585dec87f librewolf: enable darwin builds 2ef548869dfb floorp: enable darwin builds d72d4fa107a0 thunderbird: enable darwin builds cd813611a445 firefox: enable darwin builds 61f09a9edc49 perf_data_converter: fix fixed derivation hash. b01b12dcce52 python311Packages.myfitnesspal: fix build eef4b68dd040 python3Packages.python-measurement: 3.2.2 -> 4.0a8 5fbc2731f410 digikam: add conditional cmake flag for cudaSupport 27d5879adb0f forgejo: use major version to target upgrade stream 6bbd4938ee9a kpt: 0.39.3 -> 1.0.0-beta.55 cd96421ea908 nixos/k3s: refactor multi-node test f56bbed24be1 snipaste: add desktop entries 7872a84d4a08 pingvin-share: 1.2.4 -> 1.3.0 b4c2d75c622d Merge master into staging-next f9ede03bf8dc maintainers: add tensor5 7550580e19ad technium-dns-server: 13.0.2 -> 13.2 cfef478f3305 quill-log: 7.3.0 -> 7.5.0 58b8cb66b91d wipeout-rewrite: unstable-2023-08-13 -> 0-unstable-2024-07-07 211532d7c9f2 wipeout-rewrite: Migrate to by-name 9bca23b06b32 wipeout-rewrite: Add passthru.updateScript fed528af3150 wipeout-rewrite: Drop meta-wide "with lib" fdc5d84e66a1 wipeout-rewrite: nixfmt 038f8684d00b libpqxx: split outputs 9b12a53eb60a libpqxx: remove unnecessary CXXFLAGS, enable strictDeps ec6a62b74c05 libpqxx: 7.7.5 -> 7.9.2 a7daa5426bef postgresqlPackages.repmgr: 5.4.1 -> 5.5.0 12d32a594696 postgresqlPackages.plpgsql_check: 2.7.5 -> 2.7.12 1e8e3d000fda postgresqlPackages.pgvector: 0.6.2 -> 0.8.0 2b9fc77f89f0 postgresqlPackages.pgsql-http: 1.6.0 -> 1.6.1 34bcb530b12c postgresqlPackages.pgrouting: 3.6.3 -> 3.7.0 1f44f94ad386 postgresqlPackages.pgroonga: 3.2.3 -> 3.2.4 b0187db3697b postgresqlPackages.pgmq: 1.4.4 -> 1.4.5 796e44d16836 postgresqlPackages.pg_uuidv7: 1.5.0 -> 1.6.0 e7b11ef572b4 postgresqlPackages.pg_repack: 1.5.0 -> 1.5.1 a65bd1adefe2 postgresqlPackages.pg_net: 0.8.0 -> 0.13.0 448763cd4be5 postgresqlPackages.pg_bigm: 1.2-20200228 -> 1.2-20240606 7c19e850655c postgresqlPackages.periods: 1.2.2 -> 1.2.3 e87aa28b9c3a postgresqlPackages.lantern: 0.4.1 -> 0.5.0 53b1df6254fc postgresqlPackages.h3-pg: 4.1.3 -> 4.1.4 0dbbc3c5f933 postgresqlPackages.citus: 12.1.2 -> 12.1.6 68254e438c9a postgresqlPackages: enable update scripts by default cb3cce9c0c06 Merge master into staging-next 1cd36341b2b2 ruby_3_2: 3.2.5 -> 3.2.6 34b8fc2f5327 libpqxx: add and order `meta` attrs ca8cbf1c8255 libpqxx: move to finalAttrs pattern, refactor c0ea1836e0da libpqxx: nixfmt 7b47ad2dfd84 vscode-extensions: set pname b40b5be11bf0 Merge master into staging-next 500c708ba6c7 act: add passthru.tests.version 889eae69e49e gurk-rs: add passthru.tests.version 850c40d402bd 7z2hashcat: init at 2.0 30610d3d1ff0 nb: add updateScript 4de62b4c0fc4 nb: add passthru.tests.version b80d0435e49f nvtopPackages.apple: darwin support 4f1244514fcf Merge master into staging-next 7a0ebd3abc3d aspellDicts: expose pname and version 933b920360fe pagsuite: fix build e8e8784f34ea pagsuite: reformat 1268974f036a scalp: unstable-2022-03-15 -> 0-unstable-2024-08-28 03b6ef2ae0ef scalp: reformat fcac268ae7e9 croc: 10.0.13 -> 10.1.0 7d0395f7e8f2 minify: 2.20.37 -> 2.21.1 88a16286dfd5 ocamlPackages.tls: 1.0.2 -> 1.0.4 980289d071d7 maintainers: add axertheaxe 4b8fee227424 nixos/netbird: fix coturn configuration dbfde9db1c4f porn-vault: init at 0.30.0-rc.11 a413763d8856 gdal: disable flaky tests 15b9239b0913 gdal: remove unnecessary disabled tests 7e41021c7b37 gdal: disable failing darwin test 4d5b900cce97 gdal: format d69c5a4ad3d5 python3Packages.netbox-plugin-prometheus-sd: init at 1.1.1 95415a086de4 ghq: 1.6.3 -> 1.7.1 c249517d3a68 Merge master into staging-next 109721fb52fc k9s: 0.32.5 -> 0.32.6 c346fd512529 nixos/pay-respects: fix interactiveShellInit for fish and zsh 041fc2c6f58e tana: 1.0.16 -> 1.0.17 3cd382262c19 nixos/pay-respects: actually import the module d0b60f93984c incus: 6.6.0 -> 6.7.0 88d11a001044 polarity: 0-unstable-2024-06-28 -> 0-unstable-2024-11-15 500e7fcb6f81 go-task: 3.39.2 -> 3.40.0 6bd22a9174b1 libloragw-2g4: init at 1.1.0 194b5691c67d libloragw-sx1302: init at 2.1.0r7 d80e22380801 libloragw-sx1301: init at 5.0.1r2 90633c182508 pcloud: 1.14.7 -> 1.14.8 a06903acce4f glamoroustoolkit: 1.1.4 -> 1.1.7 65db89a26269 emmet-language-server: 2.2.0 -> 2.6.0 80125b026db0 ox: 0.6.10 -> 0.7.1 2c60aa206cec python312Packages.mlxtend: 0.23.1 -> 0.23.2 f70f1c7be0c7 python3Packages.brian2: fix build c446c0ec8df5 Merge master into staging-next 1555c0048816 texlive.combine: fix requiredTexPackages 82912474cbfa lunatask: 2.0.12 -> 2.0.13 2be2976bd2be tex-fmt: 0.4.6 -> 0.4.7 d75835a5d415 cli-tips: init at 0-unstable-2024-11-14 e032def5eaeb rcodesign: 0.27.0 -> 0.28.0 30d77e7f8960 klog-rs: 0.1.0 -> 0.2.0 ef6dd792cb06 Merge master into staging-next a969802fdf4d chez: 10.0.0 -> 10.1.0 e90e1dcfb264 endless-sky: 0.10.8 -> 0.10.10 b2e7be76ba71 nixos/acme: fix cert ownership assert for string `SupplementaryGroups` 7a69234cebb9 Merge master into staging-next 9a9707a8b795 maintainers: add anugrahn1 79acebfa4400 svix-server: 1.38.0 -> 1.40.0 74458684bdc1 bluej: nixfmt-rfc-style 8bc4908f5c36 bluej: with lib; cleanup 780c0bbdeaed bluej: move to pkgs/by-name 06b9024cc001 nginx: upgrade pcre to pcre2 152c4696ee79 bitwarden-desktop: 2024.9.0 -> 2024.11.1 f5ea138795f3 Merge master into staging-next 12afb737840b nixos/virtualisation: fix rendering of example in diskSize 5c5390796bc7 matrix-sliding-sync: improve assertion/deprecation message cb14281e1127 archi: 5.3.0 -> 5.4.3 57f9e0b54d10 mopidy: make PipeWire a buildInput to add GStreamer dependency d69fe7363932 tryton: 7.2.6 -> 7.4.0 897a93e92e73 duckdb: 1.1.2 -> 1.1.3 6b1c3c97b512 textlint: 14.2.1 -> 14.3.0 84eb15a5b7be kyverno: 1.12.6 -> 1.13.1 df62369e9daf Merge master into staging-next fe568fb6c026 ckan: 1.35.0 -> 1.35.2 f4a848a25d59 onefetch: 2.21.0 -> 2.22.0 7f0f95aec2c2 onefetch: darwin sdk fixup c327b0c60d9b methane: 2.0.1 -> 2.1.0 1bdfbcd3e849 methane: add passthru.updateScript 53a761ab825c methane: nixfmt a4e49326e724 clanlib: 4.1.0 -> 4.2.0 6d0d288cccb1 clanlib: add passthru.updateScript 6540042e2767 lzfse: modernize derivation 7739493e6f33 ast-grep: 0.28.1 -> 0.30.0 e2f22bac524d python312Packages.google-cloud-bigtable: 2.26.0 -> 2.27.0 72843a1519c1 python312Packages.tubeup: 2023.9.19 -> 2024.11.13 ce338e2d6c7c python312Packages.edalize: 0.5.4 -> 0.6.0 095978677b61 flashgbx: 4.2 -> 4.3 7d31a0adba02 sqldef: 0.17.20 -> 0.17.23 443726e33a0f temporal-cli: 1.0.0 → 1.1.1 014b3dfae72e python312Packages.unicorn: rename unicorn-emu input to unicorn 609794c5183a xcp: 0.21.3 -> 0.22.0 5647888ffb22 python3Packages.python-mapnik: mark broken e9f6aeb2fd67 brave: 1.71.123 -> 1.73.89 8a5d8a9818dc kubeshark: 52.3.82 -> 52.3.89 b1a9ea361136 bottles: move to pkgs/by-name d2cfb56cafd2 bottles: use nix-update-script gitUpdater was picking up an older version of bottles. e87c4e37493b bottles: add Gliczy as maintainer e024ba7ba9fb bottles: avoid with libs; 809beefe7965 bottles: 51.13 -> 51.15 c2e257006112 python312Packages.rich-click: 1.8.3 -> 1.8.4 df1d58c214a2 kubevirt: 1.3.1 -> 1.4.0 b1fa370d51ae contour: 0.4.3.6442 -> 0.5.1.7247 a74d8de73dd0 tilt: 0.33.17 -> 0.33.21 1b31d43bdca9 twig-language-server: init at 0.5.1 db558c7c4a5d backintime: 1.5.2 -> 1.5.3 e98441f15fdb sudo: 1.9.16 -> 1.9.16p2 beebdd486352 mud: 1.0.1 -> 1.0.10 479359d5b60f kcl: 0.10.0 -> 0.10.9 833e1164761b static-web-server: 2.33.0 -> 2.33.1 5c0d321d5dcb Merge branch 'NixOS:master' into pkgs/xlights 2528d14a3acd xlights: 2024.16 -> 2024.17 95fe499c1dd6 youki: add systemd build flag 625c8e4ce8c2 pmbootstrap: 2.3.1 > 3.0.0 6f1462c28c22 dcrwallet: 2.0.4 -> 2.0.5 c4b7d21c6b0e python312Packages.optuna: 4.0.0 -> 4.1.0 8a6d38531537 activemq: 6.1.3 -> 6.1.4 3b8daca28371 dezoomify-rs: migrate to new apple-sdk pattern 460fcd2e230a meshoptimizer: 0.21 -> 0.22 64e9f97a3a42 maintainers: add luNeder 58893dc7e136 btrfs-list: init at 2.3 f7f3af6db6e2 tomcat10: 10.1.30 -> 10.1.33 be0619d3b78c python312Packages.aiostreammagic: 2.8.4 -> 2.8.5 18fa0aba0b75 flclash: 0.8.66 -> 0.8.67 baf200156b02 git-spice: 0.7.0 -> 0.8.1 c5610aa78056 mydumper: add michaelglass as maintainer c443230cc50d mydumper: fix darwin build 39d936127824 mydumper: 0.14.3-1 -> 0.16.9-1 b9124898851a tplay: 0.5.0 -> 0.6.0 b5a3634ea1fc sd-image: fix raspberry pi 0 boot a9f3a296d311 nixos/lvm: expand enable description to better inform users about their actions b861831405b0 nixos/luksroot: make it harder to accidentially break cryptsetup fce91b527dcf python312Packages.optree: 0.13.0 -> 0.13.1 d5448e23ebb8 freefilesync: 13.7 -> 13.8 9bf261eff8e5 finamp: 0.9.11-beta -> 0.9.12-beta https://github.com/jmshrv/finamp/releases/tag/0.9.12-beta 7d3d959aedb4 openxr-loader: 1.1.41 -> 1.1.42 cdd8aa3f28df python312Packages.rotary-embedding-torch: 0.8.4 -> 0.8.5 f621753b76bf flatten_references_graph: remove unused fixture and all real /nix/store paths from tests 3ce3d5b24093 canon-cups-ufr2: fix color printing issues c6668dffc80c canon-cups-ufr2: 5.90 -> 6.00 0a1effab9e6c exegol: add charB66 as maintainer ac8286a5ed6b maintainers: add charB66 40e8ef4a2a09 exegol: 4.3.1 -> 4.3.8 a9a55a246b26 tidb: 8.3.0 -> 8.4.0 c2713e9c7b5e normcap: 0.5.8 -> 0.5.9 6b3108af8521 streamlink: 6.11.0 -> 7.0.0 7fae9ae3c2a8 pinentry-qt: fix caps lock warning 6cecfd8ad723 docker-tool: fix maxLayers assert f21d3a0f0705 nixos/tabby: fix typo ff0d3ad15379 wl-clicker: init at v0.3.1 6d26ed7b2922 fcitx5-mellow-themes: init at 0-unstable-2024-11-11 25cbe49079c4 container2wasm: 0.6.5 -> 0.7.0 ac196039ed84 termbench-pro: 2023-01-26 -> 2024-10-05 37279cb3d66a glaze: init at 4.0.0 08151b58b32b libunicode: 0.4.0 -> 0.6.0 d954930a4fc4 stdenv: add Silvermont support, remove incorrect AES support 95be31c1bebf proton-ge-bin: keep version information in `$steamcompattool/version` 922b38af875e onefetch: migrate to by-name bba005b82367 proton-ge-bin: Automate switching to new GE-Proton version after update c304abf7cf0e xbar: init at 2.1.7-beta d65d45c669bd maintainers: add r17x 5167a173baf5 surelog: 1.83 -> 1.84-unstable-2024-11-09 1fd4bec599ea uhdm: 1.83 -> 1.84-unstable-2024-10-06 e826282854ce python312Packages.sphinx-intl: 2.2.0 -> 2.3.0 98df2b0a6703 autofs5: enable NIS support 79fccb504861 prowlarr: 1.24.3.4754 -> 1.25.4.4818 7fa4330ceba9 azurite: 3.31.0 -> 3.33.0 0dff4975e883 adguardhome: 0.107.53 -> 0.107.54 3c2cc3049dc3 pluginupdate.py: use newer syntax for types d581c42d5d55 nixos/paperless: add secretsFile option 45dd125022f0 goldwarden: 0.3.4 -> 0.3.6 51ba14b167e2 llvmPackages: Make targetLlvmLibraries overridable e6bd72b39cf3 monado: nixfmt and refactor cf27301dc5f7 monado: backport reproducibility fix 5588cd1dfeca wgnlpy: init at 0.1.5 7bb92df5c855 freefilesync: reformat 4abc781b6b5c vscode-extensions.ionic.ionic: init at 1.96.0 8780a03d83df astyle: 3.6.3 -> 3.6.4 58c79d502fff godot_4: compile with BuildID 206ebf249d58 imewlconverter: init at 3.1.1 9af38b4ee1bc caf: apply formatting 09b4aa1dce9a eyedropper: 1.0.0 -> 2.0.1 ddc8ce08869c khronos-ocl-icd-loader: 2024.05.08 -> 2024.10.24 18d9337864ab mdk-sdk: 0.29.1 -> 0.30.0 ecee72e2475c pluginupdate.py: add support for adding/updating individual plugins e79dda5d893f open62541pp: init at 0.15.0 f91f250870ed unrar: 7.0.9 -> 7.1.1, refactor 8ce2f1475dc7 cbmc-viewer: init at 3.8 777bd013ca8b fheroes2: 1.1.2 -> 1.1.3 205e5a55fd18 R: patchelf libraries missing libR.so af5d97a9305b python312Packages.explorerscript: modernize 3605e392d953 python312Packages.explorerscript: unpin igraph a23620b20f3f python312Packages.igraph: 0.11.6 -> 0.11.8 c04916cf323d igraph: 0.10.13 -> 0.10.15 5b4a8db4d9ae build-support/docker: customisable layering strategy 81b0e3f7fa14 sogo: 5.11.0 -> 5.11.2 9cf5d33f09f0 sope: add jceb to maintainers 560391729239 libsecret: use python3Packages instead of python3.pkgs to fix cross compilation 6b2d35caf253 lcov: 2.1 -> 2.2 815ec0c6f29c nodejs: fix build on 32 bit platforms e36c592733b2 vault-tasks: init at 0.4.0 23be01302a94 flclash: libclash add meta bbbd6b711cda maintainers: add talhaHavadar d626241e242f koboldcpp: `gitUpdater` -> `nix-update-script` fd8506f99748 sccmhunter: init at 1.0.6-unstable-2024-11-07 bac10f202ba3 maintainers: Add purpole bccff63bbbb1 koboldcpp: drop `postPatch` bbb6e83f5191 nixos/binfmt: add option `addEmulatedSystemsToNixSandbox` 30a3b42239b0 koboldcpp: drop `stdenv.hostPlatform.isAarch64` requirement 2c1472820248 llvmPackages.compiler_rt: Fix compiler_rt version tests for git a2fbf260c894 velero: 1.14.1 -> 1.15.0 6bb49a52f3d6 python3Packages.pywikibot: init at 9.5.0 7c99a7de644b python310Packages.onlykey-solo-python: fix compatibility with fido2 1.1.3 426246f849d8 spotifyd: 0.3.5-unstable-2024-09-05 -> 0.3.5-unstable-2024-10-21 1b93abe91f40 python312Packages.crc: 7.0.0 -> 7.1.0 5d7e1d70fc6c qualisys-cpp-sdk: init at 2024.2 c6b04cb7feae pinocchio: 3.2.0 -> 3.3.0 f3b448bfe5b3 unnamed-sdvx-clone: init at 0.6.0 a5eaeab894dd maintainers: add sako 5255c5614d3f aaaaxy: 1.5.208 -> 1.5.220 25be6b0c86a0 angular-language-server: remove overjealous templating 3688e311b4ce flutter: Pass flutter_tools package_config.json to Dart runtime 91309f479121 python3Packages.pyvex: fix cross fe58368de684 nixos/netbox: switch to symlink to check for upgrades ff6d89ac6941 nixos/netbox: clear old static files on upgrade b6176b5fd294 eintopf.frontend: cleanup and modernize 1ca183731c4d eintopf: reformat 9f8d8481a455 eintopf.frontend: reformat b3edb98d8c2d eintopf.frontend: 0.14.1 -> 0.14.2 ef8c5ac5a524 eintopf: 0.14.1 -> 0.14.2 10959a82889b gancioPlugins.telegram-bridge: remove mkYarnPackage usage 6bd3ff78381d gancio: remove mkYarnPackage usage d19b53a5719f vidcutter: init at 6.0.5.3 975ae5ec7eb5 python312Packages.tldextract: 5.1.2 -> 5.1.3 e9d417cdd14b limesctl: drop 706960ceec6e parlay: init at 0.6.0 ddc51f709f0a home-assistant-custom-components.prometheus_sensor: 1.1.0 -> 1.1.2 64a6e8292aa3 nixos/acme: Set /var/lib/acme permissions to 755 ad24e1ca55b3 maintainers: add cterence 7d7994a7cbd1 google-chat-linux: init at 5.29.23-1 c970f0f7cd60 febio-studio: darwin sdk refactor 08bed55e78da febio: darwin sdk refactor 42a45d74bd19 tower-pixel-dungeon: init at 0.3.2 3c21a5c9d6c8 lib/systems: elaborate properly with non-matching system / config / parsed args 04c89f9811c3 python312Packages.weheat: 2024.09.23 -> 2024.11.2 87dfb08e6686 python312Packages.boltons: 24.0.0 -> 24.1.0 97c5b6880867 python312Packages.meteoswiss-async: relax aiohttp and asyncstdlib ed534e09d00f python312Packages.asyncstdlib: 3.12.5 -> 3.13.0 f4e43ac27394 python312Packages.llama-cpp-python: use stdenv from cudaPackages cc1ac71df550 python312Packages.llama-cpp-python: add passthru.test to build with CUDA support 17c58cde1623 python312Packages.llama-cpp-python: init at 0.3.1 157f77fc2861 raysession: fix pipewire-jack compatibility efb30c73fc33 patchance: fix pipewire-jack compatibility 42ac7b2428fc nixos/networkd: add dhcpServerConfig.PersistLeases option 21d6e5c77685 python312Packages.vobject: refactor 5b260ab83d67 python312Packages.vobject: 0.9.7 -> 0.9.8 f1e8d2b37f3d python312Packages.simple-websocket: 1.0.0 -> 1.1.0 162a6c2bbf03 python312Packages.python-engineio: 4.9.1 -> 4.10.1 75c3ed6d05d1 python311Packages.fslpy: init at 3.21.1 c0c69179b51c proxsuite-nlp: 0.8.0 -> 0.10.0 a58c8fee1e26 nixos/wg-access-server: bugfix dns.enabled (yaml) f2de541dfd15 nixos/suricata: add module to modules-list 9e608d46a92c nixos/suricata: add description fields for configuration 0ae7f47d5de0 hunspellDicts.id_ID: init at 6.3.0.4 f9efbc90b4c8 python312Packages.pytest-celery: 0.1.0 -> 1.1.1 f9d0de7fccd2 python312Packages.docstring-parser: 0.15 -> 0.16 38bc6ac8f9d1 nixos/transmission: fix the type of `settings.umask` 76fb46fd8ada nixos/transmission: format with nixfmt-rfc-style 89320d7377d7 nixos/transmission: improve code cebeec1b8d67 nixos/transmission: improve permission handling and description c40002e9c86c php82Extensions.tideways: init at 5.13.0 b59b8fc07bf5 tideways-daemon: init at 1.9.18 880de9943e94 tideways-cli: init at 1.2.2 0e68835e06e3 python312Packages.azure-mgmt-resource: 23.1.1 -> 23.2.0 ccffb45baea9 decent-sampler: 1.10.0 -> 1.12.1 51aced42bec5 decent-sampler: remove reliance on archive.org ed6b181a62ed decent-sampler: format with nixfmt 0d2187f1b24c halloy: fix add halloy url scheme handler c713db2b9fe7 python3Packages.pyalsaaudio: init at 0.11.0 fcb041dad95d n8n: 1.61.0 -> 1.65.1 cb08d30fca28 kdePackages.powerdevil: Add ddcutil as build input 4b440818278d nixos/searxng: limiter.toml reference moved 4541db911cca n8n: remove `with lib;` 17b05c63e87a python3.pkgs.geoarrow-pandas: init at 0.1.2 a06ca42c14d0 python3.pkgs.geoarrow-pyarrow: init at 0.1.2 0f949a0bffab python3.pkgs.geoarrow-c: init at 0.1.3 5f6dd3654ce8 python3.pkgs.geoarrow-types: init at 0.2.0 79b157542cab decent-sampler: add chewblacka to maintainers 64204e1dbbf2 n8n: drop maintainer freezeboy 942de9aafb51 google-play: init at 1.5.8 1b510687b4f5 nixos/mailman: wrap mailman cli to start as mailman user 466d4657464a koboldcpp: migrate to `apple-sdk_12` 6e9650ad5000 koboldcpp: drop unused args d794015a0684 python3Packages.pdf2image: fix providing of `poppler_utils` 13bc6b9fcc7a python312Packages.marisa-trie: 1.2.0 -> 1.2.1 4d0407614dfd rider: add avalonia libs needed for dotMemory ad3a9e9cab0a avdump3: init at 8293_stable 666ed31e6411 zydis: propagate zycore dependency 08000db65f4d sweethome3d.application: 7.3 -> 7.5 b6d57c6bf023 evdi: 1.14.6 -> 1.14.7 https://github.com/DisplayLink/evdi/releases/tag/v1.14.7 3f6d80d322dd appimageTools: add libmpg123 to the environment 547c086e27cc python-qt: 3.5.4 -> 3.5.6 a6614061b679 akkuPackages.*: add an 'akku-' prefix to the package names f7d992d6dde3 sysdig-cli-scanner: do not use --dbpath arg when --iac is set 743d0ff90b27 fixup! nixos/redlib: use upstream systemd service file a076a8813945 python312Packages.keras: add missing dependency distutils 804211c4c43e python312Packages.tf-keras: clean derivation fb13561ac916 python312Packages.tensorflow: use tensorflow-bin by default 4e6df6f865bf nixos/redlib: use upstream systemd service file 672d7efbd5ce nixos/redlib: add cfg.settings a2a4c87cab75 {,nixos/,nixosTests/}redlib: add Guanran928 as maintainer e286b91ebca6 {nixos,nixosTests}/redlib: format with nixfmt c2df671cfc78 easyeffects: fix bug 'missing spectrum analyzer' 37ffee83aeea excalidraw_export: flag broken on darwin 45f76ac0ede9 excalidraw_export: init at v1.1.0 de7359b27a3d maintainers: add venikx 6ddf796d4c6a sm64coopdx: init at 1.0.3 c78e67859b42 sm64ex: split out baserom derivation for easier reuse and nixfmt run aa6ef8e22bab nixos/gitlab-runner: let script options accept scripts as strings 8b8fd74b2329 vokoscreen-ng: 4.0.0 -> 4.2.0 801534d649c6 maintainers: add shelvacu f6c2abe75144 python3Packages.pyflipper: init at 0.18-unstable-2024-04-15 06791fce8f9e nixos/nbd: remove `with lib;` 1c79bffa2911 ciscoPacketTracer{7,8}: re-add `with maintainers` 1c4d950be626 maubot: fix "Incomplete URL substring sanitization" in plugins update script 60550330ceaf yarn2nix: fix "Incomplete URL substring sanitization" a9c9441997fc fetch-yarn-deps: fix "Incomplete URL substring sanitization" 0b3aa5bd5ccd electron: fix "Incomplete regular expression for hostnames" in update script e383d67656d9 ciscoPacketTracer8: disown 005fca65323f ciscoPacketTracer7: disown 722137f9eaca shadershark: simplify update script 25ff73017d92 ogen: init at 1.4.1 a60eddf7211d benzene: init at 0-unstable-2022-12-18 5619b33e5a37 maintainers: add eilvelia 71b36a1b261c openutau: bump dotnet version 7 -> 8 c945e4db5333 nixos/installation-device: make openssh settings a default 526239b11832 nixos/espanso: remove unused wayland option 55e7c6155a91 nixos/moodle: update to php83 c4f70c3c275c moodle: 4.4.1 -> 4.4.3 9cd5ad85f5b7 overturemaps: init at 0.9.0 e19c4033d0a2 maintainers: add crimeminister 249d4a97d51c workflows/check-nix-format: Improve error message 0a58f69255f3 nixos/pam: replace apparmor warnings with assertions 437d92c6ade8 prometheus-nats-exporter: add updateScript and testVersion ff0cde38b126 python312Packages.jianpu-ly: init at 1.801 dfd7c6738445 python3Packages.textblob: init at 0.18.0 c74c1d96069d bpftrace: Source from "bpftrace" instead of "iovisor" b0763a9ab36d maintainers: add Achmad Fathoni 60e499c17cef nixos/netboot: Fix netbootRamdisk build ee051d65f316 nixos/networkd: add L3MasterDevice option to [RoutingPolicyRule] section 38d02e4ecd88 nixos/networkd add IPv4ProxyARPPrivateVLAN option to [Network] section 402699d00e98 nixos/networkd: add IPv6RetransmissionTimeSec option to [Network] section cff7937495d8 algia: init at 0.0.74 17555cad7965 Count hard links when sizing virtual disks 15ebd6c89502 Fixup e331c90739f1 Fixup 3bdb9637ecd2 maintainers: add evris99 e9a119ead427 nixos/installation-cd-base: add git & rsync 3d44d5c2ce00 visual-hexdiff: init at 0.0.53 3ea89d7b6213 maintainers: add @daspk04 31193fae9577 maintainers: add lordmzte 7530892b4ada apacheHttpdPackages.mod_tile: 0.7.1 -> 0.7.2 50534c32b809 python3Packages.pynput: Add `updateScript` 63924a70b188 ammonite: add ammonite for Scala 3.3 04c973335eee filesender: FIX: missing format definition. dd1e48cc9e45 .github/ISSUE_TEMPLATE: Add an issue template for tracking cf33426f95ad wl-crosshair: init at 0.1.0-unstable-2024-05-09 8e02b5f478f6 nixos/loki: Start Loki after the network comes online 063943c214ae emulationstation-de: 2.2.1 -> 3.0.2 158a39089b46 gh-copilot: add auto-updating a180a54daa5b nixos/dockerTools: fixup proot/fakeroot code - exclude also dev 11f45c83621f nixos/alertmanager: add additional docs about envsubst 3d3913890084 nixos/cloud-init: remove syslog.target 2eb085d9b5ce nixos/keepalived: remove syslog.target c74e40fb3e1e nixos/aesmd: remove syslog.target 963f17c95885 nixos/connman: remove syslog.target 610e8be8387c maintainers: add tholo 9692e2e81987 nixos/java: No bashisms in `environment.shellInit` script 4f1dc4bfb7b5 nixos/modprobe: Added `boot.modprobeConfig.useUbuntuModuleBlacklist`. cd75ec216aad nixos/networkd: allow configuring RTTSec for CAKE qdisc 9711af0579b0 nixos/iso-image: fix isoImage.grubTheme = null; logic 541afcbc9b16 cinnamon: check for package exclusions by name for themes 8e1ad9ba9270 gnome: check for package exclusions by name for default program modules 6f0523e4847d nixos/documentation: Link Devhelp files 6f68d4e447f4 nixos/signald: automatically migrate db 5499e85c808c kustomize-sops: rename exec plugin to ksops dffd88e51600 nixos/zeronet: fix settings option git-subtree-dir: third_party/nixpkgs git-subtree-split: d0797a04b81caeae77bcff10a9dde78bc17f5661
This commit is contained in:
parent
3ed4d12aac
commit
d287198d5a
3924 changed files with 99941 additions and 193687 deletions
|
@ -204,5 +204,14 @@ ce21e97a1f20dee15da85c084f9d1148d84f853b
|
||||||
# sqlc: format with nixfmt
|
# sqlc: format with nixfmt
|
||||||
2bdec131b2bb2c8563f4556d741d34ccb77409e2
|
2bdec131b2bb2c8563f4556d741d34ccb77409e2
|
||||||
|
|
||||||
|
# ant: format with nixfmt-rfc-style
|
||||||
|
2538d58436b8d0b56d29780aeebf4bf720ddb9ea
|
||||||
|
|
||||||
# treewide: migrate packages to pkgs/by-name, take 1
|
# treewide: migrate packages to pkgs/by-name, take 1
|
||||||
571c71e6f73af34a229414f51585738894211408
|
571c71e6f73af34a229414f51585738894211408
|
||||||
|
|
||||||
|
# format files with nixfmt (#347275)
|
||||||
|
adb9714bd909df283c66bbd641bd631ff50a4260
|
||||||
|
|
||||||
|
# treewide: incus packages
|
||||||
|
9ab59bb5fb943ad6740f64f5a79eae9642fb8211
|
||||||
|
|
39
.github/ISSUE_TEMPLATE/tracking_issue.md
vendored
Normal file
39
.github/ISSUE_TEMPLATE/tracking_issue.md
vendored
Normal file
|
@ -0,0 +1,39 @@
|
||||||
|
---
|
||||||
|
name: Tracking issue
|
||||||
|
about: Provide an overview on a multi-step effort
|
||||||
|
title: 'Tracking issue: ISSUENAME'
|
||||||
|
labels: '5.scope: tracking'
|
||||||
|
assignees: ''
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
### Tracking description
|
||||||
|
|
||||||
|
<!--
|
||||||
|
Provide a brief summary of the project or multi-step effort. Explain why it is
|
||||||
|
necessary and what the goals are.
|
||||||
|
|
||||||
|
You may include way to reproduce the problem, screenshots or any information
|
||||||
|
that you find relevant.
|
||||||
|
-->
|
||||||
|
|
||||||
|
#### Reference Issue(s)/PR(s)
|
||||||
|
|
||||||
|
- ...
|
||||||
|
|
||||||
|
### Follow-up issues/notes
|
||||||
|
|
||||||
|
<!--
|
||||||
|
List any follow-up issues that need to be addressed after the main tasks are
|
||||||
|
completed, or any notes related to the project.
|
||||||
|
-->
|
||||||
|
|
||||||
|
#### Additional context
|
||||||
|
Add any other context about the problem here.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
Add a :+1: [reaction] to [issues you find important].
|
||||||
|
|
||||||
|
[reaction]: https://github.blog/2016-03-10-add-reactions-to-pull-requests-issues-and-comments/
|
||||||
|
[issues you find important]: https://github.com/NixOS/nixpkgs/issues?q=is%3Aissue+is%3Aopen+sort%3Areactions-%2B1-desc
|
22
.github/labeler.yml
vendored
22
.github/labeler.yml
vendored
|
@ -176,13 +176,32 @@
|
||||||
- any:
|
- any:
|
||||||
- changed-files:
|
- changed-files:
|
||||||
- any-glob-to-any-file:
|
- any-glob-to-any-file:
|
||||||
- nixos/modules/programs/java.nix
|
# Distributions
|
||||||
|
- pkgs/development/compilers/adoptopenjdk-icedtea-web/**/*
|
||||||
|
- pkgs/development/compilers/corretto/**/*
|
||||||
- pkgs/development/compilers/graalvm/**/*
|
- pkgs/development/compilers/graalvm/**/*
|
||||||
- pkgs/development/compilers/openjdk/**/*
|
- pkgs/development/compilers/openjdk/**/*
|
||||||
|
- pkgs/development/compilers/semeru-bin/**/*
|
||||||
- pkgs/development/compilers/temurin-bin/**/*
|
- pkgs/development/compilers/temurin-bin/**/*
|
||||||
- pkgs/development/compilers/zulu/**/*
|
- pkgs/development/compilers/zulu/**/*
|
||||||
|
# Documentation
|
||||||
|
- doc/languages-frameworks/java.section.md
|
||||||
|
# Gradle
|
||||||
|
- doc/languages-frameworks/gradle.section.md
|
||||||
|
- pkgs/development/tools/build-managers/gradle/**/*
|
||||||
|
- pkgs/by-name/gr/gradle-completion/**/*
|
||||||
|
# Maven
|
||||||
|
- pkgs/by-name/ma/maven/**/*
|
||||||
|
- doc/languages-frameworks/maven.section.md
|
||||||
|
# Ant
|
||||||
|
- pkgs/by-name/an/ant/**/*
|
||||||
|
# javaPackages attrset
|
||||||
- pkgs/development/java-modules/**/*
|
- pkgs/development/java-modules/**/*
|
||||||
- pkgs/top-level/java-packages.nix
|
- pkgs/top-level/java-packages.nix
|
||||||
|
# Maintainer tooling
|
||||||
|
- pkgs/by-name/ni/nixpkgs-openjdk-updater/**/*
|
||||||
|
# Misc
|
||||||
|
- nixos/modules/programs/java.nix
|
||||||
|
|
||||||
"6.topic: jitsi":
|
"6.topic: jitsi":
|
||||||
- any:
|
- any:
|
||||||
|
@ -426,6 +445,7 @@
|
||||||
- doc/languages-frameworks/ruby.section.md
|
- doc/languages-frameworks/ruby.section.md
|
||||||
- pkgs/development/interpreters/ruby/**/*
|
- pkgs/development/interpreters/ruby/**/*
|
||||||
- pkgs/development/ruby-modules/**/*
|
- pkgs/development/ruby-modules/**/*
|
||||||
|
- pkgs/top-level/ruby-packages.nix
|
||||||
|
|
||||||
"6.topic: rust":
|
"6.topic: rust":
|
||||||
- any:
|
- any:
|
||||||
|
|
15
.github/workflows/backport.yml
vendored
15
.github/workflows/backport.yml
vendored
|
@ -8,26 +8,31 @@ on:
|
||||||
# the GitHub repository. This means that it should not evaluate user input in a
|
# the GitHub repository. This means that it should not evaluate user input in a
|
||||||
# way that allows code injection.
|
# way that allows code injection.
|
||||||
|
|
||||||
permissions:
|
permissions: {}
|
||||||
contents: read
|
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
backport:
|
backport:
|
||||||
permissions:
|
|
||||||
contents: write # for korthout/backport-action to create branch
|
|
||||||
pull-requests: write # for korthout/backport-action to create PR to backport
|
|
||||||
name: Backport Pull Request
|
name: Backport Pull Request
|
||||||
if: github.repository_owner == 'NixOS' && github.event.pull_request.merged == true && (github.event_name != 'labeled' || startsWith('backport', github.event.label.name))
|
if: github.repository_owner == 'NixOS' && github.event.pull_request.merged == true && (github.event_name != 'labeled' || startsWith('backport', github.event.label.name))
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
|
# Use a GitHub App to create the PR so that CI gets triggered
|
||||||
|
# The App is scoped to Repository > Contents and Pull Requests: write for Nixpkgs
|
||||||
|
- uses: actions/create-github-app-token@5d869da34e18e7287c1daad50e0b8ea0f506ce69 # v1.11.0
|
||||||
|
id: app-token
|
||||||
|
with:
|
||||||
|
app-id: ${{ vars.BACKPORT_APP_ID }}
|
||||||
|
private-key: ${{ secrets.BACKPORT_PRIVATE_KEY }}
|
||||||
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
with:
|
with:
|
||||||
ref: ${{ github.event.pull_request.head.sha }}
|
ref: ${{ github.event.pull_request.head.sha }}
|
||||||
|
token: ${{ steps.app-token.outputs.token }}
|
||||||
- name: Create backport PRs
|
- name: Create backport PRs
|
||||||
uses: korthout/backport-action@bd410d37cdcae80be6d969823ff5a225fe5c833f # v3.0.2
|
uses: korthout/backport-action@bd410d37cdcae80be6d969823ff5a225fe5c833f # v3.0.2
|
||||||
with:
|
with:
|
||||||
# Config README: https://github.com/korthout/backport-action#backport-action
|
# Config README: https://github.com/korthout/backport-action#backport-action
|
||||||
copy_labels_pattern: 'severity:\ssecurity'
|
copy_labels_pattern: 'severity:\ssecurity'
|
||||||
|
github_token: ${{ steps.app-token.outputs.token }}
|
||||||
pull_description: |-
|
pull_description: |-
|
||||||
Bot-based backport to `${target_branch}`, triggered by a label in #${pull_number}.
|
Bot-based backport to `${target_branch}`, triggered by a label in #${pull_number}.
|
||||||
|
|
||||||
|
|
3
.github/workflows/check-nix-format.yml
vendored
3
.github/workflows/check-nix-format.yml
vendored
|
@ -83,8 +83,9 @@ jobs:
|
||||||
|
|
||||||
if (( "${#unformattedFiles[@]}" > 0 )); then
|
if (( "${#unformattedFiles[@]}" > 0 )); then
|
||||||
echo "Some new/changed Nix files are not properly formatted"
|
echo "Some new/changed Nix files are not properly formatted"
|
||||||
echo "Please go to the Nixpkgs root directory, run \`nix-shell\`, then:"
|
echo "Please format them using the Nixpkgs-specific \`nixfmt\` by going to the Nixpkgs root directory, running \`nix-shell\`, then:"
|
||||||
echo "nixfmt ${unformattedFiles[*]@Q}"
|
echo "nixfmt ${unformattedFiles[*]@Q}"
|
||||||
|
echo "Make sure your branch is up to date with master, rebase if not."
|
||||||
echo "If you're having trouble, please ping @NixOS/nix-formatting"
|
echo "If you're having trouble, please ping @NixOS/nix-formatting"
|
||||||
exit 1
|
exit 1
|
||||||
fi
|
fi
|
||||||
|
|
2
.github/workflows/check-nixf-tidy.yml
vendored
2
.github/workflows/check-nixf-tidy.yml
vendored
|
@ -107,7 +107,7 @@ jobs:
|
||||||
echo "$errors"
|
echo "$errors"
|
||||||
else
|
else
|
||||||
# just print in plain text
|
# just print in plain text
|
||||||
echo "$errors" | sed 's/^:://'
|
echo "${errors/::/}"
|
||||||
echo # add one empty line
|
echo # add one empty line
|
||||||
fi
|
fi
|
||||||
failedFiles+=("$dest")
|
failedFiles+=("$dest")
|
||||||
|
|
3
.github/workflows/check-shell.yml
vendored
3
.github/workflows/check-shell.yml
vendored
|
@ -2,6 +2,9 @@ name: "Check shell"
|
||||||
|
|
||||||
on:
|
on:
|
||||||
pull_request_target:
|
pull_request_target:
|
||||||
|
paths:
|
||||||
|
- 'shell.nix'
|
||||||
|
- 'ci/**'
|
||||||
|
|
||||||
permissions: {}
|
permissions: {}
|
||||||
|
|
||||||
|
|
2
.github/workflows/editorconfig-v2.yml
vendored
2
.github/workflows/editorconfig-v2.yml
vendored
|
@ -38,7 +38,7 @@ jobs:
|
||||||
nix_path: nixpkgs=https://github.com/NixOS/nixpkgs/archive/c473cc8714710179df205b153f4e9fa007107ff9.tar.gz
|
nix_path: nixpkgs=https://github.com/NixOS/nixpkgs/archive/c473cc8714710179df205b153f4e9fa007107ff9.tar.gz
|
||||||
- name: Checking EditorConfig
|
- name: Checking EditorConfig
|
||||||
run: |
|
run: |
|
||||||
cat "$HOME/changed_files" | nix-shell -p editorconfig-checker --run 'xargs -r editorconfig-checker -disable-indent-size'
|
< "$HOME/changed_files" nix-shell -p editorconfig-checker --run 'xargs -r editorconfig-checker -disable-indent-size'
|
||||||
- if: ${{ failure() }}
|
- if: ${{ failure() }}
|
||||||
run: |
|
run: |
|
||||||
echo "::error :: Hey! It looks like your changes don't follow our editorconfig settings. Read https://editorconfig.org/#download to configure your editor so you never see this error again."
|
echo "::error :: Hey! It looks like your changes don't follow our editorconfig settings. Read https://editorconfig.org/#download to configure your editor so you never see this error again."
|
||||||
|
|
263
.github/workflows/eval.yml
vendored
Normal file
263
.github/workflows/eval.yml
vendored
Normal file
|
@ -0,0 +1,263 @@
|
||||||
|
name: Eval
|
||||||
|
|
||||||
|
on:
|
||||||
|
pull_request_target:
|
||||||
|
push:
|
||||||
|
# Keep this synced with ci/request-reviews/dev-branches.txt
|
||||||
|
branches:
|
||||||
|
- master
|
||||||
|
- staging
|
||||||
|
- release-*
|
||||||
|
- staging-*
|
||||||
|
- haskell-updates
|
||||||
|
- python-updates
|
||||||
|
|
||||||
|
permissions:
|
||||||
|
contents: read
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
get-merge-commit:
|
||||||
|
uses: ./.github/workflows/get-merge-commit.yml
|
||||||
|
|
||||||
|
attrs:
|
||||||
|
name: Attributes
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
needs: get-merge-commit
|
||||||
|
outputs:
|
||||||
|
mergedSha: ${{ needs.get-merge-commit.outputs.mergedSha }}
|
||||||
|
baseSha: ${{ steps.baseSha.outputs.baseSha }}
|
||||||
|
systems: ${{ steps.systems.outputs.systems }}
|
||||||
|
steps:
|
||||||
|
- name: Check out the PR at the test merge commit
|
||||||
|
uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
|
# Add this to _all_ subsequent steps to skip them
|
||||||
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
|
with:
|
||||||
|
ref: ${{ needs.get-merge-commit.outputs.mergedSha }}
|
||||||
|
fetch-depth: 2
|
||||||
|
path: nixpkgs
|
||||||
|
|
||||||
|
- name: Determine base commit
|
||||||
|
if: github.event_name == 'pull_request_target' && needs.get-merge-commit.outputs.mergedSha
|
||||||
|
id: baseSha
|
||||||
|
run: |
|
||||||
|
baseSha=$(git -C nixpkgs rev-parse HEAD^1)
|
||||||
|
echo "baseSha=$baseSha" >> "$GITHUB_OUTPUT"
|
||||||
|
|
||||||
|
- name: Install Nix
|
||||||
|
uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
||||||
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
|
|
||||||
|
- name: Evaluate the list of all attributes and get the systems matrix
|
||||||
|
id: systems
|
||||||
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
|
run: |
|
||||||
|
nix-build nixpkgs/ci -A eval.attrpathsSuperset
|
||||||
|
echo "systems=$(<result/systems.json)" >> "$GITHUB_OUTPUT"
|
||||||
|
|
||||||
|
- name: Upload the list of all attributes
|
||||||
|
uses: actions/upload-artifact@b4b15b8c7c6ac21ea08fcf65892d2ee8f75cf882 # v4.4.3
|
||||||
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
|
with:
|
||||||
|
name: paths
|
||||||
|
path: result/*
|
||||||
|
|
||||||
|
eval-aliases:
|
||||||
|
name: Eval nixpkgs with aliases enabled
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
needs: attrs
|
||||||
|
steps:
|
||||||
|
- name: Check out the PR at the test merge commit
|
||||||
|
uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
|
with:
|
||||||
|
ref: ${{ needs.attrs.outputs.mergedSha }}
|
||||||
|
path: nixpkgs
|
||||||
|
|
||||||
|
- name: Install Nix
|
||||||
|
uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
||||||
|
|
||||||
|
- name: Query nixpkgs with aliases enabled to check for basic syntax errors
|
||||||
|
run: |
|
||||||
|
time nix-env -I ./nixpkgs -f ./nixpkgs -qa '*' --option restrict-eval true --option allow-import-from-derivation false >/dev/null
|
||||||
|
|
||||||
|
outpaths:
|
||||||
|
name: Outpaths
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
needs: attrs
|
||||||
|
# Skip this and future steps if the PR can't be merged
|
||||||
|
if: needs.attrs.outputs.mergedSha
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
system: ${{ fromJSON(needs.attrs.outputs.systems) }}
|
||||||
|
steps:
|
||||||
|
- name: Download the list of all attributes
|
||||||
|
uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8
|
||||||
|
with:
|
||||||
|
name: paths
|
||||||
|
path: paths
|
||||||
|
|
||||||
|
- name: Check out the PR at the test merge commit
|
||||||
|
uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
|
with:
|
||||||
|
ref: ${{ needs.attrs.outputs.mergedSha }}
|
||||||
|
path: nixpkgs
|
||||||
|
|
||||||
|
- name: Install Nix
|
||||||
|
uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
||||||
|
|
||||||
|
- name: Evaluate the ${{ matrix.system }} output paths for all derivation attributes
|
||||||
|
env:
|
||||||
|
MATRIX_SYSTEM: ${{ matrix.system }}
|
||||||
|
run: |
|
||||||
|
nix-build nixpkgs/ci -A eval.singleSystem \
|
||||||
|
--argstr evalSystem "$MATRIX_SYSTEM" \
|
||||||
|
--arg attrpathFile ./paths/paths.json \
|
||||||
|
--arg chunkSize 10000
|
||||||
|
# If it uses too much memory, slightly decrease chunkSize
|
||||||
|
|
||||||
|
- name: Upload the output paths and eval stats
|
||||||
|
uses: actions/upload-artifact@b4b15b8c7c6ac21ea08fcf65892d2ee8f75cf882 # v4.4.3
|
||||||
|
if: needs.attrs.outputs.mergedSha
|
||||||
|
with:
|
||||||
|
name: intermediate-${{ matrix.system }}
|
||||||
|
path: result/*
|
||||||
|
|
||||||
|
process:
|
||||||
|
name: Process
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
needs: [ outpaths, attrs ]
|
||||||
|
outputs:
|
||||||
|
baseRunId: ${{ steps.baseRunId.outputs.baseRunId }}
|
||||||
|
steps:
|
||||||
|
- name: Download output paths and eval stats for all systems
|
||||||
|
uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8
|
||||||
|
with:
|
||||||
|
pattern: intermediate-*
|
||||||
|
path: intermediate
|
||||||
|
|
||||||
|
- name: Check out the PR at the test merge commit
|
||||||
|
uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
|
with:
|
||||||
|
ref: ${{ needs.attrs.outputs.mergedSha }}
|
||||||
|
path: nixpkgs
|
||||||
|
|
||||||
|
- name: Install Nix
|
||||||
|
uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
||||||
|
|
||||||
|
- name: Combine all output paths and eval stats
|
||||||
|
run: |
|
||||||
|
nix-build nixpkgs/ci -A eval.combine \
|
||||||
|
--arg resultsDir ./intermediate \
|
||||||
|
-o prResult
|
||||||
|
|
||||||
|
- name: Upload the combined results
|
||||||
|
uses: actions/upload-artifact@b4b15b8c7c6ac21ea08fcf65892d2ee8f75cf882 # v4.4.3
|
||||||
|
with:
|
||||||
|
name: result
|
||||||
|
path: prResult/*
|
||||||
|
|
||||||
|
- name: Get base run id
|
||||||
|
if: needs.attrs.outputs.baseSha
|
||||||
|
id: baseRunId
|
||||||
|
run: |
|
||||||
|
# Get the latest eval.yml workflow run for the PR's base commit
|
||||||
|
if ! run=$(gh api --method GET /repos/"$REPOSITORY"/actions/workflows/eval.yml/runs \
|
||||||
|
-f head_sha="$BASE_SHA" -f event=push \
|
||||||
|
--jq '.workflow_runs | sort_by(.run_started_at) | .[-1]') \
|
||||||
|
|| [[ -z "$run" ]]; then
|
||||||
|
echo "Could not find an eval.yml workflow run for $BASE_SHA, cannot make comparison"
|
||||||
|
exit 0
|
||||||
|
fi
|
||||||
|
echo "Comparing against $(jq .html_url <<< "$run")"
|
||||||
|
runId=$(jq .id <<< "$run")
|
||||||
|
conclusion=$(jq -r .conclusion <<< "$run")
|
||||||
|
|
||||||
|
while [[ "$conclusion" == null ]]; do
|
||||||
|
echo "Workflow not done, waiting 10 seconds before checking again"
|
||||||
|
sleep 10
|
||||||
|
conclusion=$(gh api /repos/"$REPOSITORY"/actions/runs/"$runId" --jq '.conclusion')
|
||||||
|
done
|
||||||
|
|
||||||
|
if [[ "$conclusion" != "success" ]]; then
|
||||||
|
echo "Workflow was not successful, cannot make comparison"
|
||||||
|
exit 0
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "baseRunId=$runId" >> "$GITHUB_OUTPUT"
|
||||||
|
env:
|
||||||
|
REPOSITORY: ${{ github.repository }}
|
||||||
|
BASE_SHA: ${{ needs.attrs.outputs.baseSha }}
|
||||||
|
GH_TOKEN: ${{ github.token }}
|
||||||
|
|
||||||
|
- uses: actions/download-artifact@v4
|
||||||
|
if: steps.baseRunId.outputs.baseRunId
|
||||||
|
with:
|
||||||
|
name: result
|
||||||
|
path: baseResult
|
||||||
|
github-token: ${{ github.token }}
|
||||||
|
run-id: ${{ steps.baseRunId.outputs.baseRunId }}
|
||||||
|
|
||||||
|
- name: Compare against the base branch
|
||||||
|
if: steps.baseRunId.outputs.baseRunId
|
||||||
|
run: |
|
||||||
|
nix-build nixpkgs/ci -A eval.compare \
|
||||||
|
--arg beforeResultDir ./baseResult \
|
||||||
|
--arg afterResultDir ./prResult \
|
||||||
|
-o comparison
|
||||||
|
cat comparison/step-summary.md >> "$GITHUB_STEP_SUMMARY"
|
||||||
|
# TODO: Request reviews from maintainers for packages whose files are modified in the PR
|
||||||
|
|
||||||
|
- name: Upload the combined results
|
||||||
|
if: steps.baseRunId.outputs.baseRunId
|
||||||
|
uses: actions/upload-artifact@b4b15b8c7c6ac21ea08fcf65892d2ee8f75cf882 # v4.4.3
|
||||||
|
with:
|
||||||
|
name: comparison
|
||||||
|
path: comparison/*
|
||||||
|
|
||||||
|
# Separate job to have a very tightly scoped PR write token
|
||||||
|
tag:
|
||||||
|
name: Tag
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
needs: process
|
||||||
|
if: needs.process.outputs.baseRunId
|
||||||
|
permissions:
|
||||||
|
pull-requests: write
|
||||||
|
steps:
|
||||||
|
- name: Download process result
|
||||||
|
uses: actions/download-artifact@fa0a91b85d4f404e444e00e005971372dc801d16 # v4.1.8
|
||||||
|
with:
|
||||||
|
name: comparison
|
||||||
|
path: comparison
|
||||||
|
|
||||||
|
- name: Tagging pull request
|
||||||
|
run: |
|
||||||
|
# Get all currently set rebuild labels
|
||||||
|
gh api \
|
||||||
|
/repos/"$REPOSITORY"/issues/"$NUMBER"/labels \
|
||||||
|
--jq '.[].name | select(startswith("10.rebuild"))' \
|
||||||
|
| sort > before
|
||||||
|
|
||||||
|
# And the labels that should be there
|
||||||
|
jq -r '.labels[]' comparison/changed-paths.json \
|
||||||
|
| sort > after
|
||||||
|
|
||||||
|
# Remove the ones not needed anymore
|
||||||
|
while read -r toRemove; do
|
||||||
|
echo "Removing label $toRemove"
|
||||||
|
gh api \
|
||||||
|
--method DELETE \
|
||||||
|
/repos/"$REPOSITORY"/issues/"$NUMBER"/labels/"$toRemove"
|
||||||
|
done < <(comm -23 before after)
|
||||||
|
|
||||||
|
# And add the ones that aren't set already
|
||||||
|
while read -r toAdd; do
|
||||||
|
echo "Adding label $toAdd"
|
||||||
|
gh api \
|
||||||
|
--method POST \
|
||||||
|
/repos/"$REPOSITORY"/issues/"$NUMBER"/labels \
|
||||||
|
-f "labels[]=$toAdd"
|
||||||
|
done < <(comm -13 before after)
|
||||||
|
env:
|
||||||
|
GH_TOKEN: ${{ github.token }}
|
||||||
|
REPOSITORY: ${{ github.repository }}
|
||||||
|
NUMBER: ${{ github.event.number }}
|
43
.github/workflows/get-merge-commit.yml
vendored
Normal file
43
.github/workflows/get-merge-commit.yml
vendored
Normal file
|
@ -0,0 +1,43 @@
|
||||||
|
name: Get merge commit
|
||||||
|
|
||||||
|
on:
|
||||||
|
workflow_call:
|
||||||
|
outputs:
|
||||||
|
mergedSha:
|
||||||
|
description: "The merge commit SHA"
|
||||||
|
value: ${{ jobs.resolve-merge-commit.outputs.mergedSha }}
|
||||||
|
|
||||||
|
# We need a token to query the API, but it doesn't need any special permissions
|
||||||
|
permissions: {}
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
resolve-merge-commit:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
outputs:
|
||||||
|
mergedSha: ${{ steps.merged.outputs.mergedSha }}
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
|
with:
|
||||||
|
path: base
|
||||||
|
sparse-checkout: ci
|
||||||
|
- name: Check if the PR can be merged and get the test merge commit
|
||||||
|
id: merged
|
||||||
|
env:
|
||||||
|
GH_TOKEN: ${{ github.token }}
|
||||||
|
GH_EVENT: ${{ github.event_name }}
|
||||||
|
run: |
|
||||||
|
case "$GH_EVENT" in
|
||||||
|
push)
|
||||||
|
echo "mergedSha=${{ github.sha }}" >> "$GITHUB_OUTPUT"
|
||||||
|
;;
|
||||||
|
pull_request_target)
|
||||||
|
if mergedSha=$(base/ci/get-merge-commit.sh ${{ github.repository }} ${{ github.event.number }}); then
|
||||||
|
echo "Checking the merge commit $mergedSha"
|
||||||
|
echo "mergedSha=$mergedSha" >> "$GITHUB_OUTPUT"
|
||||||
|
else
|
||||||
|
# Skipping so that no notifications are sent
|
||||||
|
echo "Skipping the rest..."
|
||||||
|
fi
|
||||||
|
;;
|
||||||
|
esac
|
||||||
|
rm -rf base
|
7
.github/workflows/lint-actions.sh
vendored
Executable file
7
.github/workflows/lint-actions.sh
vendored
Executable file
|
@ -0,0 +1,7 @@
|
||||||
|
#!/usr/bin/env nix-shell
|
||||||
|
#!nix-shell -i bash -p bash actionlint shellcheck -I nixpkgs=../..
|
||||||
|
set -euo pipefail
|
||||||
|
|
||||||
|
SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" &> /dev/null && pwd )"
|
||||||
|
cd "$SCRIPT_DIR/../.."
|
||||||
|
actionlint
|
32
.github/workflows/nixpkgs-vet.yml
vendored
32
.github/workflows/nixpkgs-vet.yml
vendored
|
@ -19,46 +19,34 @@ permissions: {}
|
||||||
# There is a feature request for suppressing notifications on concurrency-canceled runs: https://github.com/orgs/community/discussions/13015
|
# There is a feature request for suppressing notifications on concurrency-canceled runs: https://github.com/orgs/community/discussions/13015
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
|
get-merge-commit:
|
||||||
|
uses: ./.github/workflows/get-merge-commit.yml
|
||||||
|
|
||||||
check:
|
check:
|
||||||
name: nixpkgs-vet
|
name: nixpkgs-vet
|
||||||
# This needs to be x86_64-linux, because we depend on the tooling being pre-built in the GitHub releases.
|
# This needs to be x86_64-linux, because we depend on the tooling being pre-built in the GitHub releases.
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
# This should take 1 minute at most, but let's be generous. The default of 6 hours is definitely too long.
|
# This should take 1 minute at most, but let's be generous. The default of 6 hours is definitely too long.
|
||||||
timeout-minutes: 10
|
timeout-minutes: 10
|
||||||
|
needs: get-merge-commit
|
||||||
steps:
|
steps:
|
||||||
# This checks out the base branch because of pull_request_target
|
|
||||||
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
||||||
with:
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
path: base
|
|
||||||
sparse-checkout: ci
|
|
||||||
- name: Resolving the merge commit
|
|
||||||
env:
|
|
||||||
GH_TOKEN: ${{ github.token }}
|
|
||||||
run: |
|
|
||||||
if mergedSha=$(base/ci/get-merge-commit.sh ${{ github.repository }} ${{ github.event.number }}); then
|
|
||||||
echo "Checking the merge commit $mergedSha"
|
|
||||||
echo "mergedSha=$mergedSha" >> "$GITHUB_ENV"
|
|
||||||
else
|
|
||||||
echo "Skipping the rest..."
|
|
||||||
fi
|
|
||||||
rm -rf base
|
|
||||||
- uses: actions/checkout@11bd71901bbe5b1630ceea73d27597364c9af683 # v4.2.2
|
|
||||||
if: env.mergedSha
|
|
||||||
with:
|
with:
|
||||||
# pull_request_target checks out the base branch by default
|
# pull_request_target checks out the base branch by default
|
||||||
ref: ${{ env.mergedSha }}
|
ref: ${{ needs.get-merge-commit.outputs.mergedSha }}
|
||||||
# Fetches the merge commit and its parents
|
# Fetches the merge commit and its parents
|
||||||
fetch-depth: 2
|
fetch-depth: 2
|
||||||
- name: Checking out base branch
|
- name: Checking out base branch
|
||||||
if: env.mergedSha
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
run: |
|
run: |
|
||||||
base=$(mktemp -d)
|
base=$(mktemp -d)
|
||||||
git worktree add "$base" "$(git rev-parse HEAD^1)"
|
git worktree add "$base" "$(git rev-parse HEAD^1)"
|
||||||
echo "base=$base" >> "$GITHUB_ENV"
|
echo "base=$base" >> "$GITHUB_ENV"
|
||||||
- uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
- uses: cachix/install-nix-action@08dcb3a5e62fa31e2da3d490afc4176ef55ecd72 # v30
|
||||||
if: env.mergedSha
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
- name: Fetching the pinned tool
|
- name: Fetching the pinned tool
|
||||||
if: env.mergedSha
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
# Update the pinned version using ci/nixpkgs-vet/update-pinned-tool.sh
|
# Update the pinned version using ci/nixpkgs-vet/update-pinned-tool.sh
|
||||||
run: |
|
run: |
|
||||||
# The pinned version of the tooling to use.
|
# The pinned version of the tooling to use.
|
||||||
|
@ -71,7 +59,7 @@ jobs:
|
||||||
# Adds a result symlink as a GC root.
|
# Adds a result symlink as a GC root.
|
||||||
nix-store --realise "$toolPath" --add-root result
|
nix-store --realise "$toolPath" --add-root result
|
||||||
- name: Running nixpkgs-vet
|
- name: Running nixpkgs-vet
|
||||||
if: env.mergedSha
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
env:
|
env:
|
||||||
# Force terminal colors to be enabled. The library that `nixpkgs-vet` uses respects https://bixense.com/clicolors/
|
# Force terminal colors to be enabled. The library that `nixpkgs-vet` uses respects https://bixense.com/clicolors/
|
||||||
CLICOLOR_FORCE: 1
|
CLICOLOR_FORCE: 1
|
||||||
|
|
1
.mailmap
1
.mailmap
|
@ -14,6 +14,7 @@ Jörg Thalheim <joerg@thalheim.io> <Mic92@users.noreply.github.com>
|
||||||
Lin Jian <me@linj.tech> <linj.dev@outlook.com>
|
Lin Jian <me@linj.tech> <linj.dev@outlook.com>
|
||||||
Lin Jian <me@linj.tech> <75130626+jian-lin@users.noreply.github.com>
|
Lin Jian <me@linj.tech> <75130626+jian-lin@users.noreply.github.com>
|
||||||
Martin Weinelt <hexa@darmstadt.ccc.de> <mweinelt@users.noreply.github.com>
|
Martin Weinelt <hexa@darmstadt.ccc.de> <mweinelt@users.noreply.github.com>
|
||||||
|
moni <lythe1107@gmail.com> <lythe1107@icloud.com>
|
||||||
R. RyanTM <ryantm-bot@ryantm.com>
|
R. RyanTM <ryantm-bot@ryantm.com>
|
||||||
Robert Hensing <robert@roberthensing.nl> <roberth@users.noreply.github.com>
|
Robert Hensing <robert@roberthensing.nl> <roberth@users.noreply.github.com>
|
||||||
Sandro Jäckel <sandro.jaeckel@gmail.com>
|
Sandro Jäckel <sandro.jaeckel@gmail.com>
|
||||||
|
|
|
@ -345,7 +345,7 @@ See [Nix Channel Status](https://status.nixos.org/) for the current channels and
|
||||||
Here's a brief overview of the main Git branches and what channels they're used for:
|
Here's a brief overview of the main Git branches and what channels they're used for:
|
||||||
|
|
||||||
- `master`: The main branch, used for the unstable channels such as `nixpkgs-unstable`, `nixos-unstable` and `nixos-unstable-small`.
|
- `master`: The main branch, used for the unstable channels such as `nixpkgs-unstable`, `nixos-unstable` and `nixos-unstable-small`.
|
||||||
- `release-YY.MM` (e.g. `release-24.11`): The NixOS release branches, used for the stable channels such as `nixos-24.11`, `nixos-24.11-small` and `nixpkgs-24.11-darwin`.
|
- `release-YY.MM` (e.g. `release-25.05`): The NixOS release branches, used for the stable channels such as `nixos-25.05`, `nixos-25.05-small` and `nixpkgs-25.05-darwin`.
|
||||||
|
|
||||||
When a channel is updated, a corresponding Git branch is also updated to point to the corresponding commit.
|
When a channel is updated, a corresponding Git branch is also updated to point to the corresponding commit.
|
||||||
So e.g. the [`nixpkgs-unstable` branch](https://github.com/nixos/nixpkgs/tree/nixpkgs-unstable) corresponds to the Git commit from the [`nixpkgs-unstable` channel](https://channels.nixos.org/nixpkgs-unstable).
|
So e.g. the [`nixpkgs-unstable` branch](https://github.com/nixos/nixpkgs/tree/nixpkgs-unstable) corresponds to the Git commit from the [`nixpkgs-unstable` channel](https://channels.nixos.org/nixpkgs-unstable).
|
||||||
|
|
|
@ -52,9 +52,9 @@ Nixpkgs and NixOS are built and tested by our continuous integration
|
||||||
system, [Hydra](https://hydra.nixos.org/).
|
system, [Hydra](https://hydra.nixos.org/).
|
||||||
|
|
||||||
* [Continuous package builds for unstable/master](https://hydra.nixos.org/jobset/nixos/trunk-combined)
|
* [Continuous package builds for unstable/master](https://hydra.nixos.org/jobset/nixos/trunk-combined)
|
||||||
* [Continuous package builds for the NixOS 24.05 release](https://hydra.nixos.org/jobset/nixos/release-24.05)
|
* [Continuous package builds for the NixOS 24.11 release](https://hydra.nixos.org/jobset/nixos/release-24.11)
|
||||||
* [Tests for unstable/master](https://hydra.nixos.org/job/nixos/trunk-combined/tested#tabs-constituents)
|
* [Tests for unstable/master](https://hydra.nixos.org/job/nixos/trunk-combined/tested#tabs-constituents)
|
||||||
* [Tests for the NixOS 24.05 release](https://hydra.nixos.org/job/nixos/release-24.05/tested#tabs-constituents)
|
* [Tests for the NixOS 24.11 release](https://hydra.nixos.org/job/nixos/release-24.11/tested#tabs-constituents)
|
||||||
|
|
||||||
Artifacts successfully built with Hydra are published to cache at
|
Artifacts successfully built with Hydra are published to cache at
|
||||||
https://cache.nixos.org/. When successful build and test criteria are
|
https://cache.nixos.org/. When successful build and test criteria are
|
||||||
|
|
|
@ -14,7 +14,7 @@
|
||||||
# Processing of this file is implemented in workflows/codeowners-v2.yml
|
# Processing of this file is implemented in workflows/codeowners-v2.yml
|
||||||
|
|
||||||
# CI
|
# CI
|
||||||
/.github/workflows @NixOS/Security @Mic92 @zowoq
|
/.github/workflows @NixOS/Security @Mic92 @zowoq @infinisil @azuwis
|
||||||
/.github/workflows/check-nix-format.yml @infinisil
|
/.github/workflows/check-nix-format.yml @infinisil
|
||||||
/.github/workflows/nixpkgs-vet.yml @infinisil @philiptaron
|
/.github/workflows/nixpkgs-vet.yml @infinisil @philiptaron
|
||||||
/.github/workflows/codeowners-v2.yml @infinisil
|
/.github/workflows/codeowners-v2.yml @infinisil
|
||||||
|
@ -182,6 +182,7 @@ nixos/modules/installer/tools/nix-fallback-paths.nix @NixOS/nix-team @raitobeza
|
||||||
# Rust
|
# Rust
|
||||||
/pkgs/development/compilers/rust @alyssais @Mic92 @zowoq @winterqt @figsoda
|
/pkgs/development/compilers/rust @alyssais @Mic92 @zowoq @winterqt @figsoda
|
||||||
/pkgs/build-support/rust @zowoq @winterqt @figsoda
|
/pkgs/build-support/rust @zowoq @winterqt @figsoda
|
||||||
|
/pkgs/build-support/rust/fetch-cargo-vendor* @TomaSajt
|
||||||
/doc/languages-frameworks/rust.section.md @zowoq @winterqt @figsoda
|
/doc/languages-frameworks/rust.section.md @zowoq @winterqt @figsoda
|
||||||
|
|
||||||
# Tcl
|
# Tcl
|
||||||
|
@ -217,6 +218,7 @@ pkgs/development/python-modules/buildcatrust/ @ajs124 @lukegb @mweinelt
|
||||||
/doc/languages-frameworks/java.section.md @NixOS/java
|
/doc/languages-frameworks/java.section.md @NixOS/java
|
||||||
/doc/languages-frameworks/gradle.section.md @NixOS/java
|
/doc/languages-frameworks/gradle.section.md @NixOS/java
|
||||||
/doc/languages-frameworks/maven.section.md @NixOS/java
|
/doc/languages-frameworks/maven.section.md @NixOS/java
|
||||||
|
/nixos/modules/programs/java.nix @NixOS/java
|
||||||
/pkgs/top-level/java-packages.nix @NixOS/java
|
/pkgs/top-level/java-packages.nix @NixOS/java
|
||||||
|
|
||||||
# Jetbrains
|
# Jetbrains
|
||||||
|
@ -240,6 +242,7 @@ pkgs/development/python-modules/buildcatrust/ @ajs124 @lukegb @mweinelt
|
||||||
|
|
||||||
# PostgreSQL and related stuff
|
# PostgreSQL and related stuff
|
||||||
/pkgs/servers/sql/postgresql @NixOS/postgres
|
/pkgs/servers/sql/postgresql @NixOS/postgres
|
||||||
|
/pkgs/development/tools/rust/cargo-pgrx @NixOS/postgres
|
||||||
/nixos/modules/services/databases/postgresql.md @NixOS/postgres
|
/nixos/modules/services/databases/postgresql.md @NixOS/postgres
|
||||||
/nixos/modules/services/databases/postgresql.nix @NixOS/postgres
|
/nixos/modules/services/databases/postgresql.nix @NixOS/postgres
|
||||||
/nixos/tests/postgresql @NixOS/postgres
|
/nixos/tests/postgresql @NixOS/postgres
|
||||||
|
|
29
ci/README.md
29
ci/README.md
|
@ -58,7 +58,7 @@ Exit codes:
|
||||||
|
|
||||||
### Usage
|
### Usage
|
||||||
|
|
||||||
This script can be used in GitHub Actions workflows as follows:
|
This script is implemented as a reusable GitHub Actions workflow, and can be used as follows:
|
||||||
|
|
||||||
```yaml
|
```yaml
|
||||||
on: pull_request_target
|
on: pull_request_target
|
||||||
|
@ -67,32 +67,19 @@ on: pull_request_target
|
||||||
permissions: {}
|
permissions: {}
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
|
get-merge-commit:
|
||||||
|
# use the relative path of the get-merge-commit workflow yaml here
|
||||||
|
uses: ./.github/workflows/get-merge-commit.yml
|
||||||
|
|
||||||
build:
|
build:
|
||||||
name: Build
|
name: Build
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
|
needs: get-merge-commit
|
||||||
steps:
|
steps:
|
||||||
# Important: Because of `pull_request_target`, this doesn't check out the PR,
|
|
||||||
# but rather the base branch of the PR, which is needed so we don't run untrusted code
|
|
||||||
- uses: actions/checkout@<VERSION>
|
|
||||||
with:
|
|
||||||
path: base
|
|
||||||
sparse-checkout: ci
|
|
||||||
- name: Resolving the merge commit
|
|
||||||
env:
|
|
||||||
GH_TOKEN: ${{ github.token }}
|
|
||||||
run: |
|
|
||||||
if mergedSha=$(base/ci/get-merge-commit.sh ${{ github.repository }} ${{ github.event.number }}); then
|
|
||||||
echo "Checking the merge commit $mergedSha"
|
|
||||||
echo "mergedSha=$mergedSha" >> "$GITHUB_ENV"
|
|
||||||
else
|
|
||||||
# Skipping so that no notifications are sent
|
|
||||||
echo "Skipping the rest..."
|
|
||||||
fi
|
|
||||||
rm -rf base
|
|
||||||
- uses: actions/checkout@<VERSION>
|
- uses: actions/checkout@<VERSION>
|
||||||
# Add this to _all_ subsequent steps to skip them
|
# Add this to _all_ subsequent steps to skip them
|
||||||
if: env.mergedSha
|
if: needs.get-merge-commit.outputs.mergedSha
|
||||||
with:
|
with:
|
||||||
ref: ${{ env.mergedSha }}
|
ref: ${{ needs.get-merge-commit.outputs.mergedSha }}
|
||||||
- ...
|
- ...
|
||||||
```
|
```
|
||||||
|
|
|
@ -26,4 +26,5 @@ in
|
||||||
inherit pkgs;
|
inherit pkgs;
|
||||||
requestReviews = pkgs.callPackage ./request-reviews { };
|
requestReviews = pkgs.callPackage ./request-reviews { };
|
||||||
codeownersValidator = pkgs.callPackage ./codeowners-validator { };
|
codeownersValidator = pkgs.callPackage ./codeowners-validator { };
|
||||||
|
eval = pkgs.callPackage ./eval { };
|
||||||
}
|
}
|
||||||
|
|
19
ci/eval/README.md
Normal file
19
ci/eval/README.md
Normal file
|
@ -0,0 +1,19 @@
|
||||||
|
# Nixpkgs CI evaluation
|
||||||
|
|
||||||
|
The code in this directory is used by the [eval.yml](../../.github/workflows/eval.yml) GitHub Actions workflow to evaluate the majority of Nixpkgs for all PRs, effectively making sure that when the development branches are processed by Hydra, no evaluation failures are encountered.
|
||||||
|
|
||||||
|
Furthermore it also allows local evaluation using
|
||||||
|
```
|
||||||
|
nix-build ci -A eval.full \
|
||||||
|
--max-jobs 4
|
||||||
|
--cores 2
|
||||||
|
--arg chunkSize 10000
|
||||||
|
```
|
||||||
|
|
||||||
|
- `--max-jobs`: The maximum number of derivations to run at the same time. Only each [supported system](../supportedSystems.nix) gets a separate derivation, so it doesn't make sense to set this higher than that number.
|
||||||
|
- `--cores`: The number of cores to use for each job. Recommended to set this to the amount of cores on your system divided by `--max-jobs`.
|
||||||
|
- `chunkSize`: The number of attributes that are evaluated simultaneously on a single core. Lowering this decreases memory usage at the cost of increased evaluation time. If this is too high, there won't be enough chunks to process them in parallel, and will also increase evaluation time.
|
||||||
|
|
||||||
|
A good default is to set `chunkSize` to 10000, which leads to about 3.6GB max memory usage per core, so suitable for fully utilising machines with 4 cores and 16GB memory, 8 cores and 32GB memory or 16 cores and 64GB memory.
|
||||||
|
|
||||||
|
Note that 16GB memory is the recommended minimum, while with less than 8GB memory evaluation time suffers greatly.
|
164
ci/eval/compare.jq
Normal file
164
ci/eval/compare.jq
Normal file
|
@ -0,0 +1,164 @@
|
||||||
|
# Turns
|
||||||
|
#
|
||||||
|
# {
|
||||||
|
# "hello.aarch64-linux": "a",
|
||||||
|
# "hello.x86_64-linux": "b",
|
||||||
|
# "hello.aarch64-darwin": "c",
|
||||||
|
# "hello.x86_64-darwin": "d"
|
||||||
|
# }
|
||||||
|
#
|
||||||
|
# into
|
||||||
|
#
|
||||||
|
# {
|
||||||
|
# "hello": {
|
||||||
|
# "linux": {
|
||||||
|
# "aarch64": "a",
|
||||||
|
# "x86_64": "b"
|
||||||
|
# },
|
||||||
|
# "darwin": {
|
||||||
|
# "aarch64": "c",
|
||||||
|
# "x86_64": "d"
|
||||||
|
# }
|
||||||
|
# }
|
||||||
|
# }
|
||||||
|
#
|
||||||
|
# while filtering out any attribute paths that don't match this pattern
|
||||||
|
def expand_system:
|
||||||
|
to_entries
|
||||||
|
| map(
|
||||||
|
.key |= split(".")
|
||||||
|
| select(.key | length > 1)
|
||||||
|
| .double = (.key[-1] | split("-"))
|
||||||
|
| select(.double | length == 2)
|
||||||
|
)
|
||||||
|
| group_by(.key[0:-1])
|
||||||
|
| map(
|
||||||
|
{
|
||||||
|
key: .[0].key[0:-1] | join("."),
|
||||||
|
value:
|
||||||
|
group_by(.double[1])
|
||||||
|
| map(
|
||||||
|
{
|
||||||
|
key: .[0].double[1],
|
||||||
|
value: map(.key = .double[0]) | from_entries
|
||||||
|
}
|
||||||
|
)
|
||||||
|
| from_entries
|
||||||
|
})
|
||||||
|
| from_entries
|
||||||
|
;
|
||||||
|
|
||||||
|
# Transposes
|
||||||
|
#
|
||||||
|
# {
|
||||||
|
# "a": [ "x", "y" ],
|
||||||
|
# "b": [ "x" ],
|
||||||
|
# }
|
||||||
|
#
|
||||||
|
# into
|
||||||
|
#
|
||||||
|
# {
|
||||||
|
# "x": [ "a", "b" ],
|
||||||
|
# "y": [ "a" ]
|
||||||
|
# }
|
||||||
|
def transpose:
|
||||||
|
[
|
||||||
|
to_entries[]
|
||||||
|
| {
|
||||||
|
key: .key,
|
||||||
|
value: .value[]
|
||||||
|
}
|
||||||
|
]
|
||||||
|
| group_by(.value)
|
||||||
|
| map({
|
||||||
|
key: .[0].value,
|
||||||
|
value: map(.key)
|
||||||
|
})
|
||||||
|
| from_entries
|
||||||
|
;
|
||||||
|
|
||||||
|
# Computes the key difference for two objects:
|
||||||
|
# {
|
||||||
|
# added: [ <keys only in the second object> ],
|
||||||
|
# removed: [ <keys only in the first object> ],
|
||||||
|
# changed: [ <keys with different values between the two objects> ],
|
||||||
|
# }
|
||||||
|
#
|
||||||
|
def diff($before; $after):
|
||||||
|
{
|
||||||
|
added: $after | delpaths($before | keys | map([.])) | keys,
|
||||||
|
removed: $before | delpaths($after | keys | map([.])) | keys,
|
||||||
|
changed:
|
||||||
|
$before
|
||||||
|
| to_entries
|
||||||
|
| map(
|
||||||
|
$after."\(.key)" as $after2
|
||||||
|
| select(
|
||||||
|
# Filter out attributes that don't exist anymore
|
||||||
|
($after2 != null)
|
||||||
|
and
|
||||||
|
# Filter out attributes that are the same as the new value
|
||||||
|
(.value != $after2)
|
||||||
|
)
|
||||||
|
| .key
|
||||||
|
)
|
||||||
|
}
|
||||||
|
;
|
||||||
|
|
||||||
|
($before[0] | expand_system) as $before
|
||||||
|
| ($after[0] | expand_system) as $after
|
||||||
|
| .attrdiff = diff($before; $after)
|
||||||
|
| .rebuildsByKernel = (
|
||||||
|
[
|
||||||
|
(
|
||||||
|
.attrdiff.changed[]
|
||||||
|
| {
|
||||||
|
key: .,
|
||||||
|
value: diff($before."\(.)"; $after."\(.)").changed
|
||||||
|
}
|
||||||
|
)
|
||||||
|
,
|
||||||
|
(
|
||||||
|
.attrdiff.added[]
|
||||||
|
| {
|
||||||
|
key: .,
|
||||||
|
value: ($after."\(.)" | keys)
|
||||||
|
}
|
||||||
|
)
|
||||||
|
]
|
||||||
|
| from_entries
|
||||||
|
| transpose
|
||||||
|
)
|
||||||
|
| .rebuildCountByKernel = (
|
||||||
|
.rebuildsByKernel
|
||||||
|
| with_entries(.value |= length)
|
||||||
|
| pick(.linux, .darwin)
|
||||||
|
| {
|
||||||
|
linux: (.linux // 0),
|
||||||
|
darwin: (.darwin // 0),
|
||||||
|
}
|
||||||
|
)
|
||||||
|
| .labels = (
|
||||||
|
.rebuildCountByKernel
|
||||||
|
| to_entries
|
||||||
|
| map(
|
||||||
|
"10.rebuild-\(.key): " +
|
||||||
|
if .value == 0 then
|
||||||
|
"0"
|
||||||
|
elif .value <= 10 then
|
||||||
|
"1-10"
|
||||||
|
elif .value <= 100 then
|
||||||
|
"11-100"
|
||||||
|
elif .value <= 500 then
|
||||||
|
"101-500"
|
||||||
|
elif .value <= 1000 then
|
||||||
|
"501-1000"
|
||||||
|
elif .value <= 2500 then
|
||||||
|
"1001-2500"
|
||||||
|
elif .value <= 5000 then
|
||||||
|
"2501-5000"
|
||||||
|
else
|
||||||
|
"5001+"
|
||||||
|
end
|
||||||
|
)
|
||||||
|
)
|
303
ci/eval/default.nix
Normal file
303
ci/eval/default.nix
Normal file
|
@ -0,0 +1,303 @@
|
||||||
|
{
|
||||||
|
lib,
|
||||||
|
runCommand,
|
||||||
|
writeShellScript,
|
||||||
|
linkFarm,
|
||||||
|
time,
|
||||||
|
procps,
|
||||||
|
nixVersions,
|
||||||
|
jq,
|
||||||
|
sta,
|
||||||
|
}:
|
||||||
|
|
||||||
|
let
|
||||||
|
nixpkgs =
|
||||||
|
with lib.fileset;
|
||||||
|
toSource {
|
||||||
|
root = ../..;
|
||||||
|
fileset = unions (
|
||||||
|
map (lib.path.append ../..) [
|
||||||
|
"default.nix"
|
||||||
|
"doc"
|
||||||
|
"lib"
|
||||||
|
"maintainers"
|
||||||
|
"nixos"
|
||||||
|
"pkgs"
|
||||||
|
".version"
|
||||||
|
"ci/supportedSystems.nix"
|
||||||
|
]
|
||||||
|
);
|
||||||
|
};
|
||||||
|
|
||||||
|
nix = nixVersions.nix_2_24;
|
||||||
|
|
||||||
|
supportedSystems = import ../supportedSystems.nix;
|
||||||
|
|
||||||
|
attrpathsSuperset =
|
||||||
|
runCommand "attrpaths-superset.json"
|
||||||
|
{
|
||||||
|
src = nixpkgs;
|
||||||
|
nativeBuildInputs = [
|
||||||
|
nix
|
||||||
|
time
|
||||||
|
];
|
||||||
|
env.supportedSystems = builtins.toJSON supportedSystems;
|
||||||
|
passAsFile = [ "supportedSystems" ];
|
||||||
|
}
|
||||||
|
''
|
||||||
|
export NIX_STATE_DIR=$(mktemp -d)
|
||||||
|
mkdir $out
|
||||||
|
export GC_INITIAL_HEAP_SIZE=4g
|
||||||
|
command time -v \
|
||||||
|
nix-instantiate --eval --strict --json --show-trace \
|
||||||
|
"$src/pkgs/top-level/release-attrpaths-superset.nix" \
|
||||||
|
-A paths \
|
||||||
|
-I "$src" \
|
||||||
|
--option restrict-eval true \
|
||||||
|
--option allow-import-from-derivation false \
|
||||||
|
--arg enableWarnings false > $out/paths.json
|
||||||
|
mv "$supportedSystemsPath" $out/systems.json
|
||||||
|
'';
|
||||||
|
|
||||||
|
singleSystem =
|
||||||
|
{
|
||||||
|
# The system to evaluate.
|
||||||
|
# Note that this is intentionally not called `system`,
|
||||||
|
# because `--argstr system` would only be passed to the ci/default.nix file!
|
||||||
|
evalSystem,
|
||||||
|
# The path to the `paths.json` file from `attrpathsSuperset`
|
||||||
|
attrpathFile,
|
||||||
|
# The number of attributes per chunk, see ./README.md for more info.
|
||||||
|
chunkSize,
|
||||||
|
checkMeta ? true,
|
||||||
|
includeBroken ? true,
|
||||||
|
# Whether to just evaluate a single chunk for quick testing
|
||||||
|
quickTest ? false,
|
||||||
|
}:
|
||||||
|
let
|
||||||
|
singleChunk = writeShellScript "single-chunk" ''
|
||||||
|
set -euo pipefail
|
||||||
|
chunkSize=$1
|
||||||
|
myChunk=$2
|
||||||
|
system=$3
|
||||||
|
outputDir=$4
|
||||||
|
|
||||||
|
export NIX_SHOW_STATS=1
|
||||||
|
export NIX_SHOW_STATS_PATH="$outputDir/stats/$myChunk"
|
||||||
|
echo "Chunk $myChunk on $system start"
|
||||||
|
set +e
|
||||||
|
command time -f "Chunk $myChunk on $system done [%MKB max resident, %Es elapsed] %C" \
|
||||||
|
nix-env -f "${nixpkgs}/pkgs/top-level/release-attrpaths-parallel.nix" \
|
||||||
|
--option restrict-eval true \
|
||||||
|
--option allow-import-from-derivation false \
|
||||||
|
--query --available \
|
||||||
|
--no-name --attr-path --out-path \
|
||||||
|
--show-trace \
|
||||||
|
--arg chunkSize "$chunkSize" \
|
||||||
|
--arg myChunk "$myChunk" \
|
||||||
|
--arg attrpathFile "${attrpathFile}" \
|
||||||
|
--arg systems "[ \"$system\" ]" \
|
||||||
|
--arg checkMeta ${lib.boolToString checkMeta} \
|
||||||
|
--arg includeBroken ${lib.boolToString includeBroken} \
|
||||||
|
-I ${nixpkgs} \
|
||||||
|
-I ${attrpathFile} \
|
||||||
|
> "$outputDir/result/$myChunk"
|
||||||
|
exitCode=$?
|
||||||
|
set -e
|
||||||
|
if (( exitCode != 0 )); then
|
||||||
|
echo "Evaluation failed with exit code $exitCode"
|
||||||
|
# This immediately halts all xargs processes
|
||||||
|
kill $PPID
|
||||||
|
fi
|
||||||
|
'';
|
||||||
|
in
|
||||||
|
runCommand "nixpkgs-eval-${evalSystem}"
|
||||||
|
{
|
||||||
|
nativeBuildInputs = [
|
||||||
|
nix
|
||||||
|
time
|
||||||
|
procps
|
||||||
|
jq
|
||||||
|
];
|
||||||
|
env = {
|
||||||
|
inherit evalSystem chunkSize;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
''
|
||||||
|
export NIX_STATE_DIR=$(mktemp -d)
|
||||||
|
nix-store --init
|
||||||
|
|
||||||
|
echo "System: $evalSystem"
|
||||||
|
cores=$NIX_BUILD_CORES
|
||||||
|
echo "Cores: $cores"
|
||||||
|
attrCount=$(jq length "${attrpathFile}")
|
||||||
|
echo "Attribute count: $attrCount"
|
||||||
|
echo "Chunk size: $chunkSize"
|
||||||
|
# Same as `attrCount / chunkSize` but rounded up
|
||||||
|
chunkCount=$(( (attrCount - 1) / chunkSize + 1 ))
|
||||||
|
echo "Chunk count: $chunkCount"
|
||||||
|
|
||||||
|
mkdir $out
|
||||||
|
|
||||||
|
# Record and print stats on free memory and swap in the background
|
||||||
|
(
|
||||||
|
while true; do
|
||||||
|
availMemory=$(free -b | grep Mem | awk '{print $7}')
|
||||||
|
freeSwap=$(free -b | grep Swap | awk '{print $4}')
|
||||||
|
echo "Available memory: $(( availMemory / 1024 / 1024 )) MiB, free swap: $(( freeSwap / 1024 / 1024 )) MiB"
|
||||||
|
|
||||||
|
if [[ ! -f "$out/min-avail-memory" ]] || (( availMemory < $(<$out/min-avail-memory) )); then
|
||||||
|
echo "$availMemory" > $out/min-avail-memory
|
||||||
|
fi
|
||||||
|
if [[ ! -f $out/min-free-swap ]] || (( availMemory < $(<$out/min-free-swap) )); then
|
||||||
|
echo "$freeSwap" > $out/min-free-swap
|
||||||
|
fi
|
||||||
|
sleep 4
|
||||||
|
done
|
||||||
|
) &
|
||||||
|
|
||||||
|
seq_end=$(( chunkCount - 1 ))
|
||||||
|
|
||||||
|
${lib.optionalString quickTest ''
|
||||||
|
seq_end=0
|
||||||
|
''}
|
||||||
|
|
||||||
|
chunkOutputDir=$(mktemp -d)
|
||||||
|
mkdir "$chunkOutputDir"/{result,stats}
|
||||||
|
|
||||||
|
seq -w 0 "$seq_end" |
|
||||||
|
command time -f "%e" -o "$out/total-time" \
|
||||||
|
xargs -I{} -P"$cores" \
|
||||||
|
${singleChunk} "$chunkSize" {} "$evalSystem" "$chunkOutputDir"
|
||||||
|
|
||||||
|
if (( chunkSize * chunkCount != attrCount )); then
|
||||||
|
# A final incomplete chunk would mess up the stats, don't include it
|
||||||
|
rm "$chunkOutputDir"/stats/"$seq_end"
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Make sure the glob doesn't break when there's no files
|
||||||
|
shopt -s nullglob
|
||||||
|
cat "$chunkOutputDir"/result/* > $out/paths
|
||||||
|
cat "$chunkOutputDir"/stats/* > $out/stats.jsonstream
|
||||||
|
'';
|
||||||
|
|
||||||
|
combine =
|
||||||
|
{
|
||||||
|
resultsDir,
|
||||||
|
}:
|
||||||
|
runCommand "combined-result"
|
||||||
|
{
|
||||||
|
nativeBuildInputs = [
|
||||||
|
jq
|
||||||
|
sta
|
||||||
|
];
|
||||||
|
}
|
||||||
|
''
|
||||||
|
mkdir -p $out
|
||||||
|
|
||||||
|
# Transform output paths to JSON
|
||||||
|
cat ${resultsDir}/*/paths |
|
||||||
|
jq --sort-keys --raw-input --slurp '
|
||||||
|
split("\n") |
|
||||||
|
map(select(. != "") | split(" ") | map(select(. != ""))) |
|
||||||
|
map(
|
||||||
|
{
|
||||||
|
key: .[0],
|
||||||
|
value: .[1] | split(";") | map(split("=") |
|
||||||
|
if length == 1 then
|
||||||
|
{ key: "out", value: .[0] }
|
||||||
|
else
|
||||||
|
{ key: .[0], value: .[1] }
|
||||||
|
end) | from_entries}
|
||||||
|
) | from_entries
|
||||||
|
' > $out/outpaths.json
|
||||||
|
|
||||||
|
# Computes min, mean, error, etc. for a list of values and outputs a JSON from that
|
||||||
|
statistics() {
|
||||||
|
local stat=$1
|
||||||
|
sta --transpose |
|
||||||
|
jq --raw-input --argjson stat "$stat" -n '
|
||||||
|
[
|
||||||
|
inputs |
|
||||||
|
split("\t") |
|
||||||
|
{ key: .[0], value: (.[1] | fromjson) }
|
||||||
|
] |
|
||||||
|
from_entries |
|
||||||
|
{
|
||||||
|
key: ($stat | join(".")),
|
||||||
|
value: .
|
||||||
|
}'
|
||||||
|
}
|
||||||
|
|
||||||
|
# Gets all available number stats (without .sizes because those are constant and not interesting)
|
||||||
|
readarray -t stats < <(jq -cs '.[0] | del(.sizes) | paths(type == "number")' ${resultsDir}/*/stats.jsonstream)
|
||||||
|
|
||||||
|
# Combines the statistics from all evaluations
|
||||||
|
{
|
||||||
|
echo "{ \"key\": \"minAvailMemory\", \"value\": $(cat ${resultsDir}/*/min-avail-memory | sta --brief --min) }"
|
||||||
|
echo "{ \"key\": \"minFreeSwap\", \"value\": $(cat ${resultsDir}/*/min-free-swap | sta --brief --min) }"
|
||||||
|
cat ${resultsDir}/*/total-time | statistics '["totalTime"]'
|
||||||
|
for stat in "''${stats[@]}"; do
|
||||||
|
cat ${resultsDir}/*/stats.jsonstream |
|
||||||
|
jq --argjson stat "$stat" 'getpath($stat)' |
|
||||||
|
statistics "$stat"
|
||||||
|
done
|
||||||
|
} |
|
||||||
|
jq -s from_entries > $out/stats.json
|
||||||
|
'';
|
||||||
|
|
||||||
|
compare =
|
||||||
|
{ beforeResultDir, afterResultDir }:
|
||||||
|
runCommand "compare"
|
||||||
|
{
|
||||||
|
nativeBuildInputs = [
|
||||||
|
jq
|
||||||
|
];
|
||||||
|
}
|
||||||
|
''
|
||||||
|
mkdir $out
|
||||||
|
jq -n -f ${./compare.jq} \
|
||||||
|
--slurpfile before ${beforeResultDir}/outpaths.json \
|
||||||
|
--slurpfile after ${afterResultDir}/outpaths.json \
|
||||||
|
> $out/changed-paths.json
|
||||||
|
|
||||||
|
jq -r -f ${./generate-step-summary.jq} < $out/changed-paths.json > $out/step-summary.md
|
||||||
|
# TODO: Compare eval stats
|
||||||
|
'';
|
||||||
|
|
||||||
|
full =
|
||||||
|
{
|
||||||
|
# Whether to evaluate just a single system, by default all are evaluated
|
||||||
|
evalSystem ? if quickTest then "x86_64-linux" else null,
|
||||||
|
# The number of attributes per chunk, see ./README.md for more info.
|
||||||
|
chunkSize,
|
||||||
|
quickTest ? false,
|
||||||
|
}:
|
||||||
|
let
|
||||||
|
systems = if evalSystem == null then supportedSystems else [ evalSystem ];
|
||||||
|
results = linkFarm "results" (
|
||||||
|
map (evalSystem: {
|
||||||
|
name = evalSystem;
|
||||||
|
path = singleSystem {
|
||||||
|
inherit quickTest evalSystem chunkSize;
|
||||||
|
attrpathFile = attrpathsSuperset + "/paths.json";
|
||||||
|
};
|
||||||
|
}) systems
|
||||||
|
);
|
||||||
|
in
|
||||||
|
combine {
|
||||||
|
resultsDir = results;
|
||||||
|
};
|
||||||
|
|
||||||
|
in
|
||||||
|
{
|
||||||
|
inherit
|
||||||
|
attrpathsSuperset
|
||||||
|
singleSystem
|
||||||
|
combine
|
||||||
|
compare
|
||||||
|
# The above three are used by separate VMs in a GitHub workflow,
|
||||||
|
# while the below is intended for testing on a single local machine
|
||||||
|
full
|
||||||
|
;
|
||||||
|
}
|
15
ci/eval/generate-step-summary.jq
Normal file
15
ci/eval/generate-step-summary.jq
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
def truncate(xs; n):
|
||||||
|
if xs | length > n then xs[:n] + ["..."]
|
||||||
|
else xs
|
||||||
|
end;
|
||||||
|
|
||||||
|
def itemize_packages(xs):
|
||||||
|
# we truncate the list to stay below the GitHub limit of 1MB per step summary.
|
||||||
|
truncate(xs; 3000) | map("- [\(.)](https://search.nixos.org/packages?channel=unstable&show=\(.)&from=0&size=50&sort=relevance&type=packages&query=\(.))") | join("\n");
|
||||||
|
|
||||||
|
def section(title; xs):
|
||||||
|
"<details> <summary>" + title + " (" + (xs | length | tostring) + ")</summary>\n\n" + itemize_packages(xs) + "</details>";
|
||||||
|
|
||||||
|
section("Added packages"; .attrdiff.added) + "\n\n" +
|
||||||
|
section("Removed packages"; .attrdiff.removed) + "\n\n" +
|
||||||
|
section("Changed packages"; .attrdiff.changed)
|
|
@ -1,4 +1,4 @@
|
||||||
{
|
{
|
||||||
"rev": "4de4818c1ffa76d57787af936e8a23648bda6be4",
|
"rev": "31d66ae40417bb13765b0ad75dd200400e98de84",
|
||||||
"sha256": "0l3b9jr5ydzqgvd10j12imc9jqb6jv5v2bdi1gyy5cwkwplfay67"
|
"sha256": "0fwsqd05bnk635niqnx9vqkdbinjq0ffdrbk66xllfyrnx4fvmpc"
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,7 +1,9 @@
|
||||||
# Trusted development branches:
|
# Trusted development branches:
|
||||||
# These generally require PRs to update and are built by Hydra.
|
# These generally require PRs to update and are built by Hydra.
|
||||||
|
# Keep this synced with the branches in .github/workflows/eval.yml
|
||||||
master
|
master
|
||||||
staging
|
staging
|
||||||
release-*
|
release-*
|
||||||
staging-*
|
staging-*
|
||||||
haskell-updates
|
haskell-updates
|
||||||
|
python-updates
|
||||||
|
|
6
ci/supportedSystems.nix
Normal file
6
ci/supportedSystems.nix
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
[
|
||||||
|
"aarch64-linux"
|
||||||
|
"aarch64-darwin"
|
||||||
|
"x86_64-linux"
|
||||||
|
"x86_64-darwin"
|
||||||
|
]
|
|
@ -364,7 +364,7 @@ including `nativeBuildInputs` to specify dependencies available to the `script`.
|
||||||
```nix
|
```nix
|
||||||
testers.runCommand {
|
testers.runCommand {
|
||||||
name = "access-the-internet";
|
name = "access-the-internet";
|
||||||
command = ''
|
script = ''
|
||||||
curl -o /dev/null https://example.com
|
curl -o /dev/null https://example.com
|
||||||
touch $out
|
touch $out
|
||||||
'';
|
'';
|
||||||
|
|
|
@ -754,10 +754,6 @@ This creates a derivation with a directory structure like the following:
|
||||||
...
|
...
|
||||||
```
|
```
|
||||||
|
|
||||||
## `writeReferencesToFile` {#trivial-builder-writeReferencesToFile}
|
|
||||||
|
|
||||||
Deprecated. Use [`writeClosure`](#trivial-builder-writeClosure) instead.
|
|
||||||
|
|
||||||
## `writeClosure` {#trivial-builder-writeClosure}
|
## `writeClosure` {#trivial-builder-writeClosure}
|
||||||
|
|
||||||
Given a list of [store paths](https://nixos.org/manual/nix/stable/glossary#gloss-store-path) (or string-like expressions coercible to store paths), write their collective [closure](https://nixos.org/manual/nix/stable/glossary#gloss-closure) to a text file.
|
Given a list of [store paths](https://nixos.org/manual/nix/stable/glossary#gloss-store-path) (or string-like expressions coercible to store paths), write their collective [closure](https://nixos.org/manual/nix/stable/glossary#gloss-closure) to a text file.
|
||||||
|
|
|
@ -9,6 +9,8 @@
|
||||||
mkShellNoCC,
|
mkShellNoCC,
|
||||||
documentation-highlighter,
|
documentation-highlighter,
|
||||||
nixos-render-docs,
|
nixos-render-docs,
|
||||||
|
nixos-render-docs-redirects,
|
||||||
|
writeShellScriptBin,
|
||||||
nixpkgs ? { },
|
nixpkgs ? { },
|
||||||
}:
|
}:
|
||||||
|
|
||||||
|
@ -105,8 +107,14 @@ stdenvNoCC.mkDerivation (
|
||||||
buildArgs = "./.";
|
buildArgs = "./.";
|
||||||
open = "/share/doc/nixpkgs/manual.html";
|
open = "/share/doc/nixpkgs/manual.html";
|
||||||
};
|
};
|
||||||
|
nixos-render-docs-redirects' = writeShellScriptBin "redirects" "${lib.getExe nixos-render-docs-redirects} --file ${toString ../redirects.json} $@";
|
||||||
in
|
in
|
||||||
mkShellNoCC { packages = [ devmode' ]; };
|
mkShellNoCC {
|
||||||
|
packages = [
|
||||||
|
devmode'
|
||||||
|
nixos-render-docs-redirects'
|
||||||
|
];
|
||||||
|
};
|
||||||
|
|
||||||
tests.manpage-urls = callPackage ../tests/manpage-urls.nix { };
|
tests.manpage-urls = callPackage ../tests/manpage-urls.nix { };
|
||||||
};
|
};
|
||||||
|
|
|
@ -14,15 +14,13 @@ In Nixpkgs, `cargo-tauri.hook` overrides the default build and install phases.
|
||||||
rustPlatform,
|
rustPlatform,
|
||||||
fetchNpmDeps,
|
fetchNpmDeps,
|
||||||
cargo-tauri,
|
cargo-tauri,
|
||||||
darwin,
|
|
||||||
glib-networking,
|
glib-networking,
|
||||||
libsoup,
|
|
||||||
nodejs,
|
nodejs,
|
||||||
npmHooks,
|
npmHooks,
|
||||||
openssl,
|
openssl,
|
||||||
pkg-config,
|
pkg-config,
|
||||||
webkitgtk_4_0,
|
webkitgtk_4_1,
|
||||||
wrapGAppsHook3,
|
wrapGAppsHook4,
|
||||||
}:
|
}:
|
||||||
|
|
||||||
rustPlatform.buildRustPackage rec {
|
rustPlatform.buildRustPackage rec {
|
||||||
|
@ -47,25 +45,15 @@ rustPlatform.buildRustPackage rec {
|
||||||
|
|
||||||
# Make sure we can find our libraries
|
# Make sure we can find our libraries
|
||||||
pkg-config
|
pkg-config
|
||||||
wrapGAppsHook3
|
wrapGAppsHook4
|
||||||
];
|
];
|
||||||
|
|
||||||
buildInputs =
|
buildInputs =
|
||||||
[ openssl ]
|
[ openssl ]
|
||||||
++ lib.optionals stdenv.hostPlatform.isLinux [
|
++ lib.optionals stdenv.hostPlatform.isLinux [
|
||||||
glib-networking # Most Tauri apps need networking
|
glib-networking # Most Tauri apps need networking
|
||||||
libsoup
|
webkitgtk_4_1
|
||||||
webkitgtk_4_0
|
];
|
||||||
]
|
|
||||||
++ lib.optionals stdenv.hostPlatform.isDarwin (
|
|
||||||
with darwin.apple_sdk.frameworks;
|
|
||||||
[
|
|
||||||
AppKit
|
|
||||||
CoreServices
|
|
||||||
Security
|
|
||||||
WebKit
|
|
||||||
]
|
|
||||||
);
|
|
||||||
|
|
||||||
# Set our Tauri source directory
|
# Set our Tauri source directory
|
||||||
cargoRoot = "src-tauri";
|
cargoRoot = "src-tauri";
|
||||||
|
|
|
@ -60,13 +60,13 @@ all the other eggs:
|
||||||
|
|
||||||
```nix
|
```nix
|
||||||
let
|
let
|
||||||
myChickenPackages = pkgs.chickenPackages.overrideScope' (self: super: {
|
myChickenPackages = pkgs.chickenPackages.overrideScope (self: super: {
|
||||||
# The chicken package itself can be overridden to effect the whole ecosystem.
|
# The chicken package itself can be overridden to effect the whole ecosystem.
|
||||||
# chicken = super.chicken.overrideAttrs {
|
# chicken = super.chicken.overrideAttrs {
|
||||||
# src = ...
|
# src = ...
|
||||||
# };
|
# };
|
||||||
|
|
||||||
chickenEggs = super.chickenEggs.overrideScope' (eggself: eggsuper: {
|
chickenEggs = super.chickenEggs.overrideScope (eggself: eggsuper: {
|
||||||
srfi-180 = eggsuper.srfi-180.overrideAttrs {
|
srfi-180 = eggsuper.srfi-180.overrideAttrs {
|
||||||
# path to a local copy of srfi-180
|
# path to a local copy of srfi-180
|
||||||
src = <...>;
|
src = <...>;
|
||||||
|
|
|
@ -7,32 +7,6 @@ The function `buildGoModule` builds Go programs managed with Go modules. It buil
|
||||||
- An intermediate fetcher derivation called `goModules`. This derivation will be used to fetch all the dependencies of the Go module.
|
- An intermediate fetcher derivation called `goModules`. This derivation will be used to fetch all the dependencies of the Go module.
|
||||||
- A final derivation will use the output of the intermediate derivation to build the binaries and produce the final output.
|
- A final derivation will use the output of the intermediate derivation to build the binaries and produce the final output.
|
||||||
|
|
||||||
### Attributes of `buildGoModule` {#buildgomodule-parameters}
|
|
||||||
|
|
||||||
The `buildGoModule` function accepts the following parameters in addition to the [attributes accepted by both Go builders](#ssec-go-common-attributes):
|
|
||||||
|
|
||||||
- `vendorHash`: is the hash of the output of the intermediate fetcher derivation (the dependencies of the Go modules).
|
|
||||||
|
|
||||||
`vendorHash` can be set to `null`.
|
|
||||||
In that case, rather than fetching the dependencies, the dependencies already vendored in the `vendor` directory of the source repo will be used.
|
|
||||||
|
|
||||||
To avoid updating this field when dependencies change, run `go mod vendor` in your source repo and set `vendorHash = null;`.
|
|
||||||
You can read more about [vendoring in the Go documentation](https://go.dev/ref/mod#vendoring).
|
|
||||||
|
|
||||||
To obtain the actual hash, set `vendorHash = lib.fakeHash;` and run the build ([more details here](#sec-source-hashes)).
|
|
||||||
- `proxyVendor`: If `true`, the intermediate fetcher downloads dependencies from the
|
|
||||||
[Go module proxy](https://go.dev/ref/mod#module-proxy) (using `go mod download`) instead of vendoring them. The resulting
|
|
||||||
[module cache](https://go.dev/ref/mod#module-cache) is then passed to the final derivation.
|
|
||||||
|
|
||||||
This is useful if your code depends on C code and `go mod tidy` does not include the needed sources to build or
|
|
||||||
if any dependency has case-insensitive conflicts which will produce platform-dependent `vendorHash` checksums.
|
|
||||||
|
|
||||||
Defaults to `false`.
|
|
||||||
- `modPostBuild`: Shell commands to run after the build of the goModules executes `go mod vendor`, and before calculating fixed output derivation's `vendorHash`.
|
|
||||||
Note that if you change this attribute, you need to update `vendorHash` attribute.
|
|
||||||
- `modRoot`: The root directory of the Go module that contains the `go.mod` file.
|
|
||||||
Defaults to `./`, which is the root of `src`.
|
|
||||||
|
|
||||||
### Example for `buildGoModule` {#ex-buildGoModule}
|
### Example for `buildGoModule` {#ex-buildGoModule}
|
||||||
|
|
||||||
The following is an example expression using `buildGoModule`:
|
The following is an example expression using `buildGoModule`:
|
||||||
|
@ -62,17 +36,45 @@ The following is an example expression using `buildGoModule`:
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
### Obtaining and overriding `vendorHash` for `buildGoModule` {#buildGoModule-vendorHash}
|
## Attributes of `buildGoModule` {#buildgomodule-parameters}
|
||||||
|
|
||||||
|
Many attributes [controlling the build phase](#variables-controlling-the-build-phase) are respected by `buildGoModule`. Note that `buildGoModule` reads the following attributes also when building the `vendor/` goModules fixed output derivation as well:
|
||||||
|
|
||||||
|
- [`sourceRoot`](#var-stdenv-sourceRoot)
|
||||||
|
- [`prePatch`](#var-stdenv-prePatch)
|
||||||
|
- [`patches`](#var-stdenv-patches)
|
||||||
|
- [`patchFlags`](#var-stdenv-patchFlags)
|
||||||
|
- [`postPatch`](#var-stdenv-postPatch)
|
||||||
|
- [`preBuild`](#var-stdenv-preBuild)
|
||||||
|
- `env`: useful for passing down variables such as `GOWORK`.
|
||||||
|
|
||||||
|
To control test execution of the build derivation, the following attributes are of interest:
|
||||||
|
|
||||||
|
- [`checkInputs`](#var-stdenv-checkInputs)
|
||||||
|
- [`preCheck`](#var-stdenv-preCheck)
|
||||||
|
- [`checkFlags`](#var-stdenv-checkFlags)
|
||||||
|
|
||||||
|
In addition to the above attributes, and the many more variables respected also by `stdenv.mkDerivation`, `buildGoModule` respects Go-specific attributes that tweak them to behave slightly differently:
|
||||||
|
|
||||||
|
### `vendorHash` {#var-go-vendorHash}
|
||||||
|
|
||||||
|
Hash of the output of the intermediate fetcher derivation (the dependencies of the Go modules).
|
||||||
|
|
||||||
|
`vendorHash` can be set to `null`.
|
||||||
|
In that case, rather than fetching the dependencies, the dependencies already vendored in the `vendor` directory of the source repo will be used.
|
||||||
|
|
||||||
|
To avoid updating this field when dependencies change, run `go mod vendor` in your source repo and set `vendorHash = null;`.
|
||||||
|
You can read more about [vendoring in the Go documentation](https://go.dev/ref/mod#vendoring).
|
||||||
|
|
||||||
|
To obtain the hash, set `vendorHash = lib.fakeHash;` and run the build. ([more details here](#sec-source-hashes)).
|
||||||
|
Another way is to use use `nix-prefetch` to obtain the hash. The following command gets the value of `vendorHash` for package `pet`:
|
||||||
|
|
||||||
We can use `nix-prefetch` to obtain the actual hash. The following command gets the value of `vendorHash` for package `pet`:
|
|
||||||
|
|
||||||
```sh
|
```sh
|
||||||
cd path/to/nixpkgs
|
cd path/to/nixpkgs
|
||||||
nix-prefetch -E "{ sha256 }: ((import ./. { }).my-package.overrideAttrs { vendorHash = sha256; }).goModules"
|
nix-prefetch -E "{ sha256 }: ((import ./. { }).my-package.overrideAttrs { vendorHash = sha256; }).goModules"
|
||||||
```
|
```
|
||||||
|
|
||||||
To obtain the hash without external tools, set `vendorHash = lib.fakeHash;` and run the build. ([more details here](#sec-source-hashes)).
|
|
||||||
|
|
||||||
`vendorHash` can be overridden with `overrideAttrs`. Override the above example like this:
|
`vendorHash` can be overridden with `overrideAttrs`. Override the above example like this:
|
||||||
|
|
||||||
```nix
|
```nix
|
||||||
|
@ -91,144 +93,29 @@ To obtain the hash without external tools, set `vendorHash = lib.fakeHash;` and
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
### Overriding `goModules` {#buildGoModule-goModules-override}
|
### `proxyVendor` {#var-go-proxyVendor}
|
||||||
|
|
||||||
Overriding `<pkg>.goModules` by calling `goModules.overrideAttrs` is unsupported. Still, it is possible to override the `vendorHash` (`goModules`'s `outputHash`) and the `pre`/`post` hooks for both the build and patch phases of the primary and `goModules` derivation. Alternatively, the primary derivation provides an overridable `passthru.overrideModAttrs` function to store the attribute overlay implicitly taken by `goModules.overrideAttrs`. Here's an example usage of `overrideModAttrs`:
|
If `true`, the intermediate fetcher downloads dependencies from the
|
||||||
|
[Go module proxy](https://go.dev/ref/mod#module-proxy) (using `go mod download`) instead of vendoring them. The resulting
|
||||||
|
[module cache](https://go.dev/ref/mod#module-cache) is then passed to the final derivation.
|
||||||
|
|
||||||
```nix
|
This is useful if your code depends on C code and `go mod tidy` does not include the needed sources to build or
|
||||||
{
|
if any dependency has case-insensitive conflicts which will produce platform-dependent `vendorHash` checksums.
|
||||||
pet-overridden = pet.overrideAttrs (
|
|
||||||
finalAttrs: previousAttrs: {
|
|
||||||
passthru = previousAttrs.passthru // {
|
|
||||||
# If the original package has an `overrideModAttrs` attribute set, you'd
|
|
||||||
# want to extend it, and not replace it. Hence we use
|
|
||||||
# `lib.composeExtensions`. If you are sure the `overrideModAttrs` of the
|
|
||||||
# original package trivially does nothing, you can safely replace it
|
|
||||||
# with your own by not using `lib.composeExtensions`.
|
|
||||||
overrideModAttrs = lib.composeExtensions previousAttrs.passthru.overrideModAttrs (
|
|
||||||
finalModAttrs: previousModAttrs: {
|
|
||||||
# goModules-specific overriding goes here
|
|
||||||
postBuild = ''
|
|
||||||
# Here you have access to the `vendor` directory.
|
|
||||||
substituteInPlace vendor/github.com/example/repo/file.go \
|
|
||||||
--replace-fail "panic(err)" ""
|
|
||||||
'';
|
|
||||||
}
|
|
||||||
);
|
|
||||||
};
|
|
||||||
}
|
|
||||||
);
|
|
||||||
}
|
|
||||||
```
|
|
||||||
|
|
||||||
## `buildGoPackage` (legacy) {#ssec-go-legacy}
|
Defaults to `false`.
|
||||||
|
|
||||||
The function `buildGoPackage` builds legacy Go programs, not supporting Go modules.
|
|
||||||
|
|
||||||
::: {.warning}
|
### `modPostBuild` {#var-go-modPostBuild}
|
||||||
`buildGoPackage` is deprecated and will be removed for the 25.05 release.
|
|
||||||
:::
|
|
||||||
|
|
||||||
### Migrating from `buildGoPackage` to `buildGoModule` {#buildGoPackage-migration}
|
Shell commands to run after the build of the goModules executes `go mod vendor`, and before calculating fixed output derivation's `vendorHash`.
|
||||||
|
Note that if you change this attribute, you need to update `vendorHash` attribute.
|
||||||
|
|
||||||
Go modules, released 6y ago, are now widely adopted in the ecosystem.
|
|
||||||
Most upstream projects are using Go modules, and the tooling previously used for dependency management in Go is mostly deprecated, archived or at least unmaintained at this point.
|
|
||||||
|
|
||||||
In case a project doesn't have external dependencies or dependencies are vendored in a way understood by `go mod init`, migration can be done with a few changes in the package.
|
### `modRoot` {#var-go-modRoot}
|
||||||
|
|
||||||
- Switch the builder from `buildGoPackage` to `buildGoModule`
|
The root directory of the Go module that contains the `go.mod` file.
|
||||||
- Remove `goPackagePath` and other attributes specific to `buildGoPackage`
|
|
||||||
- Set `vendorHash = null;`
|
|
||||||
- Run `go mod init <module name>` in `postPatch`
|
|
||||||
|
|
||||||
In case the package has external dependencies that aren't vendored or the build setup is more complex the upstream source might need to be patched.
|
Defaults to `./`, which is the root of `src`.
|
||||||
Examples for the migration can be found in the [issue tracking migration withing nixpkgs](https://github.com/NixOS/nixpkgs/issues/318069).
|
|
||||||
|
|
||||||
### Example for `buildGoPackage` {#example-for-buildgopackage}
|
|
||||||
|
|
||||||
In the following is an example expression using `buildGoPackage`, the following arguments are of special significance to the function:
|
|
||||||
|
|
||||||
- `goPackagePath` specifies the package's canonical Go import path.
|
|
||||||
- `goDeps` is where the Go dependencies of a Go program are listed as a list of package source identified by Go import path. It could be imported as a separate `deps.nix` file for readability. The dependency data structure is described below.
|
|
||||||
|
|
||||||
```nix
|
|
||||||
{
|
|
||||||
deis = buildGoPackage rec {
|
|
||||||
pname = "deis";
|
|
||||||
version = "1.13.0";
|
|
||||||
|
|
||||||
goPackagePath = "github.com/deis/deis";
|
|
||||||
|
|
||||||
src = fetchFromGitHub {
|
|
||||||
owner = "deis";
|
|
||||||
repo = "deis";
|
|
||||||
rev = "v${version}";
|
|
||||||
hash = "sha256-XCPD4LNWtAd8uz7zyCLRfT8rzxycIUmTACjU03GnaeM=";
|
|
||||||
};
|
|
||||||
|
|
||||||
goDeps = ./deps.nix;
|
|
||||||
};
|
|
||||||
}
|
|
||||||
```
|
|
||||||
|
|
||||||
The `goDeps` attribute can be imported from a separate `nix` file that defines which Go libraries are needed and should be included in `GOPATH` for `buildPhase`:
|
|
||||||
|
|
||||||
```nix
|
|
||||||
# deps.nix
|
|
||||||
[ # goDeps is a list of Go dependencies.
|
|
||||||
{
|
|
||||||
# goPackagePath specifies Go package import path.
|
|
||||||
goPackagePath = "gopkg.in/yaml.v2";
|
|
||||||
fetch = {
|
|
||||||
# `fetch type` that needs to be used to get package source.
|
|
||||||
# If `git` is used there should be `url`, `rev` and `hash` defined next to it.
|
|
||||||
type = "git";
|
|
||||||
url = "https://gopkg.in/yaml.v2";
|
|
||||||
rev = "a83829b6f1293c91addabc89d0571c246397bbf4";
|
|
||||||
hash = "sha256-EMrdy0M0tNuOcITaTAmT5/dPSKPXwHDKCXFpkGbVjdQ=";
|
|
||||||
};
|
|
||||||
}
|
|
||||||
{
|
|
||||||
goPackagePath = "github.com/docopt/docopt-go";
|
|
||||||
fetch = {
|
|
||||||
type = "git";
|
|
||||||
url = "https://github.com/docopt/docopt-go";
|
|
||||||
rev = "784ddc588536785e7299f7272f39101f7faccc3f";
|
|
||||||
hash = "sha256-Uo89zjE+v3R7zzOq/gbQOHj3SMYt2W1nDHS7RCUin3M=";
|
|
||||||
};
|
|
||||||
}
|
|
||||||
]
|
|
||||||
```
|
|
||||||
|
|
||||||
To extract dependency information from a Go package in automated way use [go2nix (deprecated)](https://github.com/kamilchm/go2nix). It can produce complete derivation and `goDeps` file for Go programs.
|
|
||||||
|
|
||||||
You may use Go packages installed into the active Nix profiles by adding the following to your ~/.bashrc:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
for p in $NIX_PROFILES; do
|
|
||||||
GOPATH="$p/share/go:$GOPATH"
|
|
||||||
done
|
|
||||||
```
|
|
||||||
|
|
||||||
## Attributes used by both builders {#ssec-go-common-attributes}
|
|
||||||
|
|
||||||
Many attributes [controlling the build phase](#variables-controlling-the-build-phase) are respected by both `buildGoModule` and `buildGoPackage`. Note that `buildGoModule` reads the following attributes also when building the `vendor/` goModules fixed output derivation as well:
|
|
||||||
|
|
||||||
- [`sourceRoot`](#var-stdenv-sourceRoot)
|
|
||||||
- [`prePatch`](#var-stdenv-prePatch)
|
|
||||||
- [`patches`](#var-stdenv-patches)
|
|
||||||
- [`patchFlags`](#var-stdenv-patchFlags)
|
|
||||||
- [`postPatch`](#var-stdenv-postPatch)
|
|
||||||
- [`preBuild`](#var-stdenv-preBuild)
|
|
||||||
- `env`: useful for passing down variables such as `GOWORK`.
|
|
||||||
|
|
||||||
To control test execution of the build derivation, the following attributes are of interest:
|
|
||||||
|
|
||||||
- [`checkInputs`](#var-stdenv-checkInputs)
|
|
||||||
- [`preCheck`](#var-stdenv-preCheck)
|
|
||||||
- [`checkFlags`](#var-stdenv-checkFlags)
|
|
||||||
|
|
||||||
In addition to the above attributes, and the many more variables respected also by `stdenv.mkDerivation`, both `buildGoModule` and `buildGoPackage` respect Go-specific attributes that tweak them to behave slightly differently:
|
|
||||||
|
|
||||||
### `ldflags` {#var-go-ldflags}
|
### `ldflags` {#var-go-ldflags}
|
||||||
|
|
||||||
|
@ -326,6 +213,38 @@ Whether the build result should be allowed to contain references to the Go tool
|
||||||
|
|
||||||
Defaults to `false`
|
Defaults to `false`
|
||||||
|
|
||||||
|
## Overriding `goModules` {#buildGoModule-goModules-override}
|
||||||
|
|
||||||
|
Overriding `<pkg>.goModules` by calling `goModules.overrideAttrs` is unsupported. Still, it is possible to override the `vendorHash` (`goModules`'s `outputHash`) and the `pre`/`post` hooks for both the build and patch phases of the primary and `goModules` derivation.
|
||||||
|
|
||||||
|
Alternatively, the primary derivation provides an overridable `passthru.overrideModAttrs` function to store the attribute overlay implicitly taken by `goModules.overrideAttrs`. Here's an example usage of `overrideModAttrs`:
|
||||||
|
|
||||||
|
```nix
|
||||||
|
{
|
||||||
|
pet-overridden = pet.overrideAttrs (
|
||||||
|
finalAttrs: previousAttrs: {
|
||||||
|
passthru = previousAttrs.passthru // {
|
||||||
|
# If the original package has an `overrideModAttrs` attribute set, you'd
|
||||||
|
# want to extend it, and not replace it. Hence we use
|
||||||
|
# `lib.composeExtensions`. If you are sure the `overrideModAttrs` of the
|
||||||
|
# original package trivially does nothing, you can safely replace it
|
||||||
|
# with your own by not using `lib.composeExtensions`.
|
||||||
|
overrideModAttrs = lib.composeExtensions previousAttrs.passthru.overrideModAttrs (
|
||||||
|
finalModAttrs: previousModAttrs: {
|
||||||
|
# goModules-specific overriding goes here
|
||||||
|
postBuild = ''
|
||||||
|
# Here you have access to the `vendor` directory.
|
||||||
|
substituteInPlace vendor/github.com/example/repo/file.go \
|
||||||
|
--replace-fail "panic(err)" ""
|
||||||
|
'';
|
||||||
|
}
|
||||||
|
);
|
||||||
|
};
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
## Controlling the Go environment {#ssec-go-environment}
|
## Controlling the Go environment {#ssec-go-environment}
|
||||||
|
|
||||||
The Go build can be further tweaked by setting environment variables. In most cases, this isn't needed. Possible values can be found in the [Go documentation of accepted environment variables](https://pkg.go.dev/cmd/go#hdr-Environment_variables). Notice that some of these flags are set by the builder itself and should not be set explicitly. If in doubt, grep the implementation of the builder.
|
The Go build can be further tweaked by setting environment variables. In most cases, this isn't needed. Possible values can be found in the [Go documentation of accepted environment variables](https://pkg.go.dev/cmd/go#hdr-Environment_variables). Notice that some of these flags are set by the builder itself and should not be set explicitly. If in doubt, grep the implementation of the builder.
|
||||||
|
@ -364,4 +283,23 @@ If a larger amount of tests should be skipped, the following pattern can be used
|
||||||
```
|
```
|
||||||
|
|
||||||
To disable tests altogether, set `doCheck = false;`.
|
To disable tests altogether, set `doCheck = false;`.
|
||||||
`buildGoPackage` does not execute tests by default.
|
|
||||||
|
## Migrating from `buildGoPackage` to `buildGoModule` {#buildGoPackage-migration}
|
||||||
|
|
||||||
|
::: {.warning}
|
||||||
|
`buildGoPackage` was removed for the 25.05 release. It was used to build legacy Go programs
|
||||||
|
that do not support Go modules.
|
||||||
|
:::
|
||||||
|
|
||||||
|
Go modules, released 6y ago, are now widely adopted in the ecosystem.
|
||||||
|
Most upstream projects are using Go modules, and the tooling previously used for dependency management in Go is mostly deprecated, archived or at least unmaintained at this point.
|
||||||
|
|
||||||
|
In case a project doesn't have external dependencies or dependencies are vendored in a way understood by `go mod init`, migration can be done with a few changes in the package.
|
||||||
|
|
||||||
|
- Switch the builder from `buildGoPackage` to `buildGoModule`
|
||||||
|
- Remove `goPackagePath` and other attributes specific to `buildGoPackage`
|
||||||
|
- Set `vendorHash = null;`
|
||||||
|
- Run `go mod init <module name>` in `postPatch`
|
||||||
|
|
||||||
|
In case the package has external dependencies that aren't vendored or the build setup is more complex the upstream source might need to be patched.
|
||||||
|
Examples for the migration can be found in the [issue tracking migration withing nixpkgs](https://github.com/NixOS/nixpkgs/issues/318069).
|
||||||
|
|
|
@ -67,3 +67,14 @@ nix-shell -p 'julia.withPackages ["Plots"]' --run julia
|
||||||
|
|
||||||
This normally points at a special augmented version of the Julia [General packages registry](https://github.com/JuliaRegistries/General).
|
This normally points at a special augmented version of the Julia [General packages registry](https://github.com/JuliaRegistries/General).
|
||||||
If you want to use a bleeding-edge version to pick up the latest package updates, you can plug in a later revision than the one in Nixpkgs.
|
If you want to use a bleeding-edge version to pick up the latest package updates, you can plug in a later revision than the one in Nixpkgs.
|
||||||
|
|
||||||
|
* `juliaCpuTarget`: Allows you to set `JULIA_CPU_TARGET` when precompiling. Has no effect if `precompile=false`.
|
||||||
|
|
||||||
|
You may want to use this if you're building a Julia depot that will end up in a Nix cache and used on machines with
|
||||||
|
different CPUs.
|
||||||
|
|
||||||
|
Why? Julia will detect the CPU microarchitecture of the build machine and include this information in the precompiled
|
||||||
|
`*.ji` files. Starting in 1.10 Julia became more strict about checking the CPU target compatibility, so it may reject
|
||||||
|
your precompiled files if they were compiled on a different machine.
|
||||||
|
A good option to provide wide compatibility is to set this to `"generic"`, although this may reduce performance.
|
||||||
|
You can also set a semicolon-separated list of multiple different targets. See the Julia documentation for details.
|
||||||
|
|
|
@ -49,6 +49,90 @@ This package calls `maven.buildMavenPackage` to do its work. The primary differe
|
||||||
After setting `maven.buildMavenPackage`, we then do standard Java `.jar` installation by saving the `.jar` to `$out/share/java` and then making a wrapper which allows executing that file; see [](#sec-language-java) for additional generic information about packaging Java applications.
|
After setting `maven.buildMavenPackage`, we then do standard Java `.jar` installation by saving the `.jar` to `$out/share/java` and then making a wrapper which allows executing that file; see [](#sec-language-java) for additional generic information about packaging Java applications.
|
||||||
:::
|
:::
|
||||||
|
|
||||||
|
### Overriding Maven package attributes {#maven-overriding-package-attributes}
|
||||||
|
|
||||||
|
```
|
||||||
|
overrideMavenAttrs :: (AttrSet -> Derivation) | ((AttrSet -> Attrset) -> Derivation) -> Derivation
|
||||||
|
```
|
||||||
|
|
||||||
|
The output of `buildMavenPackage` has an `overrideMavenAttrs` attribute, which is a function that takes either
|
||||||
|
- any subset of the attributes that can be passed to `buildMavenPackage`
|
||||||
|
|
||||||
|
or
|
||||||
|
- a function that takes the argument passed to the previous invocation of `buildMavenPackage` (conventionally called `old`) and returns an attribute set that can be passed to `buildMavenPackage`
|
||||||
|
|
||||||
|
and returns a derivation that builds a Maven package based on the old and new arguments merged.
|
||||||
|
|
||||||
|
This is similar to [](#sec-pkg-overrideAttrs), but notably does not allow accessing the final value of the argument to `buildMavenPackage`.
|
||||||
|
|
||||||
|
:::{.example}
|
||||||
|
### `overrideMavenAttrs` Example
|
||||||
|
|
||||||
|
Use `overrideMavenAttrs` to build `jd-cli` version 1.2.0 and disable some flaky test:
|
||||||
|
|
||||||
|
```nix
|
||||||
|
jd-cli.overrideMavenAttrs (old: rec {
|
||||||
|
version = "1.2.0";
|
||||||
|
src = fetchFromGitHub {
|
||||||
|
owner = old.src.owner;
|
||||||
|
repo = old.src.repo;
|
||||||
|
rev = "${old.pname}-${version}";
|
||||||
|
# old source hash of 1.2.0 version
|
||||||
|
hash = "sha256-US7j6tQ6mh1libeHnQdFxPGoxHzbZHqehWSgCYynKx8=";
|
||||||
|
};
|
||||||
|
|
||||||
|
# tests can be disabled by prefixing it with `!`
|
||||||
|
# see Maven documentation for more details:
|
||||||
|
# https://maven.apache.org/surefire/maven-surefire-plugin/examples/single-test.html#Multiple_Formats_in_One
|
||||||
|
mvnParameters = lib.escapeShellArgs [
|
||||||
|
"-Dsurefire.failIfNoSpecifiedTests=false"
|
||||||
|
"-Dtest=!JavaDecompilerTest#basicTest,!JavaDecompilerTest#patternMatchingTest"
|
||||||
|
];
|
||||||
|
|
||||||
|
# old mvnHash of 1.2.0 maven dependencies
|
||||||
|
mvnHash = "sha256-N9XC1pg6Y4sUiBWIQUf16QSXCuiAPpXEHGlgApviF4I=";
|
||||||
|
});
|
||||||
|
```
|
||||||
|
:::
|
||||||
|
|
||||||
|
### Offline build {#maven-offline-build}
|
||||||
|
|
||||||
|
By default, `buildMavenPackage` does the following:
|
||||||
|
|
||||||
|
1. Run `mvn package -Dmaven.repo.local=$out/.m2 ${mvnParameters}` in the
|
||||||
|
`fetchedMavenDeps` [fixed-output derivation](https://nixos.org/manual/nix/stable/glossary.html#gloss-fixed-output-derivation).
|
||||||
|
2. Run `mvn package -o -nsu "-Dmaven.repo.local=$mvnDeps/.m2"
|
||||||
|
${mvnParameters}` again in the main derivation.
|
||||||
|
|
||||||
|
As a result, tests are run twice.
|
||||||
|
This also means that a failing test will trigger a new attempt to realise the fixed-output derivation, which in turn downloads all dependencies again.
|
||||||
|
For bigger Maven projects, this might lead to a long feedback cycle.
|
||||||
|
|
||||||
|
Use `buildOffline = true` to change the behaviour of `buildMavenPackage to the following:
|
||||||
|
1. Run `mvn de.qaware.maven:go-offline-maven-plugin:1.2.8:resolve-dependencies
|
||||||
|
-Dmaven.repo.local=$out/.m2 ${mvnDepsParameters}` in the fixed-output derivation.
|
||||||
|
2. Run `mvn package -o -nsu "-Dmaven.repo.local=$mvnDeps/.m2"
|
||||||
|
${mvnParameters}` in the main derivation.
|
||||||
|
|
||||||
|
As a result, all dependencies are downloaded in step 1 and the tests are executed in step 2.
|
||||||
|
A failing test only triggers a rebuild of step 2 as it can reuse the dependencies of step 1 because they have not changed.
|
||||||
|
|
||||||
|
::: {.warning}
|
||||||
|
Test dependencies are not downloaded in step 1 and are therefore missing in
|
||||||
|
step 2 which will most probably fail the build. The `go-offline` plugin cannot
|
||||||
|
handle these so-called [dynamic dependencies](https://github.com/qaware/go-offline-maven-plugin?tab=readme-ov-file#dynamic-dependencies).
|
||||||
|
In that case you must add these dynamic dependencies manually with:
|
||||||
|
```nix
|
||||||
|
maven.buildMavenPackage rec {
|
||||||
|
manualMvnArtifacts = [
|
||||||
|
# add dynamic test dependencies here
|
||||||
|
"org.apache.maven.surefire:surefire-junit-platform:3.1.2"
|
||||||
|
"org.junit.platform:junit-platform-launcher:1.10.0"
|
||||||
|
];
|
||||||
|
};
|
||||||
|
```
|
||||||
|
:::
|
||||||
|
|
||||||
### Stable Maven plugins {#stable-maven-plugins}
|
### Stable Maven plugins {#stable-maven-plugins}
|
||||||
|
|
||||||
Maven defines default versions for its core plugins, e.g. `maven-compiler-plugin`. If your project does not override these versions, an upgrade of Maven will change the version of the used plugins, and therefore the derivation and hash.
|
Maven defines default versions for its core plugins, e.g. `maven-compiler-plugin`. If your project does not override these versions, an upgrade of Maven will change the version of the used plugins, and therefore the derivation and hash.
|
||||||
|
|
|
@ -264,10 +264,15 @@ nix-shell -p vimPluginsUpdater --run 'vim-plugins-updater --github-token=mytoken
|
||||||
Alternatively, set the number of processes to a lower count to avoid rate-limiting.
|
Alternatively, set the number of processes to a lower count to avoid rate-limiting.
|
||||||
|
|
||||||
```sh
|
```sh
|
||||||
|
|
||||||
nix-shell -p vimPluginsUpdater --run 'vim-plugins-updater --proc 1'
|
nix-shell -p vimPluginsUpdater --run 'vim-plugins-updater --proc 1'
|
||||||
```
|
```
|
||||||
|
|
||||||
|
If you want to update only certain plugins, you can specify them after the `update` command. Note that you must use the same plugin names as the `pkgs/applications/editors/vim/plugins/vim-plugin-names` file.
|
||||||
|
|
||||||
|
```sh
|
||||||
|
nix-shell -p vimPluginsUpdater --run 'vim-plugins-updater update "nvim-treesitter" "LazyVim"'
|
||||||
|
```
|
||||||
|
|
||||||
## How to maintain an out-of-tree overlay of vim plugins ? {#vim-out-of-tree-overlays}
|
## How to maintain an out-of-tree overlay of vim plugins ? {#vim-out-of-tree-overlays}
|
||||||
|
|
||||||
You can use the updater script to generate basic packages out of a custom vim
|
You can use the updater script to generate basic packages out of a custom vim
|
||||||
|
|
|
@ -1421,11 +1421,9 @@
|
||||||
"trivial-builder-symlinkJoin": [
|
"trivial-builder-symlinkJoin": [
|
||||||
"index.html#trivial-builder-symlinkJoin"
|
"index.html#trivial-builder-symlinkJoin"
|
||||||
],
|
],
|
||||||
"trivial-builder-writeReferencesToFile": [
|
|
||||||
"index.html#trivial-builder-writeReferencesToFile"
|
|
||||||
],
|
|
||||||
"trivial-builder-writeClosure": [
|
"trivial-builder-writeClosure": [
|
||||||
"index.html#trivial-builder-writeClosure"
|
"index.html#trivial-builder-writeClosure",
|
||||||
|
"index.html#trivial-builder-writeReferencesToFile"
|
||||||
],
|
],
|
||||||
"trivial-builder-writeDirectReferencesToFile": [
|
"trivial-builder-writeDirectReferencesToFile": [
|
||||||
"index.html#trivial-builder-writeDirectReferencesToFile"
|
"index.html#trivial-builder-writeDirectReferencesToFile"
|
||||||
|
@ -2721,29 +2719,20 @@
|
||||||
"index.html#ssec-language-go"
|
"index.html#ssec-language-go"
|
||||||
],
|
],
|
||||||
"buildgomodule-parameters": [
|
"buildgomodule-parameters": [
|
||||||
"index.html#buildgomodule-parameters"
|
"index.html#buildgomodule-parameters",
|
||||||
|
"index.html#ssec-go-common-attributes"
|
||||||
],
|
],
|
||||||
"ex-buildGoModule": [
|
"ex-buildGoModule": [
|
||||||
"index.html#ex-buildGoModule"
|
"index.html#ex-buildGoModule"
|
||||||
],
|
],
|
||||||
"buildGoModule-vendorHash": [
|
|
||||||
"index.html#buildGoModule-vendorHash"
|
|
||||||
],
|
|
||||||
"buildGoModule-goModules-override": [
|
"buildGoModule-goModules-override": [
|
||||||
"index.html#buildGoModule-goModules-override"
|
"index.html#buildGoModule-goModules-override"
|
||||||
],
|
],
|
||||||
"ssec-go-legacy": [
|
|
||||||
"index.html#ssec-go-legacy"
|
|
||||||
],
|
|
||||||
"buildGoPackage-migration": [
|
"buildGoPackage-migration": [
|
||||||
"index.html#buildGoPackage-migration"
|
"index.html#buildGoPackage-migration",
|
||||||
],
|
"index.html#ssec-go-legacy",
|
||||||
"example-for-buildgopackage": [
|
|
||||||
"index.html#example-for-buildgopackage"
|
"index.html#example-for-buildgopackage"
|
||||||
],
|
],
|
||||||
"ssec-go-common-attributes": [
|
|
||||||
"index.html#ssec-go-common-attributes"
|
|
||||||
],
|
|
||||||
"var-go-ldflags": [
|
"var-go-ldflags": [
|
||||||
"index.html#var-go-ldflags"
|
"index.html#var-go-ldflags"
|
||||||
],
|
],
|
||||||
|
@ -2759,6 +2748,9 @@
|
||||||
"var-go-excludedPackages": [
|
"var-go-excludedPackages": [
|
||||||
"index.html#var-go-excludedPackages"
|
"index.html#var-go-excludedPackages"
|
||||||
],
|
],
|
||||||
|
"var-go-proxyVendor": [
|
||||||
|
"index.html#var-go-proxyVendor"
|
||||||
|
],
|
||||||
"var-go-CGO_ENABLED": [
|
"var-go-CGO_ENABLED": [
|
||||||
"index.html#var-go-CGO_ENABLED"
|
"index.html#var-go-CGO_ENABLED"
|
||||||
],
|
],
|
||||||
|
@ -2768,6 +2760,16 @@
|
||||||
"var-go-allowGoReference": [
|
"var-go-allowGoReference": [
|
||||||
"index.html#var-go-allowGoReference"
|
"index.html#var-go-allowGoReference"
|
||||||
],
|
],
|
||||||
|
"var-go-vendorHash": [
|
||||||
|
"index.html#var-go-vendorHash",
|
||||||
|
"index.html#buildGoModule-vendorHash"
|
||||||
|
],
|
||||||
|
"var-go-modPostBuild": [
|
||||||
|
"index.html#var-go-modPostBuild"
|
||||||
|
],
|
||||||
|
"var-go-modRoot": [
|
||||||
|
"index.html#var-go-modRoot"
|
||||||
|
],
|
||||||
"ssec-go-environment": [
|
"ssec-go-environment": [
|
||||||
"index.html#ssec-go-environment"
|
"index.html#ssec-go-environment"
|
||||||
],
|
],
|
||||||
|
@ -3188,6 +3190,12 @@
|
||||||
"maven-buildmavenpackage": [
|
"maven-buildmavenpackage": [
|
||||||
"index.html#maven-buildmavenpackage"
|
"index.html#maven-buildmavenpackage"
|
||||||
],
|
],
|
||||||
|
"maven-overriding-package-attributes": [
|
||||||
|
"index.html#maven-overriding-package-attributes"
|
||||||
|
],
|
||||||
|
"maven-offline-build": [
|
||||||
|
"index.html#maven-offline-build"
|
||||||
|
],
|
||||||
"stable-maven-plugins": [
|
"stable-maven-plugins": [
|
||||||
"index.html#stable-maven-plugins"
|
"index.html#stable-maven-plugins"
|
||||||
],
|
],
|
||||||
|
|
|
@ -165,7 +165,7 @@ These paths will need to be replaced with relative paths and the xcbuild package
|
||||||
stdenv.mkDerivation {
|
stdenv.mkDerivation {
|
||||||
name = "libfoo-1.2.3";
|
name = "libfoo-1.2.3";
|
||||||
postPatch = ''
|
postPatch = ''
|
||||||
subsituteInPlace Makefile \
|
substituteInPlace Makefile \
|
||||||
--replace-fail '/usr/bin/xcodebuild' 'xcodebuild' \
|
--replace-fail '/usr/bin/xcodebuild' 'xcodebuild' \
|
||||||
--replace-fail '/usr/bin/xcrun' 'xcrun' \
|
--replace-fail '/usr/bin/xcrun' 'xcrun' \
|
||||||
--replace-fail '/usr/bin/PListBuddy' 'PListBuddy'
|
--replace-fail '/usr/bin/PListBuddy' 'PListBuddy'
|
||||||
|
|
|
@ -154,11 +154,13 @@ There are several ways to tweak how Nix handles a package which has been marked
|
||||||
|
|
||||||
The `allowInsecurePredicate` option is a function which accepts a package and returns a boolean, much like `allowUnfreePredicate`.
|
The `allowInsecurePredicate` option is a function which accepts a package and returns a boolean, much like `allowUnfreePredicate`.
|
||||||
|
|
||||||
The following configuration example only allows insecure packages with very short names:
|
The following configuration example allows any version of the `ovftool` package:
|
||||||
|
|
||||||
```nix
|
```nix
|
||||||
{
|
{
|
||||||
allowInsecurePredicate = pkg: builtins.stringLength (lib.getName pkg) <= 5;
|
allowInsecurePredicate = pkg: builtins.elem (lib.getName pkg) [
|
||||||
|
"ovftool"
|
||||||
|
];
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
|
|
|
@ -543,10 +543,6 @@ rec {
|
||||||
newScope = scope: newScope (self // scope);
|
newScope = scope: newScope (self // scope);
|
||||||
callPackage = self.newScope {};
|
callPackage = self.newScope {};
|
||||||
overrideScope = g: makeScope newScope (extends g f);
|
overrideScope = g: makeScope newScope (extends g f);
|
||||||
# Remove after 24.11 is released.
|
|
||||||
overrideScope' = g: warnIf (isInOldestRelease 2311)
|
|
||||||
"`overrideScope'` (from `lib.makeScope`) has been renamed to `overrideScope`."
|
|
||||||
(makeScope newScope (extends g f));
|
|
||||||
packages = f;
|
packages = f;
|
||||||
};
|
};
|
||||||
in self;
|
in self;
|
||||||
|
|
|
@ -121,7 +121,7 @@ let
|
||||||
inherit (self.customisation) overrideDerivation makeOverridable
|
inherit (self.customisation) overrideDerivation makeOverridable
|
||||||
callPackageWith callPackagesWith extendDerivation hydraJob
|
callPackageWith callPackagesWith extendDerivation hydraJob
|
||||||
makeScope makeScopeWithSplicing makeScopeWithSplicing';
|
makeScope makeScopeWithSplicing makeScopeWithSplicing';
|
||||||
inherit (self.derivations) lazyDerivation optionalDrvAttr;
|
inherit (self.derivations) lazyDerivation optionalDrvAttr warnOnInstantiate;
|
||||||
inherit (self.meta) addMetaAttrs dontDistribute setName updateName
|
inherit (self.meta) addMetaAttrs dontDistribute setName updateName
|
||||||
appendToName mapDerivationAttrset setPrio lowPrio lowPrioSet hiPrio
|
appendToName mapDerivationAttrset setPrio lowPrio lowPrioSet hiPrio
|
||||||
hiPrioSet licensesSpdx getLicenseFromSpdxId getLicenseFromSpdxIdOr
|
hiPrioSet licensesSpdx getLicenseFromSpdxId getLicenseFromSpdxIdOr
|
||||||
|
@ -152,7 +152,7 @@ let
|
||||||
scrubOptionValue literalExpression literalExample
|
scrubOptionValue literalExpression literalExample
|
||||||
showOption showOptionWithDefLocs showFiles
|
showOption showOptionWithDefLocs showFiles
|
||||||
unknownModule mkOption mkPackageOption mkPackageOptionMD
|
unknownModule mkOption mkPackageOption mkPackageOptionMD
|
||||||
mdDoc literalMD;
|
literalMD;
|
||||||
inherit (self.types) isType setType defaultTypeMerge defaultFunctor
|
inherit (self.types) isType setType defaultTypeMerge defaultFunctor
|
||||||
isOptionType mkOptionType;
|
isOptionType mkOptionType;
|
||||||
inherit (self.asserts)
|
inherit (self.asserts)
|
||||||
|
|
|
@ -4,6 +4,8 @@ let
|
||||||
inherit (lib)
|
inherit (lib)
|
||||||
genAttrs
|
genAttrs
|
||||||
isString
|
isString
|
||||||
|
mapAttrs
|
||||||
|
removeAttrs
|
||||||
throwIfNot
|
throwIfNot
|
||||||
;
|
;
|
||||||
|
|
||||||
|
@ -206,4 +208,38 @@ in
|
||||||
optionalDrvAttr =
|
optionalDrvAttr =
|
||||||
cond:
|
cond:
|
||||||
value: if cond then value else null;
|
value: if cond then value else null;
|
||||||
|
|
||||||
|
/**
|
||||||
|
Wrap a derivation such that instantiating it produces a warning.
|
||||||
|
|
||||||
|
All attributes apart from `meta`, `name`, and `type` (which are used by
|
||||||
|
`nix search`) will be wrapped in `lib.warn`.
|
||||||
|
|
||||||
|
# Inputs
|
||||||
|
|
||||||
|
`msg`
|
||||||
|
: The warning message to emit (via `lib.warn`).
|
||||||
|
|
||||||
|
`drv`
|
||||||
|
: The derivation to wrap.
|
||||||
|
|
||||||
|
# Examples
|
||||||
|
:::{.example}
|
||||||
|
## `lib.derivations.warnOnInstantiate` usage example
|
||||||
|
|
||||||
|
```nix
|
||||||
|
{
|
||||||
|
myPackage = warnOnInstantiate "myPackage has been renamed to my-package" my-package;
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
:::
|
||||||
|
*/
|
||||||
|
warnOnInstantiate =
|
||||||
|
msg: drv:
|
||||||
|
let
|
||||||
|
drvToWrap = removeAttrs drv [ "meta" "name" "type" ];
|
||||||
|
in
|
||||||
|
drv
|
||||||
|
// mapAttrs (_: lib.warn msg) drvToWrap;
|
||||||
}
|
}
|
||||||
|
|
|
@ -306,35 +306,29 @@ in
|
||||||
As a result, directories with no `.nix` files (including empty
|
As a result, directories with no `.nix` files (including empty
|
||||||
directories) will be transformed into empty attribute sets.
|
directories) will be transformed into empty attribute sets.
|
||||||
|
|
||||||
# Inputs
|
|
||||||
|
|
||||||
Structured function argument
|
|
||||||
|
|
||||||
: Attribute set containing the following attributes.
|
|
||||||
Additional attributes are ignored.
|
|
||||||
|
|
||||||
`callPackage`
|
|
||||||
|
|
||||||
: `pkgs.callPackage`
|
|
||||||
|
|
||||||
Type: `Path -> AttrSet -> a`
|
|
||||||
|
|
||||||
`directory`
|
|
||||||
|
|
||||||
: The directory to read package files from
|
|
||||||
|
|
||||||
Type: `Path`
|
|
||||||
|
|
||||||
|
|
||||||
# Type
|
# Type
|
||||||
|
|
||||||
```
|
```
|
||||||
packagesFromDirectoryRecursive :: AttrSet -> AttrSet
|
packagesFromDirectoryRecursive :: {
|
||||||
|
callPackage :: Path -> {} -> a,
|
||||||
|
directory :: Path,
|
||||||
|
...
|
||||||
|
} -> AttrSet
|
||||||
```
|
```
|
||||||
|
|
||||||
|
# Inputs
|
||||||
|
|
||||||
|
`callPackage`
|
||||||
|
: The function used to convert a Nix file's path into a leaf of the attribute set.
|
||||||
|
It is typically the `callPackage` function, taken from either `pkgs` or a new scope corresponding to the `directory`.
|
||||||
|
|
||||||
|
`directory`
|
||||||
|
: The directory to read package files from.
|
||||||
|
|
||||||
|
|
||||||
# Examples
|
# Examples
|
||||||
:::{.example}
|
:::{.example}
|
||||||
## `lib.filesystem.packagesFromDirectoryRecursive` usage example
|
## Basic use of `lib.packagesFromDirectoryRecursive`
|
||||||
|
|
||||||
```nix
|
```nix
|
||||||
packagesFromDirectoryRecursive {
|
packagesFromDirectoryRecursive {
|
||||||
|
@ -342,17 +336,48 @@ in
|
||||||
directory = ./my-packages;
|
directory = ./my-packages;
|
||||||
}
|
}
|
||||||
=> { ... }
|
=> { ... }
|
||||||
|
```
|
||||||
|
|
||||||
|
In this case, `callPackage` will only search `pkgs` for a file's input parameters.
|
||||||
|
In other words, a file cannot refer to another file in the directory in its input parameters.
|
||||||
|
:::
|
||||||
|
|
||||||
|
::::{.example}
|
||||||
|
## Create a scope for the nix files found in a directory
|
||||||
|
```nix
|
||||||
lib.makeScope pkgs.newScope (
|
lib.makeScope pkgs.newScope (
|
||||||
self: packagesFromDirectoryRecursive {
|
self: packagesFromDirectoryRecursive {
|
||||||
callPackage = self.callPackage;
|
inherit (self) callPackage;
|
||||||
directory = ./my-packages;
|
directory = ./my-packages;
|
||||||
}
|
}
|
||||||
)
|
)
|
||||||
=> { ... }
|
=> { ... }
|
||||||
```
|
```
|
||||||
|
|
||||||
|
For example, take the following directory structure:
|
||||||
|
```
|
||||||
|
my-packages
|
||||||
|
├── a.nix → { b }: assert b ? b1; ...
|
||||||
|
└── b
|
||||||
|
├── b1.nix → { a }: ...
|
||||||
|
└── b2.nix
|
||||||
|
```
|
||||||
|
|
||||||
|
Here, `b1.nix` can specify `{ a }` as a parameter, which `callPackage` will resolve as expected.
|
||||||
|
Likewise, `a.nix` receive an attrset corresponding to the contents of the `b` directory.
|
||||||
|
|
||||||
|
:::{.note}
|
||||||
|
`a.nix` cannot directly take as inputs packages defined in a child directory, such as `b1`.
|
||||||
:::
|
:::
|
||||||
|
|
||||||
|
:::{.warning}
|
||||||
|
As of now, `lib.packagesFromDirectoryRecursive` cannot create nested scopes for sub-directories.
|
||||||
|
|
||||||
|
In particular, files under `b/` can only require (as inputs) other files under `my-packages`,
|
||||||
|
but not to those in the same directory, nor those in a parent directory; e.g, `b2.nix` cannot directly
|
||||||
|
require `b1`.
|
||||||
|
:::
|
||||||
|
::::
|
||||||
*/
|
*/
|
||||||
packagesFromDirectoryRecursive =
|
packagesFromDirectoryRecursive =
|
||||||
{
|
{
|
||||||
|
|
|
@ -792,7 +792,7 @@ lib.mapAttrs mkLicense ({
|
||||||
|
|
||||||
lens = {
|
lens = {
|
||||||
fullName = "Lens Terms of Service Agreement";
|
fullName = "Lens Terms of Service Agreement";
|
||||||
url = "https://k8slens.dev/licenses/tos";
|
url = "https://k8slens.dev/legal/tos";
|
||||||
free = false;
|
free = false;
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -751,17 +751,47 @@ let
|
||||||
t' = opt.options.type;
|
t' = opt.options.type;
|
||||||
mergedType = t.typeMerge t'.functor;
|
mergedType = t.typeMerge t'.functor;
|
||||||
typesMergeable = mergedType != null;
|
typesMergeable = mergedType != null;
|
||||||
typeSet = if (bothHave "type") && typesMergeable
|
|
||||||
then { type = mergedType; }
|
# TODO: Remove this when all downstream reliances of internals: 'functor.wrapped' are sufficiently migrated.
|
||||||
else {};
|
# A function that adds the deprecated wrapped message to a type.
|
||||||
|
addDeprecatedWrapped = t:
|
||||||
|
t // {
|
||||||
|
functor = t.functor // {
|
||||||
|
wrapped = t.functor.wrappedDeprecationMessage {
|
||||||
|
inherit loc;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
typeSet =
|
||||||
|
if opt.options ? type then
|
||||||
|
if res ? type then
|
||||||
|
if typesMergeable then
|
||||||
|
{
|
||||||
|
type =
|
||||||
|
if mergedType ? functor.wrappedDeprecationMessage then
|
||||||
|
addDeprecatedWrapped mergedType
|
||||||
|
else
|
||||||
|
mergedType;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
# Keep in sync with the same error below!
|
||||||
|
throw "The option `${showOption loc}' in `${opt._file}' is already declared in ${showFiles res.declarations}."
|
||||||
|
else if opt.options.type ? functor.wrappedDeprecationMessage then
|
||||||
|
{ type = addDeprecatedWrapped opt.options.type; }
|
||||||
|
else
|
||||||
|
{}
|
||||||
|
else
|
||||||
|
{};
|
||||||
|
|
||||||
bothHave = k: opt.options ? ${k} && res ? ${k};
|
bothHave = k: opt.options ? ${k} && res ? ${k};
|
||||||
in
|
in
|
||||||
if bothHave "default" ||
|
if bothHave "default" ||
|
||||||
bothHave "example" ||
|
bothHave "example" ||
|
||||||
bothHave "description" ||
|
bothHave "description" ||
|
||||||
bothHave "apply" ||
|
bothHave "apply"
|
||||||
(bothHave "type" && (! typesMergeable))
|
|
||||||
then
|
then
|
||||||
|
# Keep in sync with the same error above!
|
||||||
throw "The option `${showOption loc}' in `${opt._file}' is already declared in ${showFiles res.declarations}."
|
throw "The option `${showOption loc}' in `${opt._file}' is already declared in ${showFiles res.declarations}."
|
||||||
else
|
else
|
||||||
let
|
let
|
||||||
|
|
|
@ -399,13 +399,6 @@ rec {
|
||||||
|
|
||||||
literalExample = lib.warn "lib.literalExample is deprecated, use lib.literalExpression instead, or use lib.literalMD for a non-Nix description." literalExpression;
|
literalExample = lib.warn "lib.literalExample is deprecated, use lib.literalExpression instead, or use lib.literalMD for a non-Nix description." literalExpression;
|
||||||
|
|
||||||
/* Transition marker for documentation that's already migrated to markdown
|
|
||||||
syntax. Has been a no-op for some while and been removed from nixpkgs.
|
|
||||||
Kept here to alert downstream users who may not be aware of the migration's
|
|
||||||
completion that it should be removed from modules.
|
|
||||||
*/
|
|
||||||
mdDoc = lib.warn "lib.mdDoc will be removed from nixpkgs in 24.11. Option descriptions are now in Markdown by default; you can remove any remaining uses of lib.mdDoc.";
|
|
||||||
|
|
||||||
/* For use in the `defaultText` and `example` option attributes. Causes the
|
/* For use in the `defaultText` and `example` option attributes. Causes the
|
||||||
given MD text to be inserted verbatim in the documentation, for when
|
given MD text to be inserted verbatim in the documentation, for when
|
||||||
a `literalExpression` would be too hard to read.
|
a `literalExpression` would be too hard to read.
|
||||||
|
|
|
@ -11,12 +11,13 @@ rec {
|
||||||
x86-64-v3 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "fma" ];
|
x86-64-v3 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "fma" ];
|
||||||
x86-64-v4 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "avx512" "fma" ];
|
x86-64-v4 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "avx512" "fma" ];
|
||||||
# x86_64 Intel
|
# x86_64 Intel
|
||||||
nehalem = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" ];
|
nehalem = [ "sse3" "ssse3" "sse4_1" "sse4_2" ];
|
||||||
westmere = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" ];
|
westmere = [ "sse3" "ssse3" "sse4_1" "sse4_2" ];
|
||||||
sandybridge = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" ];
|
silvermont = [ "sse3" "ssse3" "sse4_1" "sse4_2" ];
|
||||||
ivybridge = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" ];
|
sandybridge = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" ];
|
||||||
haswell = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "fma" ];
|
ivybridge = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" ];
|
||||||
broadwell = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "fma" ];
|
haswell = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "fma" ];
|
||||||
|
broadwell = [ "sse3" "ssse3" "sse4_1" "sse4_2" "avx" "avx2" "fma" ];
|
||||||
skylake = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "fma" ];
|
skylake = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "fma" ];
|
||||||
skylake-avx512 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "avx512" "fma" ];
|
skylake-avx512 = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "avx512" "fma" ];
|
||||||
cannonlake = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "avx512" "fma" ];
|
cannonlake = [ "sse3" "ssse3" "sse4_1" "sse4_2" "aes" "avx" "avx2" "avx512" "fma" ];
|
||||||
|
|
|
@ -6,9 +6,9 @@ let
|
||||||
filterAttrs
|
filterAttrs
|
||||||
foldl
|
foldl
|
||||||
hasInfix
|
hasInfix
|
||||||
|
isAttrs
|
||||||
isFunction
|
isFunction
|
||||||
isList
|
isList
|
||||||
isString
|
|
||||||
mapAttrs
|
mapAttrs
|
||||||
optional
|
optional
|
||||||
optionalAttrs
|
optionalAttrs
|
||||||
|
@ -55,24 +55,34 @@ let
|
||||||
*/
|
*/
|
||||||
flakeExposed = import ./flake-systems.nix { };
|
flakeExposed = import ./flake-systems.nix { };
|
||||||
|
|
||||||
|
# Turn localSystem or crossSystem, which could be system-string or attrset, into
|
||||||
|
# attrset.
|
||||||
|
systemToAttrs = systemOrArgs:
|
||||||
|
if isAttrs systemOrArgs then systemOrArgs else { system = systemOrArgs; };
|
||||||
|
|
||||||
# Elaborate a `localSystem` or `crossSystem` so that it contains everything
|
# Elaborate a `localSystem` or `crossSystem` so that it contains everything
|
||||||
# necessary.
|
# necessary.
|
||||||
#
|
#
|
||||||
# `parsed` is inferred from args, both because there are two options with one
|
# `parsed` is inferred from args, both because there are two options with one
|
||||||
# clearly preferred, and to prevent cycles. A simpler fixed point where the RHS
|
# clearly preferred, and to prevent cycles. A simpler fixed point where the RHS
|
||||||
# always just used `final.*` would fail on both counts.
|
# always just used `final.*` would fail on both counts.
|
||||||
elaborate = args': let
|
elaborate = systemOrArgs: let
|
||||||
args = if isString args' then { system = args'; }
|
allArgs = systemToAttrs systemOrArgs;
|
||||||
else args';
|
|
||||||
|
# Those two will always be derived from "config", if given, so they should NOT
|
||||||
|
# be overridden further down with "// args".
|
||||||
|
args = builtins.removeAttrs allArgs [ "parsed" "system" ];
|
||||||
|
|
||||||
# TODO: deprecate args.rustc in favour of args.rust after 23.05 is EOL.
|
# TODO: deprecate args.rustc in favour of args.rust after 23.05 is EOL.
|
||||||
rust = args.rust or args.rustc or {};
|
rust = args.rust or args.rustc or {};
|
||||||
|
|
||||||
final = {
|
final = {
|
||||||
# Prefer to parse `config` as it is strictly more informative.
|
# Prefer to parse `config` as it is strictly more informative.
|
||||||
parsed = parse.mkSystemFromString (if args ? config then args.config else args.system);
|
parsed = parse.mkSystemFromString (args.config or allArgs.system);
|
||||||
# Either of these can be losslessly-extracted from `parsed` iff parsing succeeds.
|
# This can be losslessly-extracted from `parsed` iff parsing succeeds.
|
||||||
system = parse.doubleFromSystem final.parsed;
|
system = parse.doubleFromSystem final.parsed;
|
||||||
|
# TODO: This currently can't be losslessly-extracted from `parsed`, for example
|
||||||
|
# because of -mingw32.
|
||||||
config = parse.tripleFromSystem final.parsed;
|
config = parse.tripleFromSystem final.parsed;
|
||||||
# Determine whether we can execute binaries built for the provided platform.
|
# Determine whether we can execute binaries built for the provided platform.
|
||||||
canExecute = platform:
|
canExecute = platform:
|
||||||
|
@ -435,5 +445,6 @@ in
|
||||||
inspect
|
inspect
|
||||||
parse
|
parse
|
||||||
platforms
|
platforms
|
||||||
|
systemToAttrs
|
||||||
;
|
;
|
||||||
}
|
}
|
||||||
|
|
|
@ -13,7 +13,7 @@ let
|
||||||
"x86_64-darwin" "i686-darwin" "aarch64-darwin" "armv7a-darwin"
|
"x86_64-darwin" "i686-darwin" "aarch64-darwin" "armv7a-darwin"
|
||||||
|
|
||||||
# FreeBSD
|
# FreeBSD
|
||||||
"i686-freebsd" "x86_64-freebsd"
|
"i686-freebsd" "x86_64-freebsd" "aarch64-freebsd"
|
||||||
|
|
||||||
# Genode
|
# Genode
|
||||||
"aarch64-genode" "i686-genode" "x86_64-genode"
|
"aarch64-genode" "i686-genode" "x86_64-genode"
|
||||||
|
|
|
@ -329,11 +329,17 @@ rec {
|
||||||
ucrtAarch64 = {
|
ucrtAarch64 = {
|
||||||
config = "aarch64-w64-mingw32";
|
config = "aarch64-w64-mingw32";
|
||||||
libc = "ucrt";
|
libc = "ucrt";
|
||||||
|
rust.rustcTarget = "aarch64-pc-windows-gnullvm";
|
||||||
useLLVM = true;
|
useLLVM = true;
|
||||||
};
|
};
|
||||||
|
|
||||||
# BSDs
|
# BSDs
|
||||||
|
|
||||||
|
aarch64-freebsd = {
|
||||||
|
config = "aarch64-unknown-freebsd";
|
||||||
|
useLLVM = true;
|
||||||
|
};
|
||||||
|
|
||||||
x86_64-freebsd = {
|
x86_64-freebsd = {
|
||||||
config = "x86_64-unknown-freebsd";
|
config = "x86_64-unknown-freebsd";
|
||||||
useLLVM = true;
|
useLLVM = true;
|
||||||
|
|
|
@ -386,6 +386,10 @@ checkConfigOutput '^true$' config.conditionalWorks ./declare-attrsOf.nix ./attrs
|
||||||
checkConfigOutput '^false$' config.conditionalWorks ./declare-lazyAttrsOf.nix ./attrsOf-conditional-check.nix
|
checkConfigOutput '^false$' config.conditionalWorks ./declare-lazyAttrsOf.nix ./attrsOf-conditional-check.nix
|
||||||
checkConfigOutput '^"empty"$' config.value.foo ./declare-lazyAttrsOf.nix ./attrsOf-conditional-check.nix
|
checkConfigOutput '^"empty"$' config.value.foo ./declare-lazyAttrsOf.nix ./attrsOf-conditional-check.nix
|
||||||
|
|
||||||
|
# Check attrsWith type merging
|
||||||
|
checkConfigError 'The option `mergedLazyNonLazy'\'' in `.*'\'' is already declared in `.*'\''\.' options.mergedLazyNonLazy ./lazy-attrsWith.nix
|
||||||
|
checkConfigOutput '^11$' config.lazyResult ./lazy-attrsWith.nix
|
||||||
|
checkConfigError 'infinite recursion encountered' config.nonLazyResult ./lazy-attrsWith.nix
|
||||||
|
|
||||||
# Even with multiple assignments, a type error should be thrown if any of them aren't valid
|
# Even with multiple assignments, a type error should be thrown if any of them aren't valid
|
||||||
checkConfigError 'A definition for option .* is not of type .*' \
|
checkConfigError 'A definition for option .* is not of type .*' \
|
||||||
|
@ -516,6 +520,10 @@ checkConfigError 'The option .theOption.nested. in .other.nix. is already declar
|
||||||
# Test that types.optionType leaves types untouched as long as they don't need to be merged
|
# Test that types.optionType leaves types untouched as long as they don't need to be merged
|
||||||
checkConfigOutput 'ok' config.freeformItems.foo.bar ./adhoc-freeformType-survives-type-merge.nix
|
checkConfigOutput 'ok' config.freeformItems.foo.bar ./adhoc-freeformType-survives-type-merge.nix
|
||||||
|
|
||||||
|
# Test that specifying both functor.wrapped and functor.payload isn't allowed
|
||||||
|
checkConfigError 'Type foo defines both `functor.payload` and `functor.wrapped` at the same time, which is not supported.' config.result ./default-type-merge-both.nix
|
||||||
|
|
||||||
|
|
||||||
# Anonymous submodules don't get nixed by import resolution/deduplication
|
# Anonymous submodules don't get nixed by import resolution/deduplication
|
||||||
# because of an `extendModules` bug, issue 168767.
|
# because of an `extendModules` bug, issue 168767.
|
||||||
checkConfigOutput '^1$' config.sub.specialisation.value ./extendModules-168767-imports.nix
|
checkConfigOutput '^1$' config.sub.specialisation.value ./extendModules-168767-imports.nix
|
||||||
|
@ -571,6 +579,7 @@ checkConfigOutput '^38|27$' options.submoduleLine38.declarationPositions.1.line
|
||||||
# nested options work
|
# nested options work
|
||||||
checkConfigOutput '^34$' options.nested.nestedLine34.declarationPositions.0.line ./declaration-positions.nix
|
checkConfigOutput '^34$' options.nested.nestedLine34.declarationPositions.0.line ./declaration-positions.nix
|
||||||
|
|
||||||
|
|
||||||
cat <<EOF
|
cat <<EOF
|
||||||
====== module tests ======
|
====== module tests ======
|
||||||
$pass Pass
|
$pass Pass
|
||||||
|
|
28
lib/tests/modules/default-type-merge-both.nix
Normal file
28
lib/tests/modules/default-type-merge-both.nix
Normal file
|
@ -0,0 +1,28 @@
|
||||||
|
{ lib, options, ... }:
|
||||||
|
let
|
||||||
|
foo = lib.mkOptionType {
|
||||||
|
name = "foo";
|
||||||
|
functor = lib.types.defaultFunctor "foo" // {
|
||||||
|
wrapped = lib.types.int;
|
||||||
|
payload = 10;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
in
|
||||||
|
{
|
||||||
|
imports = [
|
||||||
|
{
|
||||||
|
options.foo = lib.mkOption {
|
||||||
|
type = foo;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
{
|
||||||
|
options.foo = lib.mkOption {
|
||||||
|
type = foo;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
];
|
||||||
|
|
||||||
|
options.result = lib.mkOption {
|
||||||
|
default = builtins.seq options.foo null;
|
||||||
|
};
|
||||||
|
}
|
57
lib/tests/modules/lazy-attrsWith.nix
Normal file
57
lib/tests/modules/lazy-attrsWith.nix
Normal file
|
@ -0,0 +1,57 @@
|
||||||
|
# Check that AttrsWith { lazy = true; } is lazy
|
||||||
|
{ lib, ... }:
|
||||||
|
let
|
||||||
|
inherit (lib) types mkOption;
|
||||||
|
|
||||||
|
lazyAttrsOf = mkOption {
|
||||||
|
# Same as lazyAttrsOf
|
||||||
|
type = types.attrsWith {
|
||||||
|
lazy = true;
|
||||||
|
elemType = types.int;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
attrsOf = mkOption {
|
||||||
|
# Same as lazyAttrsOf
|
||||||
|
type = types.attrsWith {
|
||||||
|
elemType = types.int;
|
||||||
|
};
|
||||||
|
};
|
||||||
|
in
|
||||||
|
{
|
||||||
|
imports = [
|
||||||
|
# Module A
|
||||||
|
(
|
||||||
|
{ ... }:
|
||||||
|
{
|
||||||
|
options.mergedLazyLazy = lazyAttrsOf;
|
||||||
|
options.mergedLazyNonLazy = lazyAttrsOf;
|
||||||
|
options.mergedNonLazyNonLazy = attrsOf;
|
||||||
|
}
|
||||||
|
)
|
||||||
|
# Module B
|
||||||
|
(
|
||||||
|
{ ... }:
|
||||||
|
{
|
||||||
|
options.mergedLazyLazy = lazyAttrsOf;
|
||||||
|
options.mergedLazyNonLazy = attrsOf;
|
||||||
|
options.mergedNonLazyNonLazy = attrsOf;
|
||||||
|
}
|
||||||
|
)
|
||||||
|
# Result
|
||||||
|
(
|
||||||
|
{ config, ... }:
|
||||||
|
{
|
||||||
|
# Can only evaluate if lazy
|
||||||
|
config.mergedLazyLazy.bar = config.mergedLazyLazy.baz + 1;
|
||||||
|
config.mergedLazyLazy.baz = 10;
|
||||||
|
options.lazyResult = mkOption { default = config.mergedLazyLazy.bar; };
|
||||||
|
|
||||||
|
# Can not only evaluate if not lazy
|
||||||
|
config.mergedNonLazyNonLazy.bar = config.mergedNonLazyNonLazy.baz + 1;
|
||||||
|
config.mergedNonLazyNonLazy.baz = 10;
|
||||||
|
options.nonLazyResult = mkOption { default = config.mergedNonLazyNonLazy.bar; };
|
||||||
|
}
|
||||||
|
)
|
||||||
|
];
|
||||||
|
}
|
|
@ -14,19 +14,5 @@ let
|
||||||
in
|
in
|
||||||
pkgs.symlinkJoin {
|
pkgs.symlinkJoin {
|
||||||
name = "nixpkgs-lib-tests";
|
name = "nixpkgs-lib-tests";
|
||||||
paths = map testWithNix nixVersions ++
|
paths = map testWithNix nixVersions;
|
||||||
|
|
||||||
#
|
|
||||||
# TEMPORARY MIGRATION MECHANISM
|
|
||||||
#
|
|
||||||
# This comment and the expression which follows it should be
|
|
||||||
# removed as part of resolving this issue:
|
|
||||||
#
|
|
||||||
# https://github.com/NixOS/nixpkgs/issues/272591
|
|
||||||
#
|
|
||||||
[(import ../../pkgs/test/release {
|
|
||||||
inherit pkgs lib nix;
|
|
||||||
})]
|
|
||||||
;
|
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -52,7 +52,7 @@ lib.runTests (
|
||||||
|
|
||||||
testcygwin = mseteq cygwin [ "i686-cygwin" "x86_64-cygwin" ];
|
testcygwin = mseteq cygwin [ "i686-cygwin" "x86_64-cygwin" ];
|
||||||
testdarwin = mseteq darwin [ "x86_64-darwin" "i686-darwin" "aarch64-darwin" "armv7a-darwin" ];
|
testdarwin = mseteq darwin [ "x86_64-darwin" "i686-darwin" "aarch64-darwin" "armv7a-darwin" ];
|
||||||
testfreebsd = mseteq freebsd [ "i686-freebsd" "x86_64-freebsd" ];
|
testfreebsd = mseteq freebsd [ "aarch64-freebsd" "i686-freebsd" "x86_64-freebsd" ];
|
||||||
testgenode = mseteq genode [ "aarch64-genode" "i686-genode" "x86_64-genode" ];
|
testgenode = mseteq genode [ "aarch64-genode" "i686-genode" "x86_64-genode" ];
|
||||||
testredox = mseteq redox [ "x86_64-redox" ];
|
testredox = mseteq redox [ "x86_64-redox" ];
|
||||||
testgnu = mseteq gnu (linux /* ++ kfreebsd ++ ... */);
|
testgnu = mseteq gnu (linux /* ++ kfreebsd ++ ... */);
|
||||||
|
@ -78,6 +78,18 @@ lib.runTests (
|
||||||
expr = toLosslessStringMaybe (lib.systems.elaborate "x86_64-linux" // { something = "extra"; });
|
expr = toLosslessStringMaybe (lib.systems.elaborate "x86_64-linux" // { something = "extra"; });
|
||||||
expected = null;
|
expected = null;
|
||||||
};
|
};
|
||||||
|
test_elaborate_config_over_system = {
|
||||||
|
expr = (lib.systems.elaborate { config = "i686-unknown-linux-gnu"; system = "x86_64-linux"; }).system;
|
||||||
|
expected = "i686-linux";
|
||||||
|
};
|
||||||
|
test_elaborate_config_over_parsed = {
|
||||||
|
expr = (lib.systems.elaborate { config = "i686-unknown-linux-gnu"; parsed = (lib.systems.elaborate "x86_64-linux").parsed; }).parsed.cpu.arch;
|
||||||
|
expected = "i686";
|
||||||
|
};
|
||||||
|
test_elaborate_system_over_parsed = {
|
||||||
|
expr = (lib.systems.elaborate { system = "i686-linux"; parsed = (lib.systems.elaborate "x86_64-linux").parsed; }).parsed.cpu.arch;
|
||||||
|
expected = "i686";
|
||||||
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
# Generate test cases to assert that a change in any non-function attribute makes a platform unequal
|
# Generate test cases to assert that a change in any non-function attribute makes a platform unequal
|
||||||
|
|
138
lib/types.nix
138
lib/types.nix
|
@ -83,23 +83,41 @@ rec {
|
||||||
# Default type merging function
|
# Default type merging function
|
||||||
# takes two type functors and return the merged type
|
# takes two type functors and return the merged type
|
||||||
defaultTypeMerge = f: f':
|
defaultTypeMerge = f: f':
|
||||||
let wrapped = f.wrapped.typeMerge f'.wrapped.functor;
|
let
|
||||||
payload = f.binOp f.payload f'.payload;
|
mergedWrapped = f.wrapped.typeMerge f'.wrapped.functor;
|
||||||
|
mergedPayload = f.binOp f.payload f'.payload;
|
||||||
|
|
||||||
|
hasPayload = assert (f'.payload != null) == (f.payload != null); f.payload != null;
|
||||||
|
hasWrapped = assert (f'.wrapped != null) == (f.wrapped != null); f.wrapped != null;
|
||||||
|
|
||||||
|
typeFromPayload = if mergedPayload == null then null else f.type mergedPayload;
|
||||||
|
typeFromWrapped = if mergedWrapped == null then null else f.type mergedWrapped;
|
||||||
in
|
in
|
||||||
# cannot merge different types
|
# Abort early: cannot merge different types
|
||||||
if f.name != f'.name
|
if f.name != f'.name
|
||||||
then null
|
then null
|
||||||
# simple types
|
else
|
||||||
else if (f.wrapped == null && f'.wrapped == null)
|
|
||||||
&& (f.payload == null && f'.payload == null)
|
if hasPayload then
|
||||||
then f.type
|
# Just return the payload if returning wrapped is deprecated
|
||||||
# composed types
|
if f ? wrappedDeprecationMessage then
|
||||||
else if (f.wrapped != null && f'.wrapped != null) && (wrapped != null)
|
typeFromPayload
|
||||||
then f.type wrapped
|
else if hasWrapped then
|
||||||
# value types
|
# Has both wrapped and payload
|
||||||
else if (f.payload != null && f'.payload != null) && (payload != null)
|
throw ''
|
||||||
then f.type payload
|
Type ${f.name} defines both `functor.payload` and `functor.wrapped` at the same time, which is not supported.
|
||||||
else null;
|
|
||||||
|
Use either `functor.payload` or `functor.wrapped` but not both.
|
||||||
|
|
||||||
|
If your code worked before remove either `functor.wrapped` or `functor.payload` from the type definition.
|
||||||
|
''
|
||||||
|
else
|
||||||
|
typeFromPayload
|
||||||
|
else
|
||||||
|
if hasWrapped then
|
||||||
|
typeFromWrapped
|
||||||
|
else
|
||||||
|
f.type;
|
||||||
|
|
||||||
# Default type functor
|
# Default type functor
|
||||||
defaultFunctor = name: {
|
defaultFunctor = name: {
|
||||||
|
@ -568,48 +586,78 @@ rec {
|
||||||
substSubModules = m: nonEmptyListOf (elemType.substSubModules m);
|
substSubModules = m: nonEmptyListOf (elemType.substSubModules m);
|
||||||
};
|
};
|
||||||
|
|
||||||
attrsOf = elemType: mkOptionType rec {
|
attrsOf = elemType: attrsWith { inherit elemType; };
|
||||||
name = "attrsOf";
|
|
||||||
description = "attribute set of ${optionDescriptionPhrase (class: class == "noun" || class == "composite") elemType}";
|
|
||||||
descriptionClass = "composite";
|
|
||||||
check = isAttrs;
|
|
||||||
merge = loc: defs:
|
|
||||||
mapAttrs (n: v: v.value) (filterAttrs (n: v: v ? value) (zipAttrsWith (name: defs:
|
|
||||||
(mergeDefinitions (loc ++ [name]) elemType defs).optionalValue
|
|
||||||
)
|
|
||||||
# Push down position info.
|
|
||||||
(map (def: mapAttrs (n: v: { inherit (def) file; value = v; }) def.value) defs)));
|
|
||||||
emptyValue = { value = {}; };
|
|
||||||
getSubOptions = prefix: elemType.getSubOptions (prefix ++ ["<name>"]);
|
|
||||||
getSubModules = elemType.getSubModules;
|
|
||||||
substSubModules = m: attrsOf (elemType.substSubModules m);
|
|
||||||
functor = (defaultFunctor name) // { wrapped = elemType; };
|
|
||||||
nestedTypes.elemType = elemType;
|
|
||||||
};
|
|
||||||
|
|
||||||
# A version of attrsOf that's lazy in its values at the expense of
|
# A version of attrsOf that's lazy in its values at the expense of
|
||||||
# conditional definitions not working properly. E.g. defining a value with
|
# conditional definitions not working properly. E.g. defining a value with
|
||||||
# `foo.attr = mkIf false 10`, then `foo ? attr == true`, whereas with
|
# `foo.attr = mkIf false 10`, then `foo ? attr == true`, whereas with
|
||||||
# attrsOf it would correctly be `false`. Accessing `foo.attr` would throw an
|
# attrsOf it would correctly be `false`. Accessing `foo.attr` would throw an
|
||||||
# error that it's not defined. Use only if conditional definitions don't make sense.
|
# error that it's not defined. Use only if conditional definitions don't make sense.
|
||||||
lazyAttrsOf = elemType: mkOptionType rec {
|
lazyAttrsOf = elemType: attrsWith { inherit elemType; lazy = true; };
|
||||||
name = "lazyAttrsOf";
|
|
||||||
description = "lazy attribute set of ${optionDescriptionPhrase (class: class == "noun" || class == "composite") elemType}";
|
# base type for lazyAttrsOf and attrsOf
|
||||||
|
attrsWith =
|
||||||
|
let
|
||||||
|
# Push down position info.
|
||||||
|
pushPositions = map (def: mapAttrs (n: v: { inherit (def) file; value = v; }) def.value);
|
||||||
|
binOp = lhs: rhs:
|
||||||
|
let
|
||||||
|
elemType = lhs.elemType.typeMerge rhs.elemType.functor;
|
||||||
|
lazy =
|
||||||
|
if lhs.lazy == rhs.lazy then
|
||||||
|
lhs.lazy
|
||||||
|
else
|
||||||
|
null;
|
||||||
|
in
|
||||||
|
if elemType == null || lazy == null then
|
||||||
|
null
|
||||||
|
else
|
||||||
|
{
|
||||||
|
inherit elemType lazy;
|
||||||
|
};
|
||||||
|
in
|
||||||
|
{
|
||||||
|
elemType,
|
||||||
|
lazy ? false,
|
||||||
|
}:
|
||||||
|
mkOptionType {
|
||||||
|
name = if lazy then "lazyAttrsOf" else "attrsOf";
|
||||||
|
description = (if lazy then "lazy attribute set" else "attribute set") + " of ${optionDescriptionPhrase (class: class == "noun" || class == "composite") elemType}";
|
||||||
descriptionClass = "composite";
|
descriptionClass = "composite";
|
||||||
check = isAttrs;
|
check = isAttrs;
|
||||||
merge = loc: defs:
|
merge = if lazy then (
|
||||||
zipAttrsWith (name: defs:
|
# Lazy merge Function
|
||||||
let merged = mergeDefinitions (loc ++ [name]) elemType defs;
|
loc: defs:
|
||||||
# mergedValue will trigger an appropriate error when accessed
|
zipAttrsWith (name: defs:
|
||||||
in merged.optionalValue.value or elemType.emptyValue.value or merged.mergedValue
|
let merged = mergeDefinitions (loc ++ [name]) elemType defs;
|
||||||
)
|
# mergedValue will trigger an appropriate error when accessed
|
||||||
# Push down position info.
|
in merged.optionalValue.value or elemType.emptyValue.value or merged.mergedValue
|
||||||
(map (def: mapAttrs (n: v: { inherit (def) file; value = v; }) def.value) defs);
|
)
|
||||||
|
# Push down position info.
|
||||||
|
(pushPositions defs)
|
||||||
|
) else (
|
||||||
|
# Non-lazy merge Function
|
||||||
|
loc: defs:
|
||||||
|
mapAttrs (n: v: v.value) (filterAttrs (n: v: v ? value) (zipAttrsWith (name: defs:
|
||||||
|
(mergeDefinitions (loc ++ [name]) elemType (defs)).optionalValue
|
||||||
|
)
|
||||||
|
# Push down position info.
|
||||||
|
(pushPositions defs)))
|
||||||
|
);
|
||||||
emptyValue = { value = {}; };
|
emptyValue = { value = {}; };
|
||||||
getSubOptions = prefix: elemType.getSubOptions (prefix ++ ["<name>"]);
|
getSubOptions = prefix: elemType.getSubOptions (prefix ++ ["<name>"]);
|
||||||
getSubModules = elemType.getSubModules;
|
getSubModules = elemType.getSubModules;
|
||||||
substSubModules = m: lazyAttrsOf (elemType.substSubModules m);
|
substSubModules = m: attrsWith { elemType = elemType.substSubModules m; inherit lazy; };
|
||||||
functor = (defaultFunctor name) // { wrapped = elemType; };
|
functor = defaultFunctor "attrsWith" // {
|
||||||
|
wrappedDeprecationMessage = { loc }: lib.warn ''
|
||||||
|
The deprecated `type.functor.wrapped` attribute of the option `${showOption loc}` is accessed, use `type.nestedTypes.elemType` instead.
|
||||||
|
'' elemType;
|
||||||
|
payload = {
|
||||||
|
# Important!: Add new function attributes here in case of future changes
|
||||||
|
inherit elemType lazy;
|
||||||
|
};
|
||||||
|
inherit binOp;
|
||||||
|
};
|
||||||
nestedTypes.elemType = elemType;
|
nestedTypes.elemType = elemType;
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -493,6 +493,12 @@
|
||||||
github = "acesyde";
|
github = "acesyde";
|
||||||
githubId = 958435;
|
githubId = 958435;
|
||||||
};
|
};
|
||||||
|
AchmadFathoni = {
|
||||||
|
name = "Achmad Fathoni";
|
||||||
|
email = "fathoni.id@gmail.com";
|
||||||
|
github = "AchmadFathoni";
|
||||||
|
githubId = 26775746;
|
||||||
|
};
|
||||||
aciceri = {
|
aciceri = {
|
||||||
name = "Andrea Ciceri";
|
name = "Andrea Ciceri";
|
||||||
email = "andrea.ciceri@autistici.org";
|
email = "andrea.ciceri@autistici.org";
|
||||||
|
@ -1197,6 +1203,12 @@
|
||||||
name = "alyaeanyx";
|
name = "alyaeanyx";
|
||||||
keys = [ { fingerprint = "1F73 8879 5E5A 3DFC E2B3 FA32 87D1 AADC D25B 8DEE"; } ];
|
keys = [ { fingerprint = "1F73 8879 5E5A 3DFC E2B3 FA32 87D1 AADC D25B 8DEE"; } ];
|
||||||
};
|
};
|
||||||
|
amadaluzia = {
|
||||||
|
email = "amad@atl.tools";
|
||||||
|
github = "amadaluzia";
|
||||||
|
githubId = 188314694;
|
||||||
|
name = "Artur Manuel";
|
||||||
|
};
|
||||||
amadejkastelic = {
|
amadejkastelic = {
|
||||||
email = "amadejkastelic7@gmail.com";
|
email = "amadejkastelic7@gmail.com";
|
||||||
github = "amadejkastelic";
|
github = "amadejkastelic";
|
||||||
|
@ -1307,7 +1319,6 @@
|
||||||
name = "Wroclaw";
|
name = "Wroclaw";
|
||||||
};
|
};
|
||||||
amuckstot30 = {
|
amuckstot30 = {
|
||||||
email = "amuckstot30@tutanota.com";
|
|
||||||
github = "amuckstot30";
|
github = "amuckstot30";
|
||||||
githubId = 157274630;
|
githubId = 157274630;
|
||||||
name = "amuckstot30";
|
name = "amuckstot30";
|
||||||
|
@ -1619,6 +1630,12 @@
|
||||||
githubId = 4194320;
|
githubId = 4194320;
|
||||||
name = "Anton Schirg";
|
name = "Anton Schirg";
|
||||||
};
|
};
|
||||||
|
anugrahn1 = {
|
||||||
|
email = "pnanugrah@gmail.com";
|
||||||
|
github = "anugrahn1";
|
||||||
|
githubId = 117428605;
|
||||||
|
name = "Anugrah Naranatt";
|
||||||
|
};
|
||||||
anytimetraveler = {
|
anytimetraveler = {
|
||||||
email = "simon@simonscode.org";
|
email = "simon@simonscode.org";
|
||||||
github = "AnyTimeTraveler";
|
github = "AnyTimeTraveler";
|
||||||
|
@ -2273,6 +2290,12 @@
|
||||||
githubId = 206242;
|
githubId = 206242;
|
||||||
name = "Andreas Wiese";
|
name = "Andreas Wiese";
|
||||||
};
|
};
|
||||||
|
axertheaxe = {
|
||||||
|
email = "axertheaxe@proton.me";
|
||||||
|
github = "axertheaxe";
|
||||||
|
githubId = 99703210;
|
||||||
|
name = "Katherine Jamison";
|
||||||
|
};
|
||||||
ayazhafiz = {
|
ayazhafiz = {
|
||||||
email = "ayaz.hafiz.1@gmail.com";
|
email = "ayaz.hafiz.1@gmail.com";
|
||||||
github = "hafiz";
|
github = "hafiz";
|
||||||
|
@ -3806,6 +3829,12 @@
|
||||||
name = "ChaosAttractor";
|
name = "ChaosAttractor";
|
||||||
keys = [ { fingerprint = "A137 4415 DB7C 6439 10EA 5BF1 0FEE 4E47 5940 E125"; } ];
|
keys = [ { fingerprint = "A137 4415 DB7C 6439 10EA 5BF1 0FEE 4E47 5940 E125"; } ];
|
||||||
};
|
};
|
||||||
|
charB66 = {
|
||||||
|
email = "nix.disparate221@passinbox.com";
|
||||||
|
github = "charB66";
|
||||||
|
githubId = 59340663;
|
||||||
|
name = "Bryan F.";
|
||||||
|
};
|
||||||
charlesbaynham = {
|
charlesbaynham = {
|
||||||
email = "charlesbaynham@gmail.com";
|
email = "charlesbaynham@gmail.com";
|
||||||
github = "charlesbaynham";
|
github = "charlesbaynham";
|
||||||
|
@ -4186,7 +4215,7 @@
|
||||||
matrix = "@clot27:matrix.org";
|
matrix = "@clot27:matrix.org";
|
||||||
};
|
};
|
||||||
cloudripper = {
|
cloudripper = {
|
||||||
email = "other.wing8806@fastmail.com";
|
email = "dev+nixpkgs@cldrpr.com";
|
||||||
github = "cloudripper";
|
github = "cloudripper";
|
||||||
githubId = 70971768;
|
githubId = 70971768;
|
||||||
name = "cloudripper";
|
name = "cloudripper";
|
||||||
|
@ -4578,6 +4607,13 @@
|
||||||
githubId = 1707779;
|
githubId = 1707779;
|
||||||
name = "Chris Ertel";
|
name = "Chris Ertel";
|
||||||
};
|
};
|
||||||
|
crimeminister = {
|
||||||
|
email = "robert@crimeminister.org";
|
||||||
|
name = "Robert Medeiros";
|
||||||
|
github = "crimeminister";
|
||||||
|
githubId = 29072;
|
||||||
|
keys = [ { fingerprint = "E3BD A35E 590A 8D29 701A 9723 F448 7FA0 4BC6 44F2"; } ];
|
||||||
|
};
|
||||||
crinklywrappr = {
|
crinklywrappr = {
|
||||||
email = "crinklywrappr@pm.me";
|
email = "crinklywrappr@pm.me";
|
||||||
name = "Daniel Fitzpatrick";
|
name = "Daniel Fitzpatrick";
|
||||||
|
@ -4653,6 +4689,12 @@
|
||||||
githubId = 490965;
|
githubId = 490965;
|
||||||
name = "Craig Swank";
|
name = "Craig Swank";
|
||||||
};
|
};
|
||||||
|
cterence = {
|
||||||
|
email = "terence.chateigne@posteo.net";
|
||||||
|
github = "cterence";
|
||||||
|
githubId = 25285508;
|
||||||
|
name = "Térence Chateigné";
|
||||||
|
};
|
||||||
ctron = {
|
ctron = {
|
||||||
email = "ctron@dentrassi.de";
|
email = "ctron@dentrassi.de";
|
||||||
github = "ctron";
|
github = "ctron";
|
||||||
|
@ -4775,6 +4817,12 @@
|
||||||
name = "Dov Alperin";
|
name = "Dov Alperin";
|
||||||
keys = [ { fingerprint = "4EED 5096 B925 86FA 1101 6673 7F2C 07B9 1B52 BB61"; } ];
|
keys = [ { fingerprint = "4EED 5096 B925 86FA 1101 6673 7F2C 07B9 1B52 BB61"; } ];
|
||||||
};
|
};
|
||||||
|
damhiya = {
|
||||||
|
name = "SoonWon Moon";
|
||||||
|
email = "damhiya@gmail.com";
|
||||||
|
github = "damhiya";
|
||||||
|
githubId = 13533446;
|
||||||
|
};
|
||||||
DamienCassou = {
|
DamienCassou = {
|
||||||
email = "damien@cassou.me";
|
email = "damien@cassou.me";
|
||||||
github = "DamienCassou";
|
github = "DamienCassou";
|
||||||
|
@ -4957,6 +5005,12 @@
|
||||||
githubId = 7589338;
|
githubId = 7589338;
|
||||||
name = "Daniel Șerbănescu";
|
name = "Daniel Șerbănescu";
|
||||||
};
|
};
|
||||||
|
daspk04 = {
|
||||||
|
email = "dpratyush.k@gmail.com";
|
||||||
|
github = "daspk04";
|
||||||
|
githubId = 28738918;
|
||||||
|
name = "Pratyush Das";
|
||||||
|
};
|
||||||
datafoo = {
|
datafoo = {
|
||||||
github = "datafoo";
|
github = "datafoo";
|
||||||
githubId = 34766150;
|
githubId = 34766150;
|
||||||
|
@ -4968,8 +5022,7 @@
|
||||||
githubId = 28595242;
|
githubId = 28595242;
|
||||||
name = "DataHearth";
|
name = "DataHearth";
|
||||||
keys = [
|
keys = [
|
||||||
{ fingerprint = "A129 2547 0298 BFEE 7EE0 92B3 946E 2D0C 410C 7B3D"; }
|
{ fingerprint = "E8F9 0B80 908E 723D 0EDF 0916 5803 CDA5 9C26 A96A"; }
|
||||||
{ fingerprint = "FFC4 92C1 5320 B05D 0F8D 7D58 ABF6 737C 6339 6D35"; }
|
|
||||||
];
|
];
|
||||||
};
|
};
|
||||||
davegallant = {
|
davegallant = {
|
||||||
|
@ -6044,6 +6097,12 @@
|
||||||
githubId = 2025623;
|
githubId = 2025623;
|
||||||
name = "Luc Chabassier";
|
name = "Luc Chabassier";
|
||||||
};
|
};
|
||||||
|
dwrege = {
|
||||||
|
email = "email@dwrege.de";
|
||||||
|
github = "dominicwrege";
|
||||||
|
githubId = 7389000;
|
||||||
|
name = "Dominic Wrege";
|
||||||
|
};
|
||||||
dxf = {
|
dxf = {
|
||||||
email = "dingxiangfei2009@gmail.com";
|
email = "dingxiangfei2009@gmail.com";
|
||||||
github = "dingxiangfei2009";
|
github = "dingxiangfei2009";
|
||||||
|
@ -6287,6 +6346,12 @@
|
||||||
githubId = 701128;
|
githubId = 701128;
|
||||||
name = "Eike Kettner";
|
name = "Eike Kettner";
|
||||||
};
|
};
|
||||||
|
eilvelia = {
|
||||||
|
email = "hi@eilvelia.cat";
|
||||||
|
github = "eilvelia";
|
||||||
|
githubId = 10106819;
|
||||||
|
name = "eilvelia";
|
||||||
|
};
|
||||||
eken = {
|
eken = {
|
||||||
email = "edvin.kallstrom@protonmail.com";
|
email = "edvin.kallstrom@protonmail.com";
|
||||||
github = "Eken-beep";
|
github = "Eken-beep";
|
||||||
|
@ -6903,6 +6968,12 @@
|
||||||
githubId = 30512529;
|
githubId = 30512529;
|
||||||
name = "Evils";
|
name = "Evils";
|
||||||
};
|
};
|
||||||
|
evris99 = {
|
||||||
|
name = "Evrymachos Koukoumakas";
|
||||||
|
github = "evris99";
|
||||||
|
githubId = 32963606;
|
||||||
|
email = "cptevris@gmail.com";
|
||||||
|
};
|
||||||
ewok = {
|
ewok = {
|
||||||
email = "ewok@ewok.ru";
|
email = "ewok@ewok.ru";
|
||||||
github = "ewok-old";
|
github = "ewok-old";
|
||||||
|
@ -7015,12 +7086,6 @@
|
||||||
githubId = 878822;
|
githubId = 878822;
|
||||||
name = "Tristan Helmich";
|
name = "Tristan Helmich";
|
||||||
};
|
};
|
||||||
falsifian = {
|
|
||||||
email = "james.cook@utoronto.ca";
|
|
||||||
github = "falsifian";
|
|
||||||
githubId = 225893;
|
|
||||||
name = "James Cook";
|
|
||||||
};
|
|
||||||
fangpen = {
|
fangpen = {
|
||||||
email = "hello@fangpenlin.com";
|
email = "hello@fangpenlin.com";
|
||||||
github = "fangpenlin";
|
github = "fangpenlin";
|
||||||
|
@ -7260,6 +7325,13 @@
|
||||||
github = "fkautz";
|
github = "fkautz";
|
||||||
githubId = 135706;
|
githubId = 135706;
|
||||||
};
|
};
|
||||||
|
flacks = {
|
||||||
|
name = "Jean Lucas";
|
||||||
|
email = "jean@4ray.co";
|
||||||
|
github = "flacks";
|
||||||
|
githubId = 2135469;
|
||||||
|
matrix = "@flacks:matrix.org";
|
||||||
|
};
|
||||||
FlafyDev = {
|
FlafyDev = {
|
||||||
name = "Flafy Arazi";
|
name = "Flafy Arazi";
|
||||||
email = "flafyarazi@gmail.com";
|
email = "flafyarazi@gmail.com";
|
||||||
|
@ -8603,6 +8675,13 @@
|
||||||
githubId = 5317234;
|
githubId = 5317234;
|
||||||
name = "Raphael Megzari";
|
name = "Raphael Megzari";
|
||||||
};
|
};
|
||||||
|
harbiinger = {
|
||||||
|
email = "theo.godin@protonmail.com";
|
||||||
|
matrix = "@hrbgr:matrix.org";
|
||||||
|
github = "harbiinger";
|
||||||
|
githubId = 55398594;
|
||||||
|
name = "Theo Godin";
|
||||||
|
};
|
||||||
hardselius = {
|
hardselius = {
|
||||||
email = "martin@hardselius.dev";
|
email = "martin@hardselius.dev";
|
||||||
github = "hardselius";
|
github = "hardselius";
|
||||||
|
@ -11408,6 +11487,12 @@
|
||||||
githubId = 15373888;
|
githubId = 15373888;
|
||||||
name = "Claudius Holeksa";
|
name = "Claudius Holeksa";
|
||||||
};
|
};
|
||||||
|
keller00 = {
|
||||||
|
name = "Mark Keller";
|
||||||
|
email = "markooo.keller@gmail.com";
|
||||||
|
github = "keller00";
|
||||||
|
githubId = 8452750;
|
||||||
|
};
|
||||||
kennyballou = {
|
kennyballou = {
|
||||||
email = "kb@devnulllabs.io";
|
email = "kb@devnulllabs.io";
|
||||||
github = "kennyballou";
|
github = "kennyballou";
|
||||||
|
@ -11667,6 +11752,12 @@
|
||||||
name = "Kat Inskip";
|
name = "Kat Inskip";
|
||||||
keys = [ { fingerprint = "9CC6 44B5 69CD A59B C874 C4C9 E8DD E3ED 1C90 F3A0"; } ];
|
keys = [ { fingerprint = "9CC6 44B5 69CD A59B C874 C4C9 E8DD E3ED 1C90 F3A0"; } ];
|
||||||
};
|
};
|
||||||
|
kivikakk = {
|
||||||
|
email = "ashe@kivikakk.ee";
|
||||||
|
github = "kivikakk";
|
||||||
|
githubId = 1915;
|
||||||
|
name = "Asherah Connor";
|
||||||
|
};
|
||||||
kjeremy = {
|
kjeremy = {
|
||||||
email = "kjeremy@gmail.com";
|
email = "kjeremy@gmail.com";
|
||||||
name = "Jeremy Kolb";
|
name = "Jeremy Kolb";
|
||||||
|
@ -12740,6 +12831,14 @@
|
||||||
githubId = 5624721;
|
githubId = 5624721;
|
||||||
name = "Ben Wolsieffer";
|
name = "Ben Wolsieffer";
|
||||||
};
|
};
|
||||||
|
lordmzte = {
|
||||||
|
name = "Moritz Thomae";
|
||||||
|
email = "lord@mzte.de";
|
||||||
|
matrix = "@lordmzte:mzte.de";
|
||||||
|
github = "LordMZTE";
|
||||||
|
githubId = 28735087;
|
||||||
|
keys = [ { fingerprint = "AB47 3D70 53D2 74CA DC2C 230C B648 02DC 33A6 4FF6"; } ];
|
||||||
|
};
|
||||||
lord-valen = {
|
lord-valen = {
|
||||||
name = "Lord Valen";
|
name = "Lord Valen";
|
||||||
matrix = "@lord-valen:matrix.org";
|
matrix = "@lord-valen:matrix.org";
|
||||||
|
@ -12866,12 +12965,6 @@
|
||||||
githubId = 37505890;
|
githubId = 37505890;
|
||||||
name = "Luis Wirth";
|
name = "Luis Wirth";
|
||||||
};
|
};
|
||||||
luc65r = {
|
|
||||||
email = "lucas@ransan.fr";
|
|
||||||
github = "luc65r";
|
|
||||||
githubId = 59375051;
|
|
||||||
name = "Lucas Ransan";
|
|
||||||
};
|
|
||||||
LucaGuerra = {
|
LucaGuerra = {
|
||||||
email = "luca@guerra.sh";
|
email = "luca@guerra.sh";
|
||||||
github = "LucaGuerra";
|
github = "LucaGuerra";
|
||||||
|
@ -13072,6 +13165,13 @@
|
||||||
githubId = 30698906;
|
githubId = 30698906;
|
||||||
name = "Luna D Dragon";
|
name = "Luna D Dragon";
|
||||||
};
|
};
|
||||||
|
luNeder = {
|
||||||
|
email = "luana@luana.dev.br";
|
||||||
|
matrix = "@luana:catgirl.cloud";
|
||||||
|
github = "LuNeder";
|
||||||
|
githubId = 19750714;
|
||||||
|
name = "Luana Neder";
|
||||||
|
};
|
||||||
lunik1 = {
|
lunik1 = {
|
||||||
email = "ch.nixpkgs@themaw.xyz";
|
email = "ch.nixpkgs@themaw.xyz";
|
||||||
matrix = "@lunik1:lunik.one";
|
matrix = "@lunik1:lunik.one";
|
||||||
|
@ -13675,7 +13775,6 @@
|
||||||
github = "matthewpi";
|
github = "matthewpi";
|
||||||
githubId = 26559841;
|
githubId = 26559841;
|
||||||
name = "Matthew Penner";
|
name = "Matthew Penner";
|
||||||
keys = [ { fingerprint = "5118 F1CC B7B0 6C17 4DD1 5267 3131 1906 AD4C F6D6"; } ];
|
|
||||||
};
|
};
|
||||||
matthiasbenaets = {
|
matthiasbenaets = {
|
||||||
email = "matthias.benaets@gmail.com";
|
email = "matthias.benaets@gmail.com";
|
||||||
|
@ -15579,6 +15678,13 @@
|
||||||
githubId = 399535;
|
githubId = 399535;
|
||||||
name = "Niklas Hambüchen";
|
name = "Niklas Hambüchen";
|
||||||
};
|
};
|
||||||
|
n-hass = {
|
||||||
|
email = "nick@hassan.host";
|
||||||
|
github = "n-hass";
|
||||||
|
githubId = 72363381;
|
||||||
|
name = "n-hass";
|
||||||
|
keys = [ { fingerprint = "FDEE 6116 DBA7 8840 7323 4466 A371 5973 2728 A6A6"; } ];
|
||||||
|
};
|
||||||
nhnn = {
|
nhnn = {
|
||||||
matrix = "@nhnn:nhnn.dev";
|
matrix = "@nhnn:nhnn.dev";
|
||||||
github = "thenhnn";
|
github = "thenhnn";
|
||||||
|
@ -16212,6 +16318,13 @@
|
||||||
github = "octodi";
|
github = "octodi";
|
||||||
githubId = 127038896;
|
githubId = 127038896;
|
||||||
};
|
};
|
||||||
|
octvs = {
|
||||||
|
name = "octvs";
|
||||||
|
email = "octvs@posteo.de";
|
||||||
|
matrix = "@octvs:matrix.org";
|
||||||
|
github = "octvs";
|
||||||
|
githubId = 42993892;
|
||||||
|
};
|
||||||
oddlama = {
|
oddlama = {
|
||||||
email = "oddlama@oddlama.org";
|
email = "oddlama@oddlama.org";
|
||||||
github = "oddlama";
|
github = "oddlama";
|
||||||
|
@ -16724,6 +16837,11 @@
|
||||||
githubId = 33826198;
|
githubId = 33826198;
|
||||||
name = "Philipp Arras";
|
name = "Philipp Arras";
|
||||||
};
|
};
|
||||||
|
parth = {
|
||||||
|
github = "parth";
|
||||||
|
githubId = 821972;
|
||||||
|
name = "Parth Mehrotra";
|
||||||
|
};
|
||||||
pashashocky = {
|
pashashocky = {
|
||||||
email = "pashashocky@gmail.com";
|
email = "pashashocky@gmail.com";
|
||||||
github = "pashashocky";
|
github = "pashashocky";
|
||||||
|
@ -17878,6 +17996,12 @@
|
||||||
githubId = 5636;
|
githubId = 5636;
|
||||||
name = "Steve Purcell";
|
name = "Steve Purcell";
|
||||||
};
|
};
|
||||||
|
purpole = {
|
||||||
|
email = "mail@purpole.io";
|
||||||
|
github = "purpole";
|
||||||
|
githubId = 101905225;
|
||||||
|
name = "David Schneider";
|
||||||
|
};
|
||||||
purrpurrn = {
|
purrpurrn = {
|
||||||
email = "scrcpynovideoaudiocodecraw+nixpkgs@gmail.com";
|
email = "scrcpynovideoaudiocodecraw+nixpkgs@gmail.com";
|
||||||
github = "purrpurrn";
|
github = "purrpurrn";
|
||||||
|
@ -18087,6 +18211,13 @@
|
||||||
matrix = "@qyriad:katesiria.org";
|
matrix = "@qyriad:katesiria.org";
|
||||||
name = "Qyriad";
|
name = "Qyriad";
|
||||||
};
|
};
|
||||||
|
r17x = {
|
||||||
|
email = "hi@rin.rocks";
|
||||||
|
github = "r17x";
|
||||||
|
githubId = 16365952;
|
||||||
|
name = "Rin";
|
||||||
|
keys = [ { fingerprint = "476A F55D 6378 F878 0709 848A 18F9 F516 1CC0 576C"; } ];
|
||||||
|
};
|
||||||
r3dl3g = {
|
r3dl3g = {
|
||||||
email = "redleg@rothfuss-web.de";
|
email = "redleg@rothfuss-web.de";
|
||||||
github = "r3dl3g";
|
github = "r3dl3g";
|
||||||
|
@ -18537,7 +18668,7 @@
|
||||||
};
|
};
|
||||||
returntoreality = {
|
returntoreality = {
|
||||||
email = "linus@lotz.li";
|
email = "linus@lotz.li";
|
||||||
github = "retuntoreality";
|
github = "returntoreality";
|
||||||
githubId = 255667;
|
githubId = 255667;
|
||||||
name = "Linus Karl";
|
name = "Linus Karl";
|
||||||
};
|
};
|
||||||
|
@ -18639,6 +18770,12 @@
|
||||||
github = "ribose-jeffreylau";
|
github = "ribose-jeffreylau";
|
||||||
githubId = 2649467;
|
githubId = 2649467;
|
||||||
};
|
};
|
||||||
|
ribru17 = {
|
||||||
|
name = "Riley Bruins";
|
||||||
|
email = "ribru17@hotmail.com";
|
||||||
|
github = "ribru17";
|
||||||
|
githubId = 55766287;
|
||||||
|
};
|
||||||
ricarch97 = {
|
ricarch97 = {
|
||||||
email = "ricardo.steijn97@gmail.com";
|
email = "ricardo.steijn97@gmail.com";
|
||||||
github = "RicArch97";
|
github = "RicArch97";
|
||||||
|
@ -19367,6 +19504,13 @@
|
||||||
name = "Maxwell Beck";
|
name = "Maxwell Beck";
|
||||||
keys = [ { fingerprint = "D260 79E3 C2BC 2E43 905B D057 BB3E FA30 3760 A0DB"; } ];
|
keys = [ { fingerprint = "D260 79E3 C2BC 2E43 905B D057 BB3E FA30 3760 A0DB"; } ];
|
||||||
};
|
};
|
||||||
|
rytswd = {
|
||||||
|
email = "rytswd@gmail.com";
|
||||||
|
github = "rytswd";
|
||||||
|
githubId = 23435099;
|
||||||
|
name = "Ryota";
|
||||||
|
keys = [ { fingerprint = "537E 712F 0EC3 91C2 B47F 56E2 EB5D 1A84 5333 43BB"; } ];
|
||||||
|
};
|
||||||
ryze = {
|
ryze = {
|
||||||
name = "Ryze";
|
name = "Ryze";
|
||||||
github = "ryze312";
|
github = "ryze312";
|
||||||
|
@ -19407,6 +19551,14 @@
|
||||||
github = "Sail0rd";
|
github = "Sail0rd";
|
||||||
githubId = 55802415;
|
githubId = 55802415;
|
||||||
};
|
};
|
||||||
|
sako = {
|
||||||
|
name = "Sako";
|
||||||
|
email = "sako@cock.email";
|
||||||
|
matrix = "@sako:imagisphe.re";
|
||||||
|
github = "Sakooooo";
|
||||||
|
githubId = 78461130;
|
||||||
|
keys = [ { fingerprint = "CA52 EE7B E681 720E 32B6 6792 FE52 FD65 B76E 4751"; } ];
|
||||||
|
};
|
||||||
samalws = {
|
samalws = {
|
||||||
email = "sam@samalws.com";
|
email = "sam@samalws.com";
|
||||||
name = "Sam Alws";
|
name = "Sam Alws";
|
||||||
|
@ -19594,6 +19746,12 @@
|
||||||
githubId = 2347889;
|
githubId = 2347889;
|
||||||
name = "Sauyon Lee";
|
name = "Sauyon Lee";
|
||||||
};
|
};
|
||||||
|
savalet = {
|
||||||
|
email = "savinien.petitjean@gmail.com";
|
||||||
|
github = "savalet";
|
||||||
|
githubId = 73446695;
|
||||||
|
name = "savalet";
|
||||||
|
};
|
||||||
savannidgerinel = {
|
savannidgerinel = {
|
||||||
email = "savanni@luminescent-dreams.com";
|
email = "savanni@luminescent-dreams.com";
|
||||||
github = "savannidgerinel";
|
github = "savannidgerinel";
|
||||||
|
@ -20132,6 +20290,13 @@
|
||||||
githubId = 251028;
|
githubId = 251028;
|
||||||
name = "Shell Turner";
|
name = "Shell Turner";
|
||||||
};
|
};
|
||||||
|
shelvacu = {
|
||||||
|
name = "Shelvacu";
|
||||||
|
email = "nix-maint@shelvacu.com";
|
||||||
|
matrix = "@s:consortium.chat";
|
||||||
|
github = "shelvacu";
|
||||||
|
githubId = 1731537;
|
||||||
|
};
|
||||||
shhht = {
|
shhht = {
|
||||||
name = "shhht";
|
name = "shhht";
|
||||||
email = "stp.tjeerd@gmail.com";
|
email = "stp.tjeerd@gmail.com";
|
||||||
|
@ -21107,12 +21272,6 @@
|
||||||
githubId = 1694705;
|
githubId = 1694705;
|
||||||
name = "Sam Stites";
|
name = "Sam Stites";
|
||||||
};
|
};
|
||||||
stnley = {
|
|
||||||
email = "michael@stnley.io";
|
|
||||||
github = "stnley";
|
|
||||||
githubId = 64174376;
|
|
||||||
name = "Michael Stanley";
|
|
||||||
};
|
|
||||||
strager = {
|
strager = {
|
||||||
email = "strager.nds@gmail.com";
|
email = "strager.nds@gmail.com";
|
||||||
github = "strager";
|
github = "strager";
|
||||||
|
@ -21499,6 +21658,17 @@
|
||||||
githubId = 6064962;
|
githubId = 6064962;
|
||||||
name = "TakWolf";
|
name = "TakWolf";
|
||||||
};
|
};
|
||||||
|
talhaHavadar = {
|
||||||
|
email = "havadartalha@gmail.com";
|
||||||
|
github = "talhaHavadar";
|
||||||
|
githubId = 6908462;
|
||||||
|
name = "Talha Can Havadar";
|
||||||
|
keys = [
|
||||||
|
{
|
||||||
|
fingerprint = "1E13 12DF 4B71 58B6 EBF9 DE78 2574 3879 62FE B0D1";
|
||||||
|
}
|
||||||
|
];
|
||||||
|
};
|
||||||
talkara = {
|
talkara = {
|
||||||
email = "taito.horiuchi@relexsolutions.com";
|
email = "taito.horiuchi@relexsolutions.com";
|
||||||
github = "talkara";
|
github = "talkara";
|
||||||
|
@ -21687,6 +21857,12 @@
|
||||||
githubId = 2084639;
|
githubId = 2084639;
|
||||||
name = "Manu";
|
name = "Manu";
|
||||||
};
|
};
|
||||||
|
tensor5 = {
|
||||||
|
github = "tensor5";
|
||||||
|
githubId = 1545895;
|
||||||
|
matrix = "@tensor5:matrix.org";
|
||||||
|
name = "Nicola Squartini";
|
||||||
|
};
|
||||||
teozkr = {
|
teozkr = {
|
||||||
email = "teo@nullable.se";
|
email = "teo@nullable.se";
|
||||||
github = "nightkr";
|
github = "nightkr";
|
||||||
|
@ -22023,6 +22199,12 @@
|
||||||
githubId = 7709;
|
githubId = 7709;
|
||||||
name = "Thomaz Leite";
|
name = "Thomaz Leite";
|
||||||
};
|
};
|
||||||
|
tholo = {
|
||||||
|
email = "ali0mhmz@gmail.com";
|
||||||
|
github = "tholoo";
|
||||||
|
githubId = 42005990;
|
||||||
|
name = "Ali Mohammadzadeh";
|
||||||
|
};
|
||||||
thomasdesr = {
|
thomasdesr = {
|
||||||
email = "git@hive.pw";
|
email = "git@hive.pw";
|
||||||
github = "thomasdesr";
|
github = "thomasdesr";
|
||||||
|
@ -22247,6 +22429,12 @@
|
||||||
githubId = 6118602;
|
githubId = 6118602;
|
||||||
name = "Viktor";
|
name = "Viktor";
|
||||||
};
|
};
|
||||||
|
tne = {
|
||||||
|
email = "tne@garudalinux.org";
|
||||||
|
github = "JustTNE";
|
||||||
|
githubId = 38938720;
|
||||||
|
name = "TNE";
|
||||||
|
};
|
||||||
tnias = {
|
tnias = {
|
||||||
email = "phil@grmr.de";
|
email = "phil@grmr.de";
|
||||||
matrix = "@tnias:stratum0.org";
|
matrix = "@tnias:stratum0.org";
|
||||||
|
@ -23060,6 +23248,12 @@
|
||||||
githubId = 2856634;
|
githubId = 2856634;
|
||||||
name = "Tyler Compton";
|
name = "Tyler Compton";
|
||||||
};
|
};
|
||||||
|
venikx = {
|
||||||
|
email = "code@venikx.com";
|
||||||
|
github = "venikx";
|
||||||
|
githubId = 24815061;
|
||||||
|
name = "Kevin De Baerdemaeker";
|
||||||
|
};
|
||||||
veprbl = {
|
veprbl = {
|
||||||
email = "veprbl@gmail.com";
|
email = "veprbl@gmail.com";
|
||||||
github = "veprbl";
|
github = "veprbl";
|
||||||
|
@ -23097,6 +23291,12 @@
|
||||||
githubId = 11413574;
|
githubId = 11413574;
|
||||||
name = "Fiona Weber";
|
name = "Fiona Weber";
|
||||||
};
|
};
|
||||||
|
vieta = {
|
||||||
|
email = "xyzVieta@gmail.com";
|
||||||
|
github = "yVieta";
|
||||||
|
githubId = 94648307;
|
||||||
|
name = "Thanh Viet Nguyen";
|
||||||
|
};
|
||||||
vifino = {
|
vifino = {
|
||||||
email = "vifino@tty.sh";
|
email = "vifino@tty.sh";
|
||||||
github = "vifino";
|
github = "vifino";
|
||||||
|
@ -23244,6 +23444,13 @@
|
||||||
name = "Vinicius Bernardino";
|
name = "Vinicius Bernardino";
|
||||||
keys = [ { fingerprint = "F0D3 920C 722A 541F 0CCD 66E3 A7BA BA05 3D78 E7CA"; } ];
|
keys = [ { fingerprint = "F0D3 920C 722A 541F 0CCD 66E3 A7BA BA05 3D78 E7CA"; } ];
|
||||||
};
|
};
|
||||||
|
vog = {
|
||||||
|
email = "v@njh.eu";
|
||||||
|
github = "vog";
|
||||||
|
githubId = 412749;
|
||||||
|
name = "Volker Diels-Grabsch";
|
||||||
|
keys = [ { fingerprint = "A7E6 9C4F 69DC 5D6C FC84 EE34 A29F BD51 5F89 90AF"; } ];
|
||||||
|
};
|
||||||
voidless = {
|
voidless = {
|
||||||
email = "julius.schmitt@yahoo.de";
|
email = "julius.schmitt@yahoo.de";
|
||||||
github = "voidIess";
|
github = "voidIess";
|
||||||
|
|
|
@ -103,6 +103,7 @@ luazip,,,,,,
|
||||||
lush.nvim,,,https://luarocks.org/dev,,,teto
|
lush.nvim,,,https://luarocks.org/dev,,,teto
|
||||||
luuid,,,,20120509-2,,
|
luuid,,,,20120509-2,,
|
||||||
luv,,,,1.48.0-2,,
|
luv,,,,1.48.0-2,,
|
||||||
|
lusc_luv,,,,,,
|
||||||
lyaml,,,,,,lblasc
|
lyaml,,,,,,lblasc
|
||||||
lz.n,,,,,,mrcjkb
|
lz.n,,,,,,mrcjkb
|
||||||
lze,,,,,,birdee
|
lze,,,,,,birdee
|
||||||
|
@ -138,11 +139,11 @@ sqlite,,,,,,
|
||||||
std._debug,,,,,,
|
std._debug,,,,,,
|
||||||
std.normalize,,,,,,
|
std.normalize,,,,,,
|
||||||
stdlib,,,,41.2.2,,vyp
|
stdlib,,,,41.2.2,,vyp
|
||||||
teal-language-server,,,http://luarocks.org/dev,,,
|
teal-language-server,,,,,,
|
||||||
telescope-manix,,,,,,
|
telescope-manix,,,,,,
|
||||||
telescope.nvim,,,,,5.1,
|
telescope.nvim,,,,,5.1,
|
||||||
tiktoken_core,,,,,,natsukium
|
tiktoken_core,,,,,,natsukium
|
||||||
tl,,,,0.15.3-1,,mephistophiles
|
tl,,,,,,mephistophiles
|
||||||
toml-edit,,,,,5.1,mrcjkb
|
toml-edit,,,,,5.1,mrcjkb
|
||||||
tree-sitter-norg,,,,,5.1,mrcjkb
|
tree-sitter-norg,,,,,5.1,mrcjkb
|
||||||
vstruct,,,,,,
|
vstruct,,,,,,
|
||||||
|
|
|
|
@ -32,7 +32,7 @@ from functools import wraps
|
||||||
from multiprocessing.dummy import Pool
|
from multiprocessing.dummy import Pool
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from tempfile import NamedTemporaryFile
|
from tempfile import NamedTemporaryFile
|
||||||
from typing import Any, Callable, Dict, List, Optional, Tuple, Union
|
from typing import Any, Callable
|
||||||
from urllib.parse import urljoin, urlparse
|
from urllib.parse import urljoin, urlparse
|
||||||
|
|
||||||
import git
|
import git
|
||||||
|
@ -94,7 +94,7 @@ def make_request(url: str, token=None) -> urllib.request.Request:
|
||||||
|
|
||||||
|
|
||||||
# a dictionary of plugins and their new repositories
|
# a dictionary of plugins and their new repositories
|
||||||
Redirects = Dict["PluginDesc", "Repo"]
|
Redirects = dict["PluginDesc", "Repo"]
|
||||||
|
|
||||||
|
|
||||||
class Repo:
|
class Repo:
|
||||||
|
@ -103,7 +103,7 @@ class Repo:
|
||||||
"""Url to the repo"""
|
"""Url to the repo"""
|
||||||
self._branch = branch
|
self._branch = branch
|
||||||
# Redirect is the new Repo to use
|
# Redirect is the new Repo to use
|
||||||
self.redirect: Optional["Repo"] = None
|
self.redirect: "Repo | None" = None
|
||||||
self.token = "dummy_token"
|
self.token = "dummy_token"
|
||||||
|
|
||||||
@property
|
@property
|
||||||
|
@ -125,14 +125,14 @@ class Repo:
|
||||||
return True
|
return True
|
||||||
|
|
||||||
@retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
|
@retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
|
||||||
def latest_commit(self) -> Tuple[str, datetime]:
|
def latest_commit(self) -> tuple[str, datetime]:
|
||||||
log.debug("Latest commit")
|
log.debug("Latest commit")
|
||||||
loaded = self._prefetch(None)
|
loaded = self._prefetch(None)
|
||||||
updated = datetime.strptime(loaded["date"], "%Y-%m-%dT%H:%M:%S%z")
|
updated = datetime.strptime(loaded["date"], "%Y-%m-%dT%H:%M:%S%z")
|
||||||
|
|
||||||
return loaded["rev"], updated
|
return loaded["rev"], updated
|
||||||
|
|
||||||
def _prefetch(self, ref: Optional[str]):
|
def _prefetch(self, ref: str | None):
|
||||||
cmd = ["nix-prefetch-git", "--quiet", "--fetch-submodules", self.uri]
|
cmd = ["nix-prefetch-git", "--quiet", "--fetch-submodules", self.uri]
|
||||||
if ref is not None:
|
if ref is not None:
|
||||||
cmd.append(ref)
|
cmd.append(ref)
|
||||||
|
@ -141,7 +141,7 @@ class Repo:
|
||||||
loaded = json.loads(data)
|
loaded = json.loads(data)
|
||||||
return loaded
|
return loaded
|
||||||
|
|
||||||
def prefetch(self, ref: Optional[str]) -> str:
|
def prefetch(self, ref: str | None) -> str:
|
||||||
log.info("Prefetching %s", self.uri)
|
log.info("Prefetching %s", self.uri)
|
||||||
loaded = self._prefetch(ref)
|
loaded = self._prefetch(ref)
|
||||||
return loaded["sha256"]
|
return loaded["sha256"]
|
||||||
|
@ -186,7 +186,7 @@ class RepoGitHub(Repo):
|
||||||
return True
|
return True
|
||||||
|
|
||||||
@retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
|
@retry(urllib.error.URLError, tries=4, delay=3, backoff=2)
|
||||||
def latest_commit(self) -> Tuple[str, datetime]:
|
def latest_commit(self) -> tuple[str, datetime]:
|
||||||
commit_url = self.url(f"commits/{self.branch}.atom")
|
commit_url = self.url(f"commits/{self.branch}.atom")
|
||||||
log.debug("Sending request to %s", commit_url)
|
log.debug("Sending request to %s", commit_url)
|
||||||
commit_req = make_request(commit_url, self.token)
|
commit_req = make_request(commit_url, self.token)
|
||||||
|
@ -252,14 +252,14 @@ class RepoGitHub(Repo):
|
||||||
class PluginDesc:
|
class PluginDesc:
|
||||||
repo: Repo
|
repo: Repo
|
||||||
branch: str
|
branch: str
|
||||||
alias: Optional[str]
|
alias: str | None
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def name(self):
|
def name(self):
|
||||||
return self.alias or self.repo.name
|
return self.alias or self.repo.name
|
||||||
|
|
||||||
@staticmethod
|
@staticmethod
|
||||||
def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> "PluginDesc":
|
def load_from_csv(config: FetchConfig, row: dict[str, str]) -> "PluginDesc":
|
||||||
log.debug("Loading row %s", row)
|
log.debug("Loading row %s", row)
|
||||||
branch = row["branch"]
|
branch = row["branch"]
|
||||||
repo = make_repo(row["repo"], branch.strip())
|
repo = make_repo(row["repo"], branch.strip())
|
||||||
|
@ -292,7 +292,7 @@ class Plugin:
|
||||||
commit: str
|
commit: str
|
||||||
has_submodules: bool
|
has_submodules: bool
|
||||||
sha256: str
|
sha256: str
|
||||||
date: Optional[datetime] = None
|
date: datetime | None = None
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def normalized_name(self) -> str:
|
def normalized_name(self) -> str:
|
||||||
|
@ -303,7 +303,7 @@ class Plugin:
|
||||||
assert self.date is not None
|
assert self.date is not None
|
||||||
return self.date.strftime("%Y-%m-%d")
|
return self.date.strftime("%Y-%m-%d")
|
||||||
|
|
||||||
def as_json(self) -> Dict[str, str]:
|
def as_json(self) -> dict[str, str]:
|
||||||
copy = self.__dict__.copy()
|
copy = self.__dict__.copy()
|
||||||
del copy["date"]
|
del copy["date"]
|
||||||
return copy
|
return copy
|
||||||
|
@ -312,7 +312,7 @@ class Plugin:
|
||||||
def load_plugins_from_csv(
|
def load_plugins_from_csv(
|
||||||
config: FetchConfig,
|
config: FetchConfig,
|
||||||
input_file: Path,
|
input_file: Path,
|
||||||
) -> List[PluginDesc]:
|
) -> list[PluginDesc]:
|
||||||
log.debug("Load plugins from csv %s", input_file)
|
log.debug("Load plugins from csv %s", input_file)
|
||||||
plugins = []
|
plugins = []
|
||||||
with open(input_file, newline="") as csvfile:
|
with open(input_file, newline="") as csvfile:
|
||||||
|
@ -359,10 +359,10 @@ class Editor:
|
||||||
name: str,
|
name: str,
|
||||||
root: Path,
|
root: Path,
|
||||||
get_plugins: str,
|
get_plugins: str,
|
||||||
default_in: Optional[Path] = None,
|
default_in: Path | None = None,
|
||||||
default_out: Optional[Path] = None,
|
default_out: Path | None = None,
|
||||||
deprecated: Optional[Path] = None,
|
deprecated: Path | None = None,
|
||||||
cache_file: Optional[str] = None,
|
cache_file: str | None = None,
|
||||||
):
|
):
|
||||||
log.debug("get_plugins:", get_plugins)
|
log.debug("get_plugins:", get_plugins)
|
||||||
self.name = name
|
self.name = name
|
||||||
|
@ -388,6 +388,19 @@ class Editor:
|
||||||
fetch_config, args.input_file, editor.deprecated, append=append
|
fetch_config, args.input_file, editor.deprecated, append=append
|
||||||
)
|
)
|
||||||
plugin, _ = prefetch_plugin(pdesc)
|
plugin, _ = prefetch_plugin(pdesc)
|
||||||
|
|
||||||
|
if ( # lua updater doesn't support updating individual plugin
|
||||||
|
self.name != "lua"
|
||||||
|
):
|
||||||
|
# update generated.nix
|
||||||
|
update = self.get_update(
|
||||||
|
args.input_file,
|
||||||
|
args.outfile,
|
||||||
|
fetch_config,
|
||||||
|
[plugin.normalized_name],
|
||||||
|
)
|
||||||
|
update()
|
||||||
|
|
||||||
autocommit = not args.no_commit
|
autocommit = not args.no_commit
|
||||||
if autocommit:
|
if autocommit:
|
||||||
commit(
|
commit(
|
||||||
|
@ -404,16 +417,35 @@ class Editor:
|
||||||
"""CSV spec"""
|
"""CSV spec"""
|
||||||
print("the update member function should be overridden in subclasses")
|
print("the update member function should be overridden in subclasses")
|
||||||
|
|
||||||
def get_current_plugins(self, nixpkgs: str) -> List[Plugin]:
|
def get_current_plugins(
|
||||||
|
self, config: FetchConfig, nixpkgs: str
|
||||||
|
) -> list[tuple[PluginDesc, Plugin]]:
|
||||||
"""To fill the cache"""
|
"""To fill the cache"""
|
||||||
data = run_nix_expr(self.get_plugins, nixpkgs)
|
data = run_nix_expr(self.get_plugins, nixpkgs)
|
||||||
plugins = []
|
plugins = []
|
||||||
for name, attr in data.items():
|
for name, attr in data.items():
|
||||||
p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"])
|
checksum = attr["checksum"]
|
||||||
plugins.append(p)
|
|
||||||
|
# https://github.com/NixOS/nixpkgs/blob/8a335419/pkgs/applications/editors/neovim/build-neovim-plugin.nix#L36
|
||||||
|
# https://github.com/NixOS/nixpkgs/pull/344478#discussion_r1786646055
|
||||||
|
version = re.search(r"\d\d\d\d-\d\d?-\d\d?", attr["version"])
|
||||||
|
if version is None:
|
||||||
|
raise ValueError(f"Cannot parse version: {attr['version']}")
|
||||||
|
date = datetime.strptime(version.group(), "%Y-%m-%d")
|
||||||
|
|
||||||
|
pdesc = PluginDesc.load_from_string(config, f'{attr["homePage"]} as {name}')
|
||||||
|
p = Plugin(
|
||||||
|
attr["pname"],
|
||||||
|
checksum["rev"],
|
||||||
|
checksum["submodules"],
|
||||||
|
checksum["sha256"],
|
||||||
|
date,
|
||||||
|
)
|
||||||
|
|
||||||
|
plugins.append((pdesc, p))
|
||||||
return plugins
|
return plugins
|
||||||
|
|
||||||
def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]:
|
def load_plugin_spec(self, config: FetchConfig, plugin_file) -> list[PluginDesc]:
|
||||||
"""CSV spec"""
|
"""CSV spec"""
|
||||||
return load_plugins_from_csv(config, plugin_file)
|
return load_plugins_from_csv(config, plugin_file)
|
||||||
|
|
||||||
|
@ -421,28 +453,115 @@ class Editor:
|
||||||
"""Returns nothing for now, writes directly to outfile"""
|
"""Returns nothing for now, writes directly to outfile"""
|
||||||
raise NotImplementedError()
|
raise NotImplementedError()
|
||||||
|
|
||||||
def get_update(self, input_file: str, outfile: str, config: FetchConfig):
|
def filter_plugins_to_update(
|
||||||
cache: Cache = Cache(self.get_current_plugins(self.nixpkgs), self.cache_file)
|
self, plugin: PluginDesc, to_update: list[str]
|
||||||
|
) -> bool:
|
||||||
|
"""Function for filtering out plugins, that user doesn't want to update.
|
||||||
|
|
||||||
|
It is mainly used for updating only specific plugins, not all of them.
|
||||||
|
By default it filters out plugins not present in `to_update`,
|
||||||
|
assuming `to_update` is a list of plugin names (the same as in the
|
||||||
|
result expression).
|
||||||
|
|
||||||
|
This function is never called if `to_update` is empty.
|
||||||
|
Feel free to override this function in derived classes.
|
||||||
|
|
||||||
|
Note:
|
||||||
|
Known bug: you have to use a deprecated name, instead of new one.
|
||||||
|
This is because we resolve deprecations later and can't get new
|
||||||
|
plugin URL before we request info about it.
|
||||||
|
|
||||||
|
Although, we could parse deprecated.json, but it's a whole bunch
|
||||||
|
of spaghetti code, which I don't want to write.
|
||||||
|
|
||||||
|
Arguments:
|
||||||
|
plugin: Plugin on which you decide whether to ignore or not.
|
||||||
|
to_update:
|
||||||
|
List of strings passed to via the `--update` command line parameter.
|
||||||
|
By default, we assume it is a list of URIs identical to what
|
||||||
|
is in the input file.
|
||||||
|
|
||||||
|
Returns:
|
||||||
|
True if we should update plugin and False if not.
|
||||||
|
"""
|
||||||
|
return plugin.name.replace(".", "-") in to_update
|
||||||
|
|
||||||
|
def get_update(
|
||||||
|
self,
|
||||||
|
input_file: str,
|
||||||
|
output_file: str,
|
||||||
|
config: FetchConfig,
|
||||||
|
to_update: list[str] | None,
|
||||||
|
):
|
||||||
|
if to_update is None:
|
||||||
|
to_update = []
|
||||||
|
|
||||||
|
current_plugins = self.get_current_plugins(config, self.nixpkgs)
|
||||||
|
current_plugin_specs = self.load_plugin_spec(config, input_file)
|
||||||
|
|
||||||
|
cache: Cache = Cache(
|
||||||
|
[plugin for _description, plugin in current_plugins], self.cache_file
|
||||||
|
)
|
||||||
_prefetch = functools.partial(prefetch, cache=cache)
|
_prefetch = functools.partial(prefetch, cache=cache)
|
||||||
|
|
||||||
def update() -> dict:
|
plugins_to_update = (
|
||||||
plugins = self.load_plugin_spec(config, input_file)
|
current_plugin_specs
|
||||||
|
if len(to_update) == 0
|
||||||
|
else [
|
||||||
|
description
|
||||||
|
for description in current_plugin_specs
|
||||||
|
if self.filter_plugins_to_update(description, to_update)
|
||||||
|
]
|
||||||
|
)
|
||||||
|
|
||||||
|
def update() -> Redirects:
|
||||||
|
if len(plugins_to_update) == 0:
|
||||||
|
log.error(
|
||||||
|
"\n\n\n\nIt seems like you provided some arguments to `--update`:\n"
|
||||||
|
+ ", ".join(to_update)
|
||||||
|
+ "\nBut after filtering, the result list of plugins is empty\n"
|
||||||
|
"\n"
|
||||||
|
"Are you sure you provided the same URIs as in your input file?\n"
|
||||||
|
"(" + str(input_file) + ")\n\n"
|
||||||
|
)
|
||||||
|
return {}
|
||||||
|
|
||||||
try:
|
try:
|
||||||
pool = Pool(processes=config.proc)
|
pool = Pool(processes=config.proc)
|
||||||
results = pool.map(_prefetch, plugins)
|
results = pool.map(_prefetch, plugins_to_update)
|
||||||
finally:
|
finally:
|
||||||
cache.store()
|
cache.store()
|
||||||
|
|
||||||
|
print(f"{len(results)} of {len(current_plugins)} were checked")
|
||||||
|
# Do only partial update of out file
|
||||||
|
if len(results) != len(current_plugins):
|
||||||
|
results = self.merge_results(current_plugins, results)
|
||||||
plugins, redirects = check_results(results)
|
plugins, redirects = check_results(results)
|
||||||
|
|
||||||
plugins = sorted(plugins, key=lambda v: v[1].normalized_name)
|
plugins = sorted(plugins, key=lambda v: v[1].normalized_name)
|
||||||
self.generate_nix(plugins, outfile)
|
self.generate_nix(plugins, output_file)
|
||||||
|
|
||||||
return redirects
|
return redirects
|
||||||
|
|
||||||
return update
|
return update
|
||||||
|
|
||||||
|
def merge_results(
|
||||||
|
self,
|
||||||
|
current: list[tuple[PluginDesc, Plugin]],
|
||||||
|
fetched: list[tuple[PluginDesc, Exception | Plugin, Repo | None]],
|
||||||
|
) -> list[tuple[PluginDesc, Exception | Plugin, Repo | None]]:
|
||||||
|
# transforming this to dict, so lookup is O(1) instead of O(n) (n is len(current))
|
||||||
|
result: dict[str, tuple[PluginDesc, Exception | Plugin, Repo | None]] = {
|
||||||
|
# also adding redirect (third item in the result tuple)
|
||||||
|
pl.normalized_name: (pdesc, pl, None)
|
||||||
|
for pdesc, pl in current
|
||||||
|
}
|
||||||
|
|
||||||
|
for plugin_desc, plugin, redirect in fetched:
|
||||||
|
result[plugin.normalized_name] = (plugin_desc, plugin, redirect)
|
||||||
|
|
||||||
|
return list(result.values())
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def attr_path(self):
|
def attr_path(self):
|
||||||
return self.name + "Plugins"
|
return self.name + "Plugins"
|
||||||
|
@ -544,6 +663,12 @@ class Editor:
|
||||||
description="Update all or a subset of existing plugins",
|
description="Update all or a subset of existing plugins",
|
||||||
add_help=False,
|
add_help=False,
|
||||||
)
|
)
|
||||||
|
pupdate.add_argument(
|
||||||
|
"update_only",
|
||||||
|
default=None,
|
||||||
|
nargs="*",
|
||||||
|
help="Plugin URLs to update (must be the same as in the input file)",
|
||||||
|
)
|
||||||
pupdate.set_defaults(func=self.update)
|
pupdate.set_defaults(func=self.update)
|
||||||
return main
|
return main
|
||||||
|
|
||||||
|
@ -587,8 +712,8 @@ class CleanEnvironment(object):
|
||||||
|
|
||||||
def prefetch_plugin(
|
def prefetch_plugin(
|
||||||
p: PluginDesc,
|
p: PluginDesc,
|
||||||
cache: "Optional[Cache]" = None,
|
cache: "Cache | None" = None,
|
||||||
) -> Tuple[Plugin, Optional[Repo]]:
|
) -> tuple[Plugin, Repo | None]:
|
||||||
commit = None
|
commit = None
|
||||||
log.info(f"Fetching last commit for plugin {p.name} from {p.repo.uri}@{p.branch}")
|
log.info(f"Fetching last commit for plugin {p.name} from {p.repo.uri}@{p.branch}")
|
||||||
commit, date = p.repo.latest_commit()
|
commit, date = p.repo.latest_commit()
|
||||||
|
@ -621,10 +746,10 @@ def print_download_error(plugin: PluginDesc, ex: Exception):
|
||||||
|
|
||||||
|
|
||||||
def check_results(
|
def check_results(
|
||||||
results: List[Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]],
|
results: list[tuple[PluginDesc, Exception | Plugin, Repo | None]],
|
||||||
) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]:
|
) -> tuple[list[tuple[PluginDesc, Plugin]], Redirects]:
|
||||||
""" """
|
""" """
|
||||||
failures: List[Tuple[PluginDesc, Exception]] = []
|
failures: list[tuple[PluginDesc, Exception]] = []
|
||||||
plugins = []
|
plugins = []
|
||||||
redirects: Redirects = {}
|
redirects: Redirects = {}
|
||||||
for pdesc, result, redirect in results:
|
for pdesc, result, redirect in results:
|
||||||
|
@ -637,11 +762,10 @@ def check_results(
|
||||||
new_pdesc = PluginDesc(redirect, pdesc.branch, pdesc.alias)
|
new_pdesc = PluginDesc(redirect, pdesc.branch, pdesc.alias)
|
||||||
plugins.append((new_pdesc, result))
|
plugins.append((new_pdesc, result))
|
||||||
|
|
||||||
print(f"{len(results) - len(failures)} plugins were checked", end="")
|
|
||||||
if len(failures) == 0:
|
if len(failures) == 0:
|
||||||
return plugins, redirects
|
return plugins, redirects
|
||||||
else:
|
else:
|
||||||
log.error(f", {len(failures)} plugin(s) could not be downloaded:\n")
|
log.error(f"{len(failures)} plugin(s) could not be downloaded:\n")
|
||||||
|
|
||||||
for plugin, exception in failures:
|
for plugin, exception in failures:
|
||||||
print_download_error(plugin, exception)
|
print_download_error(plugin, exception)
|
||||||
|
@ -661,7 +785,7 @@ def make_repo(uri: str, branch) -> Repo:
|
||||||
return repo
|
return repo
|
||||||
|
|
||||||
|
|
||||||
def get_cache_path(cache_file_name: str) -> Optional[Path]:
|
def get_cache_path(cache_file_name: str) -> Path | None:
|
||||||
xdg_cache = os.environ.get("XDG_CACHE_HOME", None)
|
xdg_cache = os.environ.get("XDG_CACHE_HOME", None)
|
||||||
if xdg_cache is None:
|
if xdg_cache is None:
|
||||||
home = os.environ.get("HOME", None)
|
home = os.environ.get("HOME", None)
|
||||||
|
@ -673,7 +797,7 @@ def get_cache_path(cache_file_name: str) -> Optional[Path]:
|
||||||
|
|
||||||
|
|
||||||
class Cache:
|
class Cache:
|
||||||
def __init__(self, initial_plugins: List[Plugin], cache_file_name: str) -> None:
|
def __init__(self, initial_plugins: list[Plugin], cache_file_name: str) -> None:
|
||||||
self.cache_file = get_cache_path(cache_file_name)
|
self.cache_file = get_cache_path(cache_file_name)
|
||||||
|
|
||||||
downloads = {}
|
downloads = {}
|
||||||
|
@ -682,11 +806,11 @@ class Cache:
|
||||||
downloads.update(self.load())
|
downloads.update(self.load())
|
||||||
self.downloads = downloads
|
self.downloads = downloads
|
||||||
|
|
||||||
def load(self) -> Dict[str, Plugin]:
|
def load(self) -> dict[str, Plugin]:
|
||||||
if self.cache_file is None or not self.cache_file.exists():
|
if self.cache_file is None or not self.cache_file.exists():
|
||||||
return {}
|
return {}
|
||||||
|
|
||||||
downloads: Dict[str, Plugin] = {}
|
downloads: dict[str, Plugin] = {}
|
||||||
with open(self.cache_file) as f:
|
with open(self.cache_file) as f:
|
||||||
data = json.load(f)
|
data = json.load(f)
|
||||||
for attr in data.values():
|
for attr in data.values():
|
||||||
|
@ -707,7 +831,7 @@ class Cache:
|
||||||
data[name] = attr.as_json()
|
data[name] = attr.as_json()
|
||||||
json.dump(data, f, indent=4, sort_keys=True)
|
json.dump(data, f, indent=4, sort_keys=True)
|
||||||
|
|
||||||
def __getitem__(self, key: str) -> Optional[Plugin]:
|
def __getitem__(self, key: str) -> Plugin | None:
|
||||||
return self.downloads.get(key, None)
|
return self.downloads.get(key, None)
|
||||||
|
|
||||||
def __setitem__(self, key: str, value: Plugin) -> None:
|
def __setitem__(self, key: str, value: Plugin) -> None:
|
||||||
|
@ -716,7 +840,7 @@ class Cache:
|
||||||
|
|
||||||
def prefetch(
|
def prefetch(
|
||||||
pluginDesc: PluginDesc, cache: Cache
|
pluginDesc: PluginDesc, cache: Cache
|
||||||
) -> Tuple[PluginDesc, Union[Exception, Plugin], Optional[Repo]]:
|
) -> tuple[PluginDesc, Exception | Plugin, Repo | None]:
|
||||||
try:
|
try:
|
||||||
plugin, redirect = prefetch_plugin(pluginDesc, cache)
|
plugin, redirect = prefetch_plugin(pluginDesc, cache)
|
||||||
cache[plugin.commit] = plugin
|
cache[plugin.commit] = plugin
|
||||||
|
@ -731,7 +855,7 @@ def rewrite_input(
|
||||||
deprecated: Path,
|
deprecated: Path,
|
||||||
# old pluginDesc and the new
|
# old pluginDesc and the new
|
||||||
redirects: Redirects = {},
|
redirects: Redirects = {},
|
||||||
append: List[PluginDesc] = [],
|
append: list[PluginDesc] = [],
|
||||||
):
|
):
|
||||||
log.info("Rewriting input file %s", input_file)
|
log.info("Rewriting input file %s", input_file)
|
||||||
plugins = load_plugins_from_csv(config, input_file)
|
plugins = load_plugins_from_csv(config, input_file)
|
||||||
|
@ -779,7 +903,7 @@ def rewrite_input(
|
||||||
writer.writerow(asdict(plugin))
|
writer.writerow(asdict(plugin))
|
||||||
|
|
||||||
|
|
||||||
def commit(repo: git.Repo, message: str, files: List[Path]) -> None:
|
def commit(repo: git.Repo, message: str, files: list[Path]) -> None:
|
||||||
repo.index.add([str(f.resolve()) for f in files])
|
repo.index.add([str(f.resolve()) for f in files])
|
||||||
|
|
||||||
if repo.index.diff("HEAD"):
|
if repo.index.diff("HEAD"):
|
||||||
|
@ -802,7 +926,14 @@ def update_plugins(editor: Editor, args):
|
||||||
)
|
)
|
||||||
|
|
||||||
fetch_config = FetchConfig(args.proc, args.github_token)
|
fetch_config = FetchConfig(args.proc, args.github_token)
|
||||||
update = editor.get_update(args.input_file, args.outfile, fetch_config)
|
update = editor.get_update(
|
||||||
|
input_file=args.input_file,
|
||||||
|
output_file=args.outfile,
|
||||||
|
config=fetch_config,
|
||||||
|
to_update=getattr( # if script was called without arguments
|
||||||
|
args, "update_only", None
|
||||||
|
),
|
||||||
|
)
|
||||||
|
|
||||||
start_time = time.time()
|
start_time = time.time()
|
||||||
redirects = update()
|
redirects = update()
|
||||||
|
|
|
@ -440,7 +440,6 @@ with lib.maintainers;
|
||||||
hlolli
|
hlolli
|
||||||
glittershark
|
glittershark
|
||||||
ericdallo
|
ericdallo
|
||||||
thiagokokada
|
|
||||||
];
|
];
|
||||||
scope = "Maintain GraalVM Community Edition packages.";
|
scope = "Maintain GraalVM Community Edition packages.";
|
||||||
shortName = "GraalVM-CE";
|
shortName = "GraalVM-CE";
|
||||||
|
@ -576,6 +575,7 @@ with lib.maintainers;
|
||||||
members = [
|
members = [
|
||||||
aanderse
|
aanderse
|
||||||
edwtjo
|
edwtjo
|
||||||
|
hrdinka
|
||||||
thiagokokada
|
thiagokokada
|
||||||
];
|
];
|
||||||
scope = "Maintain Libretro, RetroArch and related packages.";
|
scope = "Maintain Libretro, RetroArch and related packages.";
|
||||||
|
|
|
@ -399,6 +399,23 @@ Composed types are types that take a type as parameter. `listOf
|
||||||
returned instead for the same `mkIf false` definition.
|
returned instead for the same `mkIf false` definition.
|
||||||
:::
|
:::
|
||||||
|
|
||||||
|
`types.attrsWith` { *`elemType`*, *`lazy`* ? false }
|
||||||
|
|
||||||
|
: An attribute set of where all the values are of *`elemType`* type.
|
||||||
|
|
||||||
|
**Parameters**
|
||||||
|
|
||||||
|
`elemType` (Required)
|
||||||
|
: Specifies the type of the values contained in the attribute set.
|
||||||
|
|
||||||
|
`lazy`
|
||||||
|
: Determines whether the attribute set is lazily evaluated. See: `types.lazyAttrsOf`
|
||||||
|
|
||||||
|
**Behavior**
|
||||||
|
|
||||||
|
- `attrsWith { elemType = t; }` is equivalent to `attrsOf t`
|
||||||
|
- `attrsWith { lazy = true; elemType = t; }` is equivalent to `lazyAttrsOf t`
|
||||||
|
|
||||||
`types.uniq` *`t`*
|
`types.uniq` *`t`*
|
||||||
|
|
||||||
: Ensures that type *`t`* cannot be merged. It is used to ensure option
|
: Ensures that type *`t`* cannot be merged. It is used to ensure option
|
||||||
|
|
|
@ -160,6 +160,18 @@ The first steps to all these are the same:
|
||||||
Refer to the `nixos-generate-config` step in
|
Refer to the `nixos-generate-config` step in
|
||||||
[](#sec-installation) for more information.
|
[](#sec-installation) for more information.
|
||||||
|
|
||||||
|
::: {.note}
|
||||||
|
On [UEFI](https://en.wikipedia.org/wiki/UEFI) systems, check that your `/etc/nixos/hardware-configuration.nix` did the right thing with the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition).
|
||||||
|
In NixOS, by default, both [systemd-boot](https://systemd.io/BOOT/) and [grub](https://www.gnu.org/software/grub/index.html) expect it to be mounted on `/boot`.
|
||||||
|
However, the configuration generator bases its [](#opt-fileSystems) configuration on the current mount points at the time it is run.
|
||||||
|
If the current system and NixOS's bootloader configuration don't agree on where the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition) is to be mounted, you'll need to manually alter the mount point in `hardware-configuration.nix` before building the system closure.
|
||||||
|
:::
|
||||||
|
|
||||||
|
::: {.note}
|
||||||
|
The lustrate process will not work if the [](#opt-boot.initrd.systemd.enable) option is set to `true`.
|
||||||
|
If you want to use this option, wait until after the first boot into the NixOS system to enable it and rebuild.
|
||||||
|
:::
|
||||||
|
|
||||||
You'll likely want to set a root password for your first boot using
|
You'll likely want to set a root password for your first boot using
|
||||||
the configuration files because you won't have a chance to enter a
|
the configuration files because you won't have a chance to enter a
|
||||||
password until after you reboot. You can initialize the root password
|
password until after you reboot. You can initialize the root password
|
||||||
|
@ -231,26 +243,46 @@ The first steps to all these are the same:
|
||||||
$ echo etc/nixos | sudo tee -a /etc/NIXOS_LUSTRATE
|
$ echo etc/nixos | sudo tee -a /etc/NIXOS_LUSTRATE
|
||||||
```
|
```
|
||||||
|
|
||||||
1. Finally, move the `/boot` directory of your current distribution out
|
1. Finally, install NixOS's boot system, backing up the current boot system's files in the process.
|
||||||
of the way (the lustrate process will take care of the rest once you
|
|
||||||
reboot, but this one must be moved out now because NixOS needs to
|
The details of this step can vary depending on the bootloader configuration in NixOS and the bootloader in use by the current system.
|
||||||
install its own boot files:
|
|
||||||
|
The commands below should work for:
|
||||||
|
|
||||||
|
- [BIOS](https://en.wikipedia.org/wiki/BIOS) systems.
|
||||||
|
|
||||||
|
- [UEFI](https://en.wikipedia.org/wiki/UEFI) systems where both the current system and NixOS mount the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition) on `/boot`.
|
||||||
|
Both [systemd-boot](https://systemd.io/BOOT/) and [grub](https://www.gnu.org/software/grub/index.html) expect this by default in NixOS, but other distributions vary.
|
||||||
|
|
||||||
::: {.warning}
|
::: {.warning}
|
||||||
Once you complete this step, your current distribution will no
|
Once you complete this step, your current distribution will no longer be bootable!
|
||||||
longer be bootable! If you didn't get all the NixOS configuration
|
If you didn't get all the NixOS configuration right, especially those settings pertaining to boot loading and root partition, NixOS may not be bootable either.
|
||||||
right, especially those settings pertaining to boot loading and root
|
Have a USB rescue device ready in case this happens.
|
||||||
partition, NixOS may not be bootable either. Have a USB rescue
|
:::
|
||||||
device ready in case this happens.
|
|
||||||
|
::: {.warning}
|
||||||
|
On [UEFI](https://en.wikipedia.org/wiki/UEFI) systems, anything on the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition) will be removed by these commands, such as other coexisting OS's bootloaders.
|
||||||
:::
|
:::
|
||||||
|
|
||||||
```ShellSession
|
```ShellSession
|
||||||
$ sudo mv -v /boot /boot.bak &&
|
$ sudo mkdir /boot.bak && sudo mv /boot/* /boot.bak &&
|
||||||
sudo /nix/var/nix/profiles/system/bin/switch-to-configuration boot
|
sudo NIXOS_INSTALL_BOOTLOADER=1 /nix/var/nix/profiles/system/bin/switch-to-configuration boot
|
||||||
```
|
```
|
||||||
|
|
||||||
Cross your fingers, reboot, hopefully you should get a NixOS prompt!
|
Cross your fingers, reboot, hopefully you should get a NixOS prompt!
|
||||||
|
|
||||||
|
In other cases, most commonly where the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition) of the current system is instead mounted on `/boot/efi`, the goal is to:
|
||||||
|
|
||||||
|
- Make sure `/boot` (and the [EFI System Partition](https://en.wikipedia.org/wiki/EFI_system_partition), if mounted elsewhere) are mounted how the NixOS configuration would mount them.
|
||||||
|
|
||||||
|
- Clear them of files related to the current system, backing them up outside of `/boot`.
|
||||||
|
NixOS will move the backups into `/old-root` along with everything else when it first boots.
|
||||||
|
|
||||||
|
- Instruct the NixOS closure built earlier to install its bootloader with:
|
||||||
|
```ShellSession
|
||||||
|
sudo NIXOS_INSTALL_BOOTLOADER=1 /nix/var/nix/profiles/system/bin/switch-to-configuration boot
|
||||||
|
```
|
||||||
|
|
||||||
1. If for some reason you want to revert to the old distribution,
|
1. If for some reason you want to revert to the old distribution,
|
||||||
you'll need to boot on a USB rescue disk and do something along
|
you'll need to boot on a USB rescue disk and do something along
|
||||||
these lines:
|
these lines:
|
||||||
|
|
|
@ -6,7 +6,7 @@ expressions and associated binaries. The NixOS channels are updated
|
||||||
automatically from NixOS's Git repository after certain tests have
|
automatically from NixOS's Git repository after certain tests have
|
||||||
passed and all packages have been built. These channels are:
|
passed and all packages have been built. These channels are:
|
||||||
|
|
||||||
- *Stable channels*, such as [`nixos-24.05`](https://channels.nixos.org/nixos-24.05).
|
- *Stable channels*, such as [`nixos-24.11`](https://channels.nixos.org/nixos-24.11).
|
||||||
These only get conservative bug fixes and package upgrades. For
|
These only get conservative bug fixes and package upgrades. For
|
||||||
instance, a channel update may cause the Linux kernel on your system
|
instance, a channel update may cause the Linux kernel on your system
|
||||||
to be upgraded from 4.19.34 to 4.19.38 (a minor bug fix), but not
|
to be upgraded from 4.19.34 to 4.19.38 (a minor bug fix), but not
|
||||||
|
@ -19,7 +19,7 @@ passed and all packages have been built. These channels are:
|
||||||
radical changes between channel updates. It's not recommended for
|
radical changes between channel updates. It's not recommended for
|
||||||
production systems.
|
production systems.
|
||||||
|
|
||||||
- *Small channels*, such as [`nixos-24.05-small`](https://channels.nixos.org/nixos-24.05-small)
|
- *Small channels*, such as [`nixos-24.11-small`](https://channels.nixos.org/nixos-24.11-small)
|
||||||
or [`nixos-unstable-small`](https://channels.nixos.org/nixos-unstable-small).
|
or [`nixos-unstable-small`](https://channels.nixos.org/nixos-unstable-small).
|
||||||
These are identical to the stable and unstable channels described above,
|
These are identical to the stable and unstable channels described above,
|
||||||
except that they contain fewer binary packages. This means they get updated
|
except that they contain fewer binary packages. This means they get updated
|
||||||
|
@ -38,8 +38,8 @@ supported stable release.
|
||||||
|
|
||||||
When you first install NixOS, you're automatically subscribed to the
|
When you first install NixOS, you're automatically subscribed to the
|
||||||
NixOS channel that corresponds to your installation source. For
|
NixOS channel that corresponds to your installation source. For
|
||||||
instance, if you installed from a 24.05 ISO, you will be subscribed to
|
instance, if you installed from a 24.11 ISO, you will be subscribed to
|
||||||
the `nixos-24.05` channel. To see which NixOS channel you're subscribed
|
the `nixos-24.11` channel. To see which NixOS channel you're subscribed
|
||||||
to, run the following as root:
|
to, run the following as root:
|
||||||
|
|
||||||
```ShellSession
|
```ShellSession
|
||||||
|
@ -54,16 +54,16 @@ To switch to a different NixOS channel, do
|
||||||
```
|
```
|
||||||
|
|
||||||
(Be sure to include the `nixos` parameter at the end.) For instance, to
|
(Be sure to include the `nixos` parameter at the end.) For instance, to
|
||||||
use the NixOS 24.05 stable channel:
|
use the NixOS 24.11 stable channel:
|
||||||
|
|
||||||
```ShellSession
|
```ShellSession
|
||||||
# nix-channel --add https://channels.nixos.org/nixos-24.05 nixos
|
# nix-channel --add https://channels.nixos.org/nixos-24.11 nixos
|
||||||
```
|
```
|
||||||
|
|
||||||
If you have a server, you may want to use the "small" channel instead:
|
If you have a server, you may want to use the "small" channel instead:
|
||||||
|
|
||||||
```ShellSession
|
```ShellSession
|
||||||
# nix-channel --add https://channels.nixos.org/nixos-24.05-small nixos
|
# nix-channel --add https://channels.nixos.org/nixos-24.11-small nixos
|
||||||
```
|
```
|
||||||
|
|
||||||
And if you want to live on the bleeding edge:
|
And if you want to live on the bleeding edge:
|
||||||
|
@ -117,6 +117,6 @@ modules. You can also specify a channel explicitly, e.g.
|
||||||
|
|
||||||
```nix
|
```nix
|
||||||
{
|
{
|
||||||
system.autoUpgrade.channel = "https://channels.nixos.org/nixos-24.05";
|
system.autoUpgrade.channel = "https://channels.nixos.org/nixos-24.11";
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
|
@ -1868,6 +1868,21 @@
|
||||||
"sec-release-24.11-migration-dto-compatible": [
|
"sec-release-24.11-migration-dto-compatible": [
|
||||||
"release-notes.html#sec-release-24.11-migration-dto-compatible"
|
"release-notes.html#sec-release-24.11-migration-dto-compatible"
|
||||||
],
|
],
|
||||||
|
"sec-release-24.11-wiki": [
|
||||||
|
"release-notes.html#sec-release-24.11-wiki"
|
||||||
|
],
|
||||||
|
"sec-release-24.11-lib": [
|
||||||
|
"release-notes.html#sec-release-24.11-lib"
|
||||||
|
],
|
||||||
|
"sec-release-24.11-lib-breaking": [
|
||||||
|
"release-notes.html#sec-release-24.11-lib-breaking"
|
||||||
|
],
|
||||||
|
"sec-release-24.11-lib-additions-improvements": [
|
||||||
|
"release-notes.html#sec-release-24.11-lib-additions-improvements"
|
||||||
|
],
|
||||||
|
"sec-release-24.11-lib-deprecations": [
|
||||||
|
"release-notes.html#sec-release-24.11-lib-deprecations"
|
||||||
|
],
|
||||||
"sec-release-24.05": [
|
"sec-release-24.05": [
|
||||||
"release-notes.html#sec-release-24.05"
|
"release-notes.html#sec-release-24.05"
|
||||||
],
|
],
|
||||||
|
|
|
@ -1,14 +1,9 @@
|
||||||
# Release 24.11 (“Vicuña”, 2024.11/??) {#sec-release-24.11}
|
# Release 24.11 (“Vicuña”, 2024.11/28) {#sec-release-24.11}
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
## Highlights {#sec-release-24.11-highlights}
|
## Highlights {#sec-release-24.11-highlights}
|
||||||
|
|
||||||
- **This will be the last release of Nixpkgs to support macOS Sierra 10.12 to macOS Catalina 10.15.**
|
|
||||||
Starting with release 25.05, the minimum supported version will be macOS Big Sur 11, and we cannot guarantee that packages will continue to work on older versions of macOS.
|
|
||||||
Users on old macOS versions should consider upgrading to a supported version (potentially using [OpenCore Legacy Patcher](https://dortania.github.io/OpenCore-Legacy-Patcher/) for old hardware) or installing NixOS.
|
|
||||||
If neither of those options are viable and you require new versions of software, [MacPorts](https://www.macports.org/) supports versions back to Mac OS X Snow Leopard 10.6.
|
|
||||||
|
|
||||||
- Nix was updated to 2.24, which brings a lot of improvements and fixes. See the release notes for
|
- Nix was updated to 2.24, which brings a lot of improvements and fixes. See the release notes for
|
||||||
[2.19](https://nix.dev/manual/nix/latest/release-notes/rl-2.19),
|
[2.19](https://nix.dev/manual/nix/latest/release-notes/rl-2.19),
|
||||||
[2.20](https://nix.dev/manual/nix/latest/release-notes/rl-2.20),
|
[2.20](https://nix.dev/manual/nix/latest/release-notes/rl-2.20),
|
||||||
|
@ -18,6 +13,16 @@
|
||||||
[2.24](https://nix.dev/manual/nix/latest/release-notes/rl-2.24).
|
[2.24](https://nix.dev/manual/nix/latest/release-notes/rl-2.24).
|
||||||
Notable changes include improvements to Git fetching, documentation comment support in `nix-repl> :doc`, as well as many quality of life additions.
|
Notable changes include improvements to Git fetching, documentation comment support in `nix-repl> :doc`, as well as many quality of life additions.
|
||||||
|
|
||||||
|
- There have been significant changes to macOS support.
|
||||||
|
- The build environment has been redesigned to be closer to a native Xcode toolchain, enabling us to provide all SDKs from macOS Sierra 10.12 to macOS Sequoia 15, simplify build definitions, and build more software without hacks or patching.
|
||||||
|
Although compatibility shims for the old SDK scheme are provided, some builds may break, and the old mechanisms will be removed by 25.11 at the latest.
|
||||||
|
See the [Darwin section](https://nixos.org/manual/nixpkgs/stable/#sec-darwin) of the Nixpkgs manual for details of the new scheme and how to use it, and [the announcement on Discourse](https://discourse.nixos.org/t/the-darwin-sdks-have-been-updated/55295) for more information on the changes and benefits.
|
||||||
|
|
||||||
|
- **This will be the last release of Nixpkgs to support macOS Sierra 10.12 to macOS Catalina 10.15.**
|
||||||
|
Starting with release 25.05, the minimum supported version will be macOS Big Sur 11, and we cannot guarantee that packages will continue to work on older versions of macOS.
|
||||||
|
Users on old macOS versions should consider upgrading to a supported version (potentially using [OpenCore Legacy Patcher](https://dortania.github.io/OpenCore-Legacy-Patcher/) for old hardware) or installing NixOS.
|
||||||
|
If neither of those options are viable and you require new versions of software, [MacPorts](https://www.macports.org/) supports versions back to Mac OS X Snow Leopard 10.6.
|
||||||
|
|
||||||
- This will be the last release of Nixpkgs to support versions of CUDA prior to CUDA 12.0.
|
- This will be the last release of Nixpkgs to support versions of CUDA prior to CUDA 12.0.
|
||||||
These versions only work with old compiler versions that will be unsupported by the time of the Nixpkgs 25.05 release.
|
These versions only work with old compiler versions that will be unsupported by the time of the Nixpkgs 25.05 release.
|
||||||
In the future, users should expect CUDA versions to be dropped as the compiler versions they require leave upstream support windows.
|
In the future, users should expect CUDA versions to be dropped as the compiler versions they require leave upstream support windows.
|
||||||
|
@ -29,6 +34,9 @@
|
||||||
|
|
||||||
- The `moonlight-qt` package (for [Moonlight game streaming](https://moonlight-stream.org/)) now has HDR support on Linux systems.
|
- The `moonlight-qt` package (for [Moonlight game streaming](https://moonlight-stream.org/)) now has HDR support on Linux systems.
|
||||||
|
|
||||||
|
- [Sched-ext](https://github.com/sched-ext/scx), a Linux kernel feature to run schedulers in userspace, is now available [`services.scx`](options.html#opt-services.scx.enable).
|
||||||
|
Requires Linux kernel version 6.12 or later.
|
||||||
|
|
||||||
- PostgreSQL now defaults to major version 16.
|
- PostgreSQL now defaults to major version 16.
|
||||||
|
|
||||||
- GNOME has been updated to version 47. Refer to the [release notes](https://release.gnome.org/47/) for more details.
|
- GNOME has been updated to version 47. Refer to the [release notes](https://release.gnome.org/47/) for more details.
|
||||||
|
@ -36,6 +44,8 @@
|
||||||
- `authelia` has been upgraded to version 4.38. This version brings several features and improvements which are detailed in the [release blog post](https://www.authelia.com/blog/4.38-release-notes/).
|
- `authelia` has been upgraded to version 4.38. This version brings several features and improvements which are detailed in the [release blog post](https://www.authelia.com/blog/4.38-release-notes/).
|
||||||
This release also deprecates some configuration keys which are likely to be removed in version 5.0.0.
|
This release also deprecates some configuration keys which are likely to be removed in version 5.0.0.
|
||||||
|
|
||||||
|
- `netbird` has been updated to 0.31.1. This adds a built-in relay server which is not yet supported by the NixOS module, as well as a metrics endpoint for both the management and signal services. The default metrics port for the `signal` service has been changed from `9090` to `9091` to prevent a port conflict with the management server. This can be changed with their respective `metricsPort` as needed. Refer to the [release notes](https://github.com/netbirdio/netbird/releases/tag/v0.31.1) and [this pull request](https://github.com/NixOS/nixpkgs/pull/354032#issuecomment-2480925927) for more information.
|
||||||
|
|
||||||
- `compressDrv` can compress selected files in a derivation. `compressDrvWeb` compresses files for common web server usage (`.gz` with `zopfli`, `.br` with `brotli`).
|
- `compressDrv` can compress selected files in a derivation. `compressDrvWeb` compresses files for common web server usage (`.gz` with `zopfli`, `.br` with `brotli`).
|
||||||
|
|
||||||
- [`hardware.display`](#opt-hardware.display.edid.enable) is a new module implementing workarounds for misbehaving monitors
|
- [`hardware.display`](#opt-hardware.display.edid.enable) is a new module implementing workarounds for misbehaving monitors
|
||||||
|
@ -77,6 +87,8 @@
|
||||||
|
|
||||||
## New Modules {#sec-release-24.11-new-modules}
|
## New Modules {#sec-release-24.11-new-modules}
|
||||||
|
|
||||||
|
- [Coral](https://coral.ai/), hardware support for Coral.ai Edge TPU devices. Available as [hardware.coral.usb.enable](#opt-hardware.coral.usb.enable) and [hardware.coral.pcie.enable](#opt-hardware.coral.pcie.enable).
|
||||||
|
|
||||||
- [Cyrus IMAP](https://github.com/cyrusimap/cyrus-imapd), an email, contacts and calendar server. Available as [services.cyrus-imap](#opt-services.cyrus-imap.enable) service.
|
- [Cyrus IMAP](https://github.com/cyrusimap/cyrus-imapd), an email, contacts and calendar server. Available as [services.cyrus-imap](#opt-services.cyrus-imap.enable) service.
|
||||||
|
|
||||||
- [TaskChampion Sync-Server](https://github.com/GothenburgBitFactory/taskchampion-sync-server), a [Taskwarrior 3](https://taskwarrior.org/docs/upgrade-3/) sync server. Available as [services.taskchampion-sync-server](#opt-services.taskchampion-sync-server.enable).
|
- [TaskChampion Sync-Server](https://github.com/GothenburgBitFactory/taskchampion-sync-server), a [Taskwarrior 3](https://taskwarrior.org/docs/upgrade-3/) sync server. Available as [services.taskchampion-sync-server](#opt-services.taskchampion-sync-server.enable).
|
||||||
|
@ -85,7 +97,7 @@
|
||||||
|
|
||||||
- [Gancio](https://gancio.org/), a shared agenda for local communities. Available as [services.gancio](#opt-services.gancio.enable).
|
- [Gancio](https://gancio.org/), a shared agenda for local communities. Available as [services.gancio](#opt-services.gancio.enable).
|
||||||
|
|
||||||
- [Goatcounter](https://www.goatcounter.com/), an easy web analytics platform with no tracking of personal data. Available as [services.goatcounter](options.html#opt-services.goatcocunter.enable).
|
- [Goatcounter](https://www.goatcounter.com/), an easy web analytics platform with no tracking of personal data. Available as [services.goatcounter](options.html#opt-services.goatcounter.enable).
|
||||||
|
|
||||||
- [Privatebin](https://github.com/PrivateBin/PrivateBin/), a minimalist, open source online pastebin where the server has zero knowledge of pasted data. Available as [services.privatebin](#opt-services.privatebin.enable).
|
- [Privatebin](https://github.com/PrivateBin/PrivateBin/), a minimalist, open source online pastebin where the server has zero knowledge of pasted data. Available as [services.privatebin](#opt-services.privatebin.enable).
|
||||||
|
|
||||||
|
@ -123,6 +135,8 @@
|
||||||
|
|
||||||
- [Radicle](https://radicle.xyz), an open source, peer-to-peer code collaboration stack built on Git. Available as [services.radicle](#opt-services.radicle.enable).
|
- [Radicle](https://radicle.xyz), an open source, peer-to-peer code collaboration stack built on Git. Available as [services.radicle](#opt-services.radicle.enable).
|
||||||
|
|
||||||
|
- [Ordinal](https://github.com/snu-sf/Ordinal), A library for ordinal numbers in the Coq proof assistant.
|
||||||
|
|
||||||
- [ddns-updater](https://github.com/qdm12/ddns-updater), a service with a WebUI to update DNS records periodically for many providers. Available as [services.ddns-updater](#opt-services.ddns-updater.enable).
|
- [ddns-updater](https://github.com/qdm12/ddns-updater), a service with a WebUI to update DNS records periodically for many providers. Available as [services.ddns-updater](#opt-services.ddns-updater.enable).
|
||||||
|
|
||||||
- [Immersed](https://immersed.com/), a closed-source coworking platform. Available as [programs.immersed](#opt-programs.immersed.enable).
|
- [Immersed](https://immersed.com/), a closed-source coworking platform. Available as [programs.immersed](#opt-programs.immersed.enable).
|
||||||
|
@ -139,8 +153,6 @@
|
||||||
|
|
||||||
- [zeronsd](https://github.com/zerotier/zeronsd), a DNS server for ZeroTier users. Available with [services.zeronsd.servedNetworks](#opt-services.zeronsd.servedNetworks).
|
- [zeronsd](https://github.com/zerotier/zeronsd), a DNS server for ZeroTier users. Available with [services.zeronsd.servedNetworks](#opt-services.zeronsd.servedNetworks).
|
||||||
|
|
||||||
- [agorakit](https://github.com/agorakit/agorakit), an organization tool for citizens' collectives. Available with [services.agorakit](#opt-services.agorakit.enable).
|
|
||||||
|
|
||||||
- [Collabora Online](https://www.collaboraonline.com/), a collaborative online office suite based on LibreOffice technology. Available as [services.collabora-online](options.html#opt-services.collabora-online.enable).
|
- [Collabora Online](https://www.collaboraonline.com/), a collaborative online office suite based on LibreOffice technology. Available as [services.collabora-online](options.html#opt-services.collabora-online.enable).
|
||||||
|
|
||||||
- [wg-access-server](https://github.com/freifunkMUC/wg-access-server/), an all-in-one WireGuard VPN solution with a WebUI for connecting devices. Available as [services.wg-access-server](#opt-services.wg-access-server.enable).
|
- [wg-access-server](https://github.com/freifunkMUC/wg-access-server/), an all-in-one WireGuard VPN solution with a WebUI for connecting devices. Available as [services.wg-access-server](#opt-services.wg-access-server.enable).
|
||||||
|
@ -432,6 +444,9 @@
|
||||||
|
|
||||||
- `gitea` no longer supports the opt-in feature [PAM (Pluggable Authentication Module)](https://docs.gitea.com/usage/authentication#pam-pluggable-authentication-module).
|
- `gitea` no longer supports the opt-in feature [PAM (Pluggable Authentication Module)](https://docs.gitea.com/usage/authentication#pam-pluggable-authentication-module).
|
||||||
|
|
||||||
|
- `vuze` was removed because it is unmaintained upstream and insecure (CVE-2018-13417).
|
||||||
|
BiglyBT is a maintained fork.
|
||||||
|
|
||||||
- `services.ddclient.use` has been deprecated: `ddclient` now supports separate IPv4 and IPv6 configuration. Use `services.ddclient.usev4` and `services.ddclient.usev6` instead.
|
- `services.ddclient.use` has been deprecated: `ddclient` now supports separate IPv4 and IPv6 configuration. Use `services.ddclient.usev4` and `services.ddclient.usev6` instead.
|
||||||
|
|
||||||
- `services.pgbouncer` systemd service is now configured with `Type=notify-reload` and allows reloading configuration without process restart. PgBouncer configuration options were moved to the freeform type option under [`services.pgbouncer.settings`](#opt-services.pgbouncer.settings).
|
- `services.pgbouncer` systemd service is now configured with `Type=notify-reload` and allows reloading configuration without process restart. PgBouncer configuration options were moved to the freeform type option under [`services.pgbouncer.settings`](#opt-services.pgbouncer.settings).
|
||||||
|
@ -734,7 +749,6 @@
|
||||||
- The `atlassian-crowd` package and its `services.crowd` NixOS module
|
- The `atlassian-crowd` package and its `services.crowd` NixOS module
|
||||||
- The `atlassian-jira` package and its `services.jira` NixOS module
|
- The `atlassian-jira` package and its `services.jira` NixOS module
|
||||||
|
|
||||||
|
|
||||||
- `python3Packages.nose` has been removed, as it has been deprecated and unmaintained for almost a decade and does not work on Python 3.12.
|
- `python3Packages.nose` has been removed, as it has been deprecated and unmaintained for almost a decade and does not work on Python 3.12.
|
||||||
Please switch to `pytest` or another test runner/framework.
|
Please switch to `pytest` or another test runner/framework.
|
||||||
|
|
||||||
|
@ -752,6 +766,8 @@
|
||||||
rather than dotnet 6. For packages that still need dotnet 6, use
|
rather than dotnet 6. For packages that still need dotnet 6, use
|
||||||
`dotnet-sdk_6`, etc.
|
`dotnet-sdk_6`, etc.
|
||||||
|
|
||||||
|
- torq has been removed because upstreamed went closed source.
|
||||||
|
|
||||||
## Other Notable Changes {#sec-release-24.11-notable-changes}
|
## Other Notable Changes {#sec-release-24.11-notable-changes}
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
@ -781,10 +797,6 @@
|
||||||
not the `hare` package, should be added to `nativeBuildInputs` when building
|
not the `hare` package, should be added to `nativeBuildInputs` when building
|
||||||
Hare programs.
|
Hare programs.
|
||||||
|
|
||||||
- [`lib.options.mkPackageOptionMD`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.options.mkPackageOptionMD) is now obsolete; use the identical [`lib.options.mkPackageOption`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.options.mkPackageOption) instead.
|
|
||||||
|
|
||||||
- `lib.misc.mapAttrsFlatten` is now formally deprecated and will be removed in future releases; use the identical [`lib.attrsets.mapAttrsToList`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.attrsets.mapAttrsToList) instead.
|
|
||||||
|
|
||||||
- `virtualisation.docker.liveRestore` has been renamed to `virtualisation.docker.daemon.settings."live-restore"` and turned off by default for state versions of at least 24.11.
|
- `virtualisation.docker.liveRestore` has been renamed to `virtualisation.docker.daemon.settings."live-restore"` and turned off by default for state versions of at least 24.11.
|
||||||
|
|
||||||
- Tailscale's `authKeyFile` can now have its corresponding parameters set through `config.services.tailscale.authKeyParameters`, allowing for non-ephemeral unsupervised deployment and more.
|
- Tailscale's `authKeyFile` can now have its corresponding parameters set through `config.services.tailscale.authKeyParameters`, allowing for non-ephemeral unsupervised deployment and more.
|
||||||
|
@ -808,6 +820,8 @@
|
||||||
Note that first solution of the [official FAQ answer](https://cloud.seatable.io/dtable/external-links/7b976c85f504491cbe8e/?tid=0000&vid=0000&row-id=BQhH-2HSQs68Nq2EW91DBA)
|
Note that first solution of the [official FAQ answer](https://cloud.seatable.io/dtable/external-links/7b976c85f504491cbe8e/?tid=0000&vid=0000&row-id=BQhH-2HSQs68Nq2EW91DBA)
|
||||||
is not allowed by the `services.nginx` module's config-checker.
|
is not allowed by the `services.nginx` module's config-checker.
|
||||||
|
|
||||||
|
- The new option `boot.binfmt.addEmulatedSystemsToNixSandbox` allows you to skip adding the emulated systems to `nix.settings.extra-platforms`. Now you can emulate foreign binaries locally while only building them on native remote builders.
|
||||||
|
|
||||||
- The latest available version of Nextcloud is v30 (available as `pkgs.nextcloud30`). The installation logic is as follows:
|
- The latest available version of Nextcloud is v30 (available as `pkgs.nextcloud30`). The installation logic is as follows:
|
||||||
- If [`services.nextcloud.package`](#opt-services.nextcloud.package) is specified explicitly, this package will be installed (**recommended**)
|
- If [`services.nextcloud.package`](#opt-services.nextcloud.package) is specified explicitly, this package will be installed (**recommended**)
|
||||||
- If [`system.stateVersion`](#opt-system.stateVersion) is >=24.05, `pkgs.nextcloud29` will be installed by default.
|
- If [`system.stateVersion`](#opt-system.stateVersion) is >=24.05, `pkgs.nextcloud29` will be installed by default.
|
||||||
|
@ -852,6 +866,8 @@
|
||||||
|
|
||||||
- The `shadowstack` hardening flag has been added, though disabled by default.
|
- The `shadowstack` hardening flag has been added, though disabled by default.
|
||||||
|
|
||||||
|
- `writeReferencesToFile` has been removed after its deprecation in 24.05. Use the trivial build helper `writeClosure` instead.
|
||||||
|
|
||||||
- `xxd` is now provided by the `tinyxxd` package rather than `vim.xxd` to reduce closure size and vulnerability impact. Since it has the same options and semantics as Vim's `xxd` utility, there is no user impact. Vim's `xxd` remains available as the `vim.xxd` package.
|
- `xxd` is now provided by the `tinyxxd` package rather than `vim.xxd` to reduce closure size and vulnerability impact. Since it has the same options and semantics as Vim's `xxd` utility, there is no user impact. Vim's `xxd` remains available as the `vim.xxd` package.
|
||||||
|
|
||||||
- `restic` module now has an option for inhibiting system sleep while backups are running, defaulting to off (not inhibiting sleep). Available as [`services.restic.backups.<name>.inhibitsSleep`](#opt-services.restic.backups._name_.inhibitsSleep).
|
- `restic` module now has an option for inhibiting system sleep while backups are running, defaulting to off (not inhibiting sleep). Available as [`services.restic.backups.<name>.inhibitsSleep`](#opt-services.restic.backups._name_.inhibitsSleep).
|
||||||
|
@ -893,6 +909,8 @@
|
||||||
|
|
||||||
- `virtualisation.incus` module gained new `incus-user.service` and `incus-user.socket` systemd units. It is now possible to add a user to `incus` group instead of `incus-admin` for increased security.
|
- `virtualisation.incus` module gained new `incus-user.service` and `incus-user.socket` systemd units. It is now possible to add a user to `incus` group instead of `incus-admin` for increased security.
|
||||||
|
|
||||||
|
- `freecad` now supports addons and custom configuration in nix-way, which can be used by calling `freecad.customize`.
|
||||||
|
|
||||||
## Detailed Migration Information {#sec-release-24.11-migration}
|
## Detailed Migration Information {#sec-release-24.11-migration}
|
||||||
|
|
||||||
### `sound` options removal {#sec-release-24.11-migration-sound}
|
### `sound` options removal {#sec-release-24.11-migration-sound}
|
||||||
|
@ -954,3 +972,62 @@ To provide some examples:
|
||||||
| `"foo", "bar"` | `"baz", "bar"` | no match | match | One compatible string matching is enough |
|
| `"foo", "bar"` | `"baz", "bar"` | no match | match | One compatible string matching is enough |
|
||||||
|
|
||||||
Note that this also allows writing overlays that explicitly apply to multiple boards.
|
Note that this also allows writing overlays that explicitly apply to multiple boards.
|
||||||
|
|
||||||
|
## Nixpkgs Library {#sec-release-24.11-lib}
|
||||||
|
|
||||||
|
### Breaking changes {#sec-release-24.11-lib-breaking}
|
||||||
|
|
||||||
|
- [`lib.escapeShellArg`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.strings.escapeShellArg) and [`lib.escapeShellArgs`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.strings.escapeShellArgs): Arguments that don't need to be escaped won't be anymore, which is not breaking according to the functions documentation, but it can cause breakages if used for the non-intended use cases.
|
||||||
|
- [`lib.warn msg val`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.warn) (and its relatives [`lib.warnIf`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.warnIf) and [`lib.warnIfNot`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.warnIfNot)) now require `msg` to be a string to match the behavior of the new [`builtins.warn`](https://nix.dev/manual/nix/2.25/language/builtins.html?highlight=warn#builtins-warn).
|
||||||
|
- `lib.mdDoc`: Removed after deprecation in the previous release.
|
||||||
|
|
||||||
|
### Additions and Improvements {#sec-release-24.11-lib-additions-improvements}
|
||||||
|
|
||||||
|
New and extended interfaces:
|
||||||
|
- [`lib.fromHexString`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.fromHexString): Convert a hexadecimal string to it's integer representation.
|
||||||
|
- `lib.network.ipv6.fromString`: Parse an IPv6 address.
|
||||||
|
- [`lib.getLicenseFromSpdxIdOr`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.meta.getLicenseFromSpdxIdOr): Get the corresponding attribute in `lib.licenses` from an SPDX ID or fall back to the given default value.
|
||||||
|
- [`lib.licensesSpdx`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.meta.licensesSpdx): Mapping of SPDX ID to the attributes in `lib.licenses`.
|
||||||
|
- [`lib.getFirstOutput`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.attrsets.getFirstOutput): Like `getOutput` but with a list of fallback output names.
|
||||||
|
- [`lib.getInclude`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.attrsets.getInclude) and [`lib.getStatic`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.attrsets.getStatic): Get a package’s `include`/`static` output.
|
||||||
|
- [`lib.trim`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.strings.trim) and [`lib.trimWith`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.strings.trimWith): Remove leading and trailing whitespace from a string.
|
||||||
|
- [`lib.meta.defaultPriority`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.meta.defaultPriority): The default priority of packages in Nix.
|
||||||
|
- [`lib.toExtension`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.fixedPoints.toExtension): Convert to an extending function (overlay).
|
||||||
|
- `lib.fetchers.normalizeHash`: Convert an attrset containing one of `hash`, `sha256` or `sha512` into one containing `outputHash{,Algo}` as accepted by `mkDerivation`.
|
||||||
|
- `lib.fetchers.withNormalizedHash`: Wraps a function which accepts `outputHash{,Algo}` into one which accepts `hash`, `sha256` or `sha512`.
|
||||||
|
- Various builtins are now reexported in a more standard way:
|
||||||
|
- `lib.map` -> `lib.lists.map` -> `builtins.map`
|
||||||
|
- `lib.intersectAttrs` -> `lib.attrsets.intersectAttrs` -> `builtins.intersectAttrs`
|
||||||
|
- `lib.removeAttrs` -> `lib.attrsets.removeAttrs` -> `builtins.removeAttrs`
|
||||||
|
- `lib.match` -> `lib.strings.match` -> `builtins.match`
|
||||||
|
- `lib.split` -> `lib.strings.split` -> `builtins.split`
|
||||||
|
- `lib.typeOf` -> `builtins.typeOf`
|
||||||
|
- `lib.unsafeGetAttrPos` -> `builtins.unsafeGetAttrPos`
|
||||||
|
- [`lib.cli.toGNUCommandLine`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.cli.toGNUCommandLine) now supports the `optionValueSeparator` argument attribute to control the key-value separator for arguments.
|
||||||
|
|
||||||
|
Documentation improvements:
|
||||||
|
- Much of the documentation has been migrated to the [standard doc-comment format](https://github.com/NixOS/rfcs/pull/145), including [`lib.derivations`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-derivations), [`lib.fixedPoints`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-fixedPoints), [`lib.gvariant`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-gvariant), [`lib.filesystem`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-filesystem), [`lib.strings`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-strings), [`lib.meta`](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-meta).
|
||||||
|
- [`lib.generators` documentation](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-generators) is now improved and rendered in the manual.
|
||||||
|
- [`lib.cli` documentation](https://nixos.org/manual/nixpkgs/unstable/#sec-functions-library-cli) is now improved and rendered in the manual.
|
||||||
|
- [`lib.composeExtensions`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.fixedPoints.composeExtensions) and [`lib.composeManyExtensions`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.fixedPoints.composeManyExtensions) documentation is now improved.
|
||||||
|
- [`lib.importTOML`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.importTOML) and [`lib.importJSON`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.importJSON)'s documentation now have an example.
|
||||||
|
|
||||||
|
Module System:
|
||||||
|
- `lib.importApply`: New function, imports a Nix expression file much like the module system would, after passing an extra positional argument to the function in the file.
|
||||||
|
- Improve error message when accessing an option that isn't defined.
|
||||||
|
- `lib.types.anything`: Don't fail to merge when specifying the same list multiple times.
|
||||||
|
- Improve error when loading a flake as a module.
|
||||||
|
|
||||||
|
### Deprecations {#sec-release-24.11-lib-deprecations}
|
||||||
|
|
||||||
|
- [`lib.options.mkPackageOptionMD`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.options.mkPackageOptionMD) is now obsolete; use the identical [`lib.options.mkPackageOption`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.options.mkPackageOption) instead.
|
||||||
|
- `lib.misc.mapAttrsFlatten` is now formally deprecated and will be removed in future releases; use the identical [`lib.attrsets.mapAttrsToList`](https://nixos.org/manual/nixpkgs/unstable#function-library-lib.attrsets.mapAttrsToList) instead.
|
||||||
|
- `lib.isInOldestRelease`: Renamed to [`oldestSupportedReleaseIsAtLeast`](https://nixos.org/manual/nixpkgs/unstable/#function-library-lib.trivial.oldestSupportedReleaseIsAtLeast) and deprecated.
|
||||||
|
|
||||||
|
## NixOS Wiki {#sec-release-24.11-wiki}
|
||||||
|
|
||||||
|
The official NixOS Wiki at [wiki.nixos.org](https://wiki.nixos.org/) was launched in April 2024, featuring
|
||||||
|
content initially copied from the community wiki. The wiki enhances the official documentation, linking to
|
||||||
|
existing resources and providing a categorization system for easy navigation, and is guided by a new "Manual
|
||||||
|
of Style" — a contribution guide and enhanced templates. It offers a wealth of new information, including
|
||||||
|
articles on applications, desktop environments, and a growing number of translations in multiple languages.
|
||||||
|
|
|
@ -4,7 +4,7 @@
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
- Create the first release note entry in this section!
|
- The default PHP version has been updated to 8.3.
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
|
@ -14,16 +14,70 @@
|
||||||
|
|
||||||
- [Kimai](https://www.kimai.org/), a web-based multi-user time-tracking application. Available as [services.kimai](option.html#opt-services.kimai).
|
- [Kimai](https://www.kimai.org/), a web-based multi-user time-tracking application. Available as [services.kimai](option.html#opt-services.kimai).
|
||||||
|
|
||||||
|
- [Omnom](https://github.com/asciimoo/omnom), a webpage bookmarking and snapshotting service. Available as [services.omnom](options.html#opt-services.omnom.enable).
|
||||||
|
|
||||||
|
- [Traccar](https://www.traccar.org/), a modern GPS Tracking Platform. Available as [services.traccar](#opt-services.traccar.enable).
|
||||||
|
|
||||||
|
- [Amazon CloudWatch Agent](https://github.com/aws/amazon-cloudwatch-agent), the official telemetry collector for AWS CloudWatch and AWS X-Ray. Available as [services.amazon-cloudwatch-agent](#opt-services.amazon-cloudwatch-agent.enable).
|
||||||
|
|
||||||
|
- [agorakit](https://github.com/agorakit/agorakit), an organization tool for citizens' collectives. Available with [services.agorakit](#opt-services.agorakit.enable).
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
## Backward Incompatibilities {#sec-release-25.05-incompatibilities}
|
## Backward Incompatibilities {#sec-release-25.05-incompatibilities}
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
|
- `binwalk` was updated to 3.1.0, which has been rewritten in rust. The python module is no longer available.
|
||||||
|
See the release notes of [3.1.0](https://github.com/ReFirmLabs/binwalk/releases/tag/v3.1.0) for more information.
|
||||||
|
|
||||||
|
- `buildGoPackage` has been removed. Use `buildGoModule` instead. See the [Go section in the nixpkgs manual](https://nixos.org/manual/nixpkgs/unstable/#sec-language-go) for details.
|
||||||
|
|
||||||
|
- `strawberry` has been updated to 1.2, which drops support for the VLC backend and Qt 5. The `strawberry-qt5` package
|
||||||
|
and `withGstreamer`/`withVlc` override options have been removed due to this.
|
||||||
|
|
||||||
|
- `timescaledb` requires manual upgrade steps.
|
||||||
|
After you run ALTER EXTENSION, you must run [this SQL script](https://github.com/timescale/timescaledb-extras/blob/master/utils/2.15.X-fix_hypertable_foreign_keys.sql). For more details, see the following pull requests [#6797](https://github.com/timescale/timescaledb/pull/6797).
|
||||||
|
PostgreSQL 13 is no longer supported in TimescaleDB v2.16.
|
||||||
|
|
||||||
|
- Support for CUDA 10 has been dropped, as announced in the 24.11 release notes.
|
||||||
|
|
||||||
|
- `zammad` has had its support for MySQL removed, since it was never working correctly and is now deprecated upstream. Check the [migration guide](https://docs.zammad.org/en/latest/appendix/migrate-to-postgresql.html) for how to convert your database to PostgreSQL.
|
||||||
|
|
||||||
|
- `nodePackages.insect` has been removed, as it's deprecated by upstream. The suggested replacement is `numbat`.
|
||||||
|
|
||||||
|
- The behavior of the `networking.nat.externalIP` and `networking.nat.externalIPv6` options has been changed. `networking.nat.forwardPorts` now only forwards packets destined for the specified IP addresses.
|
||||||
|
|
||||||
|
- `nodePackages.meshcommander` has been removed, as the package was deprecated by Intel.
|
||||||
|
|
||||||
- `kanata` was updated to v1.7.0, which introduces several breaking changes.
|
- `kanata` was updated to v1.7.0, which introduces several breaking changes.
|
||||||
See the release notes of
|
See the release notes of
|
||||||
[v1.7.0](https://github.com/jtroo/kanata/releases/tag/v1.7.0)
|
[v1.7.0](https://github.com/jtroo/kanata/releases/tag/v1.7.0)
|
||||||
for more information.
|
for more information.
|
||||||
|
- `vscode-utils.buildVscodeExtension` now requires pname as an argument
|
||||||
|
|
||||||
|
- `nerdfonts` has been separated into individual font packages under the namespace `nerd-fonts`. The directories for font
|
||||||
|
files have changed from `$out/share/fonts/{opentype,truetype}/NerdFonts` to
|
||||||
|
`$out/share/fonts/{opentype,truetype}/NerdFonts/<fontDirName>`, where `<fontDirName>` can be found in the
|
||||||
|
[official website](https://www.nerdfonts.com/font-downloads) as the titles in preview images, with the "Nerd Font"
|
||||||
|
suffix and any whitespaces trimmed.
|
||||||
|
|
||||||
|
- `retroarch` has been refactored and the older `retroarch.override { cores = [ ... ]; }` to create a RetroArch derivation with custom cores doesn't work anymore, use `retroarch.withCores (cores: [ ... ])` instead. If you need more customization (e.g.: custom settings), use `wrapRetroArch` instead.
|
||||||
|
|
||||||
|
- `gkraken` software and `hardware.gkraken.enable` option have been removed, use `coolercontrol` via `programs.coolercontrol.enable` option instead.
|
||||||
|
|
||||||
|
- `nodePackages.ganache` has been removed, as the package has been deprecated by upstream.
|
||||||
|
|
||||||
|
- `containerd` has been updated to v2, which contains breaking changes. See the [containerd
|
||||||
|
2.0](https://github.com/containerd/containerd/blob/main/docs/containerd-2.0.md) documentation for more
|
||||||
|
details.
|
||||||
|
|
||||||
|
- `nodePackages.stackdriver-statsd-backend` has been removed, as the StackDriver service has been discontinued by Google, and therefore the package no longer works.
|
||||||
|
|
||||||
|
- the notmuch vim plugin now lives in a separate output of the `notmuch`
|
||||||
|
package. Installing `notmuch` will not bring the notmuch vim package anymore,
|
||||||
|
add `vimPlugins.notmuch-vim` to your (Neo)vim configuration if you want the
|
||||||
|
vim plugin.
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
|
@ -31,6 +85,8 @@
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
||||||
- Create the first release note entry in this section!
|
- Cinnamon has been updated to 6.4.
|
||||||
|
|
||||||
|
- `bind.cacheNetworks` now only controls access for recursive queries, where it previously controlled access for all queries.
|
||||||
|
|
||||||
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
<!-- To avoid merge conflicts, consider adding your item at an arbitrary place in the list instead. -->
|
||||||
|
|
|
@ -10,7 +10,11 @@ let
|
||||||
buildArgs = "../../release.nix -A manualHTML.${builtins.currentSystem}";
|
buildArgs = "../../release.nix -A manualHTML.${builtins.currentSystem}";
|
||||||
open = "/${outputPath}/${indexPath}";
|
open = "/${outputPath}/${indexPath}";
|
||||||
};
|
};
|
||||||
|
nixos-render-docs-redirects = pkgs.writeShellScriptBin "redirects" "${pkgs.lib.getExe pkgs.nixos-render-docs-redirects} --file ${toString ./redirects.json} $@";
|
||||||
in
|
in
|
||||||
pkgs.mkShellNoCC {
|
pkgs.mkShellNoCC {
|
||||||
packages = [ devmode ];
|
packages = [
|
||||||
|
devmode
|
||||||
|
nixos-render-docs-redirects
|
||||||
|
];
|
||||||
}
|
}
|
||||||
|
|
|
@ -163,6 +163,9 @@ To solve this, you can run `fdisk -l $image` and generate `dd if=$image of=$imag
|
||||||
, # Disk image format, one of qcow2, qcow2-compressed, vdi, vpc, raw.
|
, # Disk image format, one of qcow2, qcow2-compressed, vdi, vpc, raw.
|
||||||
format ? "raw"
|
format ? "raw"
|
||||||
|
|
||||||
|
, # Disk image filename, without any extensions (e.g. `image_1`).
|
||||||
|
baseName ? "nixos"
|
||||||
|
|
||||||
# Whether to fix:
|
# Whether to fix:
|
||||||
# - GPT Disk Unique Identifier (diskGUID)
|
# - GPT Disk Unique Identifier (diskGUID)
|
||||||
# - GPT Partition Unique Identifier: depends on the layout, root partition UUID can be controlled through `rootGPUID` option
|
# - GPT Partition Unique Identifier: depends on the layout, root partition UUID can be controlled through `rootGPUID` option
|
||||||
|
@ -208,7 +211,7 @@ let format' = format; in let
|
||||||
|
|
||||||
compress = lib.optionalString (format' == "qcow2-compressed") "-c";
|
compress = lib.optionalString (format' == "qcow2-compressed") "-c";
|
||||||
|
|
||||||
filename = "nixos." + {
|
filename = "${baseName}." + {
|
||||||
qcow2 = "qcow2";
|
qcow2 = "qcow2";
|
||||||
vdi = "vdi";
|
vdi = "vdi";
|
||||||
vpc = "vhd";
|
vpc = "vhd";
|
||||||
|
@ -470,7 +473,7 @@ let format' = format; in let
|
||||||
additionalSpace=$(( $(numfmt --from=iec '${additionalSpace}') + reservedSpace ))
|
additionalSpace=$(( $(numfmt --from=iec '${additionalSpace}') + reservedSpace ))
|
||||||
|
|
||||||
# Compute required space in filesystem blocks
|
# Compute required space in filesystem blocks
|
||||||
diskUsage=$(find . ! -type d -print0 | du --files0-from=- --apparent-size --block-size "${blockSize}" | cut -f1 | sum_lines)
|
diskUsage=$(find . ! -type d -print0 | du --files0-from=- --apparent-size --count-links --block-size "${blockSize}" | cut -f1 | sum_lines)
|
||||||
# Each inode takes space!
|
# Each inode takes space!
|
||||||
numInodes=$(find . | wc -l)
|
numInodes=$(find . | wc -l)
|
||||||
# Convert to bytes, inodes take two blocks each!
|
# Convert to bytes, inodes take two blocks each!
|
||||||
|
|
|
@ -236,8 +236,7 @@ let
|
||||||
image = (
|
image = (
|
||||||
pkgs.vmTools.override {
|
pkgs.vmTools.override {
|
||||||
rootModules =
|
rootModules =
|
||||||
[ "zfs" "9p" "9pnet_virtio" "virtio_pci" "virtio_blk" ] ++
|
[ "zfs" "9p" "9pnet_virtio" "virtio_pci" "virtio_blk" ];
|
||||||
(pkgs.lib.optional pkgs.stdenv.hostPlatform.isx86 "rtc_cmos");
|
|
||||||
kernel = modulesTree;
|
kernel = modulesTree;
|
||||||
}
|
}
|
||||||
).runInLinuxVM (
|
).runInLinuxVM (
|
||||||
|
|
|
@ -39,10 +39,6 @@
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
## optionsDocBook
|
|
||||||
|
|
||||||
deprecated since 23.11 and will be removed in 24.05.
|
|
||||||
|
|
||||||
## optionsAsciiDoc
|
## optionsAsciiDoc
|
||||||
|
|
||||||
Documentation rendered as AsciiDoc. This is useful for e.g. man pages.
|
Documentation rendered as AsciiDoc. This is useful for e.g. man pages.
|
||||||
|
@ -111,18 +107,8 @@
|
||||||
# instead of printing warnings for eg options with missing descriptions (which may be lost
|
# instead of printing warnings for eg options with missing descriptions (which may be lost
|
||||||
# by nix build unless -L is given), emit errors instead and fail the build
|
# by nix build unless -L is given), emit errors instead and fail the build
|
||||||
, warningsAreErrors ? true
|
, warningsAreErrors ? true
|
||||||
# allow docbook option docs if `true`. only markdown documentation is allowed when set to
|
|
||||||
# `false`, and a different renderer may be used with different bugs and performance
|
|
||||||
# characteristics but (hopefully) indistinguishable output.
|
|
||||||
# deprecated since 23.11.
|
|
||||||
# TODO remove in a while.
|
|
||||||
, allowDocBook ? false
|
|
||||||
# TODO remove in a while (see https://github.com/NixOS/nixpkgs/issues/300735)
|
|
||||||
, markdownByDefault ? true
|
|
||||||
}:
|
}:
|
||||||
|
|
||||||
assert markdownByDefault && ! allowDocBook;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
rawOpts = lib.optionAttrSetToDocList options;
|
rawOpts = lib.optionAttrSetToDocList options;
|
||||||
transformedOpts = map transformOptions rawOpts;
|
transformedOpts = map transformOptions rawOpts;
|
||||||
|
@ -229,6 +215,4 @@ in rec {
|
||||||
echo "file json $dst/options.json" >> $out/nix-support/hydra-build-products
|
echo "file json $dst/options.json" >> $out/nix-support/hydra-build-products
|
||||||
echo "file json-br $dst/options.json.br" >> $out/nix-support/hydra-build-products
|
echo "file json-br $dst/options.json.br" >> $out/nix-support/hydra-build-products
|
||||||
'';
|
'';
|
||||||
|
|
||||||
optionsDocBook = throw "optionsDocBook has been removed in 24.05";
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -226,8 +226,7 @@ let
|
||||||
image = (
|
image = (
|
||||||
pkgs.vmTools.override {
|
pkgs.vmTools.override {
|
||||||
rootModules =
|
rootModules =
|
||||||
[ "zfs" "9p" "9pnet_virtio" "virtio_pci" "virtio_blk" ] ++
|
[ "zfs" "9p" "9pnet_virtio" "virtio_pci" "virtio_blk" ];
|
||||||
(pkgs.lib.optional pkgs.stdenv.hostPlatform.isx86 "rtc_cmos");
|
|
||||||
kernel = modulesTree;
|
kernel = modulesTree;
|
||||||
}
|
}
|
||||||
).runInLinuxVM (
|
).runInLinuxVM (
|
||||||
|
|
|
@ -1,17 +1,18 @@
|
||||||
{ lib
|
{
|
||||||
, python3Packages
|
lib,
|
||||||
, enableOCR ? false
|
python3Packages,
|
||||||
, qemu_pkg ? qemu_test
|
enableOCR ? false,
|
||||||
, coreutils
|
qemu_pkg ? qemu_test,
|
||||||
, imagemagick_light
|
coreutils,
|
||||||
, netpbm
|
imagemagick_light,
|
||||||
, qemu_test
|
netpbm,
|
||||||
, socat
|
qemu_test,
|
||||||
, ruff
|
socat,
|
||||||
, tesseract4
|
ruff,
|
||||||
, vde2
|
tesseract4,
|
||||||
, extraPythonPackages ? (_ : [])
|
vde2,
|
||||||
, nixosTests
|
extraPythonPackages ? (_: [ ]),
|
||||||
|
nixosTests,
|
||||||
}:
|
}:
|
||||||
let
|
let
|
||||||
fs = lib.fileset;
|
fs = lib.fileset;
|
||||||
|
@ -19,6 +20,8 @@ in
|
||||||
python3Packages.buildPythonApplication {
|
python3Packages.buildPythonApplication {
|
||||||
pname = "nixos-test-driver";
|
pname = "nixos-test-driver";
|
||||||
version = "1.1";
|
version = "1.1";
|
||||||
|
pyproject = true;
|
||||||
|
|
||||||
src = fs.toSource {
|
src = fs.toSource {
|
||||||
root = ./.;
|
root = ./.;
|
||||||
fileset = fs.unions [
|
fileset = fs.unions [
|
||||||
|
@ -27,37 +30,50 @@ python3Packages.buildPythonApplication {
|
||||||
./extract-docstrings.py
|
./extract-docstrings.py
|
||||||
];
|
];
|
||||||
};
|
};
|
||||||
pyproject = true;
|
|
||||||
|
|
||||||
propagatedBuildInputs = [
|
build-system = with python3Packages; [
|
||||||
coreutils
|
setuptools
|
||||||
netpbm
|
];
|
||||||
python3Packages.colorama
|
|
||||||
python3Packages.junit-xml
|
dependencies =
|
||||||
python3Packages.ptpython
|
with python3Packages;
|
||||||
qemu_pkg
|
[
|
||||||
socat
|
colorama
|
||||||
vde2
|
junit-xml
|
||||||
]
|
ptpython
|
||||||
++ (lib.optionals enableOCR [ imagemagick_light tesseract4 ])
|
]
|
||||||
++ extraPythonPackages python3Packages;
|
++ extraPythonPackages python3Packages;
|
||||||
|
|
||||||
nativeBuildInputs = [
|
propagatedBuildInputs =
|
||||||
python3Packages.setuptools
|
[
|
||||||
];
|
coreutils
|
||||||
|
netpbm
|
||||||
|
qemu_pkg
|
||||||
|
socat
|
||||||
|
vde2
|
||||||
|
]
|
||||||
|
++ lib.optionals enableOCR [
|
||||||
|
imagemagick_light
|
||||||
|
tesseract4
|
||||||
|
];
|
||||||
|
|
||||||
passthru.tests = {
|
passthru.tests = {
|
||||||
inherit (nixosTests.nixos-test-driver) driver-timeout;
|
inherit (nixosTests.nixos-test-driver) driver-timeout;
|
||||||
};
|
};
|
||||||
|
|
||||||
doCheck = true;
|
doCheck = true;
|
||||||
nativeCheckInputs = with python3Packages; [ mypy ruff black ];
|
|
||||||
|
nativeCheckInputs = with python3Packages; [
|
||||||
|
mypy
|
||||||
|
ruff
|
||||||
|
];
|
||||||
|
|
||||||
checkPhase = ''
|
checkPhase = ''
|
||||||
echo -e "\x1b[32m## run mypy\x1b[0m"
|
echo -e "\x1b[32m## run mypy\x1b[0m"
|
||||||
mypy test_driver extract-docstrings.py
|
mypy test_driver extract-docstrings.py
|
||||||
echo -e "\x1b[32m## run ruff\x1b[0m"
|
echo -e "\x1b[32m## run ruff check\x1b[0m"
|
||||||
ruff check .
|
ruff check .
|
||||||
echo -e "\x1b[32m## run black\x1b[0m"
|
echo -e "\x1b[32m## run ruff format\x1b[0m"
|
||||||
black --check --diff .
|
ruff format --check --diff .
|
||||||
'';
|
'';
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,6 +17,7 @@ find = {}
|
||||||
test_driver = ["py.typed"]
|
test_driver = ["py.typed"]
|
||||||
|
|
||||||
[tool.ruff]
|
[tool.ruff]
|
||||||
|
target-version = "py312"
|
||||||
line-length = 88
|
line-length = 88
|
||||||
|
|
||||||
lint.select = ["E", "F", "I", "U", "N"]
|
lint.select = ["E", "F", "I", "U", "N"]
|
||||||
|
@ -35,11 +36,6 @@ ignore_missing_imports = true
|
||||||
module = "junit_xml.*"
|
module = "junit_xml.*"
|
||||||
ignore_missing_imports = true
|
ignore_missing_imports = true
|
||||||
|
|
||||||
[tool.black]
|
|
||||||
line-length = 88
|
|
||||||
target-version = ['py39']
|
|
||||||
include = '\.pyi?$'
|
|
||||||
|
|
||||||
[tool.mypy]
|
[tool.mypy]
|
||||||
warn_redundant_casts = true
|
warn_redundant_casts = true
|
||||||
disallow_untyped_calls = true
|
disallow_untyped_calls = true
|
||||||
|
|
|
@ -3,11 +3,10 @@ import re
|
||||||
import signal
|
import signal
|
||||||
import tempfile
|
import tempfile
|
||||||
import threading
|
import threading
|
||||||
from contextlib import contextmanager
|
from collections.abc import Callable, Iterator
|
||||||
|
from contextlib import AbstractContextManager, contextmanager
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from typing import Any, Callable, ContextManager, Dict, Iterator, List, Optional, Union
|
from typing import Any
|
||||||
|
|
||||||
from colorama import Fore, Style
|
|
||||||
|
|
||||||
from test_driver.logger import AbstractLogger
|
from test_driver.logger import AbstractLogger
|
||||||
from test_driver.machine import Machine, NixStartScript, retry
|
from test_driver.machine import Machine, NixStartScript, retry
|
||||||
|
@ -44,17 +43,17 @@ class Driver:
|
||||||
and runs the tests"""
|
and runs the tests"""
|
||||||
|
|
||||||
tests: str
|
tests: str
|
||||||
vlans: List[VLan]
|
vlans: list[VLan]
|
||||||
machines: List[Machine]
|
machines: list[Machine]
|
||||||
polling_conditions: List[PollingCondition]
|
polling_conditions: list[PollingCondition]
|
||||||
global_timeout: int
|
global_timeout: int
|
||||||
race_timer: threading.Timer
|
race_timer: threading.Timer
|
||||||
logger: AbstractLogger
|
logger: AbstractLogger
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
start_scripts: List[str],
|
start_scripts: list[str],
|
||||||
vlans: List[int],
|
vlans: list[int],
|
||||||
tests: str,
|
tests: str,
|
||||||
out_dir: Path,
|
out_dir: Path,
|
||||||
logger: AbstractLogger,
|
logger: AbstractLogger,
|
||||||
|
@ -73,7 +72,7 @@ class Driver:
|
||||||
vlans = list(set(vlans))
|
vlans = list(set(vlans))
|
||||||
self.vlans = [VLan(nr, tmp_dir, self.logger) for nr in vlans]
|
self.vlans = [VLan(nr, tmp_dir, self.logger) for nr in vlans]
|
||||||
|
|
||||||
def cmd(scripts: List[str]) -> Iterator[NixStartScript]:
|
def cmd(scripts: list[str]) -> Iterator[NixStartScript]:
|
||||||
for s in scripts:
|
for s in scripts:
|
||||||
yield NixStartScript(s)
|
yield NixStartScript(s)
|
||||||
|
|
||||||
|
@ -119,7 +118,7 @@ class Driver:
|
||||||
self.logger.error(f'Test "{name}" failed with error: "{e}"')
|
self.logger.error(f'Test "{name}" failed with error: "{e}"')
|
||||||
raise e
|
raise e
|
||||||
|
|
||||||
def test_symbols(self) -> Dict[str, Any]:
|
def test_symbols(self) -> dict[str, Any]:
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(name: str) -> Iterator[None]:
|
def subtest(name: str) -> Iterator[None]:
|
||||||
return self.subtest(name)
|
return self.subtest(name)
|
||||||
|
@ -205,48 +204,11 @@ class Driver:
|
||||||
|
|
||||||
def create_machine(
|
def create_machine(
|
||||||
self,
|
self,
|
||||||
start_command: str | dict,
|
start_command: str,
|
||||||
*,
|
*,
|
||||||
name: Optional[str] = None,
|
name: str | None = None,
|
||||||
keep_vm_state: bool = False,
|
keep_vm_state: bool = False,
|
||||||
) -> Machine:
|
) -> Machine:
|
||||||
# Legacy args handling
|
|
||||||
# FIXME: remove after 24.05
|
|
||||||
if isinstance(start_command, dict):
|
|
||||||
if name is not None or keep_vm_state:
|
|
||||||
raise TypeError(
|
|
||||||
"Dictionary passed to create_machine must be the only argument"
|
|
||||||
)
|
|
||||||
|
|
||||||
args = start_command
|
|
||||||
start_command = args.pop("startCommand", SENTINEL)
|
|
||||||
|
|
||||||
if start_command is SENTINEL:
|
|
||||||
raise TypeError(
|
|
||||||
"Dictionary passed to create_machine must contain startCommand"
|
|
||||||
)
|
|
||||||
|
|
||||||
if not isinstance(start_command, str):
|
|
||||||
raise TypeError(
|
|
||||||
f"startCommand must be a string, got: {repr(start_command)}"
|
|
||||||
)
|
|
||||||
|
|
||||||
name = args.pop("name", None)
|
|
||||||
keep_vm_state = args.pop("keep_vm_state", False)
|
|
||||||
|
|
||||||
if args:
|
|
||||||
raise TypeError(
|
|
||||||
f"Unsupported arguments passed to create_machine: {args}"
|
|
||||||
)
|
|
||||||
|
|
||||||
self.logger.warning(
|
|
||||||
Fore.YELLOW
|
|
||||||
+ Style.BRIGHT
|
|
||||||
+ "WARNING: Using create_machine with a single dictionary argument is deprecated and will be removed in NixOS 24.11"
|
|
||||||
+ Style.RESET_ALL
|
|
||||||
)
|
|
||||||
# End legacy args handling
|
|
||||||
|
|
||||||
tmp_dir = get_tmp_dir()
|
tmp_dir = get_tmp_dir()
|
||||||
|
|
||||||
cmd = NixStartScript(start_command)
|
cmd = NixStartScript(start_command)
|
||||||
|
@ -273,11 +235,11 @@ class Driver:
|
||||||
|
|
||||||
def polling_condition(
|
def polling_condition(
|
||||||
self,
|
self,
|
||||||
fun_: Optional[Callable] = None,
|
fun_: Callable | None = None,
|
||||||
*,
|
*,
|
||||||
seconds_interval: float = 2.0,
|
seconds_interval: float = 2.0,
|
||||||
description: Optional[str] = None,
|
description: str | None = None,
|
||||||
) -> Union[Callable[[Callable], ContextManager], ContextManager]:
|
) -> Callable[[Callable], AbstractContextManager] | AbstractContextManager:
|
||||||
driver = self
|
driver = self
|
||||||
|
|
||||||
class Poll:
|
class Poll:
|
||||||
|
|
|
@ -5,10 +5,11 @@ import sys
|
||||||
import time
|
import time
|
||||||
import unicodedata
|
import unicodedata
|
||||||
from abc import ABC, abstractmethod
|
from abc import ABC, abstractmethod
|
||||||
|
from collections.abc import Iterator
|
||||||
from contextlib import ExitStack, contextmanager
|
from contextlib import ExitStack, contextmanager
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from queue import Empty, Queue
|
from queue import Empty, Queue
|
||||||
from typing import Any, Dict, Iterator, List
|
from typing import Any
|
||||||
from xml.sax.saxutils import XMLGenerator
|
from xml.sax.saxutils import XMLGenerator
|
||||||
from xml.sax.xmlreader import AttributesImpl
|
from xml.sax.xmlreader import AttributesImpl
|
||||||
|
|
||||||
|
@ -18,17 +19,17 @@ from junit_xml import TestCase, TestSuite
|
||||||
|
|
||||||
class AbstractLogger(ABC):
|
class AbstractLogger(ABC):
|
||||||
@abstractmethod
|
@abstractmethod
|
||||||
def log(self, message: str, attributes: Dict[str, str] = {}) -> None:
|
def log(self, message: str, attributes: dict[str, str] = {}) -> None:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
@abstractmethod
|
@abstractmethod
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(self, name: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def subtest(self, name: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
@abstractmethod
|
@abstractmethod
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def nested(self, message: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def nested(self, message: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
@abstractmethod
|
@abstractmethod
|
||||||
|
@ -68,11 +69,11 @@ class JunitXMLLogger(AbstractLogger):
|
||||||
self._print_serial_logs = True
|
self._print_serial_logs = True
|
||||||
atexit.register(self.close)
|
atexit.register(self.close)
|
||||||
|
|
||||||
def log(self, message: str, attributes: Dict[str, str] = {}) -> None:
|
def log(self, message: str, attributes: dict[str, str] = {}) -> None:
|
||||||
self.tests[self.currentSubtest].stdout += message + os.linesep
|
self.tests[self.currentSubtest].stdout += message + os.linesep
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(self, name: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def subtest(self, name: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
old_test = self.currentSubtest
|
old_test = self.currentSubtest
|
||||||
self.tests.setdefault(name, self.TestCaseState())
|
self.tests.setdefault(name, self.TestCaseState())
|
||||||
self.currentSubtest = name
|
self.currentSubtest = name
|
||||||
|
@ -82,7 +83,7 @@ class JunitXMLLogger(AbstractLogger):
|
||||||
self.currentSubtest = old_test
|
self.currentSubtest = old_test
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def nested(self, message: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def nested(self, message: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
self.log(message)
|
self.log(message)
|
||||||
yield
|
yield
|
||||||
|
|
||||||
|
@ -123,25 +124,25 @@ class JunitXMLLogger(AbstractLogger):
|
||||||
|
|
||||||
|
|
||||||
class CompositeLogger(AbstractLogger):
|
class CompositeLogger(AbstractLogger):
|
||||||
def __init__(self, logger_list: List[AbstractLogger]) -> None:
|
def __init__(self, logger_list: list[AbstractLogger]) -> None:
|
||||||
self.logger_list = logger_list
|
self.logger_list = logger_list
|
||||||
|
|
||||||
def add_logger(self, logger: AbstractLogger) -> None:
|
def add_logger(self, logger: AbstractLogger) -> None:
|
||||||
self.logger_list.append(logger)
|
self.logger_list.append(logger)
|
||||||
|
|
||||||
def log(self, message: str, attributes: Dict[str, str] = {}) -> None:
|
def log(self, message: str, attributes: dict[str, str] = {}) -> None:
|
||||||
for logger in self.logger_list:
|
for logger in self.logger_list:
|
||||||
logger.log(message, attributes)
|
logger.log(message, attributes)
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(self, name: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def subtest(self, name: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
with ExitStack() as stack:
|
with ExitStack() as stack:
|
||||||
for logger in self.logger_list:
|
for logger in self.logger_list:
|
||||||
stack.enter_context(logger.subtest(name, attributes))
|
stack.enter_context(logger.subtest(name, attributes))
|
||||||
yield
|
yield
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def nested(self, message: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def nested(self, message: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
with ExitStack() as stack:
|
with ExitStack() as stack:
|
||||||
for logger in self.logger_list:
|
for logger in self.logger_list:
|
||||||
stack.enter_context(logger.nested(message, attributes))
|
stack.enter_context(logger.nested(message, attributes))
|
||||||
|
@ -173,7 +174,7 @@ class TerminalLogger(AbstractLogger):
|
||||||
def __init__(self) -> None:
|
def __init__(self) -> None:
|
||||||
self._print_serial_logs = True
|
self._print_serial_logs = True
|
||||||
|
|
||||||
def maybe_prefix(self, message: str, attributes: Dict[str, str]) -> str:
|
def maybe_prefix(self, message: str, attributes: dict[str, str]) -> str:
|
||||||
if "machine" in attributes:
|
if "machine" in attributes:
|
||||||
return f"{attributes['machine']}: {message}"
|
return f"{attributes['machine']}: {message}"
|
||||||
return message
|
return message
|
||||||
|
@ -182,16 +183,16 @@ class TerminalLogger(AbstractLogger):
|
||||||
def _eprint(*args: object, **kwargs: Any) -> None:
|
def _eprint(*args: object, **kwargs: Any) -> None:
|
||||||
print(*args, file=sys.stderr, **kwargs)
|
print(*args, file=sys.stderr, **kwargs)
|
||||||
|
|
||||||
def log(self, message: str, attributes: Dict[str, str] = {}) -> None:
|
def log(self, message: str, attributes: dict[str, str] = {}) -> None:
|
||||||
self._eprint(self.maybe_prefix(message, attributes))
|
self._eprint(self.maybe_prefix(message, attributes))
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(self, name: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def subtest(self, name: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
with self.nested("subtest: " + name, attributes):
|
with self.nested("subtest: " + name, attributes):
|
||||||
yield
|
yield
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def nested(self, message: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def nested(self, message: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
self._eprint(
|
self._eprint(
|
||||||
self.maybe_prefix(
|
self.maybe_prefix(
|
||||||
Style.BRIGHT + Fore.GREEN + message + Style.RESET_ALL, attributes
|
Style.BRIGHT + Fore.GREEN + message + Style.RESET_ALL, attributes
|
||||||
|
@ -241,12 +242,12 @@ class XMLLogger(AbstractLogger):
|
||||||
def sanitise(self, message: str) -> str:
|
def sanitise(self, message: str) -> str:
|
||||||
return "".join(ch for ch in message if unicodedata.category(ch)[0] != "C")
|
return "".join(ch for ch in message if unicodedata.category(ch)[0] != "C")
|
||||||
|
|
||||||
def maybe_prefix(self, message: str, attributes: Dict[str, str]) -> str:
|
def maybe_prefix(self, message: str, attributes: dict[str, str]) -> str:
|
||||||
if "machine" in attributes:
|
if "machine" in attributes:
|
||||||
return f"{attributes['machine']}: {message}"
|
return f"{attributes['machine']}: {message}"
|
||||||
return message
|
return message
|
||||||
|
|
||||||
def log_line(self, message: str, attributes: Dict[str, str]) -> None:
|
def log_line(self, message: str, attributes: dict[str, str]) -> None:
|
||||||
self.xml.startElement("line", attrs=AttributesImpl(attributes))
|
self.xml.startElement("line", attrs=AttributesImpl(attributes))
|
||||||
self.xml.characters(message)
|
self.xml.characters(message)
|
||||||
self.xml.endElement("line")
|
self.xml.endElement("line")
|
||||||
|
@ -260,7 +261,7 @@ class XMLLogger(AbstractLogger):
|
||||||
def error(self, *args, **kwargs) -> None: # type: ignore
|
def error(self, *args, **kwargs) -> None: # type: ignore
|
||||||
self.log(*args, **kwargs)
|
self.log(*args, **kwargs)
|
||||||
|
|
||||||
def log(self, message: str, attributes: Dict[str, str] = {}) -> None:
|
def log(self, message: str, attributes: dict[str, str] = {}) -> None:
|
||||||
self.drain_log_queue()
|
self.drain_log_queue()
|
||||||
self.log_line(message, attributes)
|
self.log_line(message, attributes)
|
||||||
|
|
||||||
|
@ -273,7 +274,7 @@ class XMLLogger(AbstractLogger):
|
||||||
|
|
||||||
self.enqueue({"msg": message, "machine": machine, "type": "serial"})
|
self.enqueue({"msg": message, "machine": machine, "type": "serial"})
|
||||||
|
|
||||||
def enqueue(self, item: Dict[str, str]) -> None:
|
def enqueue(self, item: dict[str, str]) -> None:
|
||||||
self.queue.put(item)
|
self.queue.put(item)
|
||||||
|
|
||||||
def drain_log_queue(self) -> None:
|
def drain_log_queue(self) -> None:
|
||||||
|
@ -287,12 +288,12 @@ class XMLLogger(AbstractLogger):
|
||||||
pass
|
pass
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def subtest(self, name: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def subtest(self, name: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
with self.nested("subtest: " + name, attributes):
|
with self.nested("subtest: " + name, attributes):
|
||||||
yield
|
yield
|
||||||
|
|
||||||
@contextmanager
|
@contextmanager
|
||||||
def nested(self, message: str, attributes: Dict[str, str] = {}) -> Iterator[None]:
|
def nested(self, message: str, attributes: dict[str, str] = {}) -> Iterator[None]:
|
||||||
self.xml.startElement("nest", attrs=AttributesImpl({}))
|
self.xml.startElement("nest", attrs=AttributesImpl({}))
|
||||||
self.xml.startElement("head", attrs=AttributesImpl(attributes))
|
self.xml.startElement("head", attrs=AttributesImpl(attributes))
|
||||||
self.xml.characters(message)
|
self.xml.characters(message)
|
||||||
|
|
|
@ -12,10 +12,11 @@ import sys
|
||||||
import tempfile
|
import tempfile
|
||||||
import threading
|
import threading
|
||||||
import time
|
import time
|
||||||
|
from collections.abc import Callable, Iterable
|
||||||
from contextlib import _GeneratorContextManager, nullcontext
|
from contextlib import _GeneratorContextManager, nullcontext
|
||||||
from pathlib import Path
|
from pathlib import Path
|
||||||
from queue import Queue
|
from queue import Queue
|
||||||
from typing import Any, Callable, Dict, Iterable, List, Optional, Tuple
|
from typing import Any
|
||||||
|
|
||||||
from test_driver.logger import AbstractLogger
|
from test_driver.logger import AbstractLogger
|
||||||
|
|
||||||
|
@ -91,7 +92,7 @@ def make_command(args: list) -> str:
|
||||||
|
|
||||||
def _perform_ocr_on_screenshot(
|
def _perform_ocr_on_screenshot(
|
||||||
screenshot_path: str, model_ids: Iterable[int]
|
screenshot_path: str, model_ids: Iterable[int]
|
||||||
) -> List[str]:
|
) -> list[str]:
|
||||||
if shutil.which("tesseract") is None:
|
if shutil.which("tesseract") is None:
|
||||||
raise Exception("OCR requested but enableOCR is false")
|
raise Exception("OCR requested but enableOCR is false")
|
||||||
|
|
||||||
|
@ -248,19 +249,19 @@ class Machine:
|
||||||
start_command: StartCommand
|
start_command: StartCommand
|
||||||
keep_vm_state: bool
|
keep_vm_state: bool
|
||||||
|
|
||||||
process: Optional[subprocess.Popen]
|
process: subprocess.Popen | None
|
||||||
pid: Optional[int]
|
pid: int | None
|
||||||
monitor: Optional[socket.socket]
|
monitor: socket.socket | None
|
||||||
qmp_client: Optional[QMPSession]
|
qmp_client: QMPSession | None
|
||||||
shell: Optional[socket.socket]
|
shell: socket.socket | None
|
||||||
serial_thread: Optional[threading.Thread]
|
serial_thread: threading.Thread | None
|
||||||
|
|
||||||
booted: bool
|
booted: bool
|
||||||
connected: bool
|
connected: bool
|
||||||
# Store last serial console lines for use
|
# Store last serial console lines for use
|
||||||
# of wait_for_console_text
|
# of wait_for_console_text
|
||||||
last_lines: Queue = Queue()
|
last_lines: Queue = Queue()
|
||||||
callbacks: List[Callable]
|
callbacks: list[Callable]
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
def __repr__(self) -> str:
|
||||||
return f"<Machine '{self.name}'>"
|
return f"<Machine '{self.name}'>"
|
||||||
|
@ -273,7 +274,7 @@ class Machine:
|
||||||
logger: AbstractLogger,
|
logger: AbstractLogger,
|
||||||
name: str = "machine",
|
name: str = "machine",
|
||||||
keep_vm_state: bool = False,
|
keep_vm_state: bool = False,
|
||||||
callbacks: Optional[List[Callable]] = None,
|
callbacks: list[Callable] | None = None,
|
||||||
) -> None:
|
) -> None:
|
||||||
self.out_dir = out_dir
|
self.out_dir = out_dir
|
||||||
self.tmp_dir = tmp_dir
|
self.tmp_dir = tmp_dir
|
||||||
|
@ -314,7 +315,7 @@ class Machine:
|
||||||
def log_serial(self, msg: str) -> None:
|
def log_serial(self, msg: str) -> None:
|
||||||
self.logger.log_serial(msg, self.name)
|
self.logger.log_serial(msg, self.name)
|
||||||
|
|
||||||
def nested(self, msg: str, attrs: Dict[str, str] = {}) -> _GeneratorContextManager:
|
def nested(self, msg: str, attrs: dict[str, str] = {}) -> _GeneratorContextManager:
|
||||||
my_attrs = {"machine": self.name}
|
my_attrs = {"machine": self.name}
|
||||||
my_attrs.update(attrs)
|
my_attrs.update(attrs)
|
||||||
return self.logger.nested(msg, my_attrs)
|
return self.logger.nested(msg, my_attrs)
|
||||||
|
@ -343,7 +344,7 @@ class Machine:
|
||||||
return self.wait_for_monitor_prompt()
|
return self.wait_for_monitor_prompt()
|
||||||
|
|
||||||
def wait_for_unit(
|
def wait_for_unit(
|
||||||
self, unit: str, user: Optional[str] = None, timeout: int = 900
|
self, unit: str, user: str | None = None, timeout: int = 900
|
||||||
) -> None:
|
) -> None:
|
||||||
"""
|
"""
|
||||||
Wait for a systemd unit to get into "active" state.
|
Wait for a systemd unit to get into "active" state.
|
||||||
|
@ -373,7 +374,7 @@ class Machine:
|
||||||
):
|
):
|
||||||
retry(check_active, timeout)
|
retry(check_active, timeout)
|
||||||
|
|
||||||
def get_unit_info(self, unit: str, user: Optional[str] = None) -> Dict[str, str]:
|
def get_unit_info(self, unit: str, user: str | None = None) -> dict[str, str]:
|
||||||
status, lines = self.systemctl(f'--no-pager show "{unit}"', user)
|
status, lines = self.systemctl(f'--no-pager show "{unit}"', user)
|
||||||
if status != 0:
|
if status != 0:
|
||||||
raise Exception(
|
raise Exception(
|
||||||
|
@ -384,7 +385,7 @@ class Machine:
|
||||||
|
|
||||||
line_pattern = re.compile(r"^([^=]+)=(.*)$")
|
line_pattern = re.compile(r"^([^=]+)=(.*)$")
|
||||||
|
|
||||||
def tuple_from_line(line: str) -> Tuple[str, str]:
|
def tuple_from_line(line: str) -> tuple[str, str]:
|
||||||
match = line_pattern.match(line)
|
match = line_pattern.match(line)
|
||||||
assert match is not None
|
assert match is not None
|
||||||
return match[1], match[2]
|
return match[1], match[2]
|
||||||
|
@ -399,7 +400,7 @@ class Machine:
|
||||||
self,
|
self,
|
||||||
unit: str,
|
unit: str,
|
||||||
property: str,
|
property: str,
|
||||||
user: Optional[str] = None,
|
user: str | None = None,
|
||||||
) -> str:
|
) -> str:
|
||||||
status, lines = self.systemctl(
|
status, lines = self.systemctl(
|
||||||
f'--no-pager show "{unit}" --property="{property}"',
|
f'--no-pager show "{unit}" --property="{property}"',
|
||||||
|
@ -424,7 +425,7 @@ class Machine:
|
||||||
assert match[1] == property, invalid_output_message
|
assert match[1] == property, invalid_output_message
|
||||||
return match[2]
|
return match[2]
|
||||||
|
|
||||||
def systemctl(self, q: str, user: Optional[str] = None) -> Tuple[int, str]:
|
def systemctl(self, q: str, user: str | None = None) -> tuple[int, str]:
|
||||||
"""
|
"""
|
||||||
Runs `systemctl` commands with optional support for
|
Runs `systemctl` commands with optional support for
|
||||||
`systemctl --user`
|
`systemctl --user`
|
||||||
|
@ -480,8 +481,8 @@ class Machine:
|
||||||
command: str,
|
command: str,
|
||||||
check_return: bool = True,
|
check_return: bool = True,
|
||||||
check_output: bool = True,
|
check_output: bool = True,
|
||||||
timeout: Optional[int] = 900,
|
timeout: int | None = 900,
|
||||||
) -> Tuple[int, str]:
|
) -> tuple[int, str]:
|
||||||
"""
|
"""
|
||||||
Execute a shell command, returning a list `(status, stdout)`.
|
Execute a shell command, returning a list `(status, stdout)`.
|
||||||
|
|
||||||
|
@ -548,7 +549,7 @@ class Machine:
|
||||||
|
|
||||||
return (rc, output.decode(errors="replace"))
|
return (rc, output.decode(errors="replace"))
|
||||||
|
|
||||||
def shell_interact(self, address: Optional[str] = None) -> None:
|
def shell_interact(self, address: str | None = None) -> None:
|
||||||
"""
|
"""
|
||||||
Allows you to directly interact with the guest shell. This should
|
Allows you to directly interact with the guest shell. This should
|
||||||
only be used during test development, not in production tests.
|
only be used during test development, not in production tests.
|
||||||
|
@ -595,7 +596,7 @@ class Machine:
|
||||||
break
|
break
|
||||||
self.send_console(char.decode())
|
self.send_console(char.decode())
|
||||||
|
|
||||||
def succeed(self, *commands: str, timeout: Optional[int] = None) -> str:
|
def succeed(self, *commands: str, timeout: int | None = None) -> str:
|
||||||
"""
|
"""
|
||||||
Execute a shell command, raising an exception if the exit status is
|
Execute a shell command, raising an exception if the exit status is
|
||||||
not zero, otherwise returning the standard output. Similar to `execute`,
|
not zero, otherwise returning the standard output. Similar to `execute`,
|
||||||
|
@ -612,7 +613,7 @@ class Machine:
|
||||||
output += out
|
output += out
|
||||||
return output
|
return output
|
||||||
|
|
||||||
def fail(self, *commands: str, timeout: Optional[int] = None) -> str:
|
def fail(self, *commands: str, timeout: int | None = None) -> str:
|
||||||
"""
|
"""
|
||||||
Like `succeed`, but raising an exception if the command returns a zero
|
Like `succeed`, but raising an exception if the command returns a zero
|
||||||
status.
|
status.
|
||||||
|
@ -724,7 +725,7 @@ class Machine:
|
||||||
with self.nested(f"waiting for {regexp} to appear on tty {tty}"):
|
with self.nested(f"waiting for {regexp} to appear on tty {tty}"):
|
||||||
retry(tty_matches, timeout)
|
retry(tty_matches, timeout)
|
||||||
|
|
||||||
def send_chars(self, chars: str, delay: Optional[float] = 0.01) -> None:
|
def send_chars(self, chars: str, delay: float | None = 0.01) -> None:
|
||||||
"""
|
"""
|
||||||
Simulate typing a sequence of characters on the virtual keyboard,
|
Simulate typing a sequence of characters on the virtual keyboard,
|
||||||
e.g., `send_chars("foobar\n")` will type the string `foobar`
|
e.g., `send_chars("foobar\n")` will type the string `foobar`
|
||||||
|
@ -798,10 +799,10 @@ class Machine:
|
||||||
with self.nested(f"waiting for TCP port {port} on {addr} to be closed"):
|
with self.nested(f"waiting for TCP port {port} on {addr} to be closed"):
|
||||||
retry(port_is_closed, timeout)
|
retry(port_is_closed, timeout)
|
||||||
|
|
||||||
def start_job(self, jobname: str, user: Optional[str] = None) -> Tuple[int, str]:
|
def start_job(self, jobname: str, user: str | None = None) -> tuple[int, str]:
|
||||||
return self.systemctl(f"start {jobname}", user)
|
return self.systemctl(f"start {jobname}", user)
|
||||||
|
|
||||||
def stop_job(self, jobname: str, user: Optional[str] = None) -> Tuple[int, str]:
|
def stop_job(self, jobname: str, user: str | None = None) -> tuple[int, str]:
|
||||||
return self.systemctl(f"stop {jobname}", user)
|
return self.systemctl(f"stop {jobname}", user)
|
||||||
|
|
||||||
def wait_for_job(self, jobname: str) -> None:
|
def wait_for_job(self, jobname: str) -> None:
|
||||||
|
@ -942,13 +943,13 @@ class Machine:
|
||||||
"""Debugging: Dump the contents of the TTY<n>"""
|
"""Debugging: Dump the contents of the TTY<n>"""
|
||||||
self.execute(f"fold -w 80 /dev/vcs{tty} | systemd-cat")
|
self.execute(f"fold -w 80 /dev/vcs{tty} | systemd-cat")
|
||||||
|
|
||||||
def _get_screen_text_variants(self, model_ids: Iterable[int]) -> List[str]:
|
def _get_screen_text_variants(self, model_ids: Iterable[int]) -> list[str]:
|
||||||
with tempfile.TemporaryDirectory() as tmpdir:
|
with tempfile.TemporaryDirectory() as tmpdir:
|
||||||
screenshot_path = os.path.join(tmpdir, "ppm")
|
screenshot_path = os.path.join(tmpdir, "ppm")
|
||||||
self.send_monitor_command(f"screendump {screenshot_path}")
|
self.send_monitor_command(f"screendump {screenshot_path}")
|
||||||
return _perform_ocr_on_screenshot(screenshot_path, model_ids)
|
return _perform_ocr_on_screenshot(screenshot_path, model_ids)
|
||||||
|
|
||||||
def get_screen_text_variants(self) -> List[str]:
|
def get_screen_text_variants(self) -> list[str]:
|
||||||
"""
|
"""
|
||||||
Return a list of different interpretations of what is currently
|
Return a list of different interpretations of what is currently
|
||||||
visible on the machine's screen using optical character
|
visible on the machine's screen using optical character
|
||||||
|
@ -1028,7 +1029,7 @@ class Machine:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
def send_key(
|
def send_key(
|
||||||
self, key: str, delay: Optional[float] = 0.01, log: Optional[bool] = True
|
self, key: str, delay: float | None = 0.01, log: bool | None = True
|
||||||
) -> None:
|
) -> None:
|
||||||
"""
|
"""
|
||||||
Simulate pressing keys on the virtual keyboard, e.g.,
|
Simulate pressing keys on the virtual keyboard, e.g.,
|
||||||
|
@ -1168,7 +1169,7 @@ class Machine:
|
||||||
with self.nested("waiting for the X11 server"):
|
with self.nested("waiting for the X11 server"):
|
||||||
retry(check_x, timeout)
|
retry(check_x, timeout)
|
||||||
|
|
||||||
def get_window_names(self) -> List[str]:
|
def get_window_names(self) -> list[str]:
|
||||||
return self.succeed(
|
return self.succeed(
|
||||||
r"xwininfo -root -tree | sed 's/.*0x[0-9a-f]* \"\([^\"]*\)\".*/\1/; t; d'"
|
r"xwininfo -root -tree | sed 's/.*0x[0-9a-f]* \"\([^\"]*\)\".*/\1/; t; d'"
|
||||||
).splitlines()
|
).splitlines()
|
||||||
|
|
|
@ -1,6 +1,6 @@
|
||||||
import time
|
import time
|
||||||
|
from collections.abc import Callable
|
||||||
from math import isfinite
|
from math import isfinite
|
||||||
from typing import Callable, Optional
|
|
||||||
|
|
||||||
from test_driver.logger import AbstractLogger
|
from test_driver.logger import AbstractLogger
|
||||||
|
|
||||||
|
@ -12,7 +12,7 @@ class PollingConditionError(Exception):
|
||||||
class PollingCondition:
|
class PollingCondition:
|
||||||
condition: Callable[[], bool]
|
condition: Callable[[], bool]
|
||||||
seconds_interval: float
|
seconds_interval: float
|
||||||
description: Optional[str]
|
description: str | None
|
||||||
logger: AbstractLogger
|
logger: AbstractLogger
|
||||||
|
|
||||||
last_called: float
|
last_called: float
|
||||||
|
@ -20,10 +20,10 @@ class PollingCondition:
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
condition: Callable[[], Optional[bool]],
|
condition: Callable[[], bool | None],
|
||||||
logger: AbstractLogger,
|
logger: AbstractLogger,
|
||||||
seconds_interval: float = 2.0,
|
seconds_interval: float = 2.0,
|
||||||
description: Optional[str] = None,
|
description: str | None = None,
|
||||||
):
|
):
|
||||||
self.condition = condition # type: ignore
|
self.condition = condition # type: ignore
|
||||||
self.seconds_interval = seconds_interval
|
self.seconds_interval = seconds_interval
|
||||||
|
|
|
@ -343,6 +343,25 @@ utils = rec {
|
||||||
in
|
in
|
||||||
filter (x: !(elem (getName x) namesToRemove)) packages;
|
filter (x: !(elem (getName x) namesToRemove)) packages;
|
||||||
|
|
||||||
|
/* Returns false if a package with the same name as the `package` is present in `packagesToDisable`.
|
||||||
|
|
||||||
|
Type:
|
||||||
|
disablePackageByName :: package -> [package] -> bool
|
||||||
|
|
||||||
|
Example:
|
||||||
|
disablePackageByName file-roller [ file-roller totem ]
|
||||||
|
=> false
|
||||||
|
|
||||||
|
Example:
|
||||||
|
disablePackageByName nautilus [ file-roller totem ]
|
||||||
|
=> true
|
||||||
|
*/
|
||||||
|
disablePackageByName = package: packagesToDisable:
|
||||||
|
let
|
||||||
|
namesToDisable = map getName packagesToDisable;
|
||||||
|
in
|
||||||
|
!elem (getName package) namesToDisable;
|
||||||
|
|
||||||
systemdUtils = {
|
systemdUtils = {
|
||||||
lib = import ./systemd-lib.nix { inherit lib config pkgs utils; };
|
lib = import ./systemd-lib.nix { inherit lib config pkgs utils; };
|
||||||
unitOptions = import ./systemd-unit-options.nix { inherit lib systemdUtils; };
|
unitOptions = import ./systemd-unit-options.nix { inherit lib systemdUtils; };
|
||||||
|
|
|
@ -27,9 +27,6 @@
|
||||||
# This should not contain packages that are broken or can't build, since it
|
# This should not contain packages that are broken or can't build, since it
|
||||||
# will break this expression
|
# will break this expression
|
||||||
#
|
#
|
||||||
# Currently broken packages:
|
|
||||||
# - contour
|
|
||||||
#
|
|
||||||
# can be generated with:
|
# can be generated with:
|
||||||
# lib.attrNames (lib.filterAttrs
|
# lib.attrNames (lib.filterAttrs
|
||||||
# (_: drv: (builtins.tryEval (lib.isDerivation drv && drv ? terminfo)).value)
|
# (_: drv: (builtins.tryEval (lib.isDerivation drv && drv ? terminfo)).value)
|
||||||
|
@ -39,6 +36,7 @@
|
||||||
with pkgs.pkgsBuildBuild;
|
with pkgs.pkgsBuildBuild;
|
||||||
[
|
[
|
||||||
alacritty
|
alacritty
|
||||||
|
contour
|
||||||
foot
|
foot
|
||||||
kitty
|
kitty
|
||||||
mtm
|
mtm
|
||||||
|
|
38
nixos/modules/hardware/coral.nix
Normal file
38
nixos/modules/hardware/coral.nix
Normal file
|
@ -0,0 +1,38 @@
|
||||||
|
{
|
||||||
|
config,
|
||||||
|
lib,
|
||||||
|
pkgs,
|
||||||
|
...
|
||||||
|
}:
|
||||||
|
|
||||||
|
let
|
||||||
|
inherit (lib)
|
||||||
|
mkEnableOption
|
||||||
|
mkIf
|
||||||
|
mkMerge
|
||||||
|
;
|
||||||
|
|
||||||
|
cfg = config.hardware.coral;
|
||||||
|
in
|
||||||
|
|
||||||
|
{
|
||||||
|
options.hardware.coral = {
|
||||||
|
usb.enable = mkEnableOption "Coral USB support";
|
||||||
|
pcie.enable = mkEnableOption "Coral PCIe support";
|
||||||
|
};
|
||||||
|
|
||||||
|
config = mkMerge [
|
||||||
|
(mkIf (cfg.usb.enable || cfg.pcie.enable) {
|
||||||
|
users.groups.coral = { };
|
||||||
|
})
|
||||||
|
(mkIf cfg.usb.enable {
|
||||||
|
services.udev.packages = with pkgs; [ libedgetpu ];
|
||||||
|
})
|
||||||
|
(mkIf cfg.pcie.enable {
|
||||||
|
boot.extraModulePackages = with config.boot.kernelPackages; [ gasket ];
|
||||||
|
services.udev.extraRules = ''
|
||||||
|
SUBSYSTEM=="apex",MODE="0660",GROUP="coral"
|
||||||
|
'';
|
||||||
|
})
|
||||||
|
];
|
||||||
|
}
|
|
@ -1,15 +0,0 @@
|
||||||
{ config, lib, pkgs, ... }:
|
|
||||||
let
|
|
||||||
cfg = config.hardware.gkraken;
|
|
||||||
in
|
|
||||||
{
|
|
||||||
options.hardware.gkraken = {
|
|
||||||
enable = lib.mkEnableOption "gkraken's udev rules for NZXT AIO liquid coolers";
|
|
||||||
};
|
|
||||||
|
|
||||||
config = lib.mkIf cfg.enable {
|
|
||||||
services.udev.packages = with pkgs; [
|
|
||||||
gkraken
|
|
||||||
];
|
|
||||||
};
|
|
||||||
}
|
|
|
@ -1,12 +1,9 @@
|
||||||
{ config, pkgs, lib, ... }:
|
{ config, pkgs, lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
imcfg = config.i18n.inputMethod;
|
imcfg = config.i18n.inputMethod;
|
||||||
in
|
in
|
||||||
{
|
{
|
||||||
config = mkIf (imcfg.enable && imcfg.type == "hime") {
|
config = lib.mkIf (imcfg.enable && imcfg.type == "hime") {
|
||||||
i18n.inputMethod.package = pkgs.hime;
|
i18n.inputMethod.package = pkgs.hime;
|
||||||
environment.variables = {
|
environment.variables = {
|
||||||
GTK_IM_MODULE = "hime";
|
GTK_IM_MODULE = "hime";
|
||||||
|
|
|
@ -1,7 +1,4 @@
|
||||||
{ config, pkgs, lib, ... }:
|
{ config, pkgs, lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
imcfg = config.i18n.inputMethod;
|
imcfg = config.i18n.inputMethod;
|
||||||
cfg = imcfg.ibus;
|
cfg = imcfg.ibus;
|
||||||
|
@ -9,10 +6,10 @@ let
|
||||||
ibusEngine = lib.types.mkOptionType {
|
ibusEngine = lib.types.mkOptionType {
|
||||||
name = "ibus-engine";
|
name = "ibus-engine";
|
||||||
inherit (lib.types.package) descriptionClass merge;
|
inherit (lib.types.package) descriptionClass merge;
|
||||||
check = x: (lib.types.package.check x) && (attrByPath ["meta" "isIbusEngine"] false x);
|
check = x: (lib.types.package.check x) && (lib.attrByPath ["meta" "isIbusEngine"] false x);
|
||||||
};
|
};
|
||||||
|
|
||||||
impanel = optionalString (cfg.panel != null) "--panel=${cfg.panel}";
|
impanel = lib.optionalString (cfg.panel != null) "--panel=${cfg.panel}";
|
||||||
|
|
||||||
ibusAutostart = pkgs.writeTextFile {
|
ibusAutostart = pkgs.writeTextFile {
|
||||||
name = "autostart-ibus-daemon";
|
name = "autostart-ibus-daemon";
|
||||||
|
@ -29,32 +26,32 @@ let
|
||||||
in
|
in
|
||||||
{
|
{
|
||||||
imports = [
|
imports = [
|
||||||
(mkRenamedOptionModule [ "programs" "ibus" "plugins" ] [ "i18n" "inputMethod" "ibus" "engines" ])
|
(lib.mkRenamedOptionModule [ "programs" "ibus" "plugins" ] [ "i18n" "inputMethod" "ibus" "engines" ])
|
||||||
];
|
];
|
||||||
|
|
||||||
options = {
|
options = {
|
||||||
i18n.inputMethod.ibus = {
|
i18n.inputMethod.ibus = {
|
||||||
engines = mkOption {
|
engines = lib.mkOption {
|
||||||
type = with types; listOf ibusEngine;
|
type = with lib.types; listOf ibusEngine;
|
||||||
default = [];
|
default = [];
|
||||||
example = literalExpression "with pkgs.ibus-engines; [ mozc hangul ]";
|
example = lib.literalExpression "with pkgs.ibus-engines; [ mozc hangul ]";
|
||||||
description =
|
description =
|
||||||
let
|
let
|
||||||
enginesDrv = filterAttrs (const isDerivation) pkgs.ibus-engines;
|
enginesDrv = lib.filterAttrs (lib.const lib.isDerivation) pkgs.ibus-engines;
|
||||||
engines = concatStringsSep ", "
|
engines = lib.concatStringsSep ", "
|
||||||
(map (name: "`${name}`") (attrNames enginesDrv));
|
(map (name: "`${name}`") (lib.attrNames enginesDrv));
|
||||||
in "Enabled IBus engines. Available engines are: ${engines}.";
|
in "Enabled IBus engines. Available engines are: ${engines}.";
|
||||||
};
|
};
|
||||||
panel = mkOption {
|
panel = lib.mkOption {
|
||||||
type = with types; nullOr path;
|
type = with lib.types; nullOr path;
|
||||||
default = null;
|
default = null;
|
||||||
example = literalExpression ''"''${pkgs.plasma5Packages.plasma-desktop}/libexec/kimpanel-ibus-panel"'';
|
example = lib.literalExpression ''"''${pkgs.plasma5Packages.plasma-desktop}/libexec/kimpanel-ibus-panel"'';
|
||||||
description = "Replace the IBus panel with another panel.";
|
description = "Replace the IBus panel with another panel.";
|
||||||
};
|
};
|
||||||
};
|
};
|
||||||
};
|
};
|
||||||
|
|
||||||
config = mkIf (imcfg.enable && imcfg.type == "ibus") {
|
config = lib.mkIf (imcfg.enable && imcfg.type == "ibus") {
|
||||||
i18n.inputMethod.package = ibusPackage;
|
i18n.inputMethod.package = ibusPackage;
|
||||||
|
|
||||||
environment.systemPackages = [
|
environment.systemPackages = [
|
||||||
|
@ -76,7 +73,7 @@ in
|
||||||
XMODIFIERS = "@im=ibus";
|
XMODIFIERS = "@im=ibus";
|
||||||
};
|
};
|
||||||
|
|
||||||
xdg.portal.extraPortals = mkIf config.xdg.portal.enable [
|
xdg.portal.extraPortals = lib.mkIf config.xdg.portal.enable [
|
||||||
ibusPackage
|
ibusPackage
|
||||||
];
|
];
|
||||||
};
|
};
|
||||||
|
|
|
@ -1,11 +1,9 @@
|
||||||
{ config, pkgs, lib, ... }:
|
{ config, pkgs, lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
let
|
let
|
||||||
imcfg = config.i18n.inputMethod;
|
imcfg = config.i18n.inputMethod;
|
||||||
in
|
in
|
||||||
{
|
{
|
||||||
config = mkIf (imcfg.enable && imcfg.type == "nabi") {
|
config = lib.mkIf (imcfg.enable && imcfg.type == "nabi") {
|
||||||
i18n.inputMethod.package = pkgs.nabi;
|
i18n.inputMethod.package = pkgs.nabi;
|
||||||
|
|
||||||
environment.variables = {
|
environment.variables = {
|
||||||
|
|
|
@ -1,7 +1,4 @@
|
||||||
{ config, pkgs, lib, ... }:
|
{ config, pkgs, lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
imcfg = config.i18n.inputMethod;
|
imcfg = config.i18n.inputMethod;
|
||||||
cfg = imcfg.uim;
|
cfg = imcfg.uim;
|
||||||
|
@ -10,8 +7,8 @@ in
|
||||||
options = {
|
options = {
|
||||||
|
|
||||||
i18n.inputMethod.uim = {
|
i18n.inputMethod.uim = {
|
||||||
toolbar = mkOption {
|
toolbar = lib.mkOption {
|
||||||
type = types.enum [ "gtk" "gtk3" "gtk-systray" "gtk3-systray" "qt5" ];
|
type = lib.types.enum [ "gtk" "gtk3" "gtk-systray" "gtk3-systray" "qt5" ];
|
||||||
default = "gtk";
|
default = "gtk";
|
||||||
example = "gtk-systray";
|
example = "gtk-systray";
|
||||||
description = ''
|
description = ''
|
||||||
|
@ -22,7 +19,7 @@ in
|
||||||
|
|
||||||
};
|
};
|
||||||
|
|
||||||
config = mkIf (imcfg.enable && imcfg.type == "uim") {
|
config = lib.mkIf (imcfg.enable && imcfg.type == "uim") {
|
||||||
i18n.inputMethod.package = pkgs.uim;
|
i18n.inputMethod.package = pkgs.uim;
|
||||||
|
|
||||||
environment.variables = {
|
environment.variables = {
|
||||||
|
|
48
nixos/modules/image/file-options.nix
Normal file
48
nixos/modules/image/file-options.nix
Normal file
|
@ -0,0 +1,48 @@
|
||||||
|
{
|
||||||
|
lib,
|
||||||
|
config,
|
||||||
|
pkgs,
|
||||||
|
...
|
||||||
|
}:
|
||||||
|
{
|
||||||
|
options.image = {
|
||||||
|
baseName = lib.mkOption {
|
||||||
|
type = lib.types.str;
|
||||||
|
default = "nixos-image-${config.system.nixos.label}-${pkgs.stdenv.hostPlatform.system}";
|
||||||
|
description = ''
|
||||||
|
Basename of the image filename without any extension (e.g. `image_1`).
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
|
||||||
|
extension = lib.mkOption {
|
||||||
|
type = lib.types.str;
|
||||||
|
description = ''
|
||||||
|
Extension of the image filename (e.g. `raw`).
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
|
||||||
|
# FIXME: this should be marked readOnly, when there are no
|
||||||
|
# mkRenamedOptionModuleWith calls with `image.fileName` as
|
||||||
|
# as a target left anymore (i.e. 24.11). We can't do it
|
||||||
|
# before, as some source options where writable before.
|
||||||
|
# Those should use image.baseName and image.extension instead.
|
||||||
|
fileName = lib.mkOption {
|
||||||
|
type = lib.types.str;
|
||||||
|
default = "${config.image.baseName}.${config.image.extension}";
|
||||||
|
description = ''
|
||||||
|
Filename of the image including all extensions (e.g `image_1.raw` or
|
||||||
|
`image_1.raw.zst`).
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
|
||||||
|
filePath = lib.mkOption {
|
||||||
|
type = lib.types.str;
|
||||||
|
default = config.image.fileName;
|
||||||
|
description = ''
|
||||||
|
Path of the image, relative to `$out` in `system.build.image`.
|
||||||
|
While it defaults to `config.image.fileName`, it can be different for builders where
|
||||||
|
the image is in sub directory, such as `iso`, `sd-card` or `kexec` images.
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
};
|
||||||
|
}
|
70
nixos/modules/image/images.nix
Normal file
70
nixos/modules/image/images.nix
Normal file
|
@ -0,0 +1,70 @@
|
||||||
|
{
|
||||||
|
config,
|
||||||
|
lib,
|
||||||
|
pkgs,
|
||||||
|
extendModules,
|
||||||
|
...
|
||||||
|
}:
|
||||||
|
let
|
||||||
|
inherit (lib) types;
|
||||||
|
|
||||||
|
imageModules = {
|
||||||
|
azure = [ ../virtualisation/azure-image.nix ];
|
||||||
|
digital-ocean = [ ../virtualisation/digital-ocean-image.nix ];
|
||||||
|
google-compute = [ ../virtualisation/google-compute-image.nix ];
|
||||||
|
hyperv = [ ../virtualisation/hyperv-image.nix ];
|
||||||
|
linode = [ ../virtualisation/linode-image.nix ];
|
||||||
|
lxc = [ ../virtualisation/lxc-container.nix ];
|
||||||
|
lxc-metadata = [ ../virtualisation/lxc-image-metadata.nix ];
|
||||||
|
oci = [ ../virtualisation/oci-image.nix ];
|
||||||
|
proxmox = [ ../virtualisation/proxmox-image.nix ];
|
||||||
|
kubevirt = [ ../virtualisation/kubevirt.nix ];
|
||||||
|
vagrant-virtualbox = [ ../virtualisation/vagrant-virtualbox-image.nix ];
|
||||||
|
virtualbox = [ ../virtualisation/virtualbox-image.nix ];
|
||||||
|
vmware = [ ../virtualisation/vmware-image.nix ];
|
||||||
|
};
|
||||||
|
imageConfigs = lib.mapAttrs (
|
||||||
|
name: modules:
|
||||||
|
extendModules {
|
||||||
|
inherit modules;
|
||||||
|
}
|
||||||
|
) config.image.modules;
|
||||||
|
in
|
||||||
|
{
|
||||||
|
options = {
|
||||||
|
system.build = {
|
||||||
|
images = lib.mkOption {
|
||||||
|
type = types.lazyAttrsOf types.raw;
|
||||||
|
readOnly = true;
|
||||||
|
description = ''
|
||||||
|
Different target images generated for this NixOS configuration.
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
};
|
||||||
|
image.modules = lib.mkOption {
|
||||||
|
type = types.attrsOf (types.listOf types.deferredModule);
|
||||||
|
description = ''
|
||||||
|
image-specific NixOS Modules used for `system.build.images`.
|
||||||
|
'';
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
config.image.modules = lib.mkIf (!config.system.build ? image) imageModules;
|
||||||
|
config.system.build.images = lib.mkIf (!config.system.build ? image) (
|
||||||
|
lib.mapAttrs (
|
||||||
|
name: nixos:
|
||||||
|
let
|
||||||
|
inherit (nixos) config;
|
||||||
|
inherit (config.image) filePath;
|
||||||
|
builder =
|
||||||
|
config.system.build.image
|
||||||
|
or (throw "Module for `system.build.images.${name}` misses required `system.build.image` option.");
|
||||||
|
in
|
||||||
|
lib.recursiveUpdate builder {
|
||||||
|
passthru = {
|
||||||
|
inherit config filePath;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
) imageConfigs
|
||||||
|
);
|
||||||
|
}
|
|
@ -42,5 +42,11 @@
|
||||||
done
|
done
|
||||||
'';
|
'';
|
||||||
|
|
||||||
|
environment.defaultPackages = with pkgs; [
|
||||||
|
rsync
|
||||||
|
];
|
||||||
|
|
||||||
|
programs.git.enable = lib.mkDefault true;
|
||||||
|
|
||||||
system.stateVersion = lib.mkDefault lib.trivial.release;
|
system.stateVersion = lib.mkDefault lib.trivial.release;
|
||||||
}
|
}
|
||||||
|
|
|
@ -49,10 +49,6 @@
|
||||||
vim
|
vim
|
||||||
nano
|
nano
|
||||||
|
|
||||||
# Include some version control tools.
|
|
||||||
git
|
|
||||||
rsync
|
|
||||||
|
|
||||||
# Firefox for reading the manual.
|
# Firefox for reading the manual.
|
||||||
firefox
|
firefox
|
||||||
|
|
||||||
|
|
|
@ -335,12 +335,14 @@ let
|
||||||
set textmode=true
|
set textmode=true
|
||||||
terminal_output console
|
terminal_output console
|
||||||
}
|
}
|
||||||
|
|
||||||
|
${lib.optionalString (config.isoImage.grubTheme != null) ''
|
||||||
hiddenentry 'GUI mode' --hotkey 'g' {
|
hiddenentry 'GUI mode' --hotkey 'g' {
|
||||||
$(find ${config.isoImage.grubTheme} -iname '*.pf2' -printf "loadfont (\$root)/EFI/BOOT/grub-theme/%P\n")
|
$(find ${config.isoImage.grubTheme} -iname '*.pf2' -printf "loadfont (\$root)/EFI/BOOT/grub-theme/%P\n")
|
||||||
set textmode=false
|
set textmode=false
|
||||||
terminal_output gfxterm
|
terminal_output gfxterm
|
||||||
}
|
}
|
||||||
|
''}
|
||||||
|
|
||||||
# If the parameter iso_path is set, append the findiso parameter to the kernel
|
# If the parameter iso_path is set, append the findiso parameter to the kernel
|
||||||
# line. We need this to allow the nixos iso to be booted from grub directly.
|
# line. We need this to allow the nixos iso to be booted from grub directly.
|
||||||
|
|
|
@ -131,18 +131,30 @@ with lib;
|
||||||
|
|
||||||
boot.loader.timeout = 10;
|
boot.loader.timeout = 10;
|
||||||
|
|
||||||
boot.postBootCommands =
|
boot.postBootCommands = ''
|
||||||
''
|
# After booting, register the contents of the Nix store
|
||||||
# After booting, register the contents of the Nix store
|
# in the Nix database in the tmpfs.
|
||||||
# in the Nix database in the tmpfs.
|
${config.nix.package}/bin/nix-store --load-db < /nix/store/nix-path-registration
|
||||||
${config.nix.package}/bin/nix-store --load-db < /nix/store/nix-path-registration
|
|
||||||
|
|
||||||
# nixos-rebuild also requires a "system" profile and an
|
# nixos-rebuild also requires a "system" profile and an
|
||||||
# /etc/NIXOS tag.
|
# /etc/NIXOS tag.
|
||||||
touch /etc/NIXOS
|
touch /etc/NIXOS
|
||||||
${config.nix.package}/bin/nix-env -p /nix/var/nix/profiles/system --set /run/current-system
|
${config.nix.package}/bin/nix-env -p /nix/var/nix/profiles/system --set /run/current-system
|
||||||
'';
|
|
||||||
|
|
||||||
|
# Set password for user nixos if specified on cmdline
|
||||||
|
# Allows using nixos-anywhere in headless environments
|
||||||
|
for o in $(</proc/cmdline); do
|
||||||
|
case "$o" in
|
||||||
|
live.nixos.passwordHash=*)
|
||||||
|
set -- $(IFS==; echo $o)
|
||||||
|
${pkgs.gnugrep}/bin/grep -q "root::" /etc/shadow && ${pkgs.shadow}/bin/usermod -p "$2" root
|
||||||
|
;;
|
||||||
|
live.nixos.password=*)
|
||||||
|
set -- $(IFS==; echo $o)
|
||||||
|
${pkgs.gnugrep}/bin/grep -q "root::" /etc/shadow && echo "root:$2" | ${pkgs.shadow}/bin/chpasswd
|
||||||
|
;;
|
||||||
|
esac
|
||||||
|
done
|
||||||
|
'';
|
||||||
};
|
};
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,6 +17,10 @@
|
||||||
sdImage = {
|
sdImage = {
|
||||||
populateFirmwareCommands = let
|
populateFirmwareCommands = let
|
||||||
configTxt = pkgs.writeText "config.txt" ''
|
configTxt = pkgs.writeText "config.txt" ''
|
||||||
|
# u-boot refuses to start (gets stuck at rainbow polygon) without this,
|
||||||
|
# at least on Raspberry Pi 0.
|
||||||
|
enable_uart=1
|
||||||
|
|
||||||
# Prevent the firmware from smashing the framebuffer setup done by the mainline kernel
|
# Prevent the firmware from smashing the framebuffer setup done by the mainline kernel
|
||||||
# when attempting to show low-voltage or overtemperature warnings.
|
# when attempting to show low-voltage or overtemperature warnings.
|
||||||
avoid_warnings=1
|
avoid_warnings=1
|
||||||
|
@ -28,7 +32,7 @@
|
||||||
kernel=u-boot-rpi1.bin
|
kernel=u-boot-rpi1.bin
|
||||||
'';
|
'';
|
||||||
in ''
|
in ''
|
||||||
(cd ${pkgs.raspberrypifw}/share/raspberrypi/boot && cp bootcode.bin fixup*.dat start*.elf $NIX_BUILD_TOP/firmware/)
|
(cd ${pkgs.raspberrypifw}/share/raspberrypi/boot && cp bootcode.bin fixup*.dat start*.elf *.dtb $NIX_BUILD_TOP/firmware/)
|
||||||
cp ${pkgs.ubootRaspberryPiZero}/u-boot.bin firmware/u-boot-rpi0.bin
|
cp ${pkgs.ubootRaspberryPiZero}/u-boot.bin firmware/u-boot-rpi0.bin
|
||||||
cp ${pkgs.ubootRaspberryPi}/u-boot.bin firmware/u-boot-rpi1.bin
|
cp ${pkgs.ubootRaspberryPi}/u-boot.bin firmware/u-boot-rpi1.bin
|
||||||
cp ${configTxt} firmware/config.txt
|
cp ${configTxt} firmware/config.txt
|
||||||
|
|
|
@ -1,13 +1,10 @@
|
||||||
{ lib, ... }:
|
{ lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
{
|
{
|
||||||
|
|
||||||
options = {
|
options = {
|
||||||
|
|
||||||
assertions = mkOption {
|
assertions = lib.mkOption {
|
||||||
type = types.listOf types.unspecified;
|
type = lib.types.listOf lib.types.unspecified;
|
||||||
internal = true;
|
internal = true;
|
||||||
default = [];
|
default = [];
|
||||||
example = [ { assertion = false; message = "you can't enable this for that reason"; } ];
|
example = [ { assertion = false; message = "you can't enable this for that reason"; } ];
|
||||||
|
@ -18,10 +15,10 @@ with lib;
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
|
|
||||||
warnings = mkOption {
|
warnings = lib.mkOption {
|
||||||
internal = true;
|
internal = true;
|
||||||
default = [];
|
default = [];
|
||||||
type = types.listOf types.str;
|
type = lib.types.listOf lib.types.str;
|
||||||
example = [ "The `foo' service is deprecated and will go away soon!" ];
|
example = [ "The `foo' service is deprecated and will go away soon!" ];
|
||||||
description = ''
|
description = ''
|
||||||
This option allows modules to show warnings to users during
|
This option allows modules to show warnings to users during
|
||||||
|
|
|
@ -1,11 +1,8 @@
|
||||||
{ config, lib, pkgs, ... }:
|
{ config, lib, pkgs, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
crashdump = config.boot.crashDump;
|
crashdump = config.boot.crashDump;
|
||||||
|
|
||||||
kernelParams = concatStringsSep " " crashdump.kernelParams;
|
kernelParams = lib.concatStringsSep " " crashdump.kernelParams;
|
||||||
|
|
||||||
in
|
in
|
||||||
###### interface
|
###### interface
|
||||||
|
@ -13,8 +10,8 @@ in
|
||||||
options = {
|
options = {
|
||||||
boot = {
|
boot = {
|
||||||
crashDump = {
|
crashDump = {
|
||||||
enable = mkOption {
|
enable = lib.mkOption {
|
||||||
type = types.bool;
|
type = lib.types.bool;
|
||||||
default = false;
|
default = false;
|
||||||
description = ''
|
description = ''
|
||||||
If enabled, NixOS will set up a kernel that will
|
If enabled, NixOS will set up a kernel that will
|
||||||
|
@ -24,17 +21,17 @@ in
|
||||||
It also activates the NMI watchdog.
|
It also activates the NMI watchdog.
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
reservedMemory = mkOption {
|
reservedMemory = lib.mkOption {
|
||||||
default = "128M";
|
default = "128M";
|
||||||
type = types.str;
|
type = lib.types.str;
|
||||||
description = ''
|
description = ''
|
||||||
The amount of memory reserved for the crashdump kernel.
|
The amount of memory reserved for the crashdump kernel.
|
||||||
If you choose a too high value, dmesg will mention
|
If you choose a too high value, dmesg will mention
|
||||||
"crashkernel reservation failed".
|
"crashkernel reservation failed".
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
kernelParams = mkOption {
|
kernelParams = lib.mkOption {
|
||||||
type = types.listOf types.str;
|
type = lib.types.listOf lib.types.str;
|
||||||
default = [ "1" "boot.shell_on_fail" ];
|
default = [ "1" "boot.shell_on_fail" ];
|
||||||
description = ''
|
description = ''
|
||||||
Parameters that will be passed to the kernel kexec-ed on crash.
|
Parameters that will be passed to the kernel kexec-ed on crash.
|
||||||
|
@ -46,7 +43,7 @@ in
|
||||||
|
|
||||||
###### implementation
|
###### implementation
|
||||||
|
|
||||||
config = mkIf crashdump.enable {
|
config = lib.mkIf crashdump.enable {
|
||||||
boot = {
|
boot = {
|
||||||
postBootCommands = ''
|
postBootCommands = ''
|
||||||
echo "loading crashdump kernel...";
|
echo "loading crashdump kernel...";
|
||||||
|
|
|
@ -367,7 +367,13 @@ in
|
||||||
})
|
})
|
||||||
|
|
||||||
(mkIf cfg.doc.enable {
|
(mkIf cfg.doc.enable {
|
||||||
environment.pathsToLink = [ "/share/doc" ];
|
environment.pathsToLink = [
|
||||||
|
"/share/doc"
|
||||||
|
|
||||||
|
# Legacy paths used by gtk-doc & adjacent tools.
|
||||||
|
"/share/gtk-doc"
|
||||||
|
"/share/devhelp"
|
||||||
|
];
|
||||||
environment.extraOutputsToInstall = [ "doc" ] ++ optional cfg.dev.enable "devdoc";
|
environment.extraOutputsToInstall = [ "doc" ] ++ optional cfg.dev.enable "devdoc";
|
||||||
})
|
})
|
||||||
|
|
||||||
|
|
|
@ -1,7 +1,4 @@
|
||||||
{ config, lib, ... }:
|
{ config, lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
cfg = config.system.nixos;
|
cfg = config.system.nixos;
|
||||||
in
|
in
|
||||||
|
@ -10,8 +7,8 @@ in
|
||||||
|
|
||||||
options.system = {
|
options.system = {
|
||||||
|
|
||||||
nixos.label = mkOption {
|
nixos.label = lib.mkOption {
|
||||||
type = types.strMatching "[a-zA-Z0-9:_\\.-]*";
|
type = lib.types.strMatching "[a-zA-Z0-9:_\\.-]*";
|
||||||
description = ''
|
description = ''
|
||||||
NixOS version name to be used in the names of generated
|
NixOS version name to be used in the names of generated
|
||||||
outputs and boot labels.
|
outputs and boot labels.
|
||||||
|
@ -43,8 +40,8 @@ in
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
|
|
||||||
nixos.tags = mkOption {
|
nixos.tags = lib.mkOption {
|
||||||
type = types.listOf types.str;
|
type = lib.types.listOf lib.types.str;
|
||||||
default = [];
|
default = [];
|
||||||
example = [ "with-xen" ];
|
example = [ "with-xen" ];
|
||||||
description = ''
|
description = ''
|
||||||
|
@ -68,9 +65,9 @@ in
|
||||||
config = {
|
config = {
|
||||||
# This is set here rather than up there so that changing it would
|
# This is set here rather than up there so that changing it would
|
||||||
# not rebuild the manual
|
# not rebuild the manual
|
||||||
system.nixos.label = mkDefault (maybeEnv "NIXOS_LABEL"
|
system.nixos.label = lib.mkDefault (lib.maybeEnv "NIXOS_LABEL"
|
||||||
(concatStringsSep "-" ((sort (x: y: x < y) cfg.tags)
|
(lib.concatStringsSep "-" ((lib.sort (x: y: x < y) cfg.tags)
|
||||||
++ [ (maybeEnv "NIXOS_LABEL_VERSION" cfg.version) ])));
|
++ [ (lib.maybeEnv "NIXOS_LABEL_VERSION" cfg.version) ])));
|
||||||
};
|
};
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,28 +1,25 @@
|
||||||
{ lib, ... }:
|
{ lib, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
maintainer = mkOptionType {
|
maintainer = lib.mkOptionType {
|
||||||
name = "maintainer";
|
name = "maintainer";
|
||||||
check = email: elem email (attrValues lib.maintainers);
|
check = email: lib.elem email (lib.attrValues lib.maintainers);
|
||||||
merge = loc: defs: listToAttrs (singleton (nameValuePair (last defs).file (last defs).value));
|
merge = loc: defs: lib.listToAttrs (lib.singleton (lib.nameValuePair (lib.last defs).file (lib.last defs).value));
|
||||||
};
|
};
|
||||||
|
|
||||||
listOfMaintainers = types.listOf maintainer // {
|
listOfMaintainers = lib.types.listOf maintainer // {
|
||||||
# Returns list of
|
# Returns list of
|
||||||
# { "module-file" = [
|
# { "module-file" = [
|
||||||
# "maintainer1 <first@nixos.org>"
|
# "maintainer1 <first@nixos.org>"
|
||||||
# "maintainer2 <second@nixos.org>" ];
|
# "maintainer2 <second@nixos.org>" ];
|
||||||
# }
|
# }
|
||||||
merge = loc: defs:
|
merge = loc: defs:
|
||||||
zipAttrs
|
lib.zipAttrs
|
||||||
(flatten (imap1 (n: def: imap1 (m: def':
|
(lib.flatten (lib.imap1 (n: def: lib.imap1 (m: def':
|
||||||
maintainer.merge (loc ++ ["[${toString n}-${toString m}]"])
|
maintainer.merge (loc ++ ["[${toString n}-${toString m}]"])
|
||||||
[{ inherit (def) file; value = def'; }]) def.value) defs));
|
[{ inherit (def) file; value = def'; }]) def.value) defs));
|
||||||
};
|
};
|
||||||
|
|
||||||
docFile = types.path // {
|
docFile = lib.types.path // {
|
||||||
# Returns tuples of
|
# Returns tuples of
|
||||||
# { file = "module location"; value = <path/to/doc.xml>; }
|
# { file = "module location"; value = <path/to/doc.xml>; }
|
||||||
merge = loc: defs: defs;
|
merge = loc: defs: defs;
|
||||||
|
@ -33,18 +30,18 @@ in
|
||||||
options = {
|
options = {
|
||||||
meta = {
|
meta = {
|
||||||
|
|
||||||
maintainers = mkOption {
|
maintainers = lib.mkOption {
|
||||||
type = listOfMaintainers;
|
type = listOfMaintainers;
|
||||||
internal = true;
|
internal = true;
|
||||||
default = [];
|
default = [];
|
||||||
example = literalExpression ''[ lib.maintainers.all ]'';
|
example = lib.literalExpression ''[ lib.maintainers.all ]'';
|
||||||
description = ''
|
description = ''
|
||||||
List of maintainers of each module. This option should be defined at
|
List of maintainers of each module. This option should be defined at
|
||||||
most once per module.
|
most once per module.
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
|
|
||||||
doc = mkOption {
|
doc = lib.mkOption {
|
||||||
type = docFile;
|
type = docFile;
|
||||||
internal = true;
|
internal = true;
|
||||||
example = "./meta.chapter.md";
|
example = "./meta.chapter.md";
|
||||||
|
@ -54,8 +51,8 @@ in
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
|
|
||||||
buildDocsInSandbox = mkOption {
|
buildDocsInSandbox = lib.mkOption {
|
||||||
type = types.bool // {
|
type = lib.types.bool // {
|
||||||
merge = loc: defs: defs;
|
merge = loc: defs: defs;
|
||||||
};
|
};
|
||||||
internal = true;
|
internal = true;
|
||||||
|
@ -72,5 +69,5 @@ in
|
||||||
};
|
};
|
||||||
};
|
};
|
||||||
|
|
||||||
meta.maintainers = singleton lib.maintainers.pierron;
|
meta.maintainers = lib.singleton lib.maintainers.pierron;
|
||||||
}
|
}
|
||||||
|
|
|
@ -36,14 +36,13 @@ let
|
||||||
DOCUMENTATION_URL = optionalString isNixos "https://nixos.org/learn.html";
|
DOCUMENTATION_URL = optionalString isNixos "https://nixos.org/learn.html";
|
||||||
SUPPORT_URL = optionalString isNixos "https://nixos.org/community.html";
|
SUPPORT_URL = optionalString isNixos "https://nixos.org/community.html";
|
||||||
BUG_REPORT_URL = optionalString isNixos "https://github.com/NixOS/nixpkgs/issues";
|
BUG_REPORT_URL = optionalString isNixos "https://github.com/NixOS/nixpkgs/issues";
|
||||||
ANSI_COLOR = optionalString isNixos "1;34";
|
ANSI_COLOR = optionalString isNixos "0;38;2;126;186;228";
|
||||||
IMAGE_ID = optionalString (config.system.image.id != null) config.system.image.id;
|
IMAGE_ID = optionalString (config.system.image.id != null) config.system.image.id;
|
||||||
IMAGE_VERSION = optionalString (config.system.image.version != null) config.system.image.version;
|
IMAGE_VERSION = optionalString (config.system.image.version != null) config.system.image.version;
|
||||||
VARIANT = optionalString (cfg.variantName != null) cfg.variantName;
|
VARIANT = optionalString (cfg.variantName != null) cfg.variantName;
|
||||||
VARIANT_ID = optionalString (cfg.variant_id != null) cfg.variant_id;
|
VARIANT_ID = optionalString (cfg.variant_id != null) cfg.variant_id;
|
||||||
DEFAULT_HOSTNAME = config.networking.fqdnOrHostName;
|
DEFAULT_HOSTNAME = config.system.nixos.distroId;
|
||||||
SUPPORT_END = "2025-06-30";
|
} // cfg.extraOSReleaseArgs;
|
||||||
};
|
|
||||||
|
|
||||||
initrdReleaseContents = (removeAttrs osReleaseContents [ "BUILD_ID" ]) // {
|
initrdReleaseContents = (removeAttrs osReleaseContents [ "BUILD_ID" ]) // {
|
||||||
PRETTY_NAME = "${osReleaseContents.PRETTY_NAME} (Initrd)";
|
PRETTY_NAME = "${osReleaseContents.PRETTY_NAME} (Initrd)";
|
||||||
|
@ -143,6 +142,26 @@ in
|
||||||
default = "NixOS";
|
default = "NixOS";
|
||||||
description = "The name of the operating system vendor";
|
description = "The name of the operating system vendor";
|
||||||
};
|
};
|
||||||
|
|
||||||
|
extraOSReleaseArgs = mkOption {
|
||||||
|
internal = true;
|
||||||
|
type = types.attrsOf types.str;
|
||||||
|
default = { };
|
||||||
|
description = "Additional attributes to be merged with the /etc/os-release generator.";
|
||||||
|
example = {
|
||||||
|
ANSI_COLOR = "1;31";
|
||||||
|
};
|
||||||
|
};
|
||||||
|
|
||||||
|
extraLSBReleaseArgs = mkOption {
|
||||||
|
internal = true;
|
||||||
|
type = types.attrsOf types.str;
|
||||||
|
default = { };
|
||||||
|
description = "Additional attributes to be merged with the /etc/lsb-release generator.";
|
||||||
|
example = {
|
||||||
|
LSB_VERSION = "1.0";
|
||||||
|
};
|
||||||
|
};
|
||||||
};
|
};
|
||||||
|
|
||||||
image = {
|
image = {
|
||||||
|
@ -237,13 +256,13 @@ in
|
||||||
# https://www.freedesktop.org/software/systemd/man/os-release.html for the
|
# https://www.freedesktop.org/software/systemd/man/os-release.html for the
|
||||||
# format.
|
# format.
|
||||||
environment.etc = {
|
environment.etc = {
|
||||||
"lsb-release".text = attrsToText {
|
"lsb-release".text = attrsToText ({
|
||||||
LSB_VERSION = "${cfg.release} (${cfg.codeName})";
|
LSB_VERSION = "${cfg.release} (${cfg.codeName})";
|
||||||
DISTRIB_ID = "${cfg.distroId}";
|
DISTRIB_ID = "${cfg.distroId}";
|
||||||
DISTRIB_RELEASE = cfg.release;
|
DISTRIB_RELEASE = cfg.release;
|
||||||
DISTRIB_CODENAME = toLower cfg.codeName;
|
DISTRIB_CODENAME = toLower cfg.codeName;
|
||||||
DISTRIB_DESCRIPTION = "${cfg.distroName} ${cfg.release} (${cfg.codeName})";
|
DISTRIB_DESCRIPTION = "${cfg.distroName} ${cfg.release} (${cfg.codeName})";
|
||||||
};
|
} // cfg.extraLSBReleaseArgs);
|
||||||
|
|
||||||
"os-release".text = attrsToText osReleaseContents;
|
"os-release".text = attrsToText osReleaseContents;
|
||||||
};
|
};
|
||||||
|
|
|
@ -52,6 +52,7 @@
|
||||||
./hardware/bladeRF.nix
|
./hardware/bladeRF.nix
|
||||||
./hardware/brillo.nix
|
./hardware/brillo.nix
|
||||||
./hardware/ckb-next.nix
|
./hardware/ckb-next.nix
|
||||||
|
./hardware/coral.nix
|
||||||
./hardware/corectrl.nix
|
./hardware/corectrl.nix
|
||||||
./hardware/cpu/amd-microcode.nix
|
./hardware/cpu/amd-microcode.nix
|
||||||
./hardware/cpu/amd-sev.nix
|
./hardware/cpu/amd-sev.nix
|
||||||
|
@ -64,7 +65,6 @@
|
||||||
./hardware/digitalbitbox.nix
|
./hardware/digitalbitbox.nix
|
||||||
./hardware/flipperzero.nix
|
./hardware/flipperzero.nix
|
||||||
./hardware/flirc.nix
|
./hardware/flirc.nix
|
||||||
./hardware/gkraken.nix
|
|
||||||
./hardware/glasgow.nix
|
./hardware/glasgow.nix
|
||||||
./hardware/gpgsmartcards.nix
|
./hardware/gpgsmartcards.nix
|
||||||
./hardware/graphics.nix
|
./hardware/graphics.nix
|
||||||
|
@ -124,6 +124,7 @@
|
||||||
./i18n/input-method/kime.nix
|
./i18n/input-method/kime.nix
|
||||||
./i18n/input-method/nabi.nix
|
./i18n/input-method/nabi.nix
|
||||||
./i18n/input-method/uim.nix
|
./i18n/input-method/uim.nix
|
||||||
|
./image/images.nix
|
||||||
./installer/tools/tools.nix
|
./installer/tools/tools.nix
|
||||||
./misc/assertions.nix
|
./misc/assertions.nix
|
||||||
./misc/crashdump.nix
|
./misc/crashdump.nix
|
||||||
|
@ -264,6 +265,7 @@
|
||||||
./programs/openvpn3.nix
|
./programs/openvpn3.nix
|
||||||
./programs/obs-studio.nix
|
./programs/obs-studio.nix
|
||||||
./programs/partition-manager.nix
|
./programs/partition-manager.nix
|
||||||
|
./programs/pay-respects.nix
|
||||||
./programs/plotinus.nix
|
./programs/plotinus.nix
|
||||||
./programs/pqos-wrapper.nix
|
./programs/pqos-wrapper.nix
|
||||||
./programs/projecteur.nix
|
./programs/projecteur.nix
|
||||||
|
@ -810,6 +812,7 @@
|
||||||
./services/misc/octoprint.nix
|
./services/misc/octoprint.nix
|
||||||
./services/misc/ollama.nix
|
./services/misc/ollama.nix
|
||||||
./services/misc/ombi.nix
|
./services/misc/ombi.nix
|
||||||
|
./services/misc/omnom.nix
|
||||||
./services/misc/open-webui.nix
|
./services/misc/open-webui.nix
|
||||||
./services/misc/osrm.nix
|
./services/misc/osrm.nix
|
||||||
./services/misc/owncast.nix
|
./services/misc/owncast.nix
|
||||||
|
@ -879,6 +882,7 @@
|
||||||
./services/misc/zookeeper.nix
|
./services/misc/zookeeper.nix
|
||||||
./services/monitoring/alerta.nix
|
./services/monitoring/alerta.nix
|
||||||
./services/monitoring/alloy.nix
|
./services/monitoring/alloy.nix
|
||||||
|
./services/monitoring/amazon-cloudwatch-agent.nix
|
||||||
./services/monitoring/apcupsd.nix
|
./services/monitoring/apcupsd.nix
|
||||||
./services/monitoring/arbtt.nix
|
./services/monitoring/arbtt.nix
|
||||||
./services/monitoring/below.nix
|
./services/monitoring/below.nix
|
||||||
|
@ -892,6 +896,7 @@
|
||||||
./services/monitoring/do-agent.nix
|
./services/monitoring/do-agent.nix
|
||||||
./services/monitoring/fusion-inventory.nix
|
./services/monitoring/fusion-inventory.nix
|
||||||
./services/monitoring/gatus.nix
|
./services/monitoring/gatus.nix
|
||||||
|
./services/monitoring/gitwatch.nix
|
||||||
./services/monitoring/glances.nix
|
./services/monitoring/glances.nix
|
||||||
./services/monitoring/goss.nix
|
./services/monitoring/goss.nix
|
||||||
./services/monitoring/grafana-agent.nix
|
./services/monitoring/grafana-agent.nix
|
||||||
|
@ -942,6 +947,7 @@
|
||||||
./services/monitoring/telegraf.nix
|
./services/monitoring/telegraf.nix
|
||||||
./services/monitoring/thanos.nix
|
./services/monitoring/thanos.nix
|
||||||
./services/monitoring/todesk.nix
|
./services/monitoring/todesk.nix
|
||||||
|
./services/monitoring/traccar.nix
|
||||||
./services/monitoring/tremor-rs.nix
|
./services/monitoring/tremor-rs.nix
|
||||||
./services/monitoring/tuptime.nix
|
./services/monitoring/tuptime.nix
|
||||||
./services/monitoring/unpoller.nix
|
./services/monitoring/unpoller.nix
|
||||||
|
@ -1237,6 +1243,7 @@
|
||||||
./services/networking/sunshine.nix
|
./services/networking/sunshine.nix
|
||||||
./services/networking/supplicant.nix
|
./services/networking/supplicant.nix
|
||||||
./services/networking/supybot.nix
|
./services/networking/supybot.nix
|
||||||
|
./services/networking/suricata/default.nix
|
||||||
./services/networking/syncplay.nix
|
./services/networking/syncplay.nix
|
||||||
./services/networking/syncthing-relay.nix
|
./services/networking/syncthing-relay.nix
|
||||||
./services/networking/syncthing.nix
|
./services/networking/syncthing.nix
|
||||||
|
@ -1299,6 +1306,7 @@
|
||||||
./services/scheduling/atd.nix
|
./services/scheduling/atd.nix
|
||||||
./services/scheduling/cron.nix
|
./services/scheduling/cron.nix
|
||||||
./services/scheduling/fcron.nix
|
./services/scheduling/fcron.nix
|
||||||
|
./services/scheduling/scx.nix
|
||||||
./services/search/elasticsearch-curator.nix
|
./services/search/elasticsearch-curator.nix
|
||||||
./services/search/elasticsearch.nix
|
./services/search/elasticsearch.nix
|
||||||
./services/search/hound.nix
|
./services/search/hound.nix
|
||||||
|
@ -1313,6 +1321,7 @@
|
||||||
./services/security/aesmd.nix
|
./services/security/aesmd.nix
|
||||||
./services/security/authelia.nix
|
./services/security/authelia.nix
|
||||||
./services/security/bitwarden-directory-connector-cli.nix
|
./services/security/bitwarden-directory-connector-cli.nix
|
||||||
|
./services/security/canaille.nix
|
||||||
./services/security/certmgr.nix
|
./services/security/certmgr.nix
|
||||||
./services/security/cfssl.nix
|
./services/security/cfssl.nix
|
||||||
./services/security/clamav.nix
|
./services/security/clamav.nix
|
||||||
|
@ -1491,6 +1500,7 @@
|
||||||
./services/web-apps/onlyoffice.nix
|
./services/web-apps/onlyoffice.nix
|
||||||
./services/web-apps/openvscode-server.nix
|
./services/web-apps/openvscode-server.nix
|
||||||
./services/web-apps/mediagoblin.nix
|
./services/web-apps/mediagoblin.nix
|
||||||
|
./services/web-apps/open-web-calendar.nix
|
||||||
./services/web-apps/mobilizon.nix
|
./services/web-apps/mobilizon.nix
|
||||||
./services/web-apps/openwebrx.nix
|
./services/web-apps/openwebrx.nix
|
||||||
./services/web-apps/outline.nix
|
./services/web-apps/outline.nix
|
||||||
|
@ -1503,6 +1513,7 @@
|
||||||
./services/web-apps/pingvin-share.nix
|
./services/web-apps/pingvin-share.nix
|
||||||
./services/web-apps/plantuml-server.nix
|
./services/web-apps/plantuml-server.nix
|
||||||
./services/web-apps/plausible.nix
|
./services/web-apps/plausible.nix
|
||||||
|
./services/web-apps/porn-vault/default.nix
|
||||||
./services/web-apps/powerdns-admin.nix
|
./services/web-apps/powerdns-admin.nix
|
||||||
./services/web-apps/pretalx.nix
|
./services/web-apps/pretalx.nix
|
||||||
./services/web-apps/pretix.nix
|
./services/web-apps/pretix.nix
|
||||||
|
@ -1614,6 +1625,7 @@
|
||||||
./services/x11/xserver.nix
|
./services/x11/xserver.nix
|
||||||
./system/activation/activatable-system.nix
|
./system/activation/activatable-system.nix
|
||||||
./system/activation/activation-script.nix
|
./system/activation/activation-script.nix
|
||||||
|
./system/activation/pre-switch-check.nix
|
||||||
./system/activation/specialisation.nix
|
./system/activation/specialisation.nix
|
||||||
./system/activation/switchable-system.nix
|
./system/activation/switchable-system.nix
|
||||||
./system/activation/bootspec.nix
|
./system/activation/bootspec.nix
|
||||||
|
|
|
@ -74,8 +74,8 @@ with lib;
|
||||||
# installation device for head-less systems i.e. arm boards by manually
|
# installation device for head-less systems i.e. arm boards by manually
|
||||||
# mounting the storage in a different system.
|
# mounting the storage in a different system.
|
||||||
services.openssh = {
|
services.openssh = {
|
||||||
enable = true;
|
enable = mkDefault true;
|
||||||
settings.PermitRootLogin = "yes";
|
settings.PermitRootLogin = mkDefault "yes";
|
||||||
};
|
};
|
||||||
|
|
||||||
# Enable wpa_supplicant, but don't start it by default.
|
# Enable wpa_supplicant, but don't start it by default.
|
||||||
|
|
|
@ -1,7 +1,4 @@
|
||||||
{ config, lib, pkgs, ... }:
|
{ config, lib, pkgs, ... }:
|
||||||
|
|
||||||
with lib;
|
|
||||||
|
|
||||||
let
|
let
|
||||||
cfg = config.programs.fcast-receiver;
|
cfg = config.programs.fcast-receiver;
|
||||||
in
|
in
|
||||||
|
@ -11,20 +8,20 @@ in
|
||||||
};
|
};
|
||||||
|
|
||||||
options.programs.fcast-receiver = {
|
options.programs.fcast-receiver = {
|
||||||
enable = mkEnableOption "FCast Receiver";
|
enable = lib.mkEnableOption "FCast Receiver";
|
||||||
openFirewall = mkOption {
|
openFirewall = lib.mkOption {
|
||||||
type = types.bool;
|
type = lib.types.bool;
|
||||||
default = false;
|
default = false;
|
||||||
description = ''
|
description = ''
|
||||||
Open ports needed for the functionality of the program.
|
Open ports needed for the functionality of the program.
|
||||||
'';
|
'';
|
||||||
};
|
};
|
||||||
package = mkPackageOption pkgs "fcast-receiver" { };
|
package = lib.mkPackageOption pkgs "fcast-receiver" { };
|
||||||
};
|
};
|
||||||
|
|
||||||
config = mkIf cfg.enable {
|
config = lib.mkIf cfg.enable {
|
||||||
environment.systemPackages = [ cfg.package ];
|
environment.systemPackages = [ cfg.package ];
|
||||||
networking.firewall = mkIf cfg.openFirewall {
|
networking.firewall = lib.mkIf cfg.openFirewall {
|
||||||
allowedTCPPorts = [ 46899 ];
|
allowedTCPPorts = [ 46899 ];
|
||||||
};
|
};
|
||||||
};
|
};
|
||||||
|
|
|
@ -313,5 +313,5 @@ in
|
||||||
'';
|
'';
|
||||||
|
|
||||||
};
|
};
|
||||||
|
meta.maintainers = with lib.maintainers; [ sigmasquadron ];
|
||||||
}
|
}
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Reference in a new issue